Oxycodone
(MUZQPDBAOYKNLO-RKXJKUSZSA-N)
Structure
- SMILES
- COc1ccc2c3c1O[C@@H]1[C@@]43CCN([C@H](C2)[C@]4(O)CCC1=O)C.Cl
- Molecular Formula:
- C18H22ClNO4
- Molecular Weight:
- 351.825
- Log P:
- 1.7881
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 2
- TPSA:
- 59
- CAS Number(s):
- 124-90-3
Synonym(s)
1.
Oxycodone
2.
Dihydrohydroxycodeinone
3.
Oxiconum
4.
Oxycodeinon
5.
Dihydrone
6.
Dinarkon
7.
Eucodal
8.
Oxycodone Hydrochloride
9.
Oxycone
10.
Oxycontin
11.
Pancodine
12.
Theocodin
External Link(s)
| MeSH | D010098 |
| PubChem Compound | 5462350 25137874 |
| ChEBI | 7859 |
| CHEMBL | CHEMBL1200890 |
| KEGG | cpd:C08026 dr:D00847 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Toxicity to various agents | FAERS: 1119 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Drug ineffective | FAERS: 308 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 3 | Completed Suicide | FAERS: 138 | US FAERS | |
| 4 | Overdose | FAERS: 121 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 5 | Nausea | FAERS: 120 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 6 | Drug abuse | FAERS: 109 Canada Vigilance: 36 | Canada Vigilance US FAERS | |
| 7 | Pain | FAERS: 100 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 8 | Vomiting | FAERS: 99 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 9 | Respiratory arrest | FAERS: 97 | US FAERS | |
| 10 | Cardiac Arrest | FAERS: 83 | US FAERS | |
| 11 | Somnolence | FAERS: 80 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Accidental overdose | FAERS: 78 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 13 | Drug Dependence | FAERS: 76 Canada Vigilance: 44 | Canada Vigilance US FAERS | |
| 14 | Drug abuser | FAERS: 73 | US FAERS | |
| 15 | Malaise | FAERS: 63 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 16 | Constipation | FAERS: 60 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 17 | Headache | FAERS: 60 | US FAERS | |
| 18 | Drug withdrawal syndrome | FAERS: 55 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 19 | Inadequate analgesia | FAERS: 54 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 20 | Dizziness | FAERS: 53 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 21 | Multiple drug overdose | FAERS: 51 | US FAERS | |
| 22 | Delirium | FAERS: 45 | US FAERS | |
| 23 | Drug diversion | FAERS: 42 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 24 | Feeling abnormal | FAERS: 42 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 25 | Pharmaceutical product complaint | FAERS: 42 | US FAERS | |
| 26 | Unresponsive to stimuli | FAERS: 39 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 27 | Pruritus | FAERS: 33 | US FAERS | |
| 28 | Product quality issue | FAERS: 32 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 29 | Product substitution issue | FAERS: 30 | US FAERS | |
| 30 | Medication Error | FAERS: 28 | US FAERS | |
| 31 | Fatigue | FAERS: 26 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 32 | Drug dispensing error | FAERS: 25 | US FAERS | |
| 33 | Pneumonia | FAERS: 25 | US FAERS | |
| 34 | Respiratory Failure | FAERS: 25 | US FAERS | |
| 35 | Lethargy | FAERS: 24 | US FAERS | |
| 36 | Tremor | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 37 | Unevaluable event | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 38 | Abdominal discomfort | FAERS: 22 | US FAERS | |
| 39 | Therapeutic response unexpected with drug substitution | FAERS: 22 | US FAERS | |
| 40 | Urticaria | FAERS: 22 | US FAERS | |
| 41 | Accidental drug intake by child | FAERS: 19 | US FAERS | |
| 42 | Euphoric mood | FAERS: 19 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 43 | Intentional drug misuse | FAERS: 19 | US FAERS | |
| 44 | Poisoning | FAERS: 19 | US FAERS | |
| 45 | Anxiety | FAERS: 18 | US FAERS | |
| 46 | Depressed Level of Consciousness | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 47 | nervous system disorder | FAERS: 18 | US FAERS | |
| 48 | Abdominal Pain | FAERS: 17 | US FAERS | |
| 49 | Drug toxicity | FAERS: 17 | US FAERS | |
| 50 | Weight decreased | FAERS: 17 | US FAERS | |
| 51 | Back Pain | FAERS: 16 | US FAERS | |
| 52 | Intentional product use issue | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 53 | Malignant neoplasm progression | FAERS: 16 | US FAERS | |
