brinzolamide
(HCRKCZRJWPKOAR-JTQLQIEISA-N)
Structure
- SMILES
- COCCCN1C[C@H](NCC)c2c(S1(=O)=O)sc(c2)S(=O)(=O)N
- Type(s)
- Approved
- ATC code(s)
- S01EC04; S01EC54
- Molecular Formula:
- C12H21N3O5S3
- Molecular Weight:
- 383.507
- Log P:
- 3.2776
- Hydrogen Bond Acceptor:
- 9
- Hydrogen Bond Donor:
- 2
- TPSA:
- 163.8
- CAS Number(s):
- 138890-50-3; 138890-62-7
Synonym(s)
1.
brinzolamide
2.
(R)-4-(ethylamino)-3,4-dihydro-2-(3-methoxypropyl)-2H-thieno(3,2-E)-1,2-thiazine-6-sulfonamide 1,1-dioxide
3.
Azopt
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 119 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Eye irritation | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 3 | Eye pain | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 4 | Glaucoma | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 5 | Visual Impairment | FAERS: 24 | SIDER US FAERS | |
| 6 | No adverse event | FAERS: 23 | US FAERS | |
| 7 | Product quality issue | FAERS: 20 | US FAERS | |
| 8 | Blindness | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 9 | Foreign body sensation in eyes | FAERS: 14 | OFFSIDES SIDER US FAERS | |
| 10 | Headache | FAERS: 14 | SIDER US FAERS | |
| 11 | Malaise | FAERS: 14 | SIDER US FAERS | |
| 12 | Dizziness | FAERS: 13 | SIDER US FAERS | |
| 13 | Hypersensitivity | FAERS: 13 | SIDER US FAERS | |
| 14 | Asthenia | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 15 | Cataract | FAERS: 11 | OFFSIDES US FAERS | |
| 16 | Fatigue | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 17 | Nausea | FAERS: 10 | SIDER US FAERS | |
| 18 | Chest Pain | FAERS: 7 | SIDER US FAERS | |
| 19 | Feeling abnormal | FAERS: 7 | SIDER US FAERS | |
| 20 | Incorrect dose administered | FAERS: 7 | US FAERS | |
| 21 | Medication residue present | FAERS: 7 | SIDER US FAERS | |
| 22 | Ocular discomfort | FAERS: 7 | SIDER US FAERS | |
| 23 | Palpitations | FAERS: 7 | SIDER US FAERS | |
| 24 | Accidental exposure to product | FAERS: 6 | US FAERS | |
| 25 | Alopecia | FAERS: 6 | SIDER US FAERS | |
| 26 | Deafness | FAERS: 6 | US FAERS | |
| 27 | Epistaxis | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 28 | Macular degeneration | FAERS: 6 | US FAERS | |
| 29 | Product dropper issue | FAERS: 6 | US FAERS | |
| 30 | Dysgeusia | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 31 | Limb injury | FAERS: 5 | US FAERS | |
| 32 | Nasopharyngitis | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 33 | Oropharyngeal pain | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 34 | Product administration error | FAERS: 5 | US FAERS | |
| 35 | Pruritus | FAERS: 5 | SIDER US FAERS | |
| 36 | Vertigo | FAERS: 5 | SIDER US FAERS | |
| 37 | Arthritis | FAERS: 4 | US FAERS | |
| 38 | Asthma | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 39 | Back Pain | FAERS: 4 | SIDER US FAERS | |
| 40 | Bradycardia | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 41 | Diabetes Mellitus | FAERS: 4 | US FAERS | |
| 42 | Dysphonia | FAERS: 4 | US FAERS | |
| 43 | Eyelid margin crusting | FAERS: 4 | SIDER US FAERS | |
| 44 | Nervousness | FAERS: 4 | SIDER US FAERS | |
| 45 | Photophobia | FAERS: 4 | SIDER US FAERS | |
| 46 | Punctate keratitis | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 47 | Abdominal discomfort | FAERS: 3 | SIDER US FAERS | |
| 48 | Agitation | FAERS: 3 | SIDER US FAERS | |
| 49 | Alanine Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 50 | Anxiety | FAERS: 3 | US FAERS | |
