Iopamidol
(XQZXYNRDCRIARQ-LURJTMIESA-N)
Structure
- SMILES
- OCC(NC(=O)c1c(I)c(C(=O)NC(CO)CO)c(c(c1I)NC(=O)[C@@H](O)C)I)CO
- Type(s)
- Approved
- ATC code(s)
- V08AB04
- Molecular Formula:
- C17H22I3N3O8
- Molecular Weight:
- 777.085
- Log P:
- -0.1595
- Hydrogen Bond Acceptor:
- 11
- Hydrogen Bond Donor:
- 8
- TPSA:
- 188.45
- CAS Number(s):
- 60166-93-0; 62883-00-5
Synonym(s)
1.
Iopamidol
2.
B-15,000
3.
B-15000
4.
Gastromiro
5.
Iopamidol, (+-)-Isomer
6.
Iopamidol, (R)-Isomer
7.
Iopamidol, Sodium Salt, (S)-Isomer
8.
Iopamiro
9.
Isovue
10.
Isovue 370
11.
Jopamidol
12.
Niopam
13.
SQ 13,396
14.
Solutrast
15.
Solutrast 370
16.
Solutrast Gastro
17.
B 15,000
18.
B 15000
19.
B15,000
20.
B15000
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Urticaria | FAERS: 133 Canada Vigilance: 492 | 2923308 16163047 | CTD SIDER Canada Vigilance US FAERS |
| 2 | Hypersensitivity | FAERS: 112 Canada Vigilance: 22 | Canada Vigilance US FAERS | |
| 3 | Nausea | FAERS: 105 Canada Vigilance: 42 | CTD OFFSIDES SIDER Canada Vigilance US FAERS | |
| 4 | Vomiting | FAERS: 105 Canada Vigilance: 48 | 1889431 2916435 17101256 | CTD SIDER Canada Vigilance US FAERS |
| 5 | Pruritus | FAERS: 103 Canada Vigilance: 190 | Canada Vigilance SIDER US FAERS | |
| 6 | Contrast media reaction | FAERS: 101 Canada Vigilance: 15 | Canada Vigilance SIDER US FAERS | |
| 7 | Anaphylactic shock | FAERS: 68 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 8 | No adverse event | FAERS: 68 | US FAERS | |
| 9 | Maternal exposure during pregnancy | FAERS: 58 | US FAERS | |
| 10 | Erythema | FAERS: 55 Canada Vigilance: 66 | Canada Vigilance US FAERS | |
| 11 | Extravasation | FAERS: 49 | SIDER US FAERS | |
| 12 | Sneezing | FAERS: 49 Canada Vigilance: 71 | Canada Vigilance SIDER US FAERS | |
| 13 | Cardiac Arrest | FAERS: 46 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 14 | Flushing | FAERS: 45 Canada Vigilance: 15 | Canada Vigilance SIDER US FAERS | |
| 15 | Anaphylactoid Reaction | FAERS: 44 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 16 | Product physical issue | FAERS: 41 | US FAERS | |
| 17 | Depressed Level of Consciousness | FAERS: 39 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 18 | Shock | FAERS: 37 | SIDER US FAERS | |
| 19 | Throat irritation | FAERS: 35 Canada Vigilance: 32 | Canada Vigilance US FAERS | |
| 20 | Headache | FAERS: 32 Canada Vigilance: 3 | 1410326 2670034 3545637 | CTD SIDER Canada Vigilance US FAERS |
| 21 | Hypotension | FAERS: 32 Canada Vigilance: 2 | 2923308 | CTD SIDER Canada Vigilance US FAERS |
| 22 | Acute kidney injury | FAERS: 31 | CTD US FAERS | |
| 23 | Chest discomfort | FAERS: 31 Canada Vigilance: 20 | Canada Vigilance SIDER US FAERS | |
| 24 | Dizziness | FAERS: 31 Canada Vigilance: 13 | 1410326 2670034 | CTD SIDER Canada Vigilance US FAERS |
| 25 | Chest Pain | FAERS: 27 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 26 | Chills | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 27 | Cyanosis | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 28 | Respiratory arrest | FAERS: 26 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 29 | Feeling abnormal | FAERS: 24 | OFFSIDES SIDER US FAERS | |
| 30 | Asthenia | FAERS: 21 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 31 | Unresponsive to stimuli | FAERS: 21 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 32 | Contrast media allergy | FAERS: 20 Canada Vigilance: 6 | Canada Vigilance OFFSIDES US FAERS | |
| 33 | Injection site extravasation | FAERS: 20 | US FAERS | |
| 34 | Poor quality drug administered | FAERS: 20 | US FAERS | |
| 35 | Tremor | FAERS: 20 Canada Vigilance: 9 | Canada Vigilance SIDER US FAERS | |
| 36 | Infusion Site Extravasation | FAERS: 19 | US FAERS | |
| 37 | Malaise | FAERS: 19 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 38 | Bronchospasm | FAERS: 18 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 39 | Angioedema | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 40 | Tachycardia | FAERS: 17 | 1889431 2923308 | CTD SIDER US FAERS |