| 54 | Respiratory Depression | FAERS: 16 | US FAERS | |
| 55 | Suicide attempt | FAERS: 16 | US FAERS | |
| 56 | Mental status changes | FAERS: 15 | US FAERS | |
| 57 | Autonomic nervous system imbalance | FAERS: 14 | US FAERS | |
| 58 | Chest Pain | FAERS: 14 | US FAERS | |
| 59 | Hypotension | FAERS: 14 | US FAERS | |
| 60 | Myocardial Infarction | FAERS: 14 | US FAERS | |
| 61 | Cerebrovascular accident | FAERS: 13 | US FAERS | |
| 62 | General physical health deterioration | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 63 | Product formulation issue | FAERS: 13 | US FAERS | |
| 64 | Agitation | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 65 | Amnesia | FAERS: 12 | US FAERS | |
| 66 | Asthenia | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 67 | Drug screen negative | FAERS: 12 | US FAERS | |
| 68 | Memory impairment | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 69 | Accidental exposure | FAERS: 11 | US FAERS | |
| 70 | Incorrect dose administered | FAERS: 11 | US FAERS | |
| 71 | Incorrect route of drug administration | FAERS: 11 | US FAERS | |
| 72 | Product taste abnormal | FAERS: 11 | US FAERS | |
| 73 | Disorientation | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 74 | Tachycardia | FAERS: 10 | US FAERS | |
| 75 | Wrong technique in product usage process | FAERS: 10 | US FAERS | |
| 76 | Bedridden | FAERS: 9 | US FAERS | |
| 77 | Brain Death | FAERS: 9 | US FAERS | |
| 78 | Bronchitis | FAERS: 9 | US FAERS | |
| 79 | Drug level increased | FAERS: 9 | US FAERS | |
| 80 | Dysgeusia | FAERS: 9 | US FAERS | |
| 81 | Dyspepsia | FAERS: 9 | US FAERS | |
| 82 | Hypersensitivity | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 83 | Pulmonary Embolism | FAERS: 9 | US FAERS | |
| 84 | Pulmonary Hypertension | FAERS: 9 | US FAERS | |
| 85 | Pulmonary granuloma | FAERS: 9 | US FAERS | |
| 86 | Wrong technique in drug usage process | FAERS: 9 | US FAERS | |
| 87 | Dysarthria | FAERS: 8 | US FAERS | |
| 88 | Hypoxia | FAERS: 8 | US FAERS | |
| 89 | Intentional product misuse | FAERS: 8 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 90 | Sepsis | FAERS: 8 | US FAERS | |
| 91 | Ventricular Fibrillation | FAERS: 8 | US FAERS | |
| 92 | Bronchopneumonia | FAERS: 7 | US FAERS | |
| 93 | Cardiomegaly | FAERS: 7 | US FAERS | |
| 94 | Dehydration | FAERS: 7 | US FAERS | |
| 95 | Drug administered to patient of inappropriate age | FAERS: 7 | US FAERS | |
| 96 | Drug prescribing error | FAERS: 7 | US FAERS | |
| 97 | Drug screen positive | FAERS: 7 | US FAERS | |
| 98 | Excoriation | FAERS: 7 | US FAERS | |
| 99 | Product physical issue | FAERS: 7 | US FAERS | |
| 100 | Right ventricular failure | FAERS: 7 | US FAERS | |
| 101 | Accidental death | FAERS: 6 | US FAERS | |
| 102 | Altered state of consciousness | FAERS: 6 | US FAERS | |
| 103 | Arthralgia | FAERS: 6 | US FAERS | |
| 104 | Arthritis | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 105 | Blood glucose increased | FAERS: 6 | US FAERS | |
| 106 | Chills | FAERS: 6 | US FAERS | |
| 107 | Cold sweat | FAERS: 6 | US FAERS | |
| 108 | Endocarditis | FAERS: 6 | US FAERS | |
| 109 | Feeling jittery | FAERS: 6 | US FAERS | |
| 110 | Formication | FAERS: 6 | US FAERS | |
| 111 | Inappropriate schedule of drug administration | FAERS: 6 | US FAERS | |
| 112 | Leukoencephalopathy | FAERS: 6 | US FAERS | |
| 113 | Loss of personal independence in daily activities | FAERS: 6 | US FAERS | |
| 114 | Multiple drug overdose accidental | FAERS: 6 | US FAERS | |
| 115 | Myalgia | FAERS: 6 | US FAERS | |
| 116 | Nephrolithiasis | FAERS: 6 | US FAERS | |
| 117 | Respiratory distress | FAERS: 6 | US FAERS | |
| 118 | Spinal fusion surgery | FAERS: 6 | US FAERS | |
| 119 | Syncope | FAERS: 6 | US FAERS | |
| 120 | Toxic leukoencephalopathy | FAERS: 6 | US FAERS | |
| 121 | Chest discomfort | FAERS: 5 | US FAERS | |
| 122 | Chromaturia | FAERS: 5 | US FAERS | |
| 123 | Dependence | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 124 | Diabetes Mellitus | FAERS: 5 | US FAERS | |
| 125 | Fibromyalgia | FAERS: 5 | US FAERS | |
| 126 | Flatulence | FAERS: 5 | US FAERS | |
| 127 | Hepatitis C | FAERS: 5 | US FAERS | |
| 128 | Hip surgery | FAERS: 5 | US FAERS | |
| 129 | Hydrocephalus | FAERS: 5 | US FAERS | |
