Raltegravir Potassium
(CZFFBEXEKNGXKS-UHFFFAOYSA-N)
Structure
- SMILES
- Fc1ccc(cc1)CNC(=O)c1nc(n(c(=O)c1O)C)C(NC(=O)c1nnc(o1)C)(C)C
- Type(s)
- Approved
- ATC code(s)
- J05AR16; J05AX08
- Molecular Formula:
- C20H21FN6O5
- Molecular Weight:
- 444.416
- Log P:
- 1.6933
- Hydrogen Bond Acceptor:
- 11
- Hydrogen Bond Donor:
- 3
- TPSA:
- 152.24
- CAS Number(s):
- 518048-05-0
Synonym(s)
1.
Raltegravir Potassium
2.
Isentress
3.
MK 0518
4.
MK-0518
5.
MK0518
6.
Raltegravir
7.
0518, MK
8.
Potassium, Raltegravir
External Link(s)
| MeSH | D000068898 |
| PubChem Compound | 54671008 |
| BindingDB | 25351 |
| CHEMBL | CHEMBL254316 |
| DrugBank | DB06817 |
| DrugCentral | 2352 |
| KEGG | dr:D06676 |
| Therapeutic Target Database | D0I1FQ |
| ZINC | 13831130 114994525 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Adverse event | FAERS: 88 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | No adverse event | FAERS: 82 | US FAERS | |
| 3 | Drug dose omission | FAERS: 43 | US FAERS | |
| 4 | Nausea | FAERS: 39 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 5 | Malaise | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 6 | Fatigue | FAERS: 29 | SIDER US FAERS | |
| 7 | Headache | FAERS: 26 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 8 | Inappropriate schedule of drug administration | FAERS: 26 | US FAERS | |
| 9 | Myalgia | FAERS: 24 | SIDER US FAERS | |
| 10 | Wrong technique in product usage process | FAERS: 22 | US FAERS | |
| 11 | Product use issue | FAERS: 19 | US FAERS | |
| 12 | Wrong technique in drug usage process | FAERS: 19 | US FAERS | |
| 13 | Vomiting | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 14 | Dizziness | FAERS: 17 | SIDER US FAERS | |
| 15 | Maternal exposure during pregnancy | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Blood creatine phosphokinase increased | FAERS: 16 | SIDER US FAERS | |
| 17 | Drug ineffective | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 18 | Virologic failure | FAERS: 16 | US FAERS | |
| 19 | Drug exposure during pregnancy | FAERS: 15 | US FAERS | |
| 20 | Gastrostomy | FAERS: 15 | US FAERS | |
| 21 | Nasopharyngitis | FAERS: 15 | SIDER US FAERS | |
| 22 | Pruritus | FAERS: 15 | SIDER US FAERS | |
| 23 | Alanine Aminotransferase Increased | FAERS: 14 | SIDER US FAERS | |
| 24 | Anxiety | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 25 | Pneumonia | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 26 | Arthralgia | FAERS: 12 | SIDER US FAERS | |
| 27 | Pain | FAERS: 12 | SIDER US FAERS | |
| 28 | Aspartate Aminotransferase Increased | FAERS: 11 | SIDER US FAERS | |
| 29 | Product quality issue | FAERS: 11 | US FAERS | |
| 30 | Abdominal discomfort | FAERS: 10 | SIDER US FAERS | |
| 31 | Diabetes Mellitus | FAERS: 10 | SIDER US FAERS | |
| 32 | Myocardial Infarction | FAERS: 10 | SIDER US FAERS | |
| 33 | Incorrect route of drug administration | FAERS: 9 | US FAERS | |
| 34 | Lymphoma | FAERS: 9 | SIDER US FAERS | |
| 35 | Asthenia | FAERS: 8 | SIDER US FAERS | |