| 41 | Cerebral Infarction | FAERS: 14 | US FAERS | |
| 42 | Pain | FAERS: 14 Canada Vigilance: 1 | 3198369 7496696 16163047 | CTD SIDER Canada Vigilance US FAERS |
| 43 | Post procedural complication | FAERS: 14 | US FAERS | |
| 44 | Respiratory Failure | FAERS: 14 | US FAERS | |
| 45 | Wheezing | FAERS: 14 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 46 | Procedural complication | FAERS: 13 | OFFSIDES US FAERS | |
| 47 | Drug administration error | FAERS: 12 | US FAERS | |
| 48 | Drug ineffective | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 49 | Dysphonia | FAERS: 12 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 50 | Product quality issue | FAERS: 12 | US FAERS | |
| 51 | Aphasia | FAERS: 11 | SIDER US FAERS | |
| 52 | Cerebrovascular accident | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 53 | Abdominal Pain | FAERS: 10 | SIDER US FAERS | |
| 54 | Anxiety | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 55 | Contrast encephalopathy | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 56 | Pallor | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 57 | Palpitations | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 58 | Somnolence | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 59 | Syncope | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 60 | Agitation | FAERS: 9 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 61 | Back Pain | FAERS: 9 | SIDER US FAERS | |
| 62 | Foaming at mouth | FAERS: 9 | US FAERS | |
| 63 | Incorrect route of drug administration | FAERS: 9 | US FAERS | |
| 64 | Respiratory distress | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 65 | Swelling | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 66 | Urinary Incontinence | FAERS: 9 | US FAERS | |
| 67 | Acute myocardial infarction | FAERS: 8 | US FAERS | |
| 68 | Amnesia | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 69 | Atrial Fibrillation | FAERS: 8 | US FAERS | |
| 70 | Blood creatinine increased | FAERS: 8 | OFFSIDES US FAERS | |
| 71 | Bradycardia | FAERS: 8 | 1889431 2742326 17101256 | CTD SIDER US FAERS |
| 72 | Burning sensation | FAERS: 8 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 73 | Hemiparesis | FAERS: 8 | OFFSIDES US FAERS | |
| 74 | Accidental exposure to product | FAERS: 7 | US FAERS | |
| 75 | Blood pressure immeasurable | FAERS: 7 | OFFSIDES US FAERS | |
| 76 | Eye irritation | FAERS: 7 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 77 | Hemiplegia | FAERS: 7 | OFFSIDES US FAERS | |
| 78 | Injection site pain | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 79 | Medication Error | FAERS: 7 | US FAERS | |
| 80 | Unevaluable event | FAERS: 7 | US FAERS | |
| 81 | Cold sweat | FAERS: 6 | US FAERS | |
| 82 | Multiple use of single-use product | FAERS: 6 | US FAERS | |
| 83 | Mydriasis | FAERS: 6 | US FAERS | |
| 84 | Pharmaceutical product complaint | FAERS: 6 | US FAERS | |
| 85 | Product deposit | FAERS: 6 | US FAERS | |
| 86 | Pulmonary Embolism | FAERS: 6 | US FAERS | |
| 87 | Stevens-Johnson Syndrome | FAERS: 6 | OFFSIDES US FAERS | |
| 88 | Acidosis | FAERS: 5 | OFFSIDES US FAERS | |
| 89 | Arthralgia | FAERS: 5 | US FAERS | |
| 90 | Blood blister | FAERS: 5 | OFFSIDES US FAERS | |
| 91 | Disorientation | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 92 | Disseminated Intravascular Coagulation | FAERS: 5 | OFFSIDES US FAERS | |
| 93 | Extra dose administered | FAERS: 5 | US FAERS | |
| 94 | Eye pain | FAERS: 5 | US FAERS | |
| 95 | Fatigue | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 96 | Lethargy | FAERS: 5 | OFFSIDES US FAERS | |
| 97 | Memory impairment | FAERS: 5 | US FAERS | |
| 98 | Myocardial Infarction | FAERS: 5 | SIDER US FAERS | |
| 99 | Oral pruritus | FAERS: 5 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 100 | Presyncope | FAERS: 5 | US FAERS | |
| 101 | Product container issue | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 102 | Purpura | FAERS: 5 | US FAERS | |