| 130 | Hypersomnia | FAERS: 5 | US FAERS | |
| 131 | Intentional misuse | FAERS: 5 | US FAERS | |
| 132 | Limb injury | FAERS: 5 | US FAERS | |
| 133 | No adverse event | FAERS: 5 | US FAERS | |
| 134 | Pallor | FAERS: 5 | US FAERS | |
| 135 | Palpitations | FAERS: 5 | US FAERS | |
| 136 | Sciatica | FAERS: 5 | US FAERS | |
| 137 | Urinary tract infection | FAERS: 5 | US FAERS | |
| 138 | Victim of homicide | FAERS: 5 | US FAERS | |
| 139 | Visual Impairment | FAERS: 5 | US FAERS | |
| 140 | Activities of daily living impaired | FAERS: 4 | US FAERS | |
| 141 | Acute Lung Injury | FAERS: 4 | US FAERS | |
| 142 | Alanine Aminotransferase Increased | FAERS: 4 | US FAERS | |
| 143 | Anger | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 144 | Arthropathy | FAERS: 4 | US FAERS | |
| 145 | Aspartate Aminotransferase Increased | FAERS: 4 | US FAERS | |
| 146 | Asthma | FAERS: 4 | US FAERS | |
| 147 | Biliary dilatation | FAERS: 4 | US FAERS | |
| 148 | Blood creatine phosphokinase increased | FAERS: 4 | US FAERS | |
| 149 | Blood pH decreased | FAERS: 4 | US FAERS | |
| 150 | Cardiac Death | FAERS: 4 | US FAERS | |
| 151 | Cyanosis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 152 | Drug Tolerance | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 153 | Erythema | FAERS: 4 | US FAERS | |
| 154 | Homicide | FAERS: 4 | US FAERS | |
| 155 | Influenza | FAERS: 4 | US FAERS | |
| 156 | Intervertebral Disc Degeneration | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 157 | Joint swelling | FAERS: 4 | US FAERS | |
| 158 | Lyme Disease | FAERS: 4 | US FAERS | |
| 159 | Mental impairment | FAERS: 4 | US FAERS | |
| 160 | Multiple drug overdose intentional | FAERS: 4 | US FAERS | |
| 161 | Nasopharyngitis | FAERS: 4 | US FAERS | |
| 162 | Nervousness | FAERS: 4 | US FAERS | |
| 163 | Oropharyngeal pain | FAERS: 4 | US FAERS | |
| 164 | Paroxysmal sympathetic hyperactivity | FAERS: 4 | US FAERS | |
| 165 | Polysubstance abuse | FAERS: 4 | US FAERS | |
| 166 | Product counterfeit | FAERS: 4 | US FAERS | |
| 167 | Product dispensing error | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 168 | Quadriplegia | FAERS: 4 | US FAERS | |
| 169 | Restlessness | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 170 | Sudden Cardiac Death | FAERS: 4 | US FAERS | |
| 171 | Swelling | FAERS: 4 | US FAERS | |
| 172 | Therapeutic response unexpected | FAERS: 4 | US FAERS | |
| 173 | Toothache | FAERS: 4 | US FAERS | |
| 174 | Transaminases increased | FAERS: 4 | US FAERS | |
| 175 | Urinary Retention | FAERS: 4 | US FAERS | |
| 176 | Vertigo | FAERS: 4 | US FAERS | |
| 177 | Wrong drug administered | FAERS: 4 | US FAERS | |
| 178 | Abasia | FAERS: 3 | US FAERS | |
| 179 | Akathisia | FAERS: 3 | US FAERS | |
| 180 | Arthropod bite | FAERS: 3 | US FAERS | |
| 181 | Atrial Fibrillation | FAERS: 3 | US FAERS | |
| 182 | Blood alkaline phosphatase increased | FAERS: 3 | US FAERS | |
| 183 | Blood chloride increased | FAERS: 3 | US FAERS | |
| 184 | Blood glucose decreased | FAERS: 3 | US FAERS | |
| 185 | Blood immunoglobulin E increased | FAERS: 3 | US FAERS | |
| 186 | Blood potassium increased | FAERS: 3 | US FAERS | |
| 187 | Blood testosterone decreased | FAERS: 3 | US FAERS | |
| 188 | Blood urea increased | FAERS: 3 | US FAERS | |
| 189 | Bone pain | FAERS: 3 | US FAERS | |
| 190 | Breakthrough Pain | FAERS: 3 | US FAERS | |
| 191 | Cataract | FAERS: 3 | US FAERS | |
| 192 | Catatonia | FAERS: 3 | US FAERS | |
| 193 | Cellulitis | FAERS: 3 | US FAERS | |
| 194 | Dental caries | FAERS: 3 | US FAERS | |
| 195 | Depressed mood | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 196 | Disability | FAERS: 3 | US FAERS | |
| 197 | Drug administration error | FAERS: 3 | US FAERS | |
| 198 | Drug effect incomplete | FAERS: 3 | US FAERS | |
| 199 | Drug exposure during pregnancy | FAERS: 3 | US FAERS | |
| 200 | Drug exposure via breast milk | FAERS: 3 | US FAERS | |
| 201 | Ejection Fraction Decreased | FAERS: 3 | US FAERS | |
| 202 | Emotional disorder | FAERS: 3 | US FAERS | |
| 203 | Emotional distress | FAERS: 3 | US FAERS | |
| 204 | Extra dose administered | FAERS: 3 | US FAERS | |
| 205 | Eye pain | FAERS: 3 | US FAERS | |
| 206 | Feeling Cold | FAERS: 3 | US FAERS | |
| 207 | Gastrointestinal Pain | FAERS: 3 | US FAERS | |
