cabozantinib
(ONIQOQHATWINJY-UHFFFAOYSA-N)
Structure
- SMILES
- COc1cc2c(ccnc2cc1OC)Oc1ccc(cc1)NC(=O)C1(CC1)C(=O)Nc1ccc(cc1)F
- Type(s)
- Approved; Investigational
- ATC code(s)
- L01XE26
- Molecular Formula:
- C28H24FN3O5
- Molecular Weight:
- 501.506
- Log P:
- 5.6868
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 2
- TPSA:
- 98.78
- CAS Number(s):
- 849217-68-1
Synonym(s)
1.
cabozantinib
2.
BMS 907351
3.
BMS-907351
4.
BMS907351
5.
Cometriq
6.
XL 184
7.
XL-184
8.
XL184 cpd
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Fatigue | FAERS: 163 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 2 | Nausea | FAERS: 111 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 3 | Asthenia | FAERS: 73 | SIDER US FAERS | |
| 4 | Malignant neoplasm progression | FAERS: 67 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 5 | Stomatitis | FAERS: 63 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 6 | Vomiting | FAERS: 62 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 7 | Weight decreased | FAERS: 51 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 8 | Pain | FAERS: 50 | US FAERS | |
| 9 | Dizziness | FAERS: 47 | SIDER US FAERS | |
| 10 | Malaise | FAERS: 44 | US FAERS | |
| 11 | Dysphonia | FAERS: 41 | SIDER US FAERS | |
| 12 | Dysgeusia | FAERS: 40 | SIDER US FAERS | |
| 13 | Oral pain | FAERS: 40 | SIDER US FAERS | |
| 14 | Dehydration | FAERS: 36 | SIDER US FAERS | |
| 15 | Constipation | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 16 | Skin Ulcer | FAERS: 30 | SIDER US FAERS | |
| 17 | Headache | FAERS: 29 | SIDER US FAERS | |
| 18 | Oropharyngeal pain | FAERS: 29 | SIDER US FAERS | |
| 19 | Dry skin | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 20 | Pneumonia | FAERS: 23 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 21 | Ageusia | FAERS: 21 | SIDER US FAERS | |
| 22 | Abdominal Pain | FAERS: 20 | SIDER US FAERS | |
| 23 | Sepsis | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 24 | Erythema | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 25 | Abdominal discomfort | FAERS: 17 | US FAERS | |
| 26 | General physical health deterioration | FAERS: 15 | US FAERS | |
| 27 | Peripheral swelling | FAERS: 15 | US FAERS | |
| 28 | Pneumothorax | FAERS: 15 | SIDER US FAERS | |
| 29 | Dyspepsia | FAERS: 14 | SIDER US FAERS | |
| 30 | Pruritus | FAERS: 14 | US FAERS | |
| 31 | Arthralgia | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 32 | Back Pain | FAERS: 13 | US FAERS | |
| 33 | Urinary tract infection | FAERS: 13 | US FAERS | |
| 34 | Alopecia | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 35 | Chest Pain | FAERS: 12 | US FAERS | |
| 36 | Blood creatinine increased | FAERS: 11 | US FAERS | |
| 37 | Burning sensation | FAERS: 11 | US FAERS | |
| 38 | Myalgia | FAERS: 11 | US FAERS | |
| 39 | Somnolence | FAERS: 11 | US FAERS | |
| 40 | Anxiety | FAERS: 10 | SIDER US FAERS | |
| 41 | Pulmonary Embolism | FAERS: 10 | SIDER US FAERS | |
| 42 | Hypotension | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 43 | Memory impairment | FAERS: 9 | US FAERS | |
| 44 | Respiratory Failure | FAERS: 9 | SIDER US FAERS | |
| 45 | Cerebrovascular accident | FAERS: 8 | US FAERS | |
| 46 | Musculoskeletal Pain | FAERS: 8 | US FAERS | |
