obeticholic acid
(ZXERDUOLZKYMJM-ZWECCWDJSA-N)
Structure
- SMILES
- CC[C@H]1[C@@H](O)[C@H]2[C@@H]3CC[C@@H]([C@@]3(C)CC[C@@H]2[C@@]2([C@H]1C[C@H](O)CC2)C)[C@@H](CCC(=O)O)C
- Type(s)
- Approved
- ATC code(s)
- A05AA04
- Molecular Formula:
- C26H44O4
- Molecular Weight:
- 420.625
- Log P:
- 5.1140
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 3
- TPSA:
- 77.76
- CAS Number(s):
- 459789-99-2
Synonym(s)
1.
obeticholic acid
2.
6-ECDCA
3.
6-ethyl chenodeoxycholic acid
4.
6-ethyl-3,7-dihydroxycholan-24-oic acid
5.
6-ethylchenodeoxycholic acid
6.
6ECDCA
7.
6alpha-ethyl-3alpha,7alpha-dihydroxy-5beta-cholan-24-oic acid
8.
6alpha-ethyl-chenodeoxycholic acid
9.
DSP-1747
10.
DSP1747
11.
INT 747
12.
INT-747
13.
INT747
14.
Ocaliva
15.
cholan-24-oic acid, 6-ethyl-3,7-dihydroxy-, (3alpha,5beta,6alpha,7alpha)-
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Pruritus | FAERS: 936 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 2 | Fatigue | FAERS: 308 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Drug ineffective | FAERS: 112 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 4 | Arthralgia | FAERS: 108 | US FAERS | |
| 5 | Nausea | FAERS: 98 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 6 | Constipation | FAERS: 97 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Drug dose omission | FAERS: 88 | US FAERS | |
| 8 | Dizziness | FAERS: 78 | US FAERS | |
| 9 | Blood alkaline phosphatase increased | FAERS: 63 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 10 | Malaise | FAERS: 61 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 11 | Headache | FAERS: 45 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Asthenia | FAERS: 40 | US FAERS | |
| 13 | Abdominal Pain | FAERS: 38 | US FAERS | |
| 14 | Vomiting | FAERS: 38 | US FAERS | |
| 15 | Product dose omission | FAERS: 37 | US FAERS | |
| 16 | Peripheral swelling | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | Abdominal discomfort | FAERS: 32 | US FAERS | |
| 18 | Alopecia | FAERS: 31 | US FAERS | |
| 19 | Pain | FAERS: 30 | US FAERS | |
| 20 | Dry skin | FAERS: 29 | US FAERS | |
| 21 | Back Pain | FAERS: 28 | US FAERS | |
| 22 | Hypersensitivity | FAERS: 28 | US FAERS | |
| 23 | Somnolence | FAERS: 28 | US FAERS | |
| 24 | Weight decreased | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 25 | Feeling abnormal | FAERS: 23 | US FAERS | |
| 26 | Influenza | FAERS: 23 | US FAERS | |
| 27 | Urticaria | FAERS: 21 | US FAERS | |
| 28 | Oropharyngeal pain | FAERS: 20 | US FAERS | |
| 29 | Myalgia | FAERS: 19 | US FAERS | |
| 30 | Pneumonia | FAERS: 18 | US FAERS | |
| 31 | Blood cholesterol increased | FAERS: 17 | US FAERS | |
| 32 | Memory impairment | FAERS: 17 | US FAERS | |
| 33 | Ascites | FAERS: 16 | US FAERS | |
| 34 | Swelling | FAERS: 16 | US FAERS | |
| 35 | Palpitations | FAERS: 15 | US FAERS | |
| 36 | Therapy cessation | FAERS: 15 | US FAERS | |
| 37 | jaundice | FAERS: 15 | US FAERS | |
| 38 | Disease Progression | FAERS: 14 | US FAERS | |
| 39 | Urinary tract infection | FAERS: 14 | US FAERS | |
| 40 | Joint swelling | FAERS: 13 | US FAERS | |
| 41 | Nasopharyngitis | FAERS: 13 | US FAERS | |