| 103 | Stridor | FAERS: 5 | OFFSIDES US FAERS | |
| 104 | Tinnitus | FAERS: 5 | SIDER US FAERS | |
| 105 | Ventricular Fibrillation | FAERS: 5 | CTD OFFSIDES SIDER US FAERS | |
| 106 | Altered state of consciousness | FAERS: 4 | US FAERS | |
| 107 | Arthritis | FAERS: 4 | US FAERS | |
| 108 | Central nervous system lesion | FAERS: 4 | OFFSIDES US FAERS | |
| 109 | Dehydration | FAERS: 4 | US FAERS | |
| 110 | Dysarthria | FAERS: 4 | US FAERS | |
| 111 | Erythema Multiforme | FAERS: 4 | OFFSIDES US FAERS | |
| 112 | General physical health deterioration | FAERS: 4 | US FAERS | |
| 113 | Hypoxia | FAERS: 4 | US FAERS | |
| 114 | Incontinence | FAERS: 4 | OFFSIDES US FAERS | |
| 115 | Incorrect route of product administration | FAERS: 4 | US FAERS | |
| 116 | Lip swelling | FAERS: 4 Canada Vigilance: 18 | Canada Vigilance US FAERS | |
| 117 | Liquid product physical issue | FAERS: 4 | US FAERS | |
| 118 | Livedo Reticularis | FAERS: 4 | US FAERS | |
| 119 | Meningitis | FAERS: 4 | US FAERS | |
| 120 | Overdose | FAERS: 4 | US FAERS | |
| 121 | Rash erythematous | FAERS: 4 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 122 | Restlessness | FAERS: 4 | US FAERS | |
| 123 | Rhabdomyolysis | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 124 | Skin Ulcer | FAERS: 4 | US FAERS | |
| 125 | jaundice | FAERS: 4 | US FAERS | |
| 126 | Abasia | FAERS: 3 | US FAERS | |
| 127 | Administration site extravasation | FAERS: 3 | US FAERS | |
| 128 | Anuria | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 129 | Asthma | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 130 | Blood potassium increased | FAERS: 3 | US FAERS | |
| 131 | Brain Death | FAERS: 3 | US FAERS | |
| 132 | Cataract | FAERS: 3 | US FAERS | |
| 133 | Delirium | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 134 | Device malfunction | FAERS: 3 | US FAERS | |
| 135 | Diabetes Mellitus | FAERS: 3 | US FAERS | |
| 136 | Diabetic Retinopathy | FAERS: 3 | OFFSIDES US FAERS | |
| 137 | Discomfort | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 138 | Dysphasia | FAERS: 3 | SIDER US FAERS | |
| 139 | Epilepsy | FAERS: 3 | 3405414 | CTD US FAERS |
| 140 | Foreign body sensation in eyes | FAERS: 3 | US FAERS | |
| 141 | Hyperthyroidism | FAERS: 3 | US FAERS | |
| 142 | Injection site vesicles | FAERS: 3 | OFFSIDES US FAERS | |
| 143 | Laryngospasm | FAERS: 3 | US FAERS | |
| 144 | Limb discomfort | FAERS: 3 | US FAERS | |
| 145 | Mental status changes | FAERS: 3 | US FAERS | |
| 146 | Metabolic acidosis | FAERS: 3 | US FAERS | |
| 147 | Myalgia | FAERS: 3 | SIDER US FAERS | |
| 148 | Necrosis | FAERS: 3 | SIDER US FAERS | |
| 149 | Oxygen saturation immeasurable | FAERS: 3 | US FAERS | |
| 150 | Pancreatitis | FAERS: 3 | US FAERS | |
| 151 | Peripheral swelling | FAERS: 3 | US FAERS | |
| 152 | Product use in unapproved indication | FAERS: 3 | US FAERS | |
| 153 | Sepsis | FAERS: 3 | US FAERS | |
| 154 | Sinus Tachycardia | FAERS: 3 | US FAERS | |
| 155 | Urinary Retention | FAERS: 3 | SIDER US FAERS | |
| 156 | Wrong drug administered | FAERS: 3 | US FAERS | |
| 157 | Wrong product administered | FAERS: 3 | US FAERS | |
| 158 | Wrong technique in drug usage process | FAERS: 3 | US FAERS | |
| 159 | Accidental exposure | FAERS: 2 | OFFSIDES US FAERS | |
| 160 | Acute respiratory failure | FAERS: 2 | US FAERS | |
| 161 | Alanine Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 162 | Alopecia | FAERS: 2 | US FAERS | |
| 163 | Aphonia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 164 | Aspartate Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 165 | Bacillus test positive | FAERS: 2 | US FAERS | |
| 166 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 167 | Blood sodium decreased | FAERS: 2 | US FAERS | |
| 168 | Blood urine present | FAERS: 2 | OFFSIDES US FAERS | |
| 169 | Coronary no-reflow phenomenon | FAERS: 2 | US FAERS | |
| 170 | Drug toxicity | FAERS: 2 | US FAERS | |
| 171 | Dysgeusia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 172 | Dysuria | FAERS: 2 | US FAERS | |
