testosterone 17 beta-cypionate
(HPFVBGJFAYZEBE-ZLQWOROUSA-N)
Structure
- SMILES
- O=C(O[C@H]1CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CCC2=CC(=O)CC[C@]12C)CCC1CCCC1
- Type(s)
- Approved
- Molecular Formula:
- C27H40O3
- Molecular Weight:
- 412.605
- Log P:
- 6.4005
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 0
- TPSA:
- 43.37
- CAS Number(s):
- 58-20-8
Synonym(s)
1.
testosterone 17 beta-cypionate
2.
Andronate
3.
Depo-Testosterone
4.
Depo-Testosterone Cypionate
5.
Depostomead
6.
Duratest
7.
Testa-C
8.
Testex Elmu
9.
deposteron
10.
testosterone 17 beta-cyclopentanepropionate
11.
testosterone 17 beta-cyclopentylpropionate
12.
testosterone cypionate
External Link(s)
| MeSH | C016131 |
| PubChem Compound | 441404 |
| ChEBI | 9463 |
| CHEMBL | CHEMBL1201101 |
| DrugBank | DB13943 |
| DrugCentral | 4454 |
| KEGG | cpd:C08156 dr:D00957 |
| ZINC | 4097468 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Myocardial Infarction | FAERS: 246 | US FAERS | |
| 2 | Drug ineffective | FAERS: 164 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 3 | Cerebrovascular accident | FAERS: 145 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 4 | Deep Vein Thrombosis | FAERS: 92 | US FAERS | |
| 5 | Injection site pain | FAERS: 91 | US FAERS | |
| 6 | Pulmonary Embolism | FAERS: 85 | US FAERS | |
| 7 | Poor quality drug administered | FAERS: 63 | OFFSIDES US FAERS | |
| 8 | Product quality issue | FAERS: 54 | OFFSIDES US FAERS | |
| 9 | Thrombosis | FAERS: 52 | US FAERS | |
| 10 | Burning sensation | FAERS: 49 | OFFSIDES US FAERS | |
| 11 | Fatigue | FAERS: 43 | OFFSIDES US FAERS | |
| 12 | Intentional product use issue | FAERS: 37 | US FAERS | |
| 13 | Malaise | FAERS: 32 | US FAERS | |
| 14 | Acute myocardial infarction | FAERS: 31 | OFFSIDES US FAERS | |
| 15 | Incorrect drug administration duration | FAERS: 31 | US FAERS | |
| 16 | Product deposit | FAERS: 31 | US FAERS | |
| 17 | Asthenia | FAERS: 28 | US FAERS | |
| 18 | Blood testosterone decreased | FAERS: 27 | US FAERS | |
| 19 | Pain | FAERS: 26 | OFFSIDES US FAERS | |
| 20 | Inappropriate schedule of drug administration | FAERS: 25 | US FAERS | |
| 21 | Feeling abnormal | FAERS: 23 | OFFSIDES US FAERS | |
| 22 | Drug administered at inappropriate site | FAERS: 21 | US FAERS | |
| 23 | Injection site erythema | FAERS: 20 | OFFSIDES US FAERS | |
| 24 | Dizziness | FAERS: 19 | US FAERS | |
| 25 | Multiple use of single-use product | FAERS: 17 | US FAERS | |
| 26 | Blood testosterone increased | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 27 | Chest Pain | FAERS: 16 | OFFSIDES US FAERS | |
| 28 | Headache | FAERS: 16 | US FAERS | |
| 29 | Anxiety | FAERS: 15 | OFFSIDES US FAERS | |
| 30 | Injection site mass | FAERS: 15 | US FAERS | |
| 31 | Activities of daily living impaired | FAERS: 14 | US FAERS | |
| 32 | Drug dose omission | FAERS: 14 | US FAERS | |
| 33 | Arthralgia | FAERS: 13 | US FAERS | |
| 34 | Nausea | FAERS: 13 | US FAERS | |
| 35 | Hypersensitivity | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 36 | Cellulitis | FAERS: 11 | OFFSIDES US FAERS | |
| 37 | Coronary Artery Disease | FAERS: 11 | US FAERS | |
