liposomal doxorubicin
(MWWSFMDVAYGXBV-RUELKSSGSA-N)
Structure
- SMILES
- OCC(=O)[C@@]1(O)C[C@H](O[C@H]2C[C@H](N)[C@@H]([C@@H](O2)C)O)c2c(C1)c(O)c1c(c2O)C(=O)c2c(C1=O)cccc2OC.Cl
- Molecular Formula:
- C27H30ClNO11
- Molecular Weight:
- 579.980
- Log P:
- 1.5036
- Hydrogen Bond Acceptor:
- 12
- Hydrogen Bond Donor:
- 7
- TPSA:
- 206.07
- CAS Number(s):
- 25316-40-9
Synonym(s)
1.
liposomal doxorubicin
2.
Caelyx
3.
DOX-SL
4.
Doxil
5.
Lipodox
6.
pegylated liposomal doxorubicin
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nausea | FAERS: 51 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Neutropenia | FAERS: 41 | US FAERS | |
| 3 | Product use in unapproved indication | FAERS: 39 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 4 | Product use issue | FAERS: 38 | US FAERS | |
| 5 | Cardiotoxicity | FAERS: 36 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 6 | Vomiting | FAERS: 36 | US FAERS | |
| 7 | Febrile Neutropenia | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Stomatitis | FAERS: 33 | US FAERS | |
| 9 | Fatigue | FAERS: 30 | US FAERS | |
| 10 | Erythema | FAERS: 29 | US FAERS | |
| 11 | Sepsis | FAERS: 29 | US FAERS | |
| 12 | Abdominal Pain | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 13 | Pain | FAERS: 24 | US FAERS | |
| 14 | Incorrect route of drug administration | FAERS: 22 | US FAERS | |
| 15 | Myocardial Infarction | FAERS: 22 | US FAERS | |
| 16 | Ejection Fraction Decreased | FAERS: 21 | US FAERS | |
| 17 | White blood cell count decreased | FAERS: 21 | US FAERS | |
| 18 | Hypersensitivity | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 19 | Product quality issue | FAERS: 18 | US FAERS | |
| 20 | Adverse event | FAERS: 17 | US FAERS | |
| 21 | Toxicity to various agents | FAERS: 17 | US FAERS | |
| 22 | Asthenia | FAERS: 16 | US FAERS | |
| 23 | Extravasation | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 24 | Thrombocytopenia | FAERS: 16 | US FAERS | |
| 25 | Back Pain | FAERS: 15 | US FAERS | |
| 26 | Chest Pain | FAERS: 15 | US FAERS | |
| 27 | Disease Progression | FAERS: 15 | US FAERS | |
| 28 | Neutrophil count decreased | FAERS: 15 | US FAERS | |
| 29 | Leukopenia | FAERS: 14 | US FAERS | |
| 30 | Malaise | FAERS: 14 | US FAERS | |
| 31 | Alanine Aminotransferase Increased | FAERS: 13 | US FAERS | |
| 32 | Constipation | FAERS: 13 | US FAERS | |
| 33 | Infection | FAERS: 13 | US FAERS | |
| 34 | Ascites | FAERS: 12 | US FAERS | |
| 35 | Intestinal Obstruction | FAERS: 12 | US FAERS | |
| 36 | Respiratory Failure | FAERS: 12 | US FAERS | |
| 37 | Alopecia | FAERS: 11 | US FAERS | |
| 38 | Atrial Fibrillation | FAERS: 11 | US FAERS | |
| 39 | Chest discomfort | FAERS: 11 | US FAERS | |
| 40 | Pneumonia | FAERS: 11 | US FAERS | |
| 41 | Flushing | FAERS: 10 | US FAERS | |
| 42 | Gamma-Glutamyltransferase Increased | FAERS: 10 | US FAERS | |
| 43 | Lip and/or oral cavity cancer | FAERS: 10 | US FAERS | |
| 44 | Pneumothorax | FAERS: 10 | US FAERS | |
| 45 | Urinary tract infection | FAERS: 10 | US FAERS | |
| 46 | Disseminated Intravascular Coagulation | FAERS: 9 | US FAERS | |
| 47 | Drug ineffective | FAERS: 9 | US FAERS | |
| 48 | General physical health deterioration | FAERS: 9 | US FAERS | |
| 49 | Pancytopenia | FAERS: 9 | US FAERS | |