| 51 | Arthralgia | FAERS: 3 | SIDER US FAERS | |
| 52 | Arthropathy | FAERS: 3 | US FAERS | |
| 53 | Aspartate Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 54 | Cerebrovascular accident | FAERS: 3 | US FAERS | |
| 55 | Chest discomfort | FAERS: 3 | SIDER US FAERS | |
| 56 | Erythema | FAERS: 3 | SIDER US FAERS | |
| 57 | Eye Infection | FAERS: 3 | US FAERS | |
| 58 | Eye allergy | FAERS: 3 | SIDER US FAERS | |
| 59 | Keratitis | FAERS: 3 | SIDER US FAERS | |
| 60 | Liquid product physical issue | FAERS: 3 | US FAERS | |
| 61 | Myalgia | FAERS: 3 | SIDER US FAERS | |
| 62 | Overdose | FAERS: 3 | US FAERS | |
| 63 | Polyneuropathy | FAERS: 3 | US FAERS | |
| 64 | Product deposit | FAERS: 3 | US FAERS | |
| 65 | Productive Cough | FAERS: 3 | US FAERS | |
| 66 | Syncope | FAERS: 3 | US FAERS | |
| 67 | Thrombosis | FAERS: 3 | US FAERS | |
| 68 | Tremor | FAERS: 3 | SIDER US FAERS | |
| 69 | Vomiting | FAERS: 3 | SIDER US FAERS | |
| 70 | Weight decreased | FAERS: 3 | US FAERS | |
| 71 | Wheezing | FAERS: 3 | US FAERS | |
| 72 | Accidental overdose | FAERS: 2 | US FAERS | |
| 73 | Amnesia | FAERS: 2 | SIDER US FAERS | |
| 74 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 75 | Burning sensation | FAERS: 2 | US FAERS | |
| 76 | Choking sensation | FAERS: 2 | OFFSIDES US FAERS | |
| 77 | Corneal epithelium defect | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 78 | Crying | FAERS: 2 | US FAERS | |
| 79 | Dehydration | FAERS: 2 | OFFSIDES US FAERS | |
| 80 | Diplopia | FAERS: 2 | SIDER US FAERS | |
| 81 | Drug administration error | FAERS: 2 | US FAERS | |
| 82 | Emotional distress | FAERS: 2 | OFFSIDES US FAERS | |
| 83 | Exfoliation Syndrome | FAERS: 2 | US FAERS | |
| 84 | Facial Pain | FAERS: 2 | US FAERS | |
| 85 | Food Poisoning | FAERS: 2 | US FAERS | |
| 86 | General physical health deterioration | FAERS: 2 | OFFSIDES US FAERS | |
| 87 | Gout | FAERS: 2 | OFFSIDES US FAERS | |
| 88 | Hypotension | FAERS: 2 | SIDER US FAERS | |
| 89 | Inappropriate schedule of drug administration | FAERS: 2 | US FAERS | |
| 90 | Joint injury | FAERS: 2 | US FAERS | |
| 91 | Macular fibrosis | FAERS: 2 | US FAERS | |
| 92 | Memory impairment | FAERS: 2 | SIDER US FAERS | |
| 93 | Monoplegia | FAERS: 2 | US FAERS | |
| 94 | Muscle tightness | FAERS: 2 | US FAERS | |
| 95 | Pain | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 96 | Product container issue | FAERS: 2 | US FAERS | |
| 97 | Product packaging issue | FAERS: 2 | US FAERS | |
| 98 | Product physical consistency issue | FAERS: 2 | US FAERS | |
| 99 | Product use issue | FAERS: 2 | US FAERS | |
| 100 | Retinal Artery Occlusion | FAERS: 2 | US FAERS | |
| 101 | Retinal Vein Occlusion | FAERS: 2 | OFFSIDES US FAERS | |
| 102 | Rhinitis | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 103 | Stevens-Johnson Syndrome | FAERS: 2 | 25811541 | CTD OFFSIDES US FAERS |
| 104 | Suicide attempt | FAERS: 2 | US FAERS | |
| 105 | Throat irritation | FAERS: 2 | SIDER US FAERS | |
| 106 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 107 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 108 | treatment failure | FAERS: 2 | US FAERS | |
| 109 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 110 | Accidental death | FAERS: 1 | US FAERS | |
| 111 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 112 | Alcohol Intolerance | FAERS: 1 | US FAERS | |