| 173 | Electrocardiogram ST segment abnormal | FAERS: 2 | US FAERS | |
| 174 | Fallopian tube stenosis | FAERS: 2 | US FAERS | |
| 175 | Feeling of body temperature change | FAERS: 2 | US FAERS | |
| 176 | Fluid overload | FAERS: 2 | US FAERS | |
| 177 | Gastric ulcer | FAERS: 2 | US FAERS | |
| 178 | Gastroenteritis | FAERS: 2 | US FAERS | |
| 179 | Hypoaesthesia facial | FAERS: 2 | US FAERS | |
| 180 | Immediate post-injection reaction | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 181 | Infusion site pain | FAERS: 2 | OFFSIDES US FAERS | |
| 182 | Infusion site swelling | FAERS: 2 | US FAERS | |
| 183 | Injection Site Reaction | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 184 | Injection related reaction | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 185 | Injection site erythema | FAERS: 2 | US FAERS | |
| 186 | Injection site ulcer | FAERS: 2 | US FAERS | |
| 187 | Mouth swelling | FAERS: 2 | US FAERS | |
| 188 | Musculoskeletal Pain | FAERS: 2 | SIDER US FAERS | |
| 189 | Musculoskeletal stiffness | FAERS: 2 | SIDER US FAERS | |
| 190 | Neck Pain | FAERS: 2 | 1410326 | CTD SIDER US FAERS |
| 191 | Occupational exposure to product | FAERS: 2 | US FAERS | |
| 192 | Oropharyngeal discomfort | FAERS: 2 | US FAERS | |
| 193 | Oropharyngeal pain | FAERS: 2 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 194 | Oropharyngeal swelling | FAERS: 2 | US FAERS | |
| 195 | Patent ductus arteriosus | FAERS: 2 | US FAERS | |
| 196 | Pelvic Pain | FAERS: 2 | US FAERS | |
| 197 | Photophobia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 198 | Product package associated injury | FAERS: 2 | US FAERS | |
| 199 | Psychomotor skills impaired | FAERS: 2 | US FAERS | |
| 200 | Pulmonary Fibrosis | FAERS: 2 | US FAERS | |
| 201 | Rales | FAERS: 2 | US FAERS | |
| 202 | Renal pain | FAERS: 2 | US FAERS | |
| 203 | Renal tubular necrosis | FAERS: 2 | US FAERS | |
| 204 | Respiratory Depression | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 205 | Sciatica | FAERS: 2 | SIDER US FAERS | |
| 206 | Skin irritation | FAERS: 2 | US FAERS | |
| 207 | Sudden death | FAERS: 2 | US FAERS | |
| 208 | Supraventricular tachycardia | FAERS: 2 | US FAERS | |
| 209 | Tetany | FAERS: 2 | US FAERS | |
| 210 | Thirst | FAERS: 2 | US FAERS | |
| 211 | Thrombocytopenia | FAERS: 2 | US FAERS | |
| 212 | Toxicity to various agents | FAERS: 2 | US FAERS | |
| 213 | Transaminases increased | FAERS: 2 | OFFSIDES US FAERS | |
| 214 | Upper airway obstruction | FAERS: 2 | US FAERS | |
| 215 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 216 | Yawning | FAERS: 2 | OFFSIDES US FAERS | |
| 217 | Accidental overdose | FAERS: 1 | OFFSIDES US FAERS | |
| 218 | Administration site swelling | FAERS: 1 | US FAERS | |
| 219 | Air Embolism | FAERS: 1 | US FAERS | |
| 220 | Amaurosis | FAERS: 1 | US FAERS | |
| 221 | Amylase increased | FAERS: 1 | US FAERS | |
| 222 | Anal sphincter atony | FAERS: 1 | US FAERS | |
| 223 | Angina Pectoris | FAERS: 1 | 17101256 | CTD SIDER US FAERS |
| 224 | Anorexia | FAERS: 1 | SIDER US FAERS | |
| 225 | Anticonvulsant drug level below therapeutic | FAERS: 1 | US FAERS | |
| 226 | Antithrombin III decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 227 | Apallic syndrome | FAERS: 1 | US FAERS | |
| 228 | Application site vesicles | FAERS: 1 | US FAERS | |
| 229 | Arachnoiditis | FAERS: 1 | US FAERS | |
| 230 | Ascites | FAERS: 1 | US FAERS | |
| 231 | Asphyxia | FAERS: 1 | US FAERS | |
| 232 | Asterixis | FAERS: 1 | SIDER US FAERS | |
| 233 | Atrial thrombosis | FAERS: 1 | OFFSIDES US FAERS | |
| 234 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 235 | Axillary vein thrombosis | FAERS: 1 | US FAERS | |
| 236 | Back disorder | FAERS: 1 | US FAERS | |
| 237 | Bile duct necrosis | FAERS: 1 | US FAERS | |
| 238 | Biliary tract infection | FAERS: 1 | US FAERS | |
| 239 | Bladder pain | FAERS: 1 | US FAERS | |
| 240 | Bladder sphincter atony | FAERS: 1 | US FAERS | |