| 38 | Erythema | FAERS: 11 | OFFSIDES US FAERS | |
| 39 | Myalgia | FAERS: 11 | US FAERS | |
| 40 | No adverse event | FAERS: 11 | US FAERS | |
| 41 | Product administered at inappropriate site | FAERS: 11 | US FAERS | |
| 42 | Cardiac Arrest | FAERS: 10 | US FAERS | |
| 43 | Erectile dysfunction | FAERS: 10 | US FAERS | |
| 44 | Inappropriate schedule of product administration | FAERS: 10 | US FAERS | |
| 45 | Injection Site Reaction | FAERS: 10 | US FAERS | |
| 46 | Drug dispensing error | FAERS: 9 | US FAERS | |
| 47 | Incorrect product storage | FAERS: 9 | US FAERS | |
| 48 | Lethargy | FAERS: 9 | US FAERS | |
| 49 | Pharmaceutical product complaint | FAERS: 9 | OFFSIDES US FAERS | |
| 50 | Pruritus | FAERS: 9 | US FAERS | |
| 51 | Accidental exposure to product | FAERS: 8 | US FAERS | |
| 52 | Anger | FAERS: 8 | US FAERS | |
| 53 | Incorrect product administration duration | FAERS: 8 | US FAERS | |
| 54 | Injection site pruritus | FAERS: 8 | US FAERS | |
| 55 | Intentional product misuse | FAERS: 8 | US FAERS | |
| 56 | Memory impairment | FAERS: 8 | US FAERS | |
| 57 | Product use issue | FAERS: 8 | US FAERS | |
| 58 | Urticaria | FAERS: 8 | US FAERS | |
| 59 | Acne | FAERS: 7 | US FAERS | |
| 60 | Alopecia | FAERS: 7 | US FAERS | |
| 61 | Atrial Fibrillation | FAERS: 7 | US FAERS | |
| 62 | Blood testosterone abnormal | FAERS: 7 | US FAERS | |
| 63 | Conjunctivitis | FAERS: 7 | US FAERS | |
| 64 | Injection site warmth | FAERS: 7 | OFFSIDES US FAERS | |
| 65 | Product dose omission | FAERS: 7 | US FAERS | |
| 66 | Wrong technique in product usage process | FAERS: 7 | US FAERS | |
| 67 | Abscess | FAERS: 6 | OFFSIDES US FAERS | |
| 68 | Drug administration error | FAERS: 6 | US FAERS | |
| 69 | Drug effect incomplete | FAERS: 6 | US FAERS | |
| 70 | Expired product administered | FAERS: 6 | US FAERS | |
| 71 | Incorrect dose administered | FAERS: 6 | US FAERS | |
| 72 | Injection site abscess | FAERS: 6 | US FAERS | |
| 73 | Injection site bruising | FAERS: 6 | US FAERS | |
| 74 | Injection site nodule | FAERS: 6 | US FAERS | |
| 75 | Night sweats | FAERS: 6 | US FAERS | |
| 76 | Product contamination | FAERS: 6 | US FAERS | |
| 77 | Syncope | FAERS: 6 | US FAERS | |
| 78 | Agitation | FAERS: 5 | US FAERS | |
| 79 | Angina Pectoris | FAERS: 5 | US FAERS | |
| 80 | Back Pain | FAERS: 5 | US FAERS | |
| 81 | Blindness | FAERS: 5 | US FAERS | |
| 82 | Cerebral Infarction | FAERS: 5 | US FAERS | |
| 83 | Depressed mood | FAERS: 5 | OFFSIDES US FAERS | |
| 84 | Erection increased | FAERS: 5 | US FAERS | |
| 85 | Impaired work ability | FAERS: 5 | OFFSIDES US FAERS | |
| 86 | Incorrect route of drug administration | FAERS: 5 | US FAERS | |
| 87 | Injection site inflammation | FAERS: 5 | US FAERS | |
| 88 | Liquid product physical issue | FAERS: 5 | US FAERS | |
| 89 | Palpitations | FAERS: 5 | US FAERS | |
| 90 | Peripheral swelling | FAERS: 5 | US FAERS | |
| 91 | Post-Traumatic Stress Disorder | FAERS: 5 | US FAERS | |
| 92 | Product contamination physical | FAERS: 5 | US FAERS | |
| 93 | Somnolence | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 94 | Vomiting | FAERS: 5 | US FAERS | |
| 95 | Weight decreased | FAERS: 5 | US FAERS | |