| 36 | Cerebrovascular accident | FAERS: 8 | US FAERS | |
| 37 | Chest Pain | FAERS: 8 | SIDER US FAERS | |
| 38 | Overdose | FAERS: 8 | US FAERS | |
| 39 | Somnolence | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 40 | Weight decreased | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 41 | Blood HIV RNA increased | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 42 | Blood glucose increased | FAERS: 7 | SIDER US FAERS | |
| 43 | Circumstance or information capable of leading to medication error | FAERS: 7 | US FAERS | |
| 44 | Drug prescribing error | FAERS: 7 | US FAERS | |
| 45 | General physical health deterioration | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 46 | Incorrect dose administered | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 47 | Incorrect product storage | FAERS: 7 | US FAERS | |
| 48 | Product dose omission | FAERS: 7 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 49 | Rhabdomyolysis | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 50 | Drug administration error | FAERS: 6 | US FAERS | |
| 51 | Feeling abnormal | FAERS: 6 | SIDER US FAERS | |
| 52 | Paranoia | FAERS: 6 | SIDER US FAERS | |
| 53 | Product use in unapproved indication | FAERS: 6 | US FAERS | |
| 54 | Sepsis | FAERS: 6 | US FAERS | |
| 55 | Septic Shock | FAERS: 6 | US FAERS | |
| 56 | Viral load increased | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 57 | Amnesia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 58 | Blood potassium increased | FAERS: 5 | US FAERS | |
| 59 | Constipation | FAERS: 5 | SIDER US FAERS | |
| 60 | Drug dispensing error | FAERS: 5 | US FAERS | |
| 61 | Flushing | FAERS: 5 | US FAERS | |
| 62 | Hepatotoxicity | FAERS: 5 | US FAERS | |
| 63 | Immune reconstitution syndrome | FAERS: 5 | US FAERS | |
| 64 | Memory impairment | FAERS: 5 | SIDER US FAERS | |
| 65 | Myopathy | FAERS: 5 | SIDER US FAERS | |
| 66 | Pancreatitis | FAERS: 5 | US FAERS | |
| 67 | Pregnancy | FAERS: 5 | US FAERS | |
| 68 | Sinusitis | FAERS: 5 | US FAERS | |
| 69 | Urticaria | FAERS: 5 | SIDER US FAERS | |
| 70 | Vasculitic rash | FAERS: 5 | US FAERS | |
| 71 | Alopecia | FAERS: 4 | SIDER US FAERS | |
| 72 | Back Pain | FAERS: 4 | SIDER US FAERS | |
| 73 | Drug resistance | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 74 | Eosinophilia | FAERS: 4 | SIDER US FAERS | |
| 75 | Hypersensitivity | FAERS: 4 | SIDER US FAERS | |
| 76 | Inability to afford medication | FAERS: 4 | US FAERS | |
| 77 | Incorrect route of product administration | FAERS: 4 | US FAERS | |
| 78 | Infection | FAERS: 4 | SIDER US FAERS | |
| 79 | Mechanical ventilation | FAERS: 4 | US FAERS | |
| 80 | Myositis | FAERS: 4 | US FAERS | |
| 81 | Syncope | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 82 | Tinnitus | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 83 | Tremor | FAERS: 4 | SIDER US FAERS | |
| 84 | Abdominal Pain | FAERS: 3 | SIDER US FAERS | |
| 85 | Acute Coronary Syndrome | FAERS: 3 | SIDER US FAERS | |
| 86 | Acute kidney injury | FAERS: 3 | US FAERS | |
