Methylphenidate
(JUMYIBMBTDDLNG-OJERSXHUSA-N)
Structure
- SMILES
- COC(=O)[C@H](c1ccccc1)[C@H]1CCCCN1.Cl
- Molecular Formula:
- C14H20ClNO2
- Molecular Weight:
- 269.767
- Log P:
- 3.2161
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 2
- TPSA:
- 38.33
- CAS Number(s):
- 19262-68-1; 23655-65-4
Synonym(s)
1.
Methylphenidate
2.
Centedrin
3.
Concerta
4.
Daytrana
5.
Equasym
6.
Metadate
7.
Methylin
8.
Methylphenidate Hydrochloride
9.
Phenidylate
10.
Ritalin
11.
Ritalin-SR
12.
Ritaline
13.
Tsentedrin
14.
Hydrochloride, Methylphenidate
15.
Ritalin SR
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | No adverse event | FAERS: 6126 | US FAERS | |
| 2 | Product quality issue | FAERS: 4911 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 3 | Drug administration error | FAERS: 2032 | US FAERS | |
| 4 | Wrong technique in drug usage process | FAERS: 1647 | US FAERS | |
| 5 | Application site erythema | FAERS: 1361 | US FAERS | |
| 6 | Drug ineffective | FAERS: 1306 Canada Vigilance: 56 | Canada Vigilance US FAERS | |
| 7 | Drug dose omission | FAERS: 1218 | US FAERS | |
| 8 | Incorrect drug administration duration | FAERS: 1113 | US FAERS | |
| 9 | Drug prescribing error | FAERS: 864 | US FAERS | |
| 10 | Application site pruritus | FAERS: 668 | US FAERS | |
| 11 | Drug administered at inappropriate site | FAERS: 606 | US FAERS | |
| 12 | Wrong technique in product usage process | FAERS: 604 | US FAERS | |
| 13 | Application site irritation | FAERS: 514 | US FAERS | |
| 14 | Application site pain | FAERS: 350 | US FAERS | |
| 15 | Product adhesion issue | FAERS: 317 | US FAERS | |
| 16 | Application site rash | FAERS: 261 | US FAERS | |
| 17 | Headache | FAERS: 158 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 18 | Therapy cessation | FAERS: 135 | US FAERS | |
| 19 | Application site swelling | FAERS: 134 | US FAERS | |
| 20 | Incorrect storage of drug | FAERS: 133 | US FAERS | |
| 21 | Educational problem | FAERS: 131 | US FAERS | |
| 22 | Prescribed overdose | FAERS: 129 | US FAERS | |
| 23 | Accidental exposure | FAERS: 124 | US FAERS | |
| 24 | Application site urticaria | FAERS: 117 | US FAERS | |
| 25 | Overdose | FAERS: 110 | US FAERS | |
| 26 | Weight decreased | FAERS: 106 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 27 | Agitation | FAERS: 105 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 28 | Drug effect delayed | FAERS: 103 | US FAERS | |
| 29 | Anxiety | FAERS: 101 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 30 | Accidental exposure to product | FAERS: 97 | US FAERS | |
| 31 | Crying | FAERS: 95 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 32 | Application site vesicles | FAERS: 91 | US FAERS | |
| 33 | Application site dryness | FAERS: 87 | US FAERS | |
| 34 | Nausea | FAERS: 82 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 35 | Incorrect dose administered | FAERS: 76 | US FAERS | |
| 36 | Feeling abnormal | FAERS: 75 | US FAERS | |
| 37 | Pruritus | FAERS: 75 | US FAERS | |
| 38 | Mood swings | FAERS: 64 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 39 | Anger | FAERS: 63 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 40 | Dizziness | FAERS: 62 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 41 | Application site burn | FAERS: 61 | US FAERS | |
| 42 | Malaise | FAERS: 60 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 43 | Vomiting | FAERS: 59 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 44 | Depressed mood | FAERS: 56 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 45 | Fatigue | FAERS: 55 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 46 | Incorrect product storage | FAERS: 54 | US FAERS | |