| 47 | Thrombocytopenia | FAERS: 8 | SIDER US FAERS | |
| 48 | Tongue discomfort | FAERS: 8 | US FAERS | |
| 49 | Acne | FAERS: 7 | US FAERS | |
| 50 | Alanine Aminotransferase Increased | FAERS: 7 | SIDER US FAERS | |
| 51 | Embolism | FAERS: 7 | SIDER US FAERS | |
| 52 | Epistaxis | FAERS: 7 | US FAERS | |
| 53 | Febrile Neutropenia | FAERS: 7 | US FAERS | |
| 54 | Hyperkeratosis | FAERS: 7 | SIDER US FAERS | |
| 55 | Skin lesion | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 56 | Acute kidney injury | FAERS: 6 | US FAERS | |
| 57 | Ascites | FAERS: 6 | US FAERS | |
| 58 | Aspartate Aminotransferase Increased | FAERS: 6 | SIDER US FAERS | |
| 59 | Drug ineffective for unapproved indication | FAERS: 6 | US FAERS | |
| 60 | Flatulence | FAERS: 6 | US FAERS | |
| 61 | Nasopharyngitis | FAERS: 6 | US FAERS | |
| 62 | Non-cardiac chest pain | FAERS: 6 | US FAERS | |
| 63 | Thrombosis | FAERS: 6 | US FAERS | |
| 64 | Atrial Fibrillation | FAERS: 5 | SIDER US FAERS | |
| 65 | Blood alkaline phosphatase increased | FAERS: 5 | SIDER US FAERS | |
| 66 | Bronchitis | FAERS: 5 | US FAERS | |
| 67 | Cellulitis | FAERS: 5 | US FAERS | |
| 68 | Cholecystitis | FAERS: 5 | US FAERS | |
| 69 | Deep Vein Thrombosis | FAERS: 5 | US FAERS | |
| 70 | Drug ineffective | FAERS: 5 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 71 | Failure to Thrive | FAERS: 5 | US FAERS | |
| 72 | Hypersomnia | FAERS: 5 | US FAERS | |
| 73 | Hypophagia | FAERS: 5 | US FAERS | |
| 74 | Hypothyroidism | FAERS: 5 | SIDER US FAERS | |
| 75 | Lethargy | FAERS: 5 | US FAERS | |
| 76 | Limb discomfort | FAERS: 5 | US FAERS | |
| 77 | Lower respiratory tract infection | FAERS: 5 | US FAERS | |
| 78 | Musculoskeletal chest pain | FAERS: 5 | SIDER US FAERS | |
| 79 | Myocardial Infarction | FAERS: 5 | US FAERS | |
| 80 | Pancytopenia | FAERS: 5 | US FAERS | |
| 81 | Sinus Tachycardia | FAERS: 5 | US FAERS | |
| 82 | Syncope | FAERS: 5 | US FAERS | |
| 83 | Tooth Extraction | FAERS: 5 | US FAERS | |
| 84 | Amylase increased | FAERS: 4 | US FAERS | |
| 85 | Aphagia | FAERS: 4 | US FAERS | |
| 86 | Aphonia | FAERS: 4 | US FAERS | |
| 87 | Blood urine present | FAERS: 4 | US FAERS | |
| 88 | Bone pain | FAERS: 4 | US FAERS | |
| 89 | Cystitis | FAERS: 4 | US FAERS | |
| 90 | Delirium | FAERS: 4 | SIDER US FAERS | |
| 91 | Dermatitis acneiform | FAERS: 4 | US FAERS | |
| 92 | Disease Progression | FAERS: 4 | SIDER US FAERS | |
| 93 | Feeling abnormal | FAERS: 4 | SIDER US FAERS | |
| 94 | Gamma-Glutamyltransferase Increased | FAERS: 4 | US FAERS | |
| 95 | Hypoxia | FAERS: 4 | US FAERS | |
| 96 | Influenza | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 97 | Intestinal Obstruction | FAERS: 4 | US FAERS | |
| 98 | Laceration | FAERS: 4 | US FAERS | |
| 99 | Laryngitis | FAERS: 4 | US FAERS | |
| 100 | Leukopenia | FAERS: 4 | US FAERS | |
| 101 | Lipase increased | FAERS: 4 | SIDER US FAERS | |
| 102 | Lymphopenia | FAERS: 4 | SIDER US FAERS | |
| 103 | Pain of skin | FAERS: 4 | US FAERS | |
| 104 | Pericardial effusion | FAERS: 4 | US FAERS | |
| 105 | Proteinuria | FAERS: 4 | SIDER US FAERS | |
| 106 | Retching | FAERS: 4 | US FAERS | |
| 107 | Sinusitis | FAERS: 4 | US FAERS | |
| 108 | Swelling | FAERS: 4 | US FAERS | |