| 241 | Blindness | FAERS: 1 | SIDER US FAERS | |
| 242 | Blood brain barrier defect | FAERS: 1 | US FAERS | |
| 243 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 244 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 245 | Blood fibrinogen increased | FAERS: 1 | OFFSIDES US FAERS | |
| 246 | Blood glucose abnormal | FAERS: 1 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 247 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 248 | Blood phosphorus decreased | FAERS: 1 | US FAERS | |
| 249 | Blood potassium decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 250 | Blood urea increased | FAERS: 1 | US FAERS | |
| 251 | Brain scan abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 252 | Bronchial secretion retention | FAERS: 1 | US FAERS | |
| 253 | Cardiac Tamponade | FAERS: 1 | US FAERS | |
| 254 | Cardiac enzymes increased | FAERS: 1 | US FAERS | |
| 255 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 256 | Carotid artery occlusion | FAERS: 1 | US FAERS | |
| 257 | Catheter related complication | FAERS: 1 | US FAERS | |
| 258 | Cerebral artery occlusion | FAERS: 1 | US FAERS | |
| 259 | Cheyne-Stokes Respiration | FAERS: 1 | US FAERS | |
| 260 | Choking sensation | FAERS: 1 | US FAERS | |
| 261 | Choking | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 262 | Chromaturia | FAERS: 1 | US FAERS | |
| 263 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 264 | Concomitant disease aggravated | FAERS: 1 | US FAERS | |
| 265 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 266 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 267 | Deafness | FAERS: 1 | SIDER US FAERS | |
| 268 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 269 | Depressed mood | FAERS: 1 | US FAERS | |
| 270 | Device Failure | FAERS: 1 | US FAERS | |
| 271 | Diffuse alveolar damage | FAERS: 1 | US FAERS | |
| 272 | Diplopia | FAERS: 1 | US FAERS | |
| 273 | Documented hypersensitivity to administered drug | FAERS: 1 | US FAERS | |
| 274 | Documented hypersensitivity to administered product | FAERS: 1 | US FAERS | |
| 275 | Drug administered at inappropriate site | FAERS: 1 | US FAERS | |
| 276 | Dry skin | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 277 | Dystonia | FAERS: 1 | US FAERS | |
| 278 | Eczema | FAERS: 1 | US FAERS | |
| 279 | Electroencephalogram abnormal | FAERS: 1 | SIDER US FAERS | |
| 280 | Electromechanical dissociation | FAERS: 1 | US FAERS | |
| 281 | Emotional distress | FAERS: 1 | US FAERS | |
| 282 | Encephalitis | FAERS: 1 | US FAERS | |
| 283 | Endotracheal intubation complication | FAERS: 1 | US FAERS | |
| 284 | Epidermolysis Bullosa | FAERS: 1 | US FAERS | |
| 285 | Epistaxis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 286 | Eructation | FAERS: 1 | US FAERS | |
| 287 | Erythema Induratum | FAERS: 1 | US FAERS | |
| 288 | Excitability | FAERS: 1 | US FAERS | |
| 289 | Expired product administered | FAERS: 1 | US FAERS | |
| 290 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 291 | Exposure via eye contact | FAERS: 1 | US FAERS | |
| 292 | Eye Redness | FAERS: 1 | US FAERS | |
| 293 | Eye inflammation | FAERS: 1 | OFFSIDES US FAERS | |
| 294 | Facial Pain | FAERS: 1 | US FAERS | |
| 295 | Facial paralysis | FAERS: 1 | US FAERS | |
| 296 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 297 | Feeling Cold | FAERS: 1 | US FAERS | |
| 298 | Flatulence | FAERS: 1 | US FAERS | |
| 299 | Food Poisoning | FAERS: 1 | US FAERS | |
| 300 | Foreign body embolism | FAERS: 1 | US FAERS | |
| 301 | Gastrointestinal hypermotility | FAERS: 1 | US FAERS | |
| 302 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 303 | Gaze palsy | FAERS: 1 | US FAERS | |
| 304 | Glaucoma | FAERS: 1 | US FAERS | |
| 305 | Hepatitis | FAERS: 1 | US FAERS | |
| 306 | Hydrocephalus | FAERS: 1 | OFFSIDES US FAERS | |
| 307 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 308 | Hypercapnia | FAERS: 1 | US FAERS | |
| 309 | Hyperpyrexia | FAERS: 1 | US FAERS | |