| 96 | Accidental exposure | FAERS: 4 | OFFSIDES US FAERS | |
| 97 | Amnesia | FAERS: 4 | OFFSIDES US FAERS | |
| 98 | Bipolar Disorder | FAERS: 4 | OFFSIDES US FAERS | |
| 99 | Cerebral Thrombosis | FAERS: 4 | US FAERS | |
| 100 | Chills | FAERS: 4 | US FAERS | |
| 101 | Coronary bypass thrombosis | FAERS: 4 | US FAERS | |
| 102 | Diabetes Mellitus | FAERS: 4 | US FAERS | |
| 103 | Dysphonia | FAERS: 4 | US FAERS | |
| 104 | Exposure to unspecified agent | FAERS: 4 | US FAERS | |
| 105 | Infection | FAERS: 4 | US FAERS | |
| 106 | Injection site infection | FAERS: 4 | US FAERS | |
| 107 | Lip swelling | FAERS: 4 | US FAERS | |
| 108 | Nasopharyngitis | FAERS: 4 | US FAERS | |
| 109 | Ocular vascular disorder | FAERS: 4 | US FAERS | |
| 110 | Poor quality product administered | FAERS: 4 | US FAERS | |
| 111 | Pre-existing condition improved | FAERS: 4 | US FAERS | |
| 112 | Precocious Puberty | FAERS: 4 | OFFSIDES US FAERS | |
| 113 | Prescribed overdose | FAERS: 4 | US FAERS | |
| 114 | Product substitution issue | FAERS: 4 | US FAERS | |
| 115 | Product use in unapproved indication | FAERS: 4 | US FAERS | |
| 116 | Pulmonary thrombosis | FAERS: 4 | US FAERS | |
| 117 | Rhinitis | FAERS: 4 | US FAERS | |
| 118 | Sluggishness | FAERS: 4 | US FAERS | |
| 119 | Stress | FAERS: 4 | US FAERS | |
| 120 | Sudden Cardiac Death | FAERS: 4 | US FAERS | |
| 121 | Suspected transmission of an infectious agent via product | FAERS: 4 | US FAERS | |
| 122 | Swelling | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 123 | Therapeutic response unexpected | FAERS: 4 | US FAERS | |
| 124 | Abdominal discomfort | FAERS: 3 | OFFSIDES US FAERS | |
| 125 | Aphasia | FAERS: 3 | US FAERS | |
| 126 | Chromaturia | FAERS: 3 | US FAERS | |
| 127 | Dysuria | FAERS: 3 | US FAERS | |
| 128 | Feeling Cold | FAERS: 3 | US FAERS | |
| 129 | Flushing | FAERS: 3 | US FAERS | |
| 130 | General physical health deterioration | FAERS: 3 | US FAERS | |
| 131 | Hemiparesis | FAERS: 3 | US FAERS | |
| 132 | Hemiplegia | FAERS: 3 | US FAERS | |
| 133 | Hormone level abnormal | FAERS: 3 | US FAERS | |
| 134 | Impaired driving ability | FAERS: 3 | US FAERS | |
| 135 | Incoherent | FAERS: 3 | OFFSIDES US FAERS | |
| 136 | Injection site discomfort | FAERS: 3 | US FAERS | |
| 137 | Lymphadenopathy | FAERS: 3 | US FAERS | |
| 138 | Medication Error | FAERS: 3 | US FAERS | |
| 139 | Pancreatitis | FAERS: 3 | OFFSIDES US FAERS | |
| 140 | Product storage error | FAERS: 3 | US FAERS | |
| 141 | Pulmonary Infarction | FAERS: 3 | US FAERS | |
| 142 | Reaction to drug excipients | FAERS: 3 | US FAERS | |
| 143 | Respiratory Failure | FAERS: 3 | US FAERS | |
| 144 | Sexual Dysfunction | FAERS: 3 | US FAERS | |
| 145 | Tachycardia | FAERS: 3 | US FAERS | |
| 146 | Thirst | FAERS: 3 | US FAERS | |
| 147 | Wrong technique in drug usage process | FAERS: 3 | US FAERS | |
| 148 | Abasia | FAERS: 2 | US FAERS | |
| 149 | Abdominal Pain | FAERS: 2 | US FAERS | |
| 150 | Accidental underdose | FAERS: 2 | US FAERS | |
| 151 | Application site pain | FAERS: 2 | US FAERS | |
| 152 | Arthropathy | FAERS: 2 | US FAERS | |
| 153 | Ascites | FAERS: 2 | US FAERS | |