| 42 | Tremor | FAERS: 13 | US FAERS | |
| 43 | Chromaturia | FAERS: 12 | US FAERS | |
| 44 | Anxiety | FAERS: 11 | US FAERS | |
| 45 | Bone pain | FAERS: 11 | US FAERS | |
| 46 | Sinusitis | FAERS: 11 | US FAERS | |
| 47 | Blood alkaline phosphatase abnormal | FAERS: 10 | US FAERS | |
| 48 | Dysgeusia | FAERS: 10 | US FAERS | |
| 49 | Product prescribing error | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 50 | Eczema | FAERS: 9 | US FAERS | |
| 51 | Erythema | FAERS: 9 | US FAERS | |
| 52 | Night sweats | FAERS: 9 | US FAERS | |
| 53 | Adverse event | FAERS: 8 | US FAERS | |
| 54 | Chest Pain | FAERS: 8 | US FAERS | |
| 55 | Hepatic Encephalopathy | FAERS: 8 | US FAERS | |
| 56 | Dehydration | FAERS: 7 | US FAERS | |
| 57 | Epistaxis | FAERS: 7 | US FAERS | |
| 58 | Ocular icterus | FAERS: 7 | US FAERS | |
| 59 | Arthritis | FAERS: 6 | US FAERS | |
| 60 | Chills | FAERS: 6 | US FAERS | |
| 61 | Depressed mood | FAERS: 6 | US FAERS | |
| 62 | Dyspepsia | FAERS: 6 | US FAERS | |
| 63 | Flatulence | FAERS: 6 | US FAERS | |
| 64 | Infection | FAERS: 6 | US FAERS | |
| 65 | Nervousness | FAERS: 6 | US FAERS | |
| 66 | Portal Hypertension | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 67 | Product use in unapproved indication | FAERS: 6 | US FAERS | |
| 68 | Therapy non-responder | FAERS: 6 | US FAERS | |
| 69 | Atrial Fibrillation | FAERS: 5 | US FAERS | |
| 70 | Cerebrovascular accident | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 71 | Drug prescribing error | FAERS: 5 | US FAERS | |
| 72 | Flank Pain | FAERS: 5 | US FAERS | |
| 73 | General physical health deterioration | FAERS: 5 | US FAERS | |
| 74 | Hypotension | FAERS: 5 | US FAERS | |
| 75 | Loss of personal independence in daily activities | FAERS: 5 | US FAERS | |
| 76 | Medication Error | FAERS: 5 | US FAERS | |
| 77 | Meniscus injury | FAERS: 5 | US FAERS | |
| 78 | Mood swings | FAERS: 5 | US FAERS | |
| 79 | Myocardial Infarction | FAERS: 5 | US FAERS | |
| 80 | Scab | FAERS: 5 | US FAERS | |
| 81 | Throat irritation | FAERS: 5 | US FAERS | |
| 82 | Blood glucose increased | FAERS: 4 | US FAERS | |
| 83 | Burning sensation | FAERS: 4 | US FAERS | |
| 84 | Chest discomfort | FAERS: 4 | US FAERS | |
| 85 | Cyst | FAERS: 4 | US FAERS | |
| 86 | Feeling jittery | FAERS: 4 | US FAERS | |
| 87 | Fluid overload | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 88 | Inappropriate schedule of drug administration | FAERS: 4 | US FAERS | |
| 89 | Irritable Bowel Syndrome | FAERS: 4 | US FAERS | |
| 90 | Limb injury | FAERS: 4 | US FAERS | |
| 91 | Pain of skin | FAERS: 4 | US FAERS | |
| 92 | Product use issue | FAERS: 4 | US FAERS | |
| 93 | Skin Ulcer | FAERS: 4 | US FAERS | |
| 94 | Wrong technique in product usage process | FAERS: 4 | US FAERS | |
| 95 | Acne | FAERS: 3 | US FAERS | |
| 96 | Ammonia increased | FAERS: 3 | US FAERS | |
| 97 | Bladder pain | FAERS: 3 | US FAERS | |
| 98 | Blood iron decreased | FAERS: 3 | US FAERS | |
| 99 | Bowel movement irregularity | FAERS: 3 | US FAERS | |
| 100 | Bronchitis | FAERS: 3 | US FAERS | |
| 101 | Cardiac Arrest | FAERS: 3 | US FAERS | |