| 310 | Hypertensive crisis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 311 | Hypokinesia | FAERS: 1 | US FAERS | |
| 312 | Hypophagia | FAERS: 1 | US FAERS | |
| 313 | Hyporeflexia | FAERS: 1 | US FAERS | |
| 314 | Hypoventilation | FAERS: 1 | US FAERS | |
| 315 | Incoherent | FAERS: 1 | US FAERS | |
| 316 | Incorrect dose administered by device | FAERS: 1 | US FAERS | |
| 317 | Increased bronchial secretion | FAERS: 1 | US FAERS | |
| 318 | Increased ventricular preload | FAERS: 1 | US FAERS | |
| 319 | Infarction | FAERS: 1 | SIDER US FAERS | |
| 320 | Infectious pleural effusion | FAERS: 1 | US FAERS | |
| 321 | Infusion site cellulitis | FAERS: 1 | US FAERS | |
| 322 | Infusion site pruritus | FAERS: 1 | US FAERS | |
| 323 | Infusion site rash | FAERS: 1 | US FAERS | |
| 324 | Infusion site reaction | FAERS: 1 | US FAERS | |
| 325 | Injection site bruising | FAERS: 1 | US FAERS | |
| 326 | Injection site irritation | FAERS: 1 | US FAERS | |
| 327 | Injection site pruritus | FAERS: 1 | US FAERS | |
| 328 | Iodine allergy | FAERS: 1 | OFFSIDES US FAERS | |
| 329 | Irregular breathing | FAERS: 1 | US FAERS | |
| 330 | Leukocytoclastic vasculitis | FAERS: 1 | US FAERS | |
| 331 | Lichen Planus | FAERS: 1 | US FAERS | |
| 332 | Lip pruritus | FAERS: 1 | US FAERS | |
| 333 | Lumbosacral radiculopathy | FAERS: 1 | US FAERS | |
| 334 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 335 | Lymphopenia | FAERS: 1 | US FAERS | |
| 336 | Macule | FAERS: 1 | US FAERS | |
| 337 | Medical device complication | FAERS: 1 | US FAERS | |
| 338 | Monoplegia | FAERS: 1 | US FAERS | |
| 339 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 340 | Muscle tightness | FAERS: 1 | US FAERS | |
| 341 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 342 | Myocardial necrosis marker increased | FAERS: 1 | US FAERS | |
| 343 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 344 | Nasal pruritus | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 345 | Nephritis | FAERS: 1 | US FAERS | |
| 346 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 347 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 348 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 349 | Oculomucocutaneous syndrome | FAERS: 1 | US FAERS | |
| 350 | Oliguria | FAERS: 1 | SIDER US FAERS | |
| 351 | Opisthotonus | FAERS: 1 | US FAERS | |
| 352 | Optic Neuritis | FAERS: 1 | US FAERS | |
| 353 | Oral discharge | FAERS: 1 | US FAERS | |
| 354 | Oral mucosal erythema | FAERS: 1 | US FAERS | |
| 355 | Oxygen saturation abnormal | FAERS: 1 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 356 | PO2 decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 357 | Palatal swelling | FAERS: 1 | US FAERS | |
| 358 | Palmar erythema | FAERS: 1 | US FAERS | |
| 359 | Pancytopenia | FAERS: 1 | US FAERS | |
| 360 | Paresis | FAERS: 1 | US FAERS | |
| 361 | Peptic Ulcer | FAERS: 1 | US FAERS | |
| 362 | Pericarditis | FAERS: 1 | US FAERS | |
| 363 | Peritoneal Dialysis | FAERS: 1 | OFFSIDES US FAERS | |
| 364 | Petechiae | FAERS: 1 | SIDER US FAERS | |
| 365 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 366 | Phlebitis | FAERS: 1 | US FAERS | |
| 367 | Pneumothorax | FAERS: 1 | US FAERS | |
| 368 | Polyuria | FAERS: 1 | US FAERS | |
| 369 | Post procedural nausea | FAERS: 1 | US FAERS | |
| 370 | Postoperative fever | FAERS: 1 | US FAERS | |
| 371 | Posturing | FAERS: 1 | US FAERS | |
| 372 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 373 | Procedural hypotension | FAERS: 1 | OFFSIDES US FAERS | |
| 374 | Procedural vomiting | FAERS: 1 | US FAERS | |
| 375 | Product closure issue | FAERS: 1 | US FAERS | |
| 376 | Product container seal issue | FAERS: 1 | US FAERS | |
| 377 | Product contamination microbial | FAERS: 1 | US FAERS | |
| 378 | Product formulation issue | FAERS: 1 | US FAERS | |
| 379 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 380 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 381 | Productive Cough | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 382 | Pulmonary Infarction | FAERS: 1 | US FAERS | |