| 109 | Toothache | FAERS: 4 | US FAERS | |
| 110 | Toxicity to various agents | FAERS: 4 | US FAERS | |
| 111 | Unevaluable event | FAERS: 4 | US FAERS | |
| 112 | Abasia | FAERS: 3 | US FAERS | |
| 113 | Adverse event | FAERS: 3 | US FAERS | |
| 114 | Anal abscess | FAERS: 3 | US FAERS | |
| 115 | Aphasia | FAERS: 3 | US FAERS | |
| 116 | Cardiac Arrest | FAERS: 3 | SIDER US FAERS | |
| 117 | Chest discomfort | FAERS: 3 | US FAERS | |
| 118 | Clostridium difficile infection | FAERS: 3 | US FAERS | |
| 119 | Colitis | FAERS: 3 | US FAERS | |
| 120 | Deafness | FAERS: 3 | SIDER US FAERS | |
| 121 | Disorientation | FAERS: 3 | US FAERS | |
| 122 | Drug administration error | FAERS: 3 | US FAERS | |
| 123 | Drug dose omission | FAERS: 3 | US FAERS | |
| 124 | Dysuria | FAERS: 3 | SIDER US FAERS | |
| 125 | Enteritis | FAERS: 3 | US FAERS | |
| 126 | Enterococcal sepsis | FAERS: 3 | US FAERS | |
| 127 | Erythema Multiforme | FAERS: 3 | US FAERS | |
| 128 | Glossitis | FAERS: 3 | US FAERS | |
| 129 | Gout | FAERS: 3 | US FAERS | |
| 130 | Hepatotoxicity | FAERS: 3 | US FAERS | |
| 131 | Herpes Zoster Oticus | FAERS: 3 | US FAERS | |
| 132 | Infection | FAERS: 3 | SIDER US FAERS | |
| 133 | Inflammation | FAERS: 3 | US FAERS | |
| 134 | Joint swelling | FAERS: 3 | US FAERS | |
| 135 | Liver Abscess | FAERS: 3 | US FAERS | |
| 136 | Malnutrition | FAERS: 3 | SIDER US FAERS | |
| 137 | Musculoskeletal stiffness | FAERS: 3 | US FAERS | |
| 138 | Neuralgia | FAERS: 3 | US FAERS | |
| 139 | Periodontitis | FAERS: 3 | US FAERS | |
| 140 | Portal Vein Thrombosis | FAERS: 3 | US FAERS | |
| 141 | Productive Cough | FAERS: 3 | US FAERS | |
| 142 | Septic Shock | FAERS: 3 | US FAERS | |
| 143 | Sinus headache | FAERS: 3 | US FAERS | |
| 144 | Skin reaction | FAERS: 3 | US FAERS | |
| 145 | Tachycardia | FAERS: 3 | US FAERS | |
| 146 | Throat irritation | FAERS: 3 | US FAERS | |
| 147 | Thrombophlebitis | FAERS: 3 | US FAERS | |
| 148 | Tooth Loss | FAERS: 3 | US FAERS | |
| 149 | White blood cell count decreased | FAERS: 3 | US FAERS | |
| 150 | Wound dehiscence | FAERS: 3 | US FAERS | |
| 151 | Abdominal Infection | FAERS: 2 | US FAERS | |
| 152 | Amnesia | FAERS: 2 | US FAERS | |
| 153 | Anal Ulcer | FAERS: 2 | US FAERS | |
| 154 | Anal inflammation | FAERS: 2 | SIDER US FAERS | |
| 155 | Angina Pectoris | FAERS: 2 | SIDER US FAERS | |
| 156 | Anorectal infection | FAERS: 2 | US FAERS | |
| 157 | Arthritis | FAERS: 2 | US FAERS | |
| 158 | Back disorder | FAERS: 2 | US FAERS | |
| 159 | Blood calcitonin increased | FAERS: 2 | US FAERS | |
| 160 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 161 | Blood magnesium decreased | FAERS: 2 | US FAERS | |
| 162 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 163 | Blood thyroid stimulating hormone increased | FAERS: 2 | SIDER US FAERS | |
| 164 | Bronchial Obstruction | FAERS: 2 | US FAERS | |
| 165 | Cachexia | FAERS: 2 | US FAERS | |
| 166 | Calcium deficiency | FAERS: 2 | US FAERS | |
| 167 | Cardiac Tamponade | FAERS: 2 | US FAERS | |
| 168 | Cheilitis | FAERS: 2 | SIDER US FAERS | |
| 169 | Chromaturia | FAERS: 2 | US FAERS | |
| 170 | Coating in mouth | FAERS: 2 | US FAERS | |
| 171 | Crying | FAERS: 2 | US FAERS | |