| 208 | Gastrointestinal motility disorder | FAERS: 3 | US FAERS | |
| 209 | Glaucoma | FAERS: 3 | US FAERS | |
| 210 | Hepatitis | FAERS: 3 | US FAERS | |
| 211 | Hypercapnia | FAERS: 3 | US FAERS | |
| 212 | Hypophagia | FAERS: 3 | US FAERS | |
| 213 | Ileus | FAERS: 3 | US FAERS | |
| 214 | Impaired gastric emptying | FAERS: 3 | US FAERS | |
| 215 | Incorrect route of product administration | FAERS: 3 | US FAERS | |
| 216 | Inflammation | FAERS: 3 | US FAERS | |
| 217 | Injury asphyxiation | FAERS: 3 | US FAERS | |
| 218 | Medication residue | FAERS: 3 | US FAERS | |
| 219 | Photophobia | FAERS: 3 | US FAERS | |
| 220 | Pneumonitis | FAERS: 3 | US FAERS | |
| 221 | Product administration error | FAERS: 3 | US FAERS | |
| 222 | Product commingling | FAERS: 3 | US FAERS | |
| 223 | Product label confusion | FAERS: 3 | US FAERS | |
| 224 | Product size issue | FAERS: 3 | US FAERS | |
| 225 | Rhabdomyolysis | FAERS: 3 | US FAERS | |
| 226 | Rheumatoid Arthritis | FAERS: 3 | US FAERS | |
| 227 | Sinus Tachycardia | FAERS: 3 | US FAERS | |
| 228 | Sinusitis | FAERS: 3 | US FAERS | |
| 229 | Sluggishness | FAERS: 3 | US FAERS | |
| 230 | Sudden death | FAERS: 3 | US FAERS | |
| 231 | Throat irritation | FAERS: 3 | US FAERS | |
| 232 | Thrombosis | FAERS: 3 | US FAERS | |
| 233 | Tinnitus | FAERS: 3 | US FAERS | |
| 234 | Tongue discomfort | FAERS: 3 | US FAERS | |
| 235 | Ventricular arrhythmia | FAERS: 3 | US FAERS | |
| 236 | Visual disturbance | FAERS: 3 | US FAERS | |
| 237 | Acidosis | FAERS: 2 | US FAERS | |
| 238 | Acne | FAERS: 2 | US FAERS | |
| 239 | Acute respiratory failure | FAERS: 2 | US FAERS | |
| 240 | Ankle Fracture | FAERS: 2 | US FAERS | |
| 241 | Anorexia | FAERS: 2 | US FAERS | |
| 242 | Anoxic Encephalopathy | FAERS: 2 | US FAERS | |
| 243 | Antibody test positive | FAERS: 2 | US FAERS | |
| 244 | Apparent death | FAERS: 2 | US FAERS | |
| 245 | Asphyxia | FAERS: 2 | US FAERS | |
| 246 | Atrial Flutter | FAERS: 2 | US FAERS | |
| 247 | Autonomic neuropathy | FAERS: 2 | US FAERS | |
| 248 | Benign Prostatic Hyperplasia | FAERS: 2 | US FAERS | |
| 249 | Blood alcohol increased | FAERS: 2 | US FAERS | |
| 250 | Blood creatinine increased | FAERS: 2 | US FAERS | |
| 251 | Blood sodium decreased | FAERS: 2 | US FAERS | |
| 252 | Blood urine present | FAERS: 2 | US FAERS | |
| 253 | Brain Hypoxia | FAERS: 2 | US FAERS | |
| 254 | Carcinoma | FAERS: 2 | US FAERS | |
| 255 | Central nervous system lesion | FAERS: 2 | US FAERS | |
| 256 | Cerebral ventricle dilatation | FAERS: 2 | US FAERS | |
| 257 | Cholecystitis infective | FAERS: 2 | US FAERS | |
| 258 | Clostridium difficile infection | FAERS: 2 | US FAERS | |
| 259 | Coronary Artery Disease | FAERS: 2 | US FAERS | |
| 260 | Cycloplegia | FAERS: 2 | US FAERS | |
| 261 | Cystitis | FAERS: 2 | US FAERS | |
| 262 | Cystocele | FAERS: 2 | US FAERS | |
| 263 | Dementia | FAERS: 2 | US FAERS | |
| 264 | Dermatitis | FAERS: 2 | US FAERS | |
| 265 | Diffuse alveolar damage | FAERS: 2 | US FAERS | |
| 266 | Diplopia | FAERS: 2 | US FAERS | |
| 267 | Discomfort | FAERS: 2 | US FAERS | |
| 268 | Drug effect delayed | FAERS: 2 | US FAERS | |
| 269 | Drug effect variable | FAERS: 2 | US FAERS | |
| 270 | Dry skin | FAERS: 2 | US FAERS | |
| 271 | Dysphonia | FAERS: 2 | US FAERS | |
| 272 | Dysuria | FAERS: 2 | US FAERS | |
| 273 | Economic problem | FAERS: 2 | US FAERS | |
| 274 | Encephalitis | FAERS: 2 | US FAERS | |
| 275 | Epilepsy | FAERS: 2 | US FAERS | |
| 276 | Exposure during breast feeding | FAERS: 2 | US FAERS | |
| 277 | Flank Pain | FAERS: 2 | US FAERS | |
| 278 | Growth retardation | FAERS: 2 | US FAERS | |
| 279 | Hemiplegia | FAERS: 2 | US FAERS | |
| 280 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 281 | Incoherent | FAERS: 2 | US FAERS | |
| 282 | Infection | FAERS: 2 | US FAERS | |
| 283 | Intentional self-injury | FAERS: 2 | US FAERS | |
| 284 | Intestinal Obstruction | FAERS: 2 | US FAERS | |
| 285 | Joint injury | FAERS: 2 | US FAERS | |
| 286 | Large intestine perforation | FAERS: 2 | US FAERS | |
| 287 | Leukocytosis | FAERS: 2 | US FAERS | |
| 288 | Limb operation | FAERS: 2 | US FAERS | |
| 289 | Lobar Pneumonia | FAERS: 2 | US FAERS | |
| 290 | Lymphoma | FAERS: 2 | US FAERS | |