| 154 | Atrial Flutter | FAERS: 2 | US FAERS | |
| 155 | Atrioventricular Block | FAERS: 2 | US FAERS | |
| 156 | Blood cholesterol increased | FAERS: 2 | US FAERS | |
| 157 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 158 | Cardiac ventricular thrombosis | FAERS: 2 | US FAERS | |
| 159 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 160 | Completed Suicide | FAERS: 2 | US FAERS | |
| 161 | Deafness | FAERS: 2 | OFFSIDES US FAERS | |
| 162 | Dehydration | FAERS: 2 | US FAERS | |
| 163 | Drug effect variable | FAERS: 2 | US FAERS | |
| 164 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 165 | Drug screen positive | FAERS: 2 | OFFSIDES US FAERS | |
| 166 | Dysgeusia | FAERS: 2 | US FAERS | |
| 167 | Dysgraphia | FAERS: 2 | US FAERS | |
| 168 | Emotional disorder | FAERS: 2 | US FAERS | |
| 169 | Exposure via skin contact | FAERS: 2 | US FAERS | |
| 170 | Eye irritation | FAERS: 2 | US FAERS | |
| 171 | Frustration tolerance decreased | FAERS: 2 | US FAERS | |
| 172 | Hirsutism | FAERS: 2 | US FAERS | |
| 173 | Hydrocephalus | FAERS: 2 | US FAERS | |
| 174 | Hypersomnia | FAERS: 2 | US FAERS | |
| 175 | Incorrect route of product administration | FAERS: 2 | US FAERS | |
| 176 | Injection site cellulitis | FAERS: 2 | US FAERS | |
| 177 | Injection site irritation | FAERS: 2 | US FAERS | |
| 178 | Injection site urticaria | FAERS: 2 | US FAERS | |
| 179 | Joint swelling | FAERS: 2 | US FAERS | |
| 180 | Mental impairment | FAERS: 2 | US FAERS | |
| 181 | Muscle tightness | FAERS: 2 | US FAERS | |
| 182 | Nerve injury | FAERS: 2 | US FAERS | |
| 183 | Osteoporosis | FAERS: 2 | OFFSIDES US FAERS | |
| 184 | Peripheral artery thrombosis | FAERS: 2 | US FAERS | |
| 185 | Pneumonia | FAERS: 2 | US FAERS | |
| 186 | Product contamination microbial | FAERS: 2 | US FAERS | |
| 187 | Product formulation issue | FAERS: 2 | US FAERS | |
| 188 | Product label issue | FAERS: 2 | US FAERS | |
| 189 | Product physical consistency issue | FAERS: 2 | US FAERS | |
| 190 | Product physical issue | FAERS: 2 | US FAERS | |
| 191 | Product solubility abnormal | FAERS: 2 | US FAERS | |
| 192 | Prostatectomy | FAERS: 2 | OFFSIDES US FAERS | |
| 193 | Prostatic pain | FAERS: 2 | US FAERS | |
| 194 | Silent myocardial infarction | FAERS: 2 | US FAERS | |
| 195 | Skin reaction | FAERS: 2 | US FAERS | |
| 196 | Therapeutic product effect incomplete | FAERS: 2 | US FAERS | |
| 197 | Throat cancer | FAERS: 2 | US FAERS | |
| 198 | Tremor | FAERS: 2 | US FAERS | |
| 199 | Unevaluable event | FAERS: 2 | US FAERS | |
| 200 | Visual Impairment | FAERS: 2 | US FAERS | |
| 201 | Wheelchair user | FAERS: 2 | US FAERS | |
| 202 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 203 | Administration site infection | FAERS: 1 | US FAERS | |
| 204 | Administration site mass | FAERS: 1 | US FAERS | |
| 205 | Administration site nodule | FAERS: 1 | US FAERS | |
| 206 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 207 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 208 | Angioedema | FAERS: 1 | US FAERS | |
| 209 | Anosmia | FAERS: 1 | US FAERS | |
| 210 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 211 | Aortic Valve Stenosis | FAERS: 1 | US FAERS | |