| 87 | Agitation | FAERS: 3 | SIDER US FAERS | |
| 88 | Blood creatine increased | FAERS: 3 | US FAERS | |
| 89 | Bone pain | FAERS: 3 | US FAERS | |
| 90 | Dry skin | FAERS: 3 | SIDER US FAERS | |
| 91 | Dysgeusia | FAERS: 3 | SIDER US FAERS | |
| 92 | Erythema | FAERS: 3 | SIDER US FAERS | |
| 93 | Incorrect product formulation administered | FAERS: 3 | US FAERS | |
| 94 | Influenza | FAERS: 3 | SIDER US FAERS | |
| 95 | Lymphadenopathy | FAERS: 3 | SIDER US FAERS | |
| 96 | Medication Error | FAERS: 3 | US FAERS | |
| 97 | Medication residue present | FAERS: 3 | US FAERS | |
| 98 | Mental status changes | FAERS: 3 | US FAERS | |
| 99 | Peripheral swelling | FAERS: 3 | US FAERS | |
| 100 | Product availability issue | FAERS: 3 | US FAERS | |
| 101 | Product packaging quantity issue | FAERS: 3 | US FAERS | |
| 102 | Respiratory Failure | FAERS: 3 | US FAERS | |
| 103 | Respiratory distress | FAERS: 3 | US FAERS | |
| 104 | Stevens-Johnson Syndrome | FAERS: 3 | SIDER US FAERS | |
| 105 | Transaminases increased | FAERS: 3 | US FAERS | |
| 106 | Unevaluable event | FAERS: 3 | US FAERS | |
| 107 | White blood cell count decreased | FAERS: 3 | SIDER US FAERS | |
| 108 | nervous system disorder | FAERS: 3 | SIDER US FAERS | |
| 109 | Amaurosis | FAERS: 2 | US FAERS | |
| 110 | Amyotrophic Lateral Sclerosis | FAERS: 2 | US FAERS | |
| 111 | Aortic Aneurysm | FAERS: 2 | US FAERS | |
| 112 | Aphasia | FAERS: 2 | US FAERS | |
| 113 | Aphthous Stomatitis | FAERS: 2 | US FAERS | |
| 114 | Arthritis | FAERS: 2 | SIDER US FAERS | |
| 115 | Back disorder | FAERS: 2 | US FAERS | |
| 116 | Bedridden | FAERS: 2 | US FAERS | |
| 117 | Blood cholesterol increased | FAERS: 2 | SIDER US FAERS | |
| 118 | Blood creatine phosphokinase abnormal | FAERS: 2 | US FAERS | |
| 119 | Blood creatinine increased | FAERS: 2 | SIDER US FAERS | |
| 120 | Blood glucose decreased | FAERS: 2 | US FAERS | |
| 121 | CD4 Lymphocytes Decreased | FAERS: 2 | US FAERS | |
| 122 | Cataract | FAERS: 2 | US FAERS | |
| 123 | Cellulitis | FAERS: 2 | US FAERS | |
| 124 | Chemotherapy | FAERS: 2 | US FAERS | |
| 125 | Chest discomfort | FAERS: 2 | SIDER US FAERS | |
| 126 | Cholelithiasis | FAERS: 2 | US FAERS | |
| 127 | Coccidioidomycosis | FAERS: 2 | US FAERS | |
| 128 | Completed Suicide | FAERS: 2 | SIDER US FAERS | |
| 129 | Deafness Neurosensory | FAERS: 2 | US FAERS | |
| 130 | Dementia | FAERS: 2 | US FAERS | |
| 131 | Depressed mood | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 132 | Diffuse Large B-Cell Lymphoma | FAERS: 2 | US FAERS | |
| 133 | Drug Tolerance | FAERS: 2 | US FAERS | |
| 134 | Drug administered to patient of inappropriate age | FAERS: 2 | US FAERS | |
| 135 | Dyspepsia | FAERS: 2 | SIDER US FAERS | |
| 136 | Epilepsy | FAERS: 2 | US FAERS | |
| 137 | Epistaxis | FAERS: 2 | SIDER US FAERS | |
| 138 | Erectile dysfunction | FAERS: 2 | SIDER US FAERS | |
| 139 | Expired drug administered | FAERS: 2 | US FAERS | |
| 140 | Failure to Thrive | FAERS: 2 | US FAERS | |