| 291 | Macular degeneration | FAERS: 2 | US FAERS | |
| 292 | Malabsorption | FAERS: 2 | US FAERS | |
| 293 | Maternal exposure during pregnancy | FAERS: 2 | US FAERS | |
| 294 | Metastatic Neoplasm | FAERS: 2 | US FAERS | |
| 295 | Mood swings | FAERS: 2 | US FAERS | |
| 296 | Muscle tightness | FAERS: 2 | US FAERS | |
| 297 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 298 | Mydriasis | FAERS: 2 | US FAERS | |
| 299 | Myoclonus | FAERS: 2 | US FAERS | |
| 300 | Neck Pain | FAERS: 2 | US FAERS | |
| 301 | Neonatal hypotension | FAERS: 2 | US FAERS | |
| 302 | Nerve Root Compression | FAERS: 2 | US FAERS | |
| 303 | Nerve injury | FAERS: 2 | US FAERS | |
| 304 | Neuropsychiatric syndrome | FAERS: 2 | US FAERS | |
| 305 | Night sweats | FAERS: 2 | US FAERS | |
| 306 | Paranoia | FAERS: 2 | US FAERS | |
| 307 | Paranoid Personality Disorder | FAERS: 2 | US FAERS | |
| 308 | Pelvic discomfort | FAERS: 2 | US FAERS | |
| 309 | Polysubstance dependence | FAERS: 2 | US FAERS | |
| 310 | Poor quality drug administered | FAERS: 2 | US FAERS | |
| 311 | Poor quality sleep | FAERS: 2 | US FAERS | |
| 312 | Post procedural complication | FAERS: 2 | US FAERS | |
| 313 | Prescription drug used without a prescription | FAERS: 2 | US FAERS | |
| 314 | Product availability issue | FAERS: 2 | US FAERS | |
| 315 | Product container seal issue | FAERS: 2 | US FAERS | |
| 316 | Product contamination | FAERS: 2 | US FAERS | |
| 317 | Product tampering | FAERS: 2 | US FAERS | |
| 318 | Product use in unapproved indication | FAERS: 2 | US FAERS | |
| 319 | Pulmonary Fibrosis | FAERS: 2 | US FAERS | |
| 320 | Pulmonary congestion | FAERS: 2 | US FAERS | |
| 321 | Quality of life decreased | FAERS: 2 | US FAERS | |
| 322 | Rectocele | FAERS: 2 | US FAERS | |
| 323 | Retching | FAERS: 2 | US FAERS | |
| 324 | Septic Shock | FAERS: 2 | US FAERS | |
| 325 | Sinus headache | FAERS: 2 | US FAERS | |
| 326 | Sopor | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 327 | Spinal column stenosis | FAERS: 2 | US FAERS | |
| 328 | Stupor | FAERS: 2 | US FAERS | |
| 329 | Suspected counterfeit product | FAERS: 2 | US FAERS | |
| 330 | Theft | FAERS: 2 | US FAERS | |
| 331 | Therapeutic product effect decreased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 332 | Thermal burn | FAERS: 2 | US FAERS | |
| 333 | Tooth Extraction | FAERS: 2 | US FAERS | |
| 334 | Unresponsive to verbal stimuli | FAERS: 2 | US FAERS | |
| 335 | Ventricular hypertrophy | FAERS: 2 | US FAERS | |
| 336 | Victim of child abuse | FAERS: 2 | US FAERS | |
| 337 | Victim of sexual abuse | FAERS: 2 | US FAERS | |
| 338 | Yawning | FAERS: 2 | US FAERS | |
| 339 | Abscess | FAERS: 1 | US FAERS | |
| 340 | Accidental exposure to product | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 341 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 342 | Adenocarcinoma | FAERS: 1 | US FAERS | |
| 343 | Ageusia | FAERS: 1 | US FAERS | |
| 344 | Agonal death struggle | FAERS: 1 | US FAERS | |
| 345 | Akinesia | FAERS: 1 | US FAERS | |
| 346 | Alcohol poisoning | FAERS: 1 | US FAERS | |
| 347 | Alopecia | FAERS: 1 | US FAERS | |
| 348 | Ammonia increased | FAERS: 1 | US FAERS | |
| 349 | Analgesic drug level above therapeutic | FAERS: 1 | US FAERS | |
| 350 | Analgesic drug level decreased | FAERS: 1 | US FAERS | |
| 351 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 352 | Animal bite | FAERS: 1 | US FAERS | |
| 353 | Anosmia | FAERS: 1 | US FAERS | |
| 354 | Anuria | FAERS: 1 | US FAERS | |
| 355 | Apathy | FAERS: 1 | US FAERS | |
| 356 | Aphagia | FAERS: 1 | US FAERS | |
| 357 | Aphasia | FAERS: 1 | US FAERS | |
| 358 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 359 | Arthrodesis | FAERS: 1 | US FAERS | |
| 360 | Artificial crown procedure | FAERS: 1 | US FAERS | |
| 361 | Asterixis | FAERS: 1 | US FAERS | |
| 362 | Atherosclerosis | FAERS: 1 | US FAERS | |
| 363 | Atypical pneumonia | FAERS: 1 | US FAERS | |
| 364 | Automatic bladder | FAERS: 1 | US FAERS | |
| 365 | Back disorder | FAERS: 1 | US FAERS | |
| 366 | Ballismus | FAERS: 1 | US FAERS | |
| 367 | Base excess decreased | FAERS: 1 | US FAERS | |
| 368 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 369 | Bladder spasm | FAERS: 1 | US FAERS | |
| 370 | Blindness | FAERS: 1 | US FAERS | |