| 113 | Altered visual depth perception | FAERS: 1 | US FAERS | |
| 114 | Aphasia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 115 | Asphyxia | FAERS: 1 | US FAERS | |
| 116 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 117 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 118 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 119 | Breast cancer recurrent | FAERS: 1 | US FAERS | |
| 120 | Bronchial Hyperreactivity | FAERS: 1 | SIDER US FAERS | |
| 121 | Choking | FAERS: 1 | US FAERS | |
| 122 | Cold sweat | FAERS: 1 | US FAERS | |
| 123 | Corneal erosion | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 124 | Dacryostenosis acquired | FAERS: 1 | US FAERS | |
| 125 | Deposit eye | FAERS: 1 | SIDER US FAERS | |
| 126 | Disease Progression | FAERS: 1 | US FAERS | |
| 127 | Disease recurrence | FAERS: 1 | US FAERS | |
| 128 | Disorientation | FAERS: 1 | US FAERS | |
| 129 | Disuse syndrome | FAERS: 1 | US FAERS | |
| 130 | Documented hypersensitivity to administered drug | FAERS: 1 | US FAERS | |
| 131 | Drug Dependence | FAERS: 1 | US FAERS | |
| 132 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 133 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 134 | Drug toxicity | FAERS: 1 | US FAERS | |
| 135 | Eczema | FAERS: 1 | US FAERS | |
| 136 | Eructation | FAERS: 1 | US FAERS | |
| 137 | Expired product administered | FAERS: 1 | US FAERS | |
| 138 | Extra dose administered | FAERS: 1 | US FAERS | |
| 139 | Eyelid pain | FAERS: 1 | US FAERS | |
| 140 | Flank Pain | FAERS: 1 | US FAERS | |
| 141 | Flushing | FAERS: 1 | US FAERS | |
| 142 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 143 | Gastrointestinal motility disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 144 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 145 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 146 | Influenza | FAERS: 1 | US FAERS | |
| 147 | Iritis | FAERS: 1 | OFFSIDES US FAERS | |
| 148 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 149 | Laryngitis | FAERS: 1 | US FAERS | |
| 150 | Limb discomfort | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 151 | Malignant Hypertension | FAERS: 1 | US FAERS | |
| 152 | Mouth swelling | FAERS: 1 | US FAERS | |
| 153 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 154 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 155 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 156 | Overweight | FAERS: 1 | US FAERS | |
| 157 | Peripheral paralysis | FAERS: 1 | US FAERS | |
| 158 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 159 | Pneumonia | FAERS: 1 | US FAERS | |
| 160 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 161 | Product intolerance | FAERS: 1 | US FAERS | |
| 162 | Product package associated injury | FAERS: 1 | US FAERS | |
| 163 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 164 | Product storage error | FAERS: 1 | US FAERS | |
| 165 | Product substitution issue | FAERS: 1 | US FAERS | |
| 166 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 167 | Product use complaint | FAERS: 1 | US FAERS | |
| 168 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 169 | Proteinuria | FAERS: 1 | US FAERS | |
| 170 | Psoriasis | FAERS: 1 | US FAERS | |
| 171 | Retinal Degeneration | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 172 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 173 | Retinal Vascular Disorder | FAERS: 1 | US FAERS | |