| 212 | Arterial Injury | FAERS: 1 | US FAERS | |
| 213 | Arterial thrombosis | FAERS: 1 | US FAERS | |
| 214 | Asthma | FAERS: 1 | OFFSIDES US FAERS | |
| 215 | Ataxia | FAERS: 1 | US FAERS | |
| 216 | Back disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 217 | Bacterial sepsis | FAERS: 1 | US FAERS | |
| 218 | Benign Neoplasm | FAERS: 1 | US FAERS | |
| 219 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 220 | Body fat disorder | FAERS: 1 | US FAERS | |
| 221 | Bursitis | FAERS: 1 | US FAERS | |
| 222 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 223 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 224 | Cerebral Arteriosclerosis | FAERS: 1 | US FAERS | |
| 225 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 226 | Cholecystitis | FAERS: 1 | OFFSIDES US FAERS | |
| 227 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 228 | Confabulation | FAERS: 1 | US FAERS | |
| 229 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 230 | Crying | FAERS: 1 | US FAERS | |
| 231 | Cyst | FAERS: 1 | US FAERS | |
| 232 | Dementia | FAERS: 1 | US FAERS | |
| 233 | Dermatitis acneiform | FAERS: 1 | US FAERS | |
| 234 | Device leakage | FAERS: 1 | OFFSIDES US FAERS | |
| 235 | Discomfort | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 236 | Drug abuser | FAERS: 1 | OFFSIDES US FAERS | |
| 237 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 238 | Dry skin | FAERS: 1 | US FAERS | |
| 239 | Dysarthria | FAERS: 1 | US FAERS | |
| 240 | Dyspepsia | FAERS: 1 | US FAERS | |
| 241 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 242 | Embolism | FAERS: 1 | US FAERS | |
| 243 | Emotional distress | FAERS: 1 | OFFSIDES US FAERS | |
| 244 | Endocarditis | FAERS: 1 | US FAERS | |
| 245 | Exposure via direct contact | FAERS: 1 | US FAERS | |
| 246 | Facial asymmetry | FAERS: 1 | US FAERS | |
| 247 | Food Poisoning | FAERS: 1 | US FAERS | |
| 248 | Frustration | FAERS: 1 | US FAERS | |
| 249 | Gout | FAERS: 1 | US FAERS | |
| 250 | Heat Exhaustion | FAERS: 1 | US FAERS | |
| 251 | Hunger | FAERS: 1 | US FAERS | |
| 252 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 253 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 254 | Hypertrichosis | FAERS: 1 | US FAERS | |
| 255 | Hypogonadism | FAERS: 1 | OFFSIDES US FAERS | |
| 256 | Hypomania | FAERS: 1 | US FAERS | |
| 257 | Hypotrichosis | FAERS: 1 | US FAERS | |
| 258 | Incontinence | FAERS: 1 | US FAERS | |
| 259 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 260 | Infarction | FAERS: 1 | US FAERS | |
| 261 | Infectious pleural effusion | FAERS: 1 | US FAERS | |
| 262 | Injection site eczema | FAERS: 1 | US FAERS | |
| 263 | Injection site hypersensitivity | FAERS: 1 | US FAERS | |
| 264 | Injection site necrosis | FAERS: 1 | US FAERS | |
| 265 | Injection site scar | FAERS: 1 | US FAERS | |
| 266 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 267 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 268 | Joint injury | FAERS: 1 | US FAERS | |
| 269 | Laziness | FAERS: 1 | US FAERS | |
| 270 | Libido disorder | FAERS: 1 | US FAERS | |
| 271 | Limb injury | FAERS: 1 | US FAERS | |
| 272 | Local reaction | FAERS: 1 | US FAERS | |