| 141 | Flatulence | FAERS: 2 | SIDER US FAERS | |
| 142 | Food craving | FAERS: 2 | US FAERS | |
| 143 | Gastrectomy | FAERS: 2 | US FAERS | |
| 144 | Gastric Bypass | FAERS: 2 | US FAERS | |
| 145 | Hepatitis A | FAERS: 2 | US FAERS | |
| 146 | Hepatitis C | FAERS: 2 | SIDER US FAERS | |
| 147 | Hepatitis | FAERS: 2 | SIDER US FAERS | |
| 148 | Hip surgery | FAERS: 2 | US FAERS | |
| 149 | Hospice Care | FAERS: 2 | US FAERS | |
| 150 | Intentional drug misuse | FAERS: 2 | US FAERS | |
| 151 | Intercepted drug prescribing error | FAERS: 2 | US FAERS | |
| 152 | Intestinal Obstruction | FAERS: 2 | US FAERS | |
| 153 | Joint injury | FAERS: 2 | US FAERS | |
| 154 | Joint swelling | FAERS: 2 | US FAERS | |
| 155 | Lip swelling | FAERS: 2 | US FAERS | |
| 156 | Lipodystrophy acquired | FAERS: 2 | SIDER US FAERS | |
| 157 | Lipoma | FAERS: 2 | US FAERS | |
| 158 | Lower respiratory tract infection | FAERS: 2 | US FAERS | |
| 159 | Malabsorption | FAERS: 2 | US FAERS | |
| 160 | Malignant neoplasm progression | FAERS: 2 | US FAERS | |
| 161 | Medication residue | FAERS: 2 | US FAERS | |
| 162 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 163 | Nephrolithiasis | FAERS: 2 | SIDER US FAERS | |
| 164 | Neutropenia | FAERS: 2 | SIDER US FAERS | |
| 165 | Obesity | FAERS: 2 | US FAERS | |
| 166 | Pathogen resistance | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 167 | Prescribed underdose | FAERS: 2 | US FAERS | |
| 168 | Product physical consistency issue | FAERS: 2 | US FAERS | |
| 169 | Product physical issue | FAERS: 2 | US FAERS | |
| 170 | Product supply issue | FAERS: 2 | US FAERS | |
| 171 | Product taste abnormal | FAERS: 2 | US FAERS | |
| 172 | Pulmonary Hypertension | FAERS: 2 | US FAERS | |
| 173 | Renal pain | FAERS: 2 | US FAERS | |
| 174 | Schizophrenia | FAERS: 2 | US FAERS | |
| 175 | Senile dementia | FAERS: 2 | US FAERS | |
| 176 | Stomatitis | FAERS: 2 | US FAERS | |
| 177 | Suicide attempt | FAERS: 2 | SIDER US FAERS | |
| 178 | Therapy change | FAERS: 2 | US FAERS | |
| 179 | Thrombosis | FAERS: 2 | US FAERS | |
| 180 | Toxoplasmosis | FAERS: 2 | US FAERS | |
| 181 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 182 | Uveitis | FAERS: 2 | US FAERS | |
| 183 | furuncle | FAERS: 2 | US FAERS | |
| 184 | intensive care | FAERS: 2 | US FAERS | |
| 185 | treatment failure | FAERS: 2 | US FAERS | |
| 186 | AIDS Dementia Complex | FAERS: 1 | US FAERS | |
| 187 | Abasia | FAERS: 1 | US FAERS | |
| 188 | Abortion early | FAERS: 1 | US FAERS | |
| 189 | Acne | FAERS: 1 | US FAERS | |
| 190 | Acquired Immunodeficiency Syndrome | FAERS: 1 | SIDER US FAERS | |
| 191 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 192 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 193 | Alcohol withdrawal syndrome | FAERS: 1 | US FAERS | |
| 194 | Alopecia Areata | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 195 | Altered state of consciousness | FAERS: 1 | SIDER US FAERS | |
| 196 | Anal Fistula | FAERS: 1 | US FAERS | |
| 197 | Anger | FAERS: 1 | US FAERS | |