| 172 | Diverticulitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 173 | Dysarthria | FAERS: 2 | US FAERS | |
| 174 | Dysbacteriosis | FAERS: 2 | US FAERS | |
| 175 | Ear discomfort | FAERS: 2 | US FAERS | |
| 176 | Epilepsy | FAERS: 2 | US FAERS | |
| 177 | Exposed bone in jaw | FAERS: 2 | US FAERS | |
| 178 | Flank Pain | FAERS: 2 | US FAERS | |
| 179 | Fracture | FAERS: 2 | US FAERS | |
| 180 | Gastritis | FAERS: 2 | US FAERS | |
| 181 | Genital rash | FAERS: 2 | US FAERS | |
| 182 | Hyperchlorhydria | FAERS: 2 | US FAERS | |
| 183 | Hypersensitivity | FAERS: 2 | US FAERS | |
| 184 | Hypogeusia | FAERS: 2 | US FAERS | |
| 185 | Ileus | FAERS: 2 | US FAERS | |
| 186 | Intestinal Perforation | FAERS: 2 | US FAERS | |
| 187 | Irritable Bowel Syndrome | FAERS: 2 | US FAERS | |
| 188 | Mental impairment | FAERS: 2 | US FAERS | |
| 189 | Metabolic acidosis | FAERS: 2 | US FAERS | |
| 190 | Neck Pain | FAERS: 2 | US FAERS | |
| 191 | Neutropenia | FAERS: 2 | SIDER US FAERS | |
| 192 | Neutrophil count decreased | FAERS: 2 | SIDER US FAERS | |
| 193 | Night sweats | FAERS: 2 | US FAERS | |
| 194 | Nodule | FAERS: 2 | US FAERS | |
| 195 | Noninfective gingivitis | FAERS: 2 | US FAERS | |
| 196 | Oral infection | FAERS: 2 | US FAERS | |
| 197 | Pallor | FAERS: 2 | SIDER US FAERS | |
| 198 | Palpitations | FAERS: 2 | US FAERS | |
| 199 | Pancreatic Pseudocyst | FAERS: 2 | US FAERS | |
| 200 | Performance status decreased | FAERS: 2 | US FAERS | |
| 201 | Pharyngitis | FAERS: 2 | US FAERS | |
| 202 | Pleuritic pain | FAERS: 2 | US FAERS | |
| 203 | Posterior reversible encephalopathy syndrome | FAERS: 2 | SIDER US FAERS | |
| 204 | Product use complaint | FAERS: 2 | US FAERS | |
| 205 | Quality of life decreased | FAERS: 2 | US FAERS | |
| 206 | Rash erythematous | FAERS: 2 | US FAERS | |
| 207 | Renal pain | FAERS: 2 | US FAERS | |
| 208 | Respiratory tract congestion | FAERS: 2 | US FAERS | |
| 209 | Scab | FAERS: 2 | US FAERS | |
| 210 | Seizure like phenomena | FAERS: 2 | US FAERS | |
| 211 | Skin hypertrophy | FAERS: 2 | US FAERS | |
| 212 | Sluggishness | FAERS: 2 | US FAERS | |
| 213 | Sudden death | FAERS: 2 | US FAERS | |
| 214 | Sunburn | FAERS: 2 | US FAERS | |
| 215 | Tongue eruption | FAERS: 2 | US FAERS | |
| 216 | Toxic Shock Syndrome | FAERS: 2 | US FAERS | |
| 217 | Tremor | FAERS: 2 | SIDER US FAERS | |
| 218 | Vertigo | FAERS: 2 | US FAERS | |
| 219 | Visual Impairment | FAERS: 2 | US FAERS | |
| 220 | Vocal Cord Paralysis | FAERS: 2 | US FAERS | |
| 221 | Wound Infection | FAERS: 2 | US FAERS | |
| 222 | Abscess | FAERS: 1 | SIDER US FAERS | |
| 223 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 224 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 225 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 226 | Albinism | FAERS: 1 | US FAERS | |
| 227 | Ammonia increased | FAERS: 1 | US FAERS | |
| 228 | Anal Fissure | FAERS: 1 | SIDER US FAERS | |
| 229 | Anorectal discomfort | FAERS: 1 | US FAERS | |
| 230 | Aphthous Stomatitis | FAERS: 1 | US FAERS | |
| 231 | Appendicitis | FAERS: 1 | US FAERS | |
| 232 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 233 | Aspergillus test positive | FAERS: 1 | US FAERS | |
| 234 | Asthenopia | FAERS: 1 | US FAERS | |
| 235 | Ataxia | FAERS: 1 | SIDER US FAERS | |