| 371 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 372 | Blood amylase increased | FAERS: 1 | US FAERS | |
| 373 | Blood bicarbonate abnormal | FAERS: 1 | US FAERS | |
| 374 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 375 | Blood fibrinogen increased | FAERS: 1 | US FAERS | |
| 376 | Blood magnesium abnormal | FAERS: 1 | US FAERS | |
| 377 | Blood phosphorus increased | FAERS: 1 | US FAERS | |
| 378 | Blood potassium abnormal | FAERS: 1 | US FAERS | |
| 379 | Blood pressure immeasurable | FAERS: 1 | US FAERS | |
| 380 | Body temperature fluctuation | FAERS: 1 | US FAERS | |
| 381 | Bone scan abnormal | FAERS: 1 | US FAERS | |
| 382 | Bradycardia | FAERS: 1 | US FAERS | |
| 383 | Brain Contusion | FAERS: 1 | US FAERS | |
| 384 | Bronchospasm | FAERS: 1 | US FAERS | |
| 385 | Burning sensation | FAERS: 1 | US FAERS | |
| 386 | Cardiac ablation | FAERS: 1 | US FAERS | |
| 387 | Cardiac neoplasm unspecified | FAERS: 1 | US FAERS | |
| 388 | Cardiac valve rupture | FAERS: 1 | US FAERS | |
| 389 | Cardiovascular insufficiency | FAERS: 1 | US FAERS | |
| 390 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 391 | Cataract operation | FAERS: 1 | US FAERS | |
| 392 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 393 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 394 | Chemical injury | FAERS: 1 | US FAERS | |
| 395 | Chemotherapy | FAERS: 1 | US FAERS | |
| 396 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 397 | Colectomy | FAERS: 1 | US FAERS | |
| 398 | Colitis | FAERS: 1 | US FAERS | |
| 399 | Contraindicated drug administered | FAERS: 1 | US FAERS | |
| 400 | Cor pulmonale | FAERS: 1 | US FAERS | |
| 401 | Counterfeit drug administered | FAERS: 1 | US FAERS | |
| 402 | Counterfeit product administered | FAERS: 1 | US FAERS | |
| 403 | Crying | FAERS: 1 | US FAERS | |
| 404 | Culture positive | FAERS: 1 | US FAERS | |
| 405 | Cyst | FAERS: 1 | US FAERS | |
| 406 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 407 | Delusional disorder, unspecified type | FAERS: 1 | US FAERS | |
| 408 | Device fastener issue | FAERS: 1 | US FAERS | |
| 409 | Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 410 | Diabetic ulcer | FAERS: 1 | US FAERS | |
| 411 | Diffuse Axonal Injury | FAERS: 1 | US FAERS | |
| 412 | Diplegia | FAERS: 1 | US FAERS | |
| 413 | Disease Progression | FAERS: 1 | US FAERS | |
| 414 | Disease recurrence | FAERS: 1 | US FAERS | |
| 415 | Drowning | FAERS: 1 | US FAERS | |
| 416 | Drug dispensed to wrong patient | FAERS: 1 | US FAERS | |
| 417 | Drug dose titration not performed | FAERS: 1 | US FAERS | |
| 418 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 419 | Drug level decreased | FAERS: 1 | US FAERS | |
| 420 | Drug physiologic incompatibility | FAERS: 1 | US FAERS | |
| 421 | Drug withdrawal convulsions | FAERS: 1 | US FAERS | |
| 422 | Drug-disease interaction | FAERS: 1 | US FAERS | |
| 423 | Dysphemia | FAERS: 1 | US FAERS | |
| 424 | Electroencephalogram abnormal | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 425 | Endodontic procedure | FAERS: 1 | US FAERS | |
| 426 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 427 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 428 | Expired product administered | FAERS: 1 | US FAERS | |
| 429 | Eye irritation | FAERS: 1 | US FAERS | |
| 430 | Febrile Neutropenia | FAERS: 1 | US FAERS | |
| 431 | Feeding disorder of infancy OR early childhood | FAERS: 1 | US FAERS | |
| 432 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 433 | Flushing | FAERS: 1 | US FAERS | |
| 434 | Food aversion | FAERS: 1 | US FAERS | |
| 435 | Foreign body aspiration | FAERS: 1 | US FAERS | |
| 436 | Foreign body embolism | FAERS: 1 | US FAERS | |
| 437 | Fracture | FAERS: 1 | US FAERS | |
| 438 | Gait inability | FAERS: 1 | US FAERS | |
| 439 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 440 | Gastroschisis | FAERS: 1 | US FAERS | |
| 441 | General symptom | FAERS: 1 | US FAERS | |
| 442 | Gingival Recession | FAERS: 1 | US FAERS | |
| 443 | Gliosis | FAERS: 1 | US FAERS | |
| 444 | Glossectomy | FAERS: 1 | US FAERS | |
| 445 | Gram stain positive | FAERS: 1 | US FAERS | |
| 446 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 447 | Hepatic congestion | FAERS: 1 | US FAERS | |