| 102 | Concomitant disease progression | FAERS: 3 | US FAERS | |
| 103 | Dysphonia | FAERS: 3 | US FAERS | |
| 104 | Hepatorenal Syndrome | FAERS: 3 | US FAERS | |
| 105 | Incorrect dose administered | FAERS: 3 | US FAERS | |
| 106 | Intentional product misuse | FAERS: 3 | US FAERS | |
| 107 | Lethargy | FAERS: 3 | US FAERS | |
| 108 | Low density lipoprotein increased | FAERS: 3 | US FAERS | |
| 109 | Model for end stage liver disease score increased | FAERS: 3 | US FAERS | |
| 110 | Neck Pain | FAERS: 3 | US FAERS | |
| 111 | Onychoclasis | FAERS: 3 | US FAERS | |
| 112 | Presyncope | FAERS: 3 | US FAERS | |
| 113 | Salt craving | FAERS: 3 | US FAERS | |
| 114 | Sepsis | FAERS: 3 | US FAERS | |
| 115 | Splenomegaly | FAERS: 3 | US FAERS | |
| 116 | Stomatitis | FAERS: 3 | US FAERS | |
| 117 | Unevaluable event | FAERS: 3 | US FAERS | |
| 118 | White blood cell count decreased | FAERS: 3 | US FAERS | |
| 119 | skin abrasion | FAERS: 3 | US FAERS | |
| 120 | Alanine Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 121 | Amnesia | FAERS: 2 | US FAERS | |
| 122 | Aneurysm | FAERS: 2 | US FAERS | |
| 123 | Anorectal discomfort | FAERS: 2 | US FAERS | |
| 124 | Aphasia | FAERS: 2 | US FAERS | |
| 125 | Arthropathy | FAERS: 2 | US FAERS | |
| 126 | Bile Duct Stenosis | FAERS: 2 | US FAERS | |
| 127 | Bladder discomfort | FAERS: 2 | US FAERS | |
| 128 | Blood albumin decreased | FAERS: 2 | US FAERS | |
| 129 | Blood cholesterol abnormal | FAERS: 2 | US FAERS | |
| 130 | Blood thyroid stimulating hormone decreased | FAERS: 2 | US FAERS | |
| 131 | Blood urine present | FAERS: 2 | US FAERS | |
| 132 | Breast cancer recurrent | FAERS: 2 | US FAERS | |
| 133 | Cholelithiasis | FAERS: 2 | US FAERS | |
| 134 | Clostridium difficile infection | FAERS: 2 | US FAERS | |
| 135 | Cold sweat | FAERS: 2 | US FAERS | |
| 136 | Colitis | FAERS: 2 | 21242261 | CTD US FAERS |
| 137 | Deep Vein Thrombosis | FAERS: 2 | US FAERS | |
| 138 | Dental caries | FAERS: 2 | US FAERS | |
| 139 | Discomfort | FAERS: 2 | US FAERS | |
| 140 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 141 | Ear discomfort | FAERS: 2 | US FAERS | |
| 142 | Emergency Care | FAERS: 2 | US FAERS | |
| 143 | Emotional disorder | FAERS: 2 | US FAERS | |
| 144 | Fibromyalgia | FAERS: 2 | US FAERS | |
| 145 | Gastritis | FAERS: 2 | US FAERS | |
| 146 | Gastrointestinal sounds abnormal | FAERS: 2 | US FAERS | |
| 147 | Genital Herpes | FAERS: 2 | US FAERS | |
| 148 | Head discomfort | FAERS: 2 | US FAERS | |
| 149 | Hepatitis | FAERS: 2 | US FAERS | |
| 150 | Hypothyroidism | FAERS: 2 | US FAERS | |
| 151 | Hysterectomy | FAERS: 2 | US FAERS | |
| 152 | Immunosuppressant drug level increased | FAERS: 2 | US FAERS | |
| 153 | Impaired work ability | FAERS: 2 | US FAERS | |
| 154 | Initial insomnia | FAERS: 2 | US FAERS | |
| 155 | Intervertebral disc disorder | FAERS: 2 | US FAERS | |
| 156 | Intestinal Obstruction | FAERS: 2 | US FAERS | |
| 157 | Intra-abdominal fluid collection | FAERS: 2 | US FAERS | |
| 158 | Lip swelling | FAERS: 2 | US FAERS | |
| 159 | Liver transplant rejection | FAERS: 2 | US FAERS | |
| 160 | Lyme Disease | FAERS: 2 | US FAERS | |