| 174 | Rheumatoid Arthritis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 175 | Scab | FAERS: 1 | SIDER US FAERS | |
| 176 | Scleroderma | FAERS: 1 | OFFSIDES US FAERS | |
| 177 | Sepsis | FAERS: 1 | US FAERS | |
| 178 | Shock | FAERS: 1 | US FAERS | |
| 179 | Sinusitis | FAERS: 1 | SIDER US FAERS | |
| 180 | Sneezing | FAERS: 1 | SIDER US FAERS | |
| 181 | Somnolence | FAERS: 1 | SIDER US FAERS | |
| 182 | Stress | FAERS: 1 | US FAERS | |
| 183 | Superficial injury of eye | FAERS: 1 | US FAERS | |
| 184 | Tachycardia | FAERS: 1 | SIDER US FAERS | |
| 185 | Tension | FAERS: 1 | SIDER US FAERS | |
| 186 | Tinnitus | FAERS: 1 | SIDER US FAERS | |
| 187 | Tooth Erosion | FAERS: 1 | US FAERS | |
| 188 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 189 | Urinary Retention | FAERS: 1 | US FAERS | |
| 190 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 191 | Urinary tract obstruction | FAERS: 1 | US FAERS | |
| 192 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 193 | Viral upper respiratory tract infection | FAERS: 1 | OFFSIDES US FAERS | |
| 194 | Vitreous Detachment | FAERS: 1 | US FAERS | |
| 195 | Vitreous opacities | FAERS: 1 | US FAERS | |
| 196 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 197 | jaundice | FAERS: 1 | US FAERS | |
| 198 | nervous system disorder | FAERS: 1 | SIDER US FAERS | |
| 199 | Abnormal vision | OFFSIDES SIDER | ||
| 200 | Acid reflux | OFFSIDES | ||
| 201 | Acquired diaphragmatic eventration | OFFSIDES | ||
| 202 | Activities of daily living impaired | OFFSIDES | ||
| 203 | Acute respiratory failure | OFFSIDES | ||
| 204 | Adenocarcinoma | OFFSIDES | ||
| 205 | Ageusia | SIDER | ||
| 206 | Amphetamines | OFFSIDES | ||
| 207 | Angina Pectoris | SIDER | ||
| 208 | Apathy | SIDER | ||
| 209 | Arterial bypass operation | OFFSIDES | ||
| 210 | Asthenopia | SIDER | ||
| 211 | Atelectasis | OFFSIDES | ||
| 212 | Biliary adenoma | OFFSIDES | ||
| 213 | Biliary dilatation | OFFSIDES | ||
| 214 | Biopsy liver abnormal | OFFSIDES | ||
| 215 | Blepharitis | SIDER | ||
| 216 | Blepharoptosis | OFFSIDES | ||
| 217 | Blood 1,25-dihydroxycholecalciferol decreased | OFFSIDES | ||
| 218 | Blood and lymphatic system disorders | SIDER | ||
| 219 | Blood beta-D-glucan increased | OFFSIDES | ||
| 220 | Blood chloride increased | SIDER | ||
| 221 | Blood creatine phosphokinase abnormal | OFFSIDES | ||
| 222 | Blood parathyroid hormone increased | OFFSIDES | ||
| 223 | Blood sodium | OFFSIDES | ||
| 224 | Blurred vision | OFFSIDES | ||
| 225 | Bone lesion | OFFSIDES | ||
| 226 | Bone pain | OFFSIDES | ||
| 227 | Bronchitis | SIDER | ||
| 228 | Bruxism | OFFSIDES | ||
| 229 | C-reactive protein abnormal | OFFSIDES | ||
| 230 | Cardio-respiratory distress | SIDER | ||
| 231 | Cardioactive drug level increased | OFFSIDES | ||
| 232 | Cellulitis | OFFSIDES | ||
| 233 | Cerebral artery stenosis | OFFSIDES | ||
| 234 | Chondromalacia | OFFSIDES | ||
| 235 | Conjunctival deposit | OFFSIDES | ||
| 236 | Conjunctivitis | SIDER | ||
| 237 | Corneal Ulcer | OFFSIDES | ||
| 238 | Corneal epithelium disorder | OFFSIDES SIDER | ||
| 239 | Demyelination | OFFSIDES | ||
| 240 | Depressed mood | SIDER | ||
| 241 | Dermatitis | SIDER | ||
| 242 | Diabetes Insipidus | OFFSIDES | ||
| 243 | Discomfort | SIDER | ||
| 244 | Disturbance in sexual arousal | SIDER | ||
| 245 | Dyspepsia | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 246 | Ear and labyrinth disorders | SIDER | ||