| 273 | Male Orgasmic Disorder | FAERS: 1 | US FAERS | |
| 274 | Meningioma | FAERS: 1 | US FAERS | |
| 275 | Meningitis | FAERS: 1 | US FAERS | |
| 276 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 277 | Monocyte count increased | FAERS: 1 | US FAERS | |
| 278 | Monocyte percentage increased | FAERS: 1 | US FAERS | |
| 279 | Mood swings | FAERS: 1 | US FAERS | |
| 280 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 281 | Muscle tone disorder | FAERS: 1 | US FAERS | |
| 282 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 283 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 284 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 285 | Mycobacterium fortuitum infection | FAERS: 1 | US FAERS | |
| 286 | Myosclerosis | FAERS: 1 | US FAERS | |
| 287 | Myositis | FAERS: 1 | US FAERS | |
| 288 | Needle issue | FAERS: 1 | US FAERS | |
| 289 | Nervousness | FAERS: 1 | US FAERS | |
| 290 | Neuralgia | FAERS: 1 | US FAERS | |
| 291 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 292 | Nipple pain | FAERS: 1 | US FAERS | |
| 293 | Nodule on extremity | FAERS: 1 | US FAERS | |
| 294 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 295 | Overweight | FAERS: 1 | US FAERS | |
| 296 | Paresis | FAERS: 1 | US FAERS | |
| 297 | Pelvic mass | FAERS: 1 | US FAERS | |
| 298 | Performance status decreased | FAERS: 1 | US FAERS | |
| 299 | Peripheral arterial occlusive disease | FAERS: 1 | US FAERS | |
| 300 | Peripheral embolism | FAERS: 1 | US FAERS | |
| 301 | Personality Change | FAERS: 1 | US FAERS | |
| 302 | Physical disability | FAERS: 1 | US FAERS | |
| 303 | Physical product label issue | FAERS: 1 | US FAERS | |
| 304 | Portal Vein Thrombosis | FAERS: 1 | US FAERS | |
| 305 | Prehypertension | FAERS: 1 | US FAERS | |
| 306 | Prescribed underdose | FAERS: 1 | US FAERS | |
| 307 | Presyncope | FAERS: 1 | US FAERS | |
| 308 | Priapism | FAERS: 1 | OFFSIDES US FAERS | |
| 309 | Product counterfeit | FAERS: 1 | US FAERS | |
| 310 | Product label confusion | FAERS: 1 | US FAERS | |
| 311 | Product label on wrong product | FAERS: 1 | US FAERS | |
| 312 | Product leakage | FAERS: 1 | US FAERS | |
| 313 | Product packaging confusion | FAERS: 1 | US FAERS | |
| 314 | Product packaging issue | FAERS: 1 | US FAERS | |
| 315 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 316 | Product preparation error | FAERS: 1 | US FAERS | |
| 317 | Product prescribing issue | FAERS: 1 | US FAERS | |
| 318 | Pulmonary Eosinophilia | FAERS: 1 | US FAERS | |
| 319 | Pulmonary oil microembolism | FAERS: 1 | US FAERS | |
| 320 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 321 | Reaction to preservatives | FAERS: 1 | US FAERS | |
| 322 | Rectal discharge | FAERS: 1 | US FAERS | |
| 323 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 324 | Retching | FAERS: 1 | US FAERS | |
| 325 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 326 | Sciatica | FAERS: 1 | US FAERS | |
| 327 | Screaming | FAERS: 1 | US FAERS | |
| 328 | Skin irritation | FAERS: 1 | US FAERS | |
| 329 | Spinal column injury | FAERS: 1 | US FAERS | |
| 330 | Spinal fusion surgery | FAERS: 1 | US FAERS | |