| 198 | Angioedema | FAERS: 1 | US FAERS | |
| 199 | Angiomyolipoma | FAERS: 1 | US FAERS | |
| 200 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 201 | Antipsychotic drug level increased | FAERS: 1 | US FAERS | |
| 202 | Apathy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 203 | Aphagia | FAERS: 1 | US FAERS | |
| 204 | Arthropathy | FAERS: 1 | US FAERS | |
| 205 | Asthma | FAERS: 1 | US FAERS | |
| 206 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 207 | Bacterial sepsis | FAERS: 1 | US FAERS | |
| 208 | Blindness | FAERS: 1 | US FAERS | |
| 209 | Blood HIV RNA | FAERS: 1 | US FAERS | |
| 210 | Blood HIV RNA below assay limit | FAERS: 1 | US FAERS | |
| 211 | Blood bilirubin abnormal | FAERS: 1 | US FAERS | |
| 212 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 213 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 214 | Blood testosterone decreased | FAERS: 1 | US FAERS | |
| 215 | Blood triglycerides abnormal | FAERS: 1 | US FAERS | |
| 216 | Blood triglycerides increased | FAERS: 1 | SIDER US FAERS | |
| 217 | Blood urea increased | FAERS: 1 | SIDER US FAERS | |
| 218 | Bone decalcification | FAERS: 1 | US FAERS | |
| 219 | Breast cancer recurrent | FAERS: 1 | US FAERS | |
| 220 | Bronchitis | FAERS: 1 | SIDER US FAERS | |
| 221 | Burning sensation | FAERS: 1 | US FAERS | |
| 222 | Cachexia | FAERS: 1 | SIDER US FAERS | |
| 223 | Catatonia | FAERS: 1 | US FAERS | |
| 224 | Catheter placement | FAERS: 1 | US FAERS | |
| 225 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 226 | Cerebral ventricle dilatation | FAERS: 1 | US FAERS | |
| 227 | Cheilitis | FAERS: 1 | US FAERS | |
| 228 | Chills | FAERS: 1 | SIDER US FAERS | |
| 229 | Choking | FAERS: 1 | US FAERS | |
| 230 | Cholestasis of pregnancy | FAERS: 1 | US FAERS | |
| 231 | Cholestasis | FAERS: 1 | US FAERS | |
| 232 | Chromaturia | FAERS: 1 | US FAERS | |
| 233 | Chronic sinusitis | FAERS: 1 | US FAERS | |
| 234 | Colitis | FAERS: 1 | US FAERS | |
| 235 | Coma scale abnormal | FAERS: 1 | US FAERS | |
| 236 | Complication associated with device | FAERS: 1 | US FAERS | |
| 237 | Compulsive sexual behaviour | FAERS: 1 | US FAERS | |
| 238 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 239 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 240 | Crushing injury of trunk | FAERS: 1 | US FAERS | |
| 241 | Cytolytic hepatitis | FAERS: 1 | US FAERS | |
| 242 | Deafness | FAERS: 1 | US FAERS | |
| 243 | Dehydration | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 244 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 245 | Diplegia | FAERS: 1 | US FAERS | |
| 246 | Disease Progression | FAERS: 1 | US FAERS | |
| 247 | Disorientation | FAERS: 1 | US FAERS | |
| 248 | Dissociation | FAERS: 1 | US FAERS | |
| 249 | Diverticulitis | FAERS: 1 | US FAERS | |
| 250 | Diverticulum | FAERS: 1 | US FAERS | |
| 251 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 252 | Drug screen positive | FAERS: 1 | US FAERS | |
| 253 | Dysphemia | FAERS: 1 | US FAERS | |