| 236 | Biliary dilatation | FAERS: 1 | US FAERS | |
| 237 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 238 | Blood blister | FAERS: 1 | US FAERS | |
| 239 | Blood calcium abnormal | FAERS: 1 | US FAERS | |
| 240 | Blood electrolytes abnormal | FAERS: 1 | US FAERS | |
| 241 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 242 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 243 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 244 | Bone lesion | FAERS: 1 | US FAERS | |
| 245 | Bronchopleural Fistula | FAERS: 1 | US FAERS | |
| 246 | Budd-Chiari Syndrome | FAERS: 1 | US FAERS | |
| 247 | Bursitis | FAERS: 1 | US FAERS | |
| 248 | Cancer Pain | FAERS: 1 | US FAERS | |
| 249 | Capillary Leak Syndrome | FAERS: 1 | US FAERS | |
| 250 | Cataract operation | FAERS: 1 | US FAERS | |
| 251 | Chills | FAERS: 1 | SIDER US FAERS | |
| 252 | Choking | FAERS: 1 | US FAERS | |
| 253 | Cholangitis | FAERS: 1 | US FAERS | |
| 254 | Cholelithiasis | FAERS: 1 | SIDER US FAERS | |
| 255 | Cholestasis | FAERS: 1 | US FAERS | |
| 256 | Claustrophobia | FAERS: 1 | US FAERS | |
| 257 | Clonus | FAERS: 1 | US FAERS | |
| 258 | Colonic fistula | FAERS: 1 | US FAERS | |
| 259 | Complication associated with device | FAERS: 1 | US FAERS | |
| 260 | Cyanosis | FAERS: 1 | US FAERS | |
| 261 | Cyst | FAERS: 1 | US FAERS | |
| 262 | Dental caries | FAERS: 1 | US FAERS | |
| 263 | Dental prosthesis placement | FAERS: 1 | US FAERS | |
| 264 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 265 | Depressed mood | FAERS: 1 | US FAERS | |
| 266 | Dermatomyositis | FAERS: 1 | US FAERS | |
| 267 | Dermo-hypodermitis | FAERS: 1 | US FAERS | |
| 268 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 269 | Discomfort | FAERS: 1 | US FAERS | |
| 270 | Disseminated Intravascular Coagulation | FAERS: 1 | US FAERS | |
| 271 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 272 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 273 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 274 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 275 | Emotional disorder | FAERS: 1 | US FAERS | |
| 276 | Empyema | FAERS: 1 | US FAERS | |
| 277 | Enterococcal infection | FAERS: 1 | US FAERS | |
| 278 | Enterocolitis | FAERS: 1 | US FAERS | |
| 279 | Exposure via body fluid | FAERS: 1 | US FAERS | |
| 280 | Eye pain | FAERS: 1 | US FAERS | |
| 281 | Fasciitis | FAERS: 1 | US FAERS | |
| 282 | Feeling Cold | FAERS: 1 | US FAERS | |
| 283 | Fluid imbalance | FAERS: 1 | US FAERS | |
| 284 | Flushing | FAERS: 1 | US FAERS | |
| 285 | Folliculitis | FAERS: 1 | SIDER US FAERS | |
| 286 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 287 | Gait inability | FAERS: 1 | US FAERS | |
| 288 | Gangrene | FAERS: 1 | US FAERS | |
| 289 | Gastric pH decreased | FAERS: 1 | US FAERS | |
| 290 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 291 | Gastroenteritis norovirus | FAERS: 1 | US FAERS | |
| 292 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 293 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 294 | Gastrointestinal toxicity | FAERS: 1 | US FAERS | |
| 295 | Gingivitis | FAERS: 1 | US FAERS | |
| 296 | Glomerulonephritis | FAERS: 1 | US FAERS | |
| 297 | Groin infection | FAERS: 1 | US FAERS | |