| 50 | Pericardial effusion | FAERS: 9 | US FAERS | |
| 51 | Skin reaction | FAERS: 9 | US FAERS | |
| 52 | Skin toxicity | FAERS: 9 | US FAERS | |
| 53 | Urticaria | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 54 | Aspartate Aminotransferase Increased | FAERS: 8 | US FAERS | |
| 55 | Burning sensation | FAERS: 8 | US FAERS | |
| 56 | Cellulitis | FAERS: 8 | US FAERS | |
| 57 | Dehydration | FAERS: 8 | US FAERS | |
| 58 | Liver Abscess | FAERS: 8 | US FAERS | |
| 59 | Pneumonitis | FAERS: 8 | US FAERS | |
| 60 | Blood creatinine increased | FAERS: 7 | US FAERS | |
| 61 | Chills | FAERS: 7 | US FAERS | |
| 62 | Cyanosis | FAERS: 7 | US FAERS | |
| 63 | Dizziness | FAERS: 7 | US FAERS | |
| 64 | Hypotension | FAERS: 7 | US FAERS | |
| 65 | Lethargy | FAERS: 7 | US FAERS | |
| 66 | Skin Ulcer | FAERS: 7 | US FAERS | |
| 67 | Acute myocardial infarction | FAERS: 6 | US FAERS | |
| 68 | Bronchitis | FAERS: 6 | US FAERS | |
| 69 | Hepatotoxicity | FAERS: 6 | US FAERS | |
| 70 | Inflammation | FAERS: 6 | US FAERS | |
| 71 | Lymphoma | FAERS: 6 | US FAERS | |
| 72 | Phlebitis | FAERS: 6 | US FAERS | |
| 73 | Posterior reversible encephalopathy syndrome | FAERS: 6 | US FAERS | |
| 74 | Tachycardia | FAERS: 6 | US FAERS | |
| 75 | Thrombosis | FAERS: 6 | US FAERS | |
| 76 | Venous thrombosis limb | FAERS: 6 | US FAERS | |
| 77 | Anti-Muellerian hormone level decreased | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 78 | Blood alkaline phosphatase increased | FAERS: 5 | US FAERS | |
| 79 | Chromaturia | FAERS: 5 | US FAERS | |
| 80 | Drug dose omission | FAERS: 5 | US FAERS | |
| 81 | Feeling abnormal | FAERS: 5 | US FAERS | |
| 82 | Haematotoxicity | FAERS: 5 | US FAERS | |
| 83 | Hepatic necrosis | FAERS: 5 | US FAERS | |
| 84 | Malignant neoplasm progression | FAERS: 5 | US FAERS | |
| 85 | Medication Error | FAERS: 5 | US FAERS | |
| 86 | Pulmonary Embolism | FAERS: 5 | US FAERS | |
| 87 | Skin necrosis | FAERS: 5 | US FAERS | |
| 88 | Visual Impairment | FAERS: 5 | US FAERS | |
| 89 | Anxiety | FAERS: 4 | US FAERS | |
| 90 | Asthma | FAERS: 4 | US FAERS | |
| 91 | Brain natriuretic peptide increased | FAERS: 4 | US FAERS | |
| 92 | Cholangitis | FAERS: 4 | US FAERS | |
| 93 | Enterocolitis | FAERS: 4 | US FAERS | |
| 94 | Headache | FAERS: 4 | US FAERS | |
| 95 | Ileus | FAERS: 4 | US FAERS | |
| 96 | Inappropriate schedule of drug administration | FAERS: 4 | US FAERS | |
| 97 | Mental status changes | FAERS: 4 | US FAERS | |
| 98 | Musculoskeletal stiffness | FAERS: 4 | US FAERS | |
| 99 | Necrosis | FAERS: 4 | US FAERS | |
| 100 | Palpitations | FAERS: 4 | US FAERS | |
| 101 | Pancreatic Pseudocyst | FAERS: 4 | US FAERS | |
| 102 | Performance status decreased | FAERS: 4 | US FAERS | |
| 103 | Plantar erythema | FAERS: 4 | US FAERS | |
| 104 | Pruritus | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 105 | Septic Shock | FAERS: 4 | US FAERS | |
| 106 | Skin Erosion | FAERS: 4 | US FAERS | |
| 107 | Skin lesion | FAERS: 4 | US FAERS | |
| 108 | Vasculitis | FAERS: 4 | US FAERS | |
| 109 | Ventricular Dysfunction | FAERS: 4 | US FAERS | |
| 110 | Ventricular hypokinesia | FAERS: 4 | US FAERS | |
| 111 | Abasia | FAERS: 3 | US FAERS | |
| 112 | Abdominal discomfort | FAERS: 3 | US FAERS | |
| 113 | Acute left ventricular failure | FAERS: 3 | US FAERS | |