| 254 | Ear discomfort | FAERS: 1 | US FAERS | |
| 255 | Emotional disorder | FAERS: 1 | US FAERS | |
| 256 | Enzyme level increased | FAERS: 1 | US FAERS | |
| 257 | Epigastric discomfort | FAERS: 1 | SIDER US FAERS | |
| 258 | Erythema Nodosum | FAERS: 1 | US FAERS | |
| 259 | Extra dose administered | FAERS: 1 | US FAERS | |
| 260 | Eye pain | FAERS: 1 | US FAERS | |
| 261 | Factor VIII Deficiency | FAERS: 1 | US FAERS | |
| 262 | Fat redistribution | FAERS: 1 | US FAERS | |
| 263 | Feeling Cold | FAERS: 1 | US FAERS | |
| 264 | Flat affect | FAERS: 1 | US FAERS | |
| 265 | Foreign body in respiratory tract | FAERS: 1 | US FAERS | |
| 266 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 267 | Gastric mucosal lesion | FAERS: 1 | US FAERS | |
| 268 | Gastritis | FAERS: 1 | SIDER US FAERS | |
| 269 | Gastrointestinal Pain | FAERS: 1 | SIDER US FAERS | |
| 270 | General symptom | FAERS: 1 | US FAERS | |
| 271 | Gout | FAERS: 1 | US FAERS | |
| 272 | Hallucinations, mixed | FAERS: 1 | US FAERS | |
| 273 | Hepatitis B | FAERS: 1 | SIDER US FAERS | |
| 274 | Hernia | FAERS: 1 | US FAERS | |
| 275 | Histoplasmosis | FAERS: 1 | US FAERS | |
| 276 | Hypotension | FAERS: 1 | US FAERS | |
| 277 | Inadequate aseptic technique in use of product | FAERS: 1 | US FAERS | |
| 278 | Incorrect product dosage form administered | FAERS: 1 | US FAERS | |
| 279 | Infarction | FAERS: 1 | US FAERS | |
| 280 | Injury associated with device | FAERS: 1 | US FAERS | |
| 281 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 282 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 283 | Iron deficiency | FAERS: 1 | US FAERS | |
| 284 | Laryngeal Squamous Cell Carcinoma | FAERS: 1 | US FAERS | |
| 285 | Laryngitis | FAERS: 1 | US FAERS | |
| 286 | Limb discomfort | FAERS: 1 | US FAERS | |
| 287 | Lip and/or oral cavity cancer | FAERS: 1 | US FAERS | |
| 288 | Malnutrition | FAERS: 1 | SIDER US FAERS | |
| 289 | Manufacturing product shipping issue | FAERS: 1 | US FAERS | |
| 290 | Maternal exposure timing unspecified | FAERS: 1 | US FAERS | |
| 291 | Mental Fatigue | FAERS: 1 | US FAERS | |
| 292 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 293 | Middle insomnia | FAERS: 1 | SIDER US FAERS | |
| 294 | Morbid thoughts | FAERS: 1 | US FAERS | |
| 295 | Muscle tightness | FAERS: 1 | US FAERS | |
| 296 | Musculoskeletal Pain | FAERS: 1 | SIDER US FAERS | |
| 297 | Musculoskeletal discomfort | FAERS: 1 | SIDER US FAERS | |
| 298 | Nervousness | FAERS: 1 | SIDER US FAERS | |
| 299 | Neuralgia | FAERS: 1 | US FAERS | |
| 300 | Neuropsychiatric syndrome | FAERS: 1 | US FAERS | |
| 301 | Nodule | FAERS: 1 | US FAERS | |
| 302 | Oligodipsia | FAERS: 1 | US FAERS | |
| 303 | Oncologic complication | FAERS: 1 | US FAERS | |
| 304 | Optic Neuritis | FAERS: 1 | US FAERS | |
| 305 | Optic Neuropathy | FAERS: 1 | US FAERS | |
| 306 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 307 | Oral infection | FAERS: 1 | US FAERS | |
| 308 | Oral pain | FAERS: 1 | US FAERS | |