| 298 | Head discomfort | FAERS: 1 | US FAERS | |
| 299 | Hemiparesis | FAERS: 1 | US FAERS | |
| 300 | Hepatic Encephalopathy | FAERS: 1 | SIDER US FAERS | |
| 301 | Hepatitis C | FAERS: 1 | US FAERS | |
| 302 | Hepatitis | FAERS: 1 | US FAERS | |
| 303 | Hospice Care | FAERS: 1 | US FAERS | |
| 304 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 305 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 306 | Incision site pain | FAERS: 1 | US FAERS | |
| 307 | Incontinence | FAERS: 1 | US FAERS | |
| 308 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 309 | Initial insomnia | FAERS: 1 | US FAERS | |
| 310 | Iron deficiency | FAERS: 1 | US FAERS | |
| 311 | Klebsiella test positive | FAERS: 1 | US FAERS | |
| 312 | Lack of spontaneous speech | FAERS: 1 | US FAERS | |
| 313 | Large intestine perforation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 314 | Leukocytosis | FAERS: 1 | US FAERS | |
| 315 | Limb injury | FAERS: 1 | US FAERS | |
| 316 | Lymphangitis | FAERS: 1 | US FAERS | |
| 317 | Macular degeneration | FAERS: 1 | US FAERS | |
| 318 | Medication Error | FAERS: 1 | US FAERS | |
| 319 | Menorrhagia | FAERS: 1 | US FAERS | |
| 320 | Mental status changes | FAERS: 1 | US FAERS | |
| 321 | Metastasis | FAERS: 1 | US FAERS | |
| 322 | Mood swings | FAERS: 1 | US FAERS | |
| 323 | Mouth swelling | FAERS: 1 | US FAERS | |
| 324 | Mucosal induration | FAERS: 1 | US FAERS | |
| 325 | Nail Infection | FAERS: 1 | US FAERS | |
| 326 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 327 | Nephritis | FAERS: 1 | US FAERS | |
| 328 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 329 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 330 | Obstructive nephropathy | FAERS: 1 | US FAERS | |
| 331 | Oligodipsia | FAERS: 1 | US FAERS | |
| 332 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 333 | Oral fungal infection | FAERS: 1 | US FAERS | |
| 334 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 335 | Oral mucosal erythema | FAERS: 1 | US FAERS | |
| 336 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 337 | Overdose | FAERS: 1 | US FAERS | |
| 338 | Palmar erythema | FAERS: 1 | US FAERS | |
| 339 | Pancreatectomy | FAERS: 1 | US FAERS | |
| 340 | Pancreatitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 341 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 342 | Paranasal sinus hypersecretion | FAERS: 1 | US FAERS | |
| 343 | Paresis | FAERS: 1 | US FAERS | |
| 344 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 345 | Pelvic venous thrombosis | FAERS: 1 | US FAERS | |
| 346 | Penile blister | FAERS: 1 | US FAERS | |
| 347 | Peritonitis | FAERS: 1 | US FAERS | |
| 348 | Personality Change | FAERS: 1 | US FAERS | |
| 349 | Pleural Infection | FAERS: 1 | US FAERS | |
| 350 | Pleurisy | FAERS: 1 | US FAERS | |
| 351 | Pneumonitis | FAERS: 1 | US FAERS | |
| 352 | Pneumoperitoneum | FAERS: 1 | US FAERS | |
| 353 | Poor dental condition | FAERS: 1 | US FAERS | |
| 354 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 355 | Portal Hypertension | FAERS: 1 | US FAERS | |
| 356 | Post procedural hypothyroidism | FAERS: 1 | US FAERS | |
| 357 | Presyncope | FAERS: 1 | US FAERS | |
| 358 | Product prescribing issue | FAERS: 1 | US FAERS | |