| 114 | Administration site extravasation | FAERS: 3 | US FAERS | |
| 115 | Altered state of consciousness | FAERS: 3 | US FAERS | |
| 116 | Arthralgia | FAERS: 3 | US FAERS | |
| 117 | Atrioventricular Block | FAERS: 3 | US FAERS | |
| 118 | Blood count abnormal | FAERS: 3 | US FAERS | |
| 119 | Blood urea increased | FAERS: 3 | US FAERS | |
| 120 | Breast cancer recurrent | FAERS: 3 | US FAERS | |
| 121 | Cardiac Arrest | FAERS: 3 | US FAERS | |
| 122 | Carotid artery occlusion | FAERS: 3 | US FAERS | |
| 123 | Cholecystitis | FAERS: 3 | US FAERS | |
| 124 | Deep Vein Thrombosis | FAERS: 3 | US FAERS | |
| 125 | Discomfort | FAERS: 3 | US FAERS | |
| 126 | Drug ineffective for unapproved indication | FAERS: 3 | US FAERS | |
| 127 | Dry skin | FAERS: 3 | US FAERS | |
| 128 | Dysplasia | FAERS: 3 | US FAERS | |
| 129 | Hepatitis B | FAERS: 3 | US FAERS | |
| 130 | Hyperplasia | FAERS: 3 | US FAERS | |
| 131 | Hypothyroidism | FAERS: 3 | US FAERS | |
| 132 | Infusion site erythema | FAERS: 3 | US FAERS | |
| 133 | Joint swelling | FAERS: 3 | US FAERS | |
| 134 | Monocyte count decreased | FAERS: 3 | US FAERS | |
| 135 | Nervousness | FAERS: 3 | US FAERS | |
| 136 | Neuralgia | FAERS: 3 | US FAERS | |
| 137 | Neutropenic colitis | FAERS: 3 | US FAERS | |
| 138 | Obstruction | FAERS: 3 | US FAERS | |
| 139 | Oral candidiasis | FAERS: 3 | US FAERS | |
| 140 | Pancreatitis | FAERS: 3 | US FAERS | |
| 141 | Pneumocystis jiroveci pneumonia | FAERS: 3 | US FAERS | |
| 142 | Pulmonary toxicity | FAERS: 3 | US FAERS | |
| 143 | Radiation skin injury | FAERS: 3 | US FAERS | |
| 144 | Respiratory distress | FAERS: 3 | US FAERS | |
| 145 | Skin irritation | FAERS: 3 | US FAERS | |
| 146 | Soft tissue inflammation | FAERS: 3 | US FAERS | |
| 147 | Squamous cell carcinoma | FAERS: 3 | US FAERS | |
| 148 | Syncope | FAERS: 3 | US FAERS | |
| 149 | Transaminases increased | FAERS: 3 | US FAERS | |
| 150 | Troponin increased | FAERS: 3 | US FAERS | |
| 151 | Zygomycosis | FAERS: 3 | US FAERS | |
| 152 | Acute Coronary Syndrome | FAERS: 2 | US FAERS | |
| 153 | Acute kidney injury | FAERS: 2 | US FAERS | |
| 154 | Allergic cystitis | FAERS: 2 | US FAERS | |
| 155 | Anaphylactic shock | FAERS: 2 | US FAERS | |
| 156 | Anaphylactoid Reaction | FAERS: 2 | US FAERS | |
| 157 | Angioedema | FAERS: 2 | US FAERS | |
| 158 | Blood albumin decreased | FAERS: 2 | US FAERS | |
| 159 | Blood creatinine abnormal | FAERS: 2 | US FAERS | |
| 160 | Blood magnesium decreased | FAERS: 2 | US FAERS | |
| 161 | Bronchopneumopathy | FAERS: 2 | US FAERS | |
| 162 | Cardiac Death | FAERS: 2 | US FAERS | |
| 163 | Cardiac Tamponade | FAERS: 2 | US FAERS | |
| 164 | Carotid intima-media thickness increased | FAERS: 2 | US FAERS | |
| 165 | Cerebral Infarction | FAERS: 2 | US FAERS | |
| 166 | Cholestasis | FAERS: 2 | US FAERS | |
| 167 | Colitis | FAERS: 2 | US FAERS | |
| 168 | Cystitis | FAERS: 2 | US FAERS | |
| 169 | Depressed mood | FAERS: 2 | US FAERS | |
| 170 | Device related infection | FAERS: 2 | US FAERS | |
| 171 | Diastolic dysfunction | FAERS: 2 | US FAERS | |
| 172 | Disorientation | FAERS: 2 | US FAERS | |
| 173 | Dysarthria | FAERS: 2 | US FAERS | |
| 174 | Dysgeusia | FAERS: 2 | US FAERS | |
| 175 | Dyspepsia | FAERS: 2 | US FAERS | |