| 309 | Oropharyngeal pain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 310 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 311 | Palpitations | FAERS: 1 | SIDER US FAERS | |
| 312 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 313 | Pancreatic enlargement | FAERS: 1 | US FAERS | |
| 314 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 315 | Pelvic mass | FAERS: 1 | US FAERS | |
| 316 | Peritonitis | FAERS: 1 | US FAERS | |
| 317 | Physical assault | FAERS: 1 | US FAERS | |
| 318 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 319 | Poor quality product administered | FAERS: 1 | US FAERS | |
| 320 | Poor quality sleep | FAERS: 1 | SIDER US FAERS | |
| 321 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 322 | Prodromal Alzheimer's disease | FAERS: 1 | US FAERS | |
| 323 | Product administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 324 | Product dispensing error | FAERS: 1 | US FAERS | |
| 325 | Product distribution issue | FAERS: 1 | US FAERS | |
| 326 | Product prescribing error | FAERS: 1 | US FAERS | |
| 327 | Product prescribing issue | FAERS: 1 | US FAERS | |
| 328 | Product storage error | FAERS: 1 | US FAERS | |
| 329 | Product substitution error | FAERS: 1 | US FAERS | |
| 330 | Product use complaint | FAERS: 1 | US FAERS | |
| 331 | Productive Cough | FAERS: 1 | US FAERS | |
| 332 | Psoriasis | FAERS: 1 | US FAERS | |
| 333 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 334 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 335 | Sarcoma | FAERS: 1 | US FAERS | |
| 336 | Serotonin Syndrome | FAERS: 1 | US FAERS | |
| 337 | Skin Papilloma | FAERS: 1 | SIDER US FAERS | |
| 338 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 339 | Skin irritation | FAERS: 1 | US FAERS | |
| 340 | Skin lesion | FAERS: 1 | SIDER US FAERS | |
| 341 | Skin reaction | FAERS: 1 | US FAERS | |
| 342 | Stress | FAERS: 1 | US FAERS | |
| 343 | Swelling | FAERS: 1 | US FAERS | |
| 344 | Tachycardia | FAERS: 1 | US FAERS | |
| 345 | Terminal state | FAERS: 1 | US FAERS | |
| 346 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 347 | Thermal burn | FAERS: 1 | US FAERS | |
| 348 | Throat irritation | FAERS: 1 | US FAERS | |
| 349 | Thrombocytopenia | FAERS: 1 | SIDER US FAERS | |
| 350 | Tonsillectomy | FAERS: 1 | US FAERS | |
| 351 | Tooth Extraction | FAERS: 1 | US FAERS | |
| 352 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 353 | Tuberculosis | FAERS: 1 | US FAERS | |
| 354 | Ulcer | FAERS: 1 | US FAERS | |
| 355 | Urge Incontinence | FAERS: 1 | US FAERS | |
| 356 | Vascular bypass dysfunction | FAERS: 1 | US FAERS | |
| 357 | Vertigo | FAERS: 1 | SIDER US FAERS | |
| 358 | Viral load decreased | FAERS: 1 | US FAERS | |
| 359 | Visual Impairment | FAERS: 1 | SIDER US FAERS | |
| 360 | Vulvovaginal pain | FAERS: 1 | US FAERS | |
| 361 | angiogram | FAERS: 1 | US FAERS | |
| 362 | jaundice | FAERS: 1 | US FAERS | |
| 363 | pseudomembranous colitis | FAERS: 1 | US FAERS | |
| 364 | Abdominal tenderness | SIDER | ||