| 383 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 384 | Reduced facial expression | FAERS: 1 | US FAERS | |
| 385 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 386 | Retrograde amnesia | FAERS: 1 | US FAERS | |
| 387 | Septic Shock | FAERS: 1 | US FAERS | |
| 388 | Shunt malfunction | FAERS: 1 | US FAERS | |
| 389 | Similar reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 390 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 391 | Skin tightness | FAERS: 1 | US FAERS | |
| 392 | Small bowel angioedema | FAERS: 1 | US FAERS | |
| 393 | Staring | FAERS: 1 | US FAERS | |
| 394 | Status Asthmaticus | FAERS: 1 | US FAERS | |
| 395 | Status Epilepticus | FAERS: 1 | 15010060 | CTD US FAERS |
| 396 | Strabismus | FAERS: 1 | US FAERS | |
| 397 | Sudden Cardiac Death | FAERS: 1 | US FAERS | |
| 398 | Sunburn | FAERS: 1 | US FAERS | |
| 399 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 400 | Therapeutic product contamination | FAERS: 1 | US FAERS | |
| 401 | Thrombosis in device | FAERS: 1 | US FAERS | |
| 402 | Thrombosis | FAERS: 1 | CTD US FAERS | |
| 403 | Tongue biting | FAERS: 1 | US FAERS | |
| 404 | Toothache | FAERS: 1 | US FAERS | |
| 405 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 406 | Tryptase increased | FAERS: 1 | US FAERS | |
| 407 | Tumour haemorrhage | FAERS: 1 | US FAERS | |
| 408 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 409 | Vasculitis | FAERS: 1 | 8369214 | CTD US FAERS |
| 410 | Vasospasm | FAERS: 1 | US FAERS | |
| 411 | Venous thrombosis limb | FAERS: 1 | US FAERS | |
| 412 | Vertigo | FAERS: 1 | US FAERS | |
| 413 | Visual Impairment | FAERS: 1 | SIDER US FAERS | |
| 414 | Walking aid user | FAERS: 1 | US FAERS | |
| 415 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 416 | muscle injury | FAERS: 1 | US FAERS | |
| 417 | Abdominal Cramps | SIDER | ||
| 418 | Acute Coronary Syndrome | SIDER | ||
| 419 | Adverse event | Canada Vigilance: 2 | Canada Vigilance | |
| 420 | Agraphia | OFFSIDES | ||
| 421 | Apnea | OFFSIDES | ||
| 422 | Arterial Occlusive Diseases | 8451424 | CTD | |
| 423 | Arterial thrombosis | SIDER | ||
| 424 | Arteriosclerosis Obliterans | OFFSIDES | ||
| 425 | Arteriovenous fistula | OFFSIDES | ||
| 426 | Ataxia | SIDER | ||
| 427 | Atrial tachycardia | OFFSIDES | ||
| 428 | Automatism | OFFSIDES | ||
| 429 | Beta 2 microglobulin urine increased | OFFSIDES | ||
| 430 | Blood chloride decreased | OFFSIDES | ||
| 431 | Blood gases abnormal | OFFSIDES | ||
| 432 | Blood immunoglobulin E | OFFSIDES | ||
| 433 | Blood immunoglobulin M | OFFSIDES | ||
| 434 | Blood ketone body increased | OFFSIDES | ||
| 435 | Blood magnesium decreased | OFFSIDES | ||
| 436 | Blood pH increased | OFFSIDES | ||
| 437 | Blood sodium | OFFSIDES | ||
| 438 | Bundle-Branch Block | 17101256 | CTD | |
| 439 | Cardiovascular Diseases | 2909204 | CTD | |
| 440 | Cauda Equina Syndrome | SIDER | ||
| 441 | Chemical and Drug Induced Liver Injury | 11350297 | CTD | |
| 442 | Chest tightness | SIDER | ||
| 443 | Confusion | 10565048 | CTD | |
| 444 | Conjunctivitis | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 445 | Coronary Thrombosis | 1856412 11993202 | CTD | |
| 446 | Coronary angioplasty | OFFSIDES | ||
| 447 | Cramps of lower extremities | SIDER | ||
| 448 | Cranial nerve diseases | 2369676 | CTD | |
| 449 | Cyanotic heart disease | SIDER | ||
| 450 | Dermatitis | SIDER | ||
| 451 | Drug withdrawal headache | OFFSIDES | ||
| 452 | Dysacusis | SIDER | ||
| 453 | Dyspepsia | SIDER | ||
| 454 | Dyspnea | 8761866 17101256 | CTD | |
| 455 | Ear congestion | Canada Vigilance: 1 | Canada Vigilance | |
| 456 | Ear discomfort | Canada Vigilance: 3 | Canada Vigilance | |
| 457 | Echoacousia | SIDER | ||
| 458 | Echolalia | SIDER | ||
| 459 | Electrocardiogram abnormal | SIDER | ||
| 460 | Electrocardiogram change | SIDER | ||
| 461 | Epidermal necrosis | OFFSIDES | ||
| 462 | Erythrodermic psoriasis | OFFSIDES | ||
| 463 | Exanthema | 2923308 | CTD | |