| 176 | Embolic stroke | FAERS: 2 | US FAERS | |
| 177 | Endothelial dysfunction | FAERS: 2 | US FAERS | |
| 178 | Fracture | FAERS: 2 | US FAERS | |
| 179 | Gastrointestinal perforation | FAERS: 2 | US FAERS | |
| 180 | Gastrointestinal toxicity | FAERS: 2 | US FAERS | |
| 181 | Hepatic Encephalopathy | FAERS: 2 | US FAERS | |
| 182 | Hepatorenal Syndrome | FAERS: 2 | US FAERS | |
| 183 | Hyperkeratosis | FAERS: 2 | US FAERS | |
| 184 | Hypoxia | FAERS: 2 | US FAERS | |
| 185 | Iatrogenic injury | FAERS: 2 | US FAERS | |
| 186 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 187 | Infectious peritonitis | FAERS: 2 | US FAERS | |
| 188 | Infusion Site Extravasation | FAERS: 2 | US FAERS | |
| 189 | Injection site erythema | FAERS: 2 | US FAERS | |
| 190 | Injection site pain | FAERS: 2 | US FAERS | |
| 191 | Intestinal Perforation | FAERS: 2 | US FAERS | |
| 192 | Locked-In Syndrome | FAERS: 2 | US FAERS | |
| 193 | Lung infection pseudomonal | FAERS: 2 | US FAERS | |
| 194 | MYELODYSPLASTIC SYNDROME | FAERS: 2 | US FAERS | |
| 195 | Memory impairment | FAERS: 2 | US FAERS | |
| 196 | Myositis | FAERS: 2 | US FAERS | |
| 197 | Nonspecific reaction | FAERS: 2 | US FAERS | |
| 198 | Parotitis | FAERS: 2 | US FAERS | |
| 199 | Pathological fracture | FAERS: 2 | US FAERS | |
| 200 | Premature Menopause | FAERS: 2 | US FAERS | |
| 201 | Productive Cough | FAERS: 2 | US FAERS | |
| 202 | Quadriparesis | FAERS: 2 | US FAERS | |
| 203 | Rash follicular | FAERS: 2 | US FAERS | |
| 204 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 205 | Stevens-Johnson Syndrome | FAERS: 2 | US FAERS | |
| 206 | Stridor | FAERS: 2 | US FAERS | |
| 207 | Supraventricular tachycardia | FAERS: 2 | US FAERS | |
| 208 | Thermal burn | FAERS: 2 | US FAERS | |
| 209 | Tremor | FAERS: 2 | US FAERS | |
| 210 | Ventricular Fibrillation | FAERS: 2 | US FAERS | |
| 211 | Weight decreased | FAERS: 2 | US FAERS | |
| 212 | Wrong technique in drug usage process | FAERS: 2 | US FAERS | |
| 213 | jaundice | FAERS: 2 | US FAERS | |
| 214 | nervous system disorder | FAERS: 2 | US FAERS | |
| 215 | Abdominal Abscess | FAERS: 1 | US FAERS | |
| 216 | Abdominal mass | FAERS: 1 | US FAERS | |
| 217 | Accidental drug intake by child | FAERS: 1 | US FAERS | |
| 218 | Accidental exposure | FAERS: 1 | US FAERS | |
| 219 | Actinic keratosis | FAERS: 1 | US FAERS | |
| 220 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 221 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 222 | Alanine aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 223 | Amnesia | FAERS: 1 | US FAERS | |
| 224 | Anal abscess | FAERS: 1 | US FAERS | |
| 225 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 226 | Anuria | FAERS: 1 | US FAERS | |
| 227 | Aphagia | FAERS: 1 | US FAERS | |
| 228 | Apparent death | FAERS: 1 | US FAERS | |
| 229 | Arterial Injury | FAERS: 1 | US FAERS | |
| 230 | Arterial thrombosis | FAERS: 1 | US FAERS | |
| 231 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 232 | Arthropathy | FAERS: 1 | US FAERS | |
| 233 | Aspartate aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 234 | Ataxia | FAERS: 1 | US FAERS | |
| 235 | Atrial natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 236 | Bedridden | FAERS: 1 | US FAERS | |
| 237 | Biliary Fistula | FAERS: 1 | US FAERS | |