| 161 | Macular degeneration | FAERS: 2 | US FAERS | |
| 162 | Musculoskeletal Pain | FAERS: 2 | US FAERS | |
| 163 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 164 | Obstruction | FAERS: 2 | US FAERS | |
| 165 | Oral mucosal eruption | FAERS: 2 | US FAERS | |
| 166 | Oral pain | FAERS: 2 | US FAERS | |
| 167 | Overdose | FAERS: 2 | US FAERS | |
| 168 | Productive Cough | FAERS: 2 | US FAERS | |
| 169 | Psoriasis | FAERS: 2 | US FAERS | |
| 170 | Pulmonary Embolism | FAERS: 2 | US FAERS | |
| 171 | Pulmonary congestion | FAERS: 2 | US FAERS | |
| 172 | Rash erythematous | FAERS: 2 | US FAERS | |
| 173 | Retching | FAERS: 2 | US FAERS | |
| 174 | Rheumatoid Arthritis | FAERS: 2 | US FAERS | |
| 175 | Septic Shock | FAERS: 2 | US FAERS | |
| 176 | Skin reaction | FAERS: 2 | US FAERS | |
| 177 | Sneezing | FAERS: 2 | US FAERS | |
| 178 | Stress | FAERS: 2 | US FAERS | |
| 179 | Sunburn | FAERS: 2 | US FAERS | |
| 180 | Syncope | FAERS: 2 | US FAERS | |
| 181 | Tongue discomfort | FAERS: 2 | US FAERS | |
| 182 | Trigeminal Neuralgia | FAERS: 2 | US FAERS | |
| 183 | Urinary Retention | FAERS: 2 | US FAERS | |
| 184 | Vertigo | FAERS: 2 | US FAERS | |
| 185 | Vulvovaginal burning sensation | FAERS: 2 | US FAERS | |
| 186 | Vulvovaginal pruritus | FAERS: 2 | US FAERS | |
| 187 | Wheezing | FAERS: 2 | US FAERS | |
| 188 | muscle injury | FAERS: 2 | US FAERS | |
| 189 | Abdominal Compartment Syndrome | FAERS: 1 | US FAERS | |
| 190 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 191 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 192 | Anal infection | FAERS: 1 | US FAERS | |
| 193 | Apathy | FAERS: 1 | US FAERS | |
| 194 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 195 | Asthenopia | FAERS: 1 | US FAERS | |
| 196 | Asthma | FAERS: 1 | US FAERS | |
| 197 | Astigmatism | FAERS: 1 | US FAERS | |
| 198 | Aura | FAERS: 1 | US FAERS | |
| 199 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 200 | Bacterial test positive | FAERS: 1 | US FAERS | |
| 201 | Bedridden | FAERS: 1 | US FAERS | |
| 202 | Biliary Colic | FAERS: 1 | US FAERS | |
| 203 | Biopsy | FAERS: 1 | US FAERS | |
| 204 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 205 | Blood parathyroid hormone abnormal | FAERS: 1 | US FAERS | |
| 206 | Blood phosphorus increased | FAERS: 1 | US FAERS | |
| 207 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 208 | Blood thyroid stimulating hormone increased | FAERS: 1 | US FAERS | |
| 209 | CREST Syndrome | FAERS: 1 | US FAERS | |
| 210 | Cachexia | FAERS: 1 | US FAERS | |
| 211 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 212 | Cataract | FAERS: 1 | US FAERS | |
| 213 | Child-Pugh-Turcotte score increased | FAERS: 1 | US FAERS | |
| 214 | Compression fracture | FAERS: 1 | US FAERS | |
| 215 | Corneal erosion | FAERS: 1 | US FAERS | |
| 216 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 217 | Crying | FAERS: 1 | US FAERS | |
| 218 | Cystitis | FAERS: 1 | US FAERS | |
| 219 | Deafness | FAERS: 1 | US FAERS | |
| 220 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 221 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 222 | Disorientation | FAERS: 1 | US FAERS | |