| 464 | Eye Infection | Canada Vigilance: 1 | Canada Vigilance | |
| 465 | Facial Neuralgia | SIDER | ||
| 466 | Free fatty acids increased | OFFSIDES | ||
| 467 | Gamma-Glutamyltransferase Increased | OFFSIDES | ||
| 468 | Gingival erythema | OFFSIDES | ||
| 469 | Guillain-Barre Syndrome | SIDER | ||
| 470 | Heart Diseases | 2353655 | CTD | |
| 471 | Heartburn | SIDER | ||
| 472 | Hyperreflexia | SIDER | ||
| 473 | Hypocomplementaemia | OFFSIDES | ||
| 474 | Hypotensive | SIDER | ||
| 475 | Infection | OFFSIDES SIDER | ||
| 476 | Infusion site streaking | Canada Vigilance: 1 | Canada Vigilance | |
| 477 | Injection site urticaria | Canada Vigilance: 3 | Canada Vigilance | |
| 478 | Intracranial Hypertension | 8880713 | CTD | |
| 479 | Intracranial Thrombosis | 8880713 | CTD | |
| 480 | Ischemia | 3292761 | CTD | |
| 481 | Joint stiffness | Canada Vigilance: 2 | Canada Vigilance | |
| 482 | Joint swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 483 | Kidney Diseases | CTD | ||
| 484 | Kidney Failure | OFFSIDES | ||
| 485 | Lacrimation | SIDER | ||
| 486 | Late metabolic acidosis of newborn | OFFSIDES | ||
| 487 | Lightheadedness | SIDER | ||
| 488 | Lymphocyte stimulation test positive | OFFSIDES | ||
| 489 | Malaise and fatigue | SIDER | ||
| 490 | Malignant ascites | OFFSIDES | ||
| 491 | Meningeal disorder | OFFSIDES | ||
| 492 | Meningism | SIDER | ||
| 493 | Meningoencephalitis | 1676802 2926430 | CTD | |
| 494 | Muscle Fatigue | OFFSIDES | ||
| 495 | Muscle Spasticity | SIDER | ||
| 496 | Musculoskeletal discomfort | SIDER | ||
| 497 | Myelitis | SIDER | ||
| 498 | Nasopharyngitis | OFFSIDES | ||
| 499 | Neck stiffness | SIDER | ||
| 500 | Nephrosis | SIDER | ||
| 501 | Nephrotic Syndrome | SIDER | ||
| 502 | Neutropenia | SIDER | ||
| 503 | Nuchal Rigidity | SIDER | ||
| 504 | Numbness | SIDER | ||
| 505 | Ocular icterus | OFFSIDES | ||
| 506 | Oculogyric crisis | Canada Vigilance: 1 | Canada Vigilance | |
| 507 | Optic Disc Edema | OFFSIDES | ||
| 508 | Oral pain | Canada Vigilance: 1 | Canada Vigilance | |
| 509 | PROTHROMBIN TIME | OFFSIDES | ||
| 510 | Paraplegia | 1676803 | CTD OFFSIDES | |
| 511 | Pharyngeal swelling | Canada Vigilance: 12 | Canada Vigilance | |
| 512 | Pulmonary congestion | OFFSIDES | ||
| 513 | Pyelonephritis | OFFSIDES | ||
| 514 | Renal Insufficiency | 9169676 15150204 | CTD | |
| 515 | Respiratory tract congestion | Canada Vigilance: 1 | Canada Vigilance | |
| 516 | Retching | SIDER | ||
| 517 | Rhinitis | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 518 | Seizures | CTD | ||
| 519 | Sensation of warmth | SIDER | ||
| 520 | Shock symptom | Canada Vigilance: 1 | Canada Vigilance | |
| 521 | Sinus bradycardia | SIDER | ||
| 522 | Skin necrosis | SIDER | ||
| 523 | Skin test positive | OFFSIDES | ||
| 524 | Spinal Cord Diseases | 3386814 | CTD | |
| 525 | Stupor | SIDER | ||
| 526 | Subcutaneous nodule | OFFSIDES | ||
| 527 | Superficial injury of eye | Canada Vigilance: 1 | Canada Vigilance | |
| 528 | Sweating | SIDER | ||
| 529 | Swelling of eyelid | Canada Vigilance: 2 | Canada Vigilance | |
| 530 | Tachycardia, Ectopic Atrial | 17101256 | CTD | |
| 531 | Tachycardia, Ventricular | 7928282 17101256 | CTD | |
| 532 | Tension Headache | Canada Vigilance: 1 | Canada Vigilance | |
| 533 | Thromboembolism | 1584930 11108904 | CTD | |
| 534 | Thrombophlebitis | SIDER | ||
| 535 | Tongue pruritus | Canada Vigilance: 2 | Canada Vigilance | |
| 536 | Torticollis | Canada Vigilance: 1 | Canada Vigilance | |
| 537 | Troponin T | OFFSIDES | ||
| 538 | Unspecified visual loss | SIDER | ||
| 539 | VIIth nerve paralysis | OFFSIDES | ||
| 540 | Vasodilation procedure | SIDER | ||
| 541 | Vasodilation | SIDER | ||
| 542 | Venous Thrombosis | 1740038 | CTD SIDER | |
| 543 | Ventricular bigeminy | SIDER | ||
| 544 | Visual disturbance | SIDER | ||
| 545 | Wave slowing | SIDER | ||
| 546 | anaphylaxis | 2923308 | CTD | |
| 547 | apprehension | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.