| 238 | Blood citric acid decreased | FAERS: 1 | US FAERS | |
| 239 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 240 | Blood creatinine decreased | FAERS: 1 | US FAERS | |
| 241 | Blood immunoglobulin A increased | FAERS: 1 | US FAERS | |
| 242 | Blood immunoglobulin M increased | FAERS: 1 | US FAERS | |
| 243 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 244 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 245 | Blood phosphorus decreased | FAERS: 1 | US FAERS | |
| 246 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 247 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 248 | Blood pressure immeasurable | FAERS: 1 | US FAERS | |
| 249 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 250 | Bone marrow depression | FAERS: 1 | US FAERS | |
| 251 | Bone pain | FAERS: 1 | US FAERS | |
| 252 | Bowen's Disease | FAERS: 1 | US FAERS | |
| 253 | Bradycardia | FAERS: 1 | US FAERS | |
| 254 | Breast tenderness | FAERS: 1 | US FAERS | |
| 255 | Bronchopulmonary Aspergillosis | FAERS: 1 | US FAERS | |
| 256 | Bronchospasm | FAERS: 1 | US FAERS | |
| 257 | Budd-Chiari Syndrome | FAERS: 1 | US FAERS | |
| 258 | Bulbar palsy | FAERS: 1 | US FAERS | |
| 259 | Cancer Pain | FAERS: 1 | US FAERS | |
| 260 | Candida test positive | FAERS: 1 | US FAERS | |
| 261 | Candidiasis | FAERS: 1 | US FAERS | |
| 262 | Catheter site infection | FAERS: 1 | US FAERS | |
| 263 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 264 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 265 | Cervix carcinoma | FAERS: 1 | US FAERS | |
| 266 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 267 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 268 | Critical Illness | FAERS: 1 | US FAERS | |
| 269 | Dacryostenosis acquired | FAERS: 1 | US FAERS | |
| 270 | Deafness | FAERS: 1 | US FAERS | |
| 271 | Delirium | FAERS: 1 | US FAERS | |
| 272 | Dermatitis | FAERS: 1 | US FAERS | |
| 273 | Device connection issue | FAERS: 1 | US FAERS | |
| 274 | Diverticulitis | FAERS: 1 | US FAERS | |
| 275 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 276 | Drug toxicity | FAERS: 1 | US FAERS | |
| 277 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 278 | Duodenitis | FAERS: 1 | US FAERS | |
| 279 | Dysphonia | FAERS: 1 | US FAERS | |
| 280 | Dysuria | FAERS: 1 | US FAERS | |
| 281 | Ear discomfort | FAERS: 1 | US FAERS | |
| 282 | Ear, nose and throat examination abnormal | FAERS: 1 | US FAERS | |
| 283 | Echocardiogram abnormal | FAERS: 1 | US FAERS | |
| 284 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 285 | Electrocardiogram change | FAERS: 1 | US FAERS | |
| 286 | Electrocardiogram repolarisation abnormality | FAERS: 1 | US FAERS | |
| 287 | Embolism | FAERS: 1 | US FAERS | |
| 288 | Encephalitis | FAERS: 1 | US FAERS | |
| 289 | Enteritis | FAERS: 1 | US FAERS | |
| 290 | Epistaxis | FAERS: 1 | US FAERS | |
| 291 | Eructation | FAERS: 1 | US FAERS | |
| 292 | Factor V Leiden mutation | FAERS: 1 | US FAERS | |
| 293 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 294 | False negative laboratory result | FAERS: 1 | US FAERS | |
| 295 | Female Orgasmic Disorder | FAERS: 1 | US FAERS | |
| 296 | Flank Pain | FAERS: 1 | US FAERS | |
| 297 | Fluid overload | FAERS: 1 | US FAERS | |