| 365 | Absolute neutrophil count decreased | SIDER | ||
| 366 | Acute psychosis | SIDER | ||
| 367 | Allergic rash | SIDER | ||
| 368 | Amylase increased | SIDER | ||
| 369 | Anorectal discomfort | SIDER | ||
| 370 | Blood albumin decreased | SIDER | ||
| 371 | Blood alkaline phosphatase increased | SIDER | ||
| 372 | Blood amylase increased | SIDER | ||
| 373 | Blood and lymphatic system disorders | SIDER | ||
| 374 | Blood pancreatic amylase increased | SIDER | ||
| 375 | Blood urine present | SIDER | ||
| 376 | Body fat disorder | SIDER | ||
| 377 | Carpal Tunnel Syndrome | SIDER | ||
| 378 | Cerebellar Ataxia | SIDER | ||
| 379 | Creatine Phosphokinase Increased | SIDER | ||
| 380 | Cyst | SIDER | ||
| 381 | Delirium | SIDER | ||
| 382 | Depressed Level of Consciousness | SIDER | ||
| 383 | Dermatitis acneiform | SIDER | ||
| 384 | Dermatitis | SIDER | ||
| 385 | Discomfort | SIDER | ||
| 386 | Dysphonia | SIDER | ||
| 387 | Ear and labyrinth disorders | SIDER | ||
| 388 | Eructation | SIDER | ||
| 389 | Erythema Multiforme | SIDER | ||
| 390 | Facial wasting | SIDER | ||
| 391 | Fasting blood glucose increased | SIDER | ||
| 392 | Fasting | SIDER | ||
| 393 | Feeling jittery | SIDER | ||
| 394 | Flank Pain | SIDER | ||
| 395 | Folliculitis | SIDER | ||
| 396 | Gastroenteritis | SIDER | ||
| 397 | Genital Herpes | SIDER | ||
| 398 | Gingivitis | SIDER | ||
| 399 | Glossitis | SIDER | ||
| 400 | Glycosuria | SIDER | ||
| 401 | High density lipoprotein increased | SIDER | ||
| 402 | Hyperphagia | SIDER | ||
| 403 | Hypersomnia | SIDER | ||
| 404 | Inappropriate schedule of product administration | Canada Vigilance: 1 | Canada Vigilance | |
| 405 | Infestation | SIDER | ||
| 406 | Inflammation | SIDER | ||
| 407 | Intentional product misuse | Canada Vigilance: 2 | Canada Vigilance | |
| 408 | Lethargy | SIDER | ||
| 409 | Lipase increased | SIDER | ||
| 410 | Lipoatrophy | SIDER | ||
| 411 | Lipohypertrophy | SIDER | ||
| 412 | Low density lipoprotein increased | SIDER | ||
| 413 | Lymph node abscess | SIDER | ||
| 414 | Malaria | Canada Vigilance: 1 | Canada Vigilance | |
| 415 | Molluscum Contagiosum | SIDER | ||
| 416 | Mood swings | SIDER | ||
| 417 | Neck Pain | SIDER | ||
| 418 | Nephritis | SIDER | ||
| 419 | Neutrophil count decreased | SIDER | ||
| 420 | Night sweats | SIDER | ||
| 421 | Nocturia | SIDER | ||
| 422 | Osteopenia | SIDER | ||
| 423 | Osteoporosis | SIDER | ||
| 424 | Pancreatectomy | Canada Vigilance: 1 | Canada Vigilance | |
| 425 | Peptic Ulcer | SIDER | ||
| 426 | Polyarthritis | SIDER | ||
| 427 | Polydipsia | SIDER | ||
| 428 | Prurigo | SIDER | ||
| 429 | Renal cyst | SIDER | ||
| 430 | Renal tubular necrosis | SIDER | ||
| 431 | Sinus bradycardia | SIDER | ||
| 432 | Sinus pain | Canada Vigilance: 1 | Canada Vigilance | |
| 433 | Squamous cell carcinoma | SIDER | ||
| 434 | Submandibular mass | SIDER | ||
| 435 | Tension Headache | SIDER | ||
| 436 | Waist circumference increased | SIDER | ||
| 437 | Xeroderma | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.