| 247 | Endophthalmitis | OFFSIDES SIDER | ||
| 248 | Enthesopathy | OFFSIDES | ||
| 249 | Erectile dysfunction | SIDER | ||
| 250 | Eye inflammation | OFFSIDES | ||
| 251 | Eyelids pruritus | SIDER | ||
| 252 | Fatty Liver | OFFSIDES | ||
| 253 | Feeling jittery | SIDER | ||
| 254 | Flat affect | SIDER | ||
| 255 | Flatulence | OFFSIDES SIDER | ||
| 256 | Fracture treatment | OFFSIDES | ||
| 257 | Glaucoma, Open-Angle | 19668763 | CTD | |
| 258 | Granuloma | OFFSIDES | ||
| 259 | Induration | OFFSIDES | ||
| 260 | Infection | OFFSIDES SIDER | ||
| 261 | Infestation | SIDER | ||
| 262 | Infusion site mobility decreased | OFFSIDES | ||
| 263 | Injection site erythema | OFFSIDES | ||
| 264 | Injection site mass | OFFSIDES | ||
| 265 | Injection site pruritus | OFFSIDES | ||
| 266 | Intestinal resection | OFFSIDES | ||
| 267 | Intraocular pressure test | OFFSIDES | ||
| 268 | Keratoconjunctivitis Sicca | SIDER | ||
| 269 | Keratoconjunctivitis | SIDER | ||
| 270 | Keratopathy | SIDER | ||
| 271 | Keratorhexis | OFFSIDES | ||
| 272 | Kidney Failure | OFFSIDES | ||
| 273 | Lacrimation | SIDER | ||
| 274 | Laryngospasm | OFFSIDES | ||
| 275 | Leukopenia neonatal | OFFSIDES | ||
| 276 | Listeria sepsis | OFFSIDES | ||
| 277 | Loose tooth | OFFSIDES | ||
| 278 | Lung consolidation | OFFSIDES | ||
| 279 | Lymphoma | OFFSIDES | ||
| 280 | Malabsorption | OFFSIDES | ||
| 281 | Malnutrition | SIDER | ||
| 282 | Medication residue | SIDER | ||
| 283 | Meibomianitis | SIDER | ||
| 284 | Mental status changes | OFFSIDES | ||
| 285 | Metastases to thorax | OFFSIDES | ||
| 286 | Monoparesis | OFFSIDES | ||
| 287 | Musculoskeletal discomfort | SIDER | ||
| 288 | Neuralgia | OFFSIDES | ||
| 289 | Nocturia | OFFSIDES | ||
| 290 | Obsessive thoughts | OFFSIDES | ||
| 291 | Ocular Hypertension | 19668763 | CTD | |
| 292 | Optic Atrophy | OFFSIDES | ||
| 293 | Optic nerve cupping | SIDER | ||
| 294 | Oral polypectomy | OFFSIDES | ||
| 295 | Oropharyngeal spasm | OFFSIDES | ||
| 296 | Orthopnea | OFFSIDES | ||
| 297 | Osteolysis | OFFSIDES | ||
| 298 | Osteopenia | OFFSIDES | ||
| 299 | Osteoporosis | OFFSIDES | ||
| 300 | Osteosclerosis | OFFSIDES | ||
| 301 | Pancreatic Insufficiency | OFFSIDES | ||
| 302 | Panophthalmitis | OFFSIDES | ||
| 303 | Pharyngitis | SIDER | ||
| 304 | Pharyngolaryngeal Pain | SIDER | ||
| 305 | Physical disability | OFFSIDES | ||
| 306 | Polydactyly | OFFSIDES | ||
| 307 | Prostate examination abnormal | OFFSIDES | ||
| 308 | Pterygium | SIDER | ||
| 309 | Rectal polyp | OFFSIDES | ||
| 310 | Renal pain | SIDER | ||
| 311 | Retinoschisis | OFFSIDES | ||
| 312 | Scleral pigmentation | SIDER | ||
| 313 | Scotoma | OFFSIDES | ||
| 314 | Secretion discharge | OFFSIDES | ||
| 315 | Skin tightness | SIDER | ||
| 316 | Sopor | OFFSIDES | ||
| 317 | Subconjunctival cyst | SIDER | ||
| 318 | Superior Vena Cava Syndrome | OFFSIDES | ||
| 319 | Synovial Cyst | OFFSIDES | ||
| 320 | Upper respiratory tract congestion | SIDER | ||
| 321 | Upper-airway cough syndrome | SIDER | ||
| 322 | Upset stomach | SIDER | ||
| 323 | Urethral Obstruction | OFFSIDES | ||
| 324 | Urticaria | SIDER | ||
| 325 | Venous occlusion | OFFSIDES | ||
| 326 | Visual disturbance | SIDER | ||
| 327 | Vital dye staining cornea present | SIDER | ||
| 328 | Vocal Cord Paralysis | OFFSIDES | ||
| 329 | effusion | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.