| 298 | Gas Gangrene | FAERS: 1 | US FAERS | |
| 299 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 300 | Gastritis | FAERS: 1 | US FAERS | |
| 301 | Gaze palsy | FAERS: 1 | US FAERS | |
| 302 | Gene Mutation | FAERS: 1 | US FAERS | |
| 303 | Granulocytes abnormal | FAERS: 1 | US FAERS | |
| 304 | Granulomatous pneumonitis | FAERS: 1 | US FAERS | |
| 305 | Heart valve calcification | FAERS: 1 | US FAERS | |
| 306 | Hepatic artery embolism | FAERS: 1 | US FAERS | |
| 307 | Hepatic artery occlusion | FAERS: 1 | US FAERS | |
| 308 | Hepatitis | FAERS: 1 | US FAERS | |
| 309 | Histiocytosis haematophagic | FAERS: 1 | US FAERS | |
| 310 | Hydrothorax | FAERS: 1 | US FAERS | |
| 311 | Hyperlipasaemia | FAERS: 1 | US FAERS | |
| 312 | Hyperpyrexia | FAERS: 1 | US FAERS | |
| 313 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 314 | Hypertransaminasaemia | FAERS: 1 | US FAERS | |
| 315 | Implant site extravasation | FAERS: 1 | US FAERS | |
| 316 | Inadequate analgesia | FAERS: 1 | US FAERS | |
| 317 | Incoherent | FAERS: 1 | US FAERS | |
| 318 | Infective thrombosis | FAERS: 1 | US FAERS | |
| 319 | Infusion site infection | FAERS: 1 | US FAERS | |
| 320 | Infusion site reaction | FAERS: 1 | US FAERS | |
| 321 | Injection Site Reaction | FAERS: 1 | US FAERS | |
| 322 | Injection site extravasation | FAERS: 1 | US FAERS | |
| 323 | Injection site nerve damage | FAERS: 1 | US FAERS | |
| 324 | Intertrigo | FAERS: 1 | US FAERS | |
| 325 | Intestinal infarction | FAERS: 1 | US FAERS | |
| 326 | Laceration | FAERS: 1 | US FAERS | |
| 327 | Leiomyosarcoma recurrent | FAERS: 1 | US FAERS | |
| 328 | Leukoencephalopathy | FAERS: 1 | US FAERS | |
| 329 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 330 | Lung Injury | FAERS: 1 | US FAERS | |
| 331 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 332 | Lymphocele | FAERS: 1 | US FAERS | |
| 333 | Lymphocyte count decreased | FAERS: 1 | US FAERS | |
| 334 | Lymphopenia | FAERS: 1 | US FAERS | |
| 335 | Malnutrition | FAERS: 1 | US FAERS | |
| 336 | Melanoma recurrent | FAERS: 1 | US FAERS | |
| 337 | Meningitis | FAERS: 1 | US FAERS | |
| 338 | Monocyte count increased | FAERS: 1 | US FAERS | |
| 339 | Mood swings | FAERS: 1 | US FAERS | |
| 340 | Muscle necrosis | FAERS: 1 | US FAERS | |
| 341 | Myalgia | FAERS: 1 | US FAERS | |
| 342 | Mycosis Fungoides | FAERS: 1 | US FAERS | |
| 343 | Myocarditis | FAERS: 1 | US FAERS | |
| 344 | N-terminal prohormone brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 345 | Nail Infection | FAERS: 1 | US FAERS | |
| 346 | Nail pigmentation | FAERS: 1 | US FAERS | |
| 347 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 348 | Neuropathy | FAERS: 1 | US FAERS | |
| 349 | Neutropenic sepsis | FAERS: 1 | US FAERS | |
| 350 | Neutrophil count abnormal | FAERS: 1 | US FAERS | |
| 351 | Nocturia | FAERS: 1 | US FAERS | |
| 352 | Nodular regenerative hyperplasia | FAERS: 1 | US FAERS | |
| 353 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 354 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 355 | Onychoclasis | FAERS: 1 | US FAERS | |
| 356 | Onycholysis | FAERS: 1 | US FAERS | |
| 357 | Oral pain | FAERS: 1 | US FAERS | |
| 358 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 359 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 360 | Osteitis | FAERS: 1 | US FAERS | |