| 223 | Diverticulitis | FAERS: 1 | US FAERS | |
| 224 | Drug administration error | FAERS: 1 | US FAERS | |
| 225 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 226 | Dysarthria | FAERS: 1 | US FAERS | |
| 227 | Ecchymosis | FAERS: 1 | US FAERS | |
| 228 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 229 | Eosinophilia | FAERS: 1 | US FAERS | |
| 230 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 231 | Eructation | FAERS: 1 | US FAERS | |
| 232 | Exfoliative rash | FAERS: 1 | US FAERS | |
| 233 | Eye Infection | FAERS: 1 | US FAERS | |
| 234 | Feeling Cold | FAERS: 1 | US FAERS | |
| 235 | Food Poisoning | FAERS: 1 | US FAERS | |
| 236 | Formication | FAERS: 1 | US FAERS | |
| 237 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 238 | Gamma-glutamyltransferase abnormal | FAERS: 1 | US FAERS | |
| 239 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 240 | Gastroenteritis norovirus | FAERS: 1 | US FAERS | |
| 241 | Glossitis | FAERS: 1 | US FAERS | |
| 242 | Hair injury | FAERS: 1 | US FAERS | |
| 243 | Head titubation | FAERS: 1 | US FAERS | |
| 244 | Hepatic fibrosis marker increased | FAERS: 1 | US FAERS | |
| 245 | Hernia | FAERS: 1 | US FAERS | |
| 246 | Hip surgery | FAERS: 1 | US FAERS | |
| 247 | Hordeolum | FAERS: 1 | US FAERS | |
| 248 | Hormone level abnormal | FAERS: 1 | US FAERS | |
| 249 | Hospice Care | FAERS: 1 | US FAERS | |
| 250 | Hunger | FAERS: 1 | US FAERS | |
| 251 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 252 | Hypersomnia | FAERS: 1 | US FAERS | |
| 253 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 254 | Hypo HDL cholesterolaemia | FAERS: 1 | US FAERS | |
| 255 | Hypoxia | FAERS: 1 | US FAERS | |
| 256 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 257 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 258 | Inflammation | FAERS: 1 | 29660435 | CTD US FAERS |
| 259 | Insurance issue | FAERS: 1 | US FAERS | |
| 260 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 261 | Joint injury | FAERS: 1 | US FAERS | |
| 262 | Joint stiffness | FAERS: 1 | US FAERS | |
| 263 | Laceration | FAERS: 1 | US FAERS | |
| 264 | Lipids abnormal | FAERS: 1 | US FAERS | |
| 265 | Lymphadenitis | FAERS: 1 | US FAERS | |
| 266 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 267 | Lymphoma | FAERS: 1 | US FAERS | |
| 268 | Macule | FAERS: 1 | US FAERS | |
| 269 | Malnutrition | FAERS: 1 | US FAERS | |
| 270 | Mental impairment | FAERS: 1 | US FAERS | |
| 271 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 272 | Middle insomnia | FAERS: 1 | US FAERS | |
| 273 | Monoplegia | FAERS: 1 | US FAERS | |
| 274 | Mouth swelling | FAERS: 1 | US FAERS | |
| 275 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 276 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 277 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 278 | Nail bed disorder | FAERS: 1 | US FAERS | |
| 279 | Neuralgia | FAERS: 1 | US FAERS | |
| 280 | Oliguria | FAERS: 1 | US FAERS | |
| 281 | Overlap syndrome | FAERS: 1 | US FAERS | |
| 282 | Oxygen saturation abnormal | FAERS: 1 | US FAERS | |
| 283 | Pancreatitis | FAERS: 1 | US FAERS | |