| 448 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 449 | Hernia | FAERS: 1 | US FAERS | |
| 450 | Hyperacusis | FAERS: 1 | US FAERS | |
| 451 | Hypertrophic Cardiomyopathy | FAERS: 1 | US FAERS | |
| 452 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 453 | Hypokinesia | FAERS: 1 | US FAERS | |
| 454 | Hypoparathyroidism | FAERS: 1 | US FAERS | |
| 455 | Hyporesponsive to stimuli | FAERS: 1 | US FAERS | |
| 456 | Hypothalamic pituitary adrenal axis suppression | FAERS: 1 | US FAERS | |
| 457 | Hypothalamo-pituitary disorder | FAERS: 1 | US FAERS | |
| 458 | Hypoventilation | FAERS: 1 | US FAERS | |
| 459 | Hysterectomy | FAERS: 1 | US FAERS | |
| 460 | Impaired work ability | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 461 | Inappropriate Prescribing | FAERS: 1 | US FAERS | |
| 462 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 463 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 464 | Intercepted drug administration error | FAERS: 1 | US FAERS | |
| 465 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 466 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 467 | Intervertebral disc disorder | FAERS: 1 | US FAERS | |
| 468 | Intestinal resection | FAERS: 1 | US FAERS | |
| 469 | Joint dislocation postoperative | FAERS: 1 | US FAERS | |
| 470 | Joint stiffness | FAERS: 1 | US FAERS | |
| 471 | Laryngitis | FAERS: 1 | US FAERS | |
| 472 | Laryngospasm | FAERS: 1 | US FAERS | |
| 473 | Ligament injury | FAERS: 1 | US FAERS | |
| 474 | Lip and/or oral cavity cancer | FAERS: 1 | US FAERS | |
| 475 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 476 | Lumbar radiculopathy | FAERS: 1 | US FAERS | |
| 477 | Lung Injury | FAERS: 1 | US FAERS | |
| 478 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 479 | Macroglossia | FAERS: 1 | US FAERS | |
| 480 | Malignant ascites | FAERS: 1 | US FAERS | |
| 481 | Medical device implantation | FAERS: 1 | US FAERS | |
| 482 | Medical device removal | FAERS: 1 | US FAERS | |
| 483 | Meniscus injury | FAERS: 1 | US FAERS | |
| 484 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 485 | Metastasis | FAERS: 1 | US FAERS | |
| 486 | Middle insomnia | FAERS: 1 | US FAERS | |
| 487 | Mitral Valve Stenosis | FAERS: 1 | US FAERS | |
| 488 | Mucocutaneous flap necrosis | FAERS: 1 | US FAERS | |
| 489 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 490 | Muscle Spasticity | FAERS: 1 | US FAERS | |
| 491 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 492 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 493 | Myocardial fibrosis | FAERS: 1 | US FAERS | |
| 494 | Nail bed infection | FAERS: 1 | US FAERS | |
| 495 | Narcolepsy | FAERS: 1 | US FAERS | |
| 496 | Nasogastric output abnormal | FAERS: 1 | US FAERS | |
| 497 | Neonatal complications of substance abuse | FAERS: 1 | US FAERS | |
| 498 | Neuritis | FAERS: 1 | US FAERS | |
| 499 | Neurological examination abnormal | FAERS: 1 | US FAERS | |
| 500 | Nonspecific reaction | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 501 | Opiates positive | FAERS: 1 | US FAERS | |
| 502 | Oral pruritus | FAERS: 1 | US FAERS | |
| 503 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 504 | PO2 decreased | FAERS: 1 | US FAERS | |
| 505 | Pain of skin | FAERS: 1 | US FAERS | |
| 506 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 507 | Pancreatitis | FAERS: 1 | US FAERS | |
| 508 | Panic Disorder | FAERS: 1 | US FAERS | |
| 509 | Paraplegia | FAERS: 1 | US FAERS | |
| 510 | Paresis | FAERS: 1 | US FAERS | |
| 511 | Patient uncooperative | FAERS: 1 | US FAERS | |
| 512 | Peptic Ulcer | FAERS: 1 | US FAERS | |
| 513 | Peripheral arterial occlusive disease | FAERS: 1 | US FAERS | |
| 514 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 515 | Peritonitis | FAERS: 1 | US FAERS | |
| 516 | Personality Change | FAERS: 1 | US FAERS | |
| 517 | Petechiae | FAERS: 1 | US FAERS | |
| 518 | Pharmaceutical product counterfeit | FAERS: 1 | US FAERS | |
| 519 | Pneumoperitoneum | FAERS: 1 | US FAERS | |
| 520 | Pneumothorax | FAERS: 1 | US FAERS | |
| 521 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 522 | Pregnancy test false positive | FAERS: 1 | US FAERS | |
| 523 | Prescription form tampering | FAERS: 1 | US FAERS | |
| 524 | Presyncope | FAERS: 1 | US FAERS | |