| 361 | Osteoporosis | FAERS: 1 | US FAERS | |
| 362 | PO2 decreased | FAERS: 1 | US FAERS | |
| 363 | Parakeratosis | FAERS: 1 | US FAERS | |
| 364 | Pathogen resistance | FAERS: 1 | US FAERS | |
| 365 | Pericarditis | FAERS: 1 | US FAERS | |
| 366 | Peripheral motor neuropathy | FAERS: 1 | US FAERS | |
| 367 | Peritoneal Dialysis | FAERS: 1 | US FAERS | |
| 368 | Peritoneal lesion | FAERS: 1 | US FAERS | |
| 369 | Peritonitis | FAERS: 1 | US FAERS | |
| 370 | Platelet count abnormal | FAERS: 1 | US FAERS | |
| 371 | Portal Hypertension | FAERS: 1 | US FAERS | |
| 372 | Positron emission tomogram abnormal | FAERS: 1 | US FAERS | |
| 373 | Post procedural sepsis | FAERS: 1 | US FAERS | |
| 374 | Product label confusion | FAERS: 1 | US FAERS | |
| 375 | Product label issue | FAERS: 1 | US FAERS | |
| 376 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 377 | Protein C Deficiency | FAERS: 1 | US FAERS | |
| 378 | Pulmonary Infarction | FAERS: 1 | US FAERS | |
| 379 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 380 | Pyogenic granuloma | FAERS: 1 | US FAERS | |
| 381 | Radiation injury | FAERS: 1 | US FAERS | |
| 382 | Rash erythematous | FAERS: 1 | US FAERS | |
| 383 | Rebound effect | FAERS: 1 | US FAERS | |
| 384 | Respiratory tract irritation | FAERS: 1 | US FAERS | |
| 385 | Restrictive cardiomyopathy | FAERS: 1 | US FAERS | |
| 386 | Right Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 387 | Scab | FAERS: 1 | US FAERS | |
| 388 | Serous retinal detachment | FAERS: 1 | US FAERS | |
| 389 | Shock | FAERS: 1 | US FAERS | |
| 390 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 391 | Sinusitis | FAERS: 1 | US FAERS | |
| 392 | Skin nodule | FAERS: 1 | US FAERS | |
| 393 | Sputum retention | FAERS: 1 | US FAERS | |
| 394 | Subcutaneous Abscess | FAERS: 1 | US FAERS | |
| 395 | Sunburn | FAERS: 1 | US FAERS | |
| 396 | Superinfection fungal | FAERS: 1 | US FAERS | |
| 397 | Swelling | FAERS: 1 | US FAERS | |
| 398 | Tachyphylaxis | FAERS: 1 | US FAERS | |
| 399 | Tetany | FAERS: 1 | US FAERS | |
| 400 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 401 | Therapy regimen changed | FAERS: 1 | US FAERS | |
| 402 | Throat irritation | FAERS: 1 | US FAERS | |
| 403 | Thrombophlebitis | FAERS: 1 | US FAERS | |
| 404 | Thymus enlargement | FAERS: 1 | US FAERS | |
| 405 | Tooth Extraction | FAERS: 1 | US FAERS | |
| 406 | Trismus | FAERS: 1 | US FAERS | |
| 407 | Troponin I increased | FAERS: 1 | US FAERS | |
| 408 | Type III immune complex mediated reaction | FAERS: 1 | US FAERS | |
| 409 | Ulcer | FAERS: 1 | US FAERS | |
| 410 | Unevaluable event | FAERS: 1 | US FAERS | |
| 411 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 412 | Vascular Access Complication | FAERS: 1 | US FAERS | |
| 413 | Vascular endothelial growth factor overexpression | FAERS: 1 | US FAERS | |
| 414 | Wheezing | FAERS: 1 | US FAERS | |
| 415 | Wound Complication | FAERS: 1 | US FAERS | |
| 416 | Wound Infection | FAERS: 1 | US FAERS | |
| 417 | Wound infection staphylococcal | FAERS: 1 | US FAERS | |
| 418 | leiomyosarcoma | FAERS: 1 | US FAERS | |
| 419 | pseudomembranous colitis | FAERS: 1 | US FAERS | |
| 420 | Impaired work ability | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.