| 359 | Protein total abnormal | FAERS: 1 | US FAERS | |
| 360 | Psoriasis | FAERS: 1 | US FAERS | |
| 361 | Psychological Trauma | FAERS: 1 | US FAERS | |
| 362 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 363 | Pulmonary pain | FAERS: 1 | US FAERS | |
| 364 | Radiation inflammation | FAERS: 1 | US FAERS | |
| 365 | Rectal abscess | FAERS: 1 | US FAERS | |
| 366 | Rectal discharge | FAERS: 1 | US FAERS | |
| 367 | Rectal fissure | FAERS: 1 | US FAERS | |
| 368 | Renal Cell Carcinoma | FAERS: 1 | US FAERS | |
| 369 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 370 | Retinoschisis | FAERS: 1 | US FAERS | |
| 371 | Saliva altered | FAERS: 1 | US FAERS | |
| 372 | Salmonella sepsis | FAERS: 1 | US FAERS | |
| 373 | Secretion discharge | FAERS: 1 | US FAERS | |
| 374 | Skin Papilloma | FAERS: 1 | US FAERS | |
| 375 | Skin discomfort | FAERS: 1 | US FAERS | |
| 376 | Skin irritation | FAERS: 1 | US FAERS | |
| 377 | Squamous cell carcinoma of skin | FAERS: 1 | US FAERS | |
| 378 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 379 | Stenosis | FAERS: 1 | US FAERS | |
| 380 | Stoma site ulcer | FAERS: 1 | US FAERS | |
| 381 | Supraventricular tachycardia | FAERS: 1 | SIDER US FAERS | |
| 382 | Teeth brittle | FAERS: 1 | US FAERS | |
| 383 | Therapy cessation | FAERS: 1 | US FAERS | |
| 384 | Thermal burn | FAERS: 1 | US FAERS | |
| 385 | Thyroid Neoplasm | FAERS: 1 | US FAERS | |
| 386 | Tympanic Membrane Perforation | FAERS: 1 | US FAERS | |
| 387 | Upper respiratory fungal infection | FAERS: 1 | US FAERS | |
| 388 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 389 | Vaginal Perforation | FAERS: 1 | US FAERS | |
| 390 | Vascular rupture | FAERS: 1 | US FAERS | |
| 391 | Vasculitis | FAERS: 1 | US FAERS | |
| 392 | Wheelchair user | FAERS: 1 | US FAERS | |
| 393 | Wheezing | FAERS: 1 | US FAERS | |
| 394 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 395 | Activated partial thromboplastin time shortened | SIDER | ||
| 396 | Arterial thrombosis | SIDER | ||
| 397 | Aspergilloma | SIDER | ||
| 398 | Atelectasis | SIDER | ||
| 399 | Blood lactate dehydrogenase increased | SIDER | ||
| 400 | Cataract | SIDER | ||
| 401 | Conjunctivitis | SIDER | ||
| 402 | Dermatitis | SIDER | ||
| 403 | Ear and labyrinth disorders | SIDER | ||
| 404 | Facial Pain | SIDER | ||
| 405 | Gastrointestinal Pain | SIDER | ||
| 406 | Gastrointestinal perforation | SIDER | ||
| 407 | Infestation | SIDER | ||
| 408 | Lactic dehydrogenase activity increased | SIDER | ||
| 409 | Leukoderma | SIDER | ||
| 410 | Malignant Hypertension | SIDER | ||
| 411 | Musculoskeletal discomfort | SIDER | ||
| 412 | No adverse event | Canada Vigilance: 2 | Canada Vigilance | |
| 413 | Osteonecrosis of Jaw | SIDER | ||
| 414 | Prehypertension | SIDER | ||
| 415 | Protein urine present | SIDER | ||
| 416 | Rhabdomyolysis | SIDER | ||
| 417 | Right Ventricular Hypertrophy | Canada Vigilance: 1 | Canada Vigilance | |
| 418 | Septicemia | SIDER | ||
| 419 | Stevens-Johnson Syndrome | Canada Vigilance: 1 | Canada Vigilance | |
| 420 | Thrombocytosis | SIDER | ||
| 421 | Tinnitus | SIDER | ||
| 422 | Tracheal fistula | SIDER | ||
| 423 | Venous Thrombosis | SIDER | ||
| 424 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.