| 284 | Pelvic discomfort | FAERS: 1 | US FAERS | |
| 285 | Peptic Ulcer | FAERS: 1 | US FAERS | |
| 286 | Perioral Dermatitis | FAERS: 1 | US FAERS | |
| 287 | Platelet count abnormal | FAERS: 1 | US FAERS | |
| 288 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 289 | Post procedural complication | FAERS: 1 | US FAERS | |
| 290 | Post procedural infection | FAERS: 1 | US FAERS | |
| 291 | Primary Biliary Cholangitis | FAERS: 1 | US FAERS | |
| 292 | Product administration error | FAERS: 1 | US FAERS | |
| 293 | Product communication issue | FAERS: 1 | US FAERS | |
| 294 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 295 | Rectal Prolapse | FAERS: 1 | US FAERS | |
| 296 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 297 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 298 | Sciatica | FAERS: 1 | US FAERS | |
| 299 | Sinus headache | FAERS: 1 | US FAERS | |
| 300 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 301 | Skin discomfort | FAERS: 1 | US FAERS | |
| 302 | Skin lesion | FAERS: 1 | US FAERS | |
| 303 | Sluggishness | FAERS: 1 | US FAERS | |
| 304 | Solar lentigo | FAERS: 1 | US FAERS | |
| 305 | Spondylitis | FAERS: 1 | US FAERS | |
| 306 | Strangulated hernia | FAERS: 1 | US FAERS | |
| 307 | Subacute hepatic failure | FAERS: 1 | US FAERS | |
| 308 | Sudden onset of sleep | FAERS: 1 | US FAERS | |
| 309 | Temperature regulation disorder | FAERS: 1 | US FAERS | |
| 310 | Therapy change | FAERS: 1 | US FAERS | |
| 311 | Thirst | FAERS: 1 | US FAERS | |
| 312 | Thrombosis | FAERS: 1 | US FAERS | |
| 313 | Toothache | FAERS: 1 | US FAERS | |
| 314 | Transaminases increased | FAERS: 1 | US FAERS | |
| 315 | Transplant | FAERS: 1 | US FAERS | |
| 316 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 317 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 318 | Urticarial vasculitis | FAERS: 1 | US FAERS | |
| 319 | Visual Impairment | FAERS: 1 | US FAERS | |
| 320 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 321 | Vulvovaginal discomfort | FAERS: 1 | US FAERS | |
| 322 | Vulvovaginal dryness | FAERS: 1 | US FAERS | |
| 323 | Wrong dose | FAERS: 1 | US FAERS | |
| 324 | colonoscopy | FAERS: 1 | US FAERS | |
| 325 | furuncle | FAERS: 1 | US FAERS | |
| 326 | Albuminuria | 26655953 | CTD | |
| 327 | Chemical and Drug Induced Liver Injury | 29660435 30745416 | CTD | |
| 328 | Cholangitis | 31299240 | CTD | |
| 329 | Cholestasis | 29660435 | CTD | |
| 330 | Fatty Liver | 26655953 | CTD | |
| 331 | Fibrosis | 26655953 | CTD | |
| 332 | Hemorrhage | 21242261 | CTD | |
| 333 | Hepatitis, Animal | 30745416 | CTD | |
| 334 | Hepatomegaly | 27865854 | CTD | |
| 335 | Liver Cirrhosis, Experimental | 15860571 15980055 | CTD | |
| 336 | Liver Cirrhosis | 30745416 | CTD | |
| 337 | Massive Hepatic Necrosis | 29660435 | CTD | |
| 338 | Necrosis | 27865854 | CTD | |
| 339 | Non-alcoholic Fatty Liver Disease | 30745416 | CTD | |
| 340 | Renal Insufficiency | 26655953 | CTD | |
| 341 | Ulcer | 21242261 | CTD | |
| 342 | Weight Gain | 26655953 30745416 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120238
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.