| 525 | Priapism | FAERS: 1 | US FAERS | |
| 526 | Product container issue | FAERS: 1 | US FAERS | |
| 527 | Product dose omission | FAERS: 1 | US FAERS | |
| 528 | Product lot number issue | FAERS: 1 | US FAERS | |
| 529 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 530 | Product packaging confusion | FAERS: 1 | US FAERS | |
| 531 | Product packaging difficult to open | FAERS: 1 | US FAERS | |
| 532 | Product packaging issue | FAERS: 1 | US FAERS | |
| 533 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 534 | Product preparation error | FAERS: 1 | US FAERS | |
| 535 | Product prescribing error | FAERS: 1 | US FAERS | |
| 536 | Product residue present | FAERS: 1 | US FAERS | |
| 537 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 538 | Product use issue | FAERS: 1 | US FAERS | |
| 539 | Productive Cough | FAERS: 1 | US FAERS | |
| 540 | Protein urine present | FAERS: 1 | US FAERS | |
| 541 | Prothrombin level abnormal | FAERS: 1 | US FAERS | |
| 542 | Pulmonary Infarction | FAERS: 1 | US FAERS | |
| 543 | Pulmonary function test decreased | FAERS: 1 | US FAERS | |
| 544 | Pulmonary toxicity | FAERS: 1 | US FAERS | |
| 545 | Pupillary light reflex tests abnormal | FAERS: 1 | US FAERS | |
| 546 | Purulent discharge | FAERS: 1 | US FAERS | |
| 547 | Radiculopathy | FAERS: 1 | US FAERS | |
| 548 | Reaction to azo-dyes | FAERS: 1 | US FAERS | |
| 549 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 550 | Rebound effect | FAERS: 1 | US FAERS | |
| 551 | Reduced facial expression | FAERS: 1 | US FAERS | |
| 552 | Regurgitation | FAERS: 1 | US FAERS | |
| 553 | Renal Cell Carcinoma | FAERS: 1 | US FAERS | |
| 554 | Renal Colic | FAERS: 1 | US FAERS | |
| 555 | Renal pain | FAERS: 1 | US FAERS | |
| 556 | Sarcoidosis | FAERS: 1 | US FAERS | |
| 557 | Sarcoma | FAERS: 1 | US FAERS | |
| 558 | Scab | FAERS: 1 | US FAERS | |
| 559 | Serotonin Syndrome | FAERS: 1 | US FAERS | |
| 560 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 561 | Shock | FAERS: 1 | US FAERS | |
| 562 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 563 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 564 | Slow response to stimuli | FAERS: 1 | US FAERS | |
| 565 | Small intestine carcinoma | FAERS: 1 | US FAERS | |
| 566 | Spina Bifida | FAERS: 1 | US FAERS | |
| 567 | Splenomegaly | FAERS: 1 | US FAERS | |
| 568 | Spondylolisthesis | FAERS: 1 | US FAERS | |
| 569 | Spousal Abuse | FAERS: 1 | US FAERS | |
| 570 | Squamous cell carcinoma of skin | FAERS: 1 | US FAERS | |
| 571 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 572 | Starvation | FAERS: 1 | US FAERS | |
| 573 | Stress | FAERS: 1 | US FAERS | |
| 574 | Suspected product tampering | FAERS: 1 | US FAERS | |
| 575 | Syringomyelia | FAERS: 1 | US FAERS | |
| 576 | Tachyphrenia | FAERS: 1 | US FAERS | |
| 577 | Therapeutic product effect prolonged | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 578 | Therapy cessation | FAERS: 1 | US FAERS | |
| 579 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 580 | Thirst | FAERS: 1 | US FAERS | |
| 581 | Thoracic vertebral fracture | FAERS: 1 | US FAERS | |
| 582 | Throat cancer | FAERS: 1 | US FAERS | |
| 583 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 584 | Tooth Infection | FAERS: 1 | US FAERS | |
| 585 | Tooth Loss | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 586 | Transcription medication error | FAERS: 1 | US FAERS | |
| 587 | Tumour haemorrhage | FAERS: 1 | US FAERS | |
| 588 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 589 | Urine cannabinoids increased | FAERS: 1 | US FAERS | |
| 590 | Urobilin urine present | FAERS: 1 | US FAERS | |
| 591 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 592 | Walking aid user | FAERS: 1 | US FAERS | |
| 593 | Wound abscess | FAERS: 1 | US FAERS | |
| 594 | Wound infection staphylococcal | FAERS: 1 | US FAERS | |
| 595 | colonoscopy | FAERS: 1 | US FAERS | |
| 596 | muscle injury | FAERS: 1 | US FAERS | |
| 597 | treatment failure | FAERS: 1 | US FAERS | |
| 598 | Erythema Multiforme | Canada Vigilance: 1 | Canada Vigilance | |
| 599 | Exposure via breast milk | Canada Vigilance: 1 | Canada Vigilance | |
| 600 | Therapeutic product effect incomplete | Canada Vigilance: 5 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.