| 331 | Sudden death | FAERS: 1 | US FAERS | |
| 332 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 333 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 334 | Tension | FAERS: 1 | US FAERS | |
| 335 | Terminal state | FAERS: 1 | US FAERS | |
| 336 | Therapeutic product effect decreased | FAERS: 1 | US FAERS | |
| 337 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 338 | Therapy cessation | FAERS: 1 | US FAERS | |
| 339 | Thrombophlebitis | FAERS: 1 | US FAERS | |
| 340 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 341 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 342 | Vascular compression | FAERS: 1 | US FAERS | |
| 343 | Vascular purpura | FAERS: 1 | US FAERS | |
| 344 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 345 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 346 | Vertigo | FAERS: 1 | US FAERS | |
| 347 | Walking aid user | FAERS: 1 | US FAERS | |
| 348 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 349 | carbuncle | FAERS: 1 | US FAERS | |
| 350 | jaundice | FAERS: 1 | US FAERS | |
| 351 | Anorexia | OFFSIDES | ||
| 352 | Apathy | OFFSIDES | ||
| 353 | Arteriosclerosis | OFFSIDES | ||
| 354 | Arthritis | OFFSIDES | ||
| 355 | Blood Glucose | OFFSIDES | ||
| 356 | Blood bicarbonate | OFFSIDES | ||
| 357 | Blood creatinine increased | OFFSIDES | ||
| 358 | Blood glucose decreased | OFFSIDES | ||
| 359 | Blood immunoglobulin E | OFFSIDES | ||
| 360 | Blurred vision | OFFSIDES | ||
| 361 | Bone erosion | OFFSIDES | ||
| 362 | Bruxism | OFFSIDES | ||
| 363 | Cartilage injury | OFFSIDES | ||
| 364 | Choking sensation | OFFSIDES | ||
| 365 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 366 | Cyanopsia | OFFSIDES | ||
| 367 | Decreased Libido | OFFSIDES | ||
| 368 | Delusional disorder, unspecified type | OFFSIDES | ||
| 369 | Drug Tolerance | OFFSIDES | ||
| 370 | Drug addict | OFFSIDES | ||
| 371 | Dysthymic Disorder | OFFSIDES | ||
| 372 | Essential Tremor | OFFSIDES | ||
| 373 | Eye pain | OFFSIDES | ||
| 374 | Gambling | OFFSIDES | ||
| 375 | Ileitis | OFFSIDES | ||
| 376 | Intention tremor | OFFSIDES | ||
| 377 | Ligament injury | OFFSIDES | ||
| 378 | Limb discomfort | OFFSIDES | ||
| 379 | Lymphangitis | OFFSIDES | ||
| 380 | Mood disorder due to a general medical condition | OFFSIDES | ||
| 381 | Mycobacterium avium complex immune restoration disease | OFFSIDES | ||
| 382 | Nervous tension | OFFSIDES | ||
| 383 | Occult blood positive | OFFSIDES | ||
| 384 | PO2 decreased | OFFSIDES | ||
| 385 | Paranoia | OFFSIDES | ||
| 386 | Patellofemoral Pain Syndrome | OFFSIDES | ||
| 387 | Physical assault | OFFSIDES | ||
| 388 | Polymyositis | OFFSIDES | ||
| 389 | Renal cyst | OFFSIDES | ||
| 390 | Schizoaffective Disorder | OFFSIDES | ||
| 391 | Sebaceous adenoma | OFFSIDES | ||
| 392 | Sperm count decreased | OFFSIDES | ||
| 393 | Spondylolisthesis | OFFSIDES | ||
| 394 | Spondylolysis | OFFSIDES | ||
| 395 | Synovitis | OFFSIDES | ||
| 396 | Tongue biting | OFFSIDES | ||
| 397 | Tooth Extraction | OFFSIDES | ||
| 398 | Urethral Obstruction | OFFSIDES | ||
| 399 | Vitamin B 12 Deficiency | OFFSIDES | ||
| 400 | Weight Gain | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.