| 47 | Somnolence | FAERS: 51 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 48 | Hypersensitivity | FAERS: 49 | US FAERS | |
| 49 | Application site erosion | FAERS: 48 | US FAERS | |
| 50 | Tremor | FAERS: 46 | US FAERS | |
| 51 | Application site exfoliation | FAERS: 45 | US FAERS | |
| 52 | Emotional disorder | FAERS: 42 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 53 | Erythema | FAERS: 42 | US FAERS | |
| 54 | Application site scab | FAERS: 38 | US FAERS | |
| 55 | Restlessness | FAERS: 38 | US FAERS | |
| 56 | Chest Pain | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 57 | Abdominal discomfort | FAERS: 36 | US FAERS | |
| 58 | Nervousness | FAERS: 34 | US FAERS | |
| 59 | Product substitution issue | FAERS: 34 | US FAERS | |
| 60 | Lethargy | FAERS: 33 | US FAERS | |
| 61 | Drug withdrawal syndrome | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 62 | Expired drug administered | FAERS: 31 | US FAERS | |
| 63 | Pharmaceutical product complaint | FAERS: 31 | US FAERS | |
| 64 | Paranoia | FAERS: 30 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 65 | Palpitations | FAERS: 29 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 66 | Urticaria | FAERS: 28 | US FAERS | |
| 67 | Drug diversion | FAERS: 27 | US FAERS | |
| 68 | Screaming | FAERS: 27 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 69 | Therapeutic response unexpected | FAERS: 27 | US FAERS | |
| 70 | Feeling jittery | FAERS: 26 | US FAERS | |
| 71 | Vitiligo | FAERS: 26 | US FAERS | |
| 72 | Application site reaction | FAERS: 25 | US FAERS | |
| 73 | Skin irritation | FAERS: 24 | US FAERS | |
| 74 | Product dose omission | FAERS: 23 | US FAERS | |
| 75 | Application site discomfort | FAERS: 22 | US FAERS | |
| 76 | Expired product administered | FAERS: 22 | US FAERS | |
| 77 | Abdominal Pain | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 78 | Initial insomnia | FAERS: 21 | US FAERS | |
| 79 | Product administered at inappropriate site | FAERS: 21 | US FAERS | |
| 80 | Tachycardia | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 81 | Visual Impairment | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 82 | Alopecia | FAERS: 19 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 83 | Asthenia | FAERS: 19 | US FAERS | |
| 84 | Drug dispensing error | FAERS: 19 | US FAERS | |
| 85 | Growth retardation | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 86 | Application site inflammation | FAERS: 17 | US FAERS | |
| 87 | Application site ulcer | FAERS: 17 | US FAERS | |
| 88 | Excessive eye blinking | FAERS: 16 | US FAERS | |
| 89 | Flushing | FAERS: 16 | US FAERS | |
| 90 | Application site warmth | FAERS: 14 | US FAERS | |
| 91 | Incorrect route of drug administration | FAERS: 14 | US FAERS | |
| 92 | Pain | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 93 | Emotional distress | FAERS: 13 | US FAERS | |
| 94 | Intentional drug misuse | FAERS: 13 | US FAERS | |
| 95 | Medication Error | FAERS: 13 | US FAERS | |
| 96 | Personality Change | FAERS: 13 | US FAERS | |
| 97 | Adverse event | FAERS: 12 | US FAERS | |
| 98 | Application site hypersensitivity | FAERS: 12 | US FAERS | |
| 99 | Hostility | FAERS: 12 | US FAERS | |
| 100 | Mydriasis | FAERS: 12 | US FAERS | |
| 101 | Negativism | FAERS: 12 | US FAERS | |
| 102 | Product packaging quantity issue | FAERS: 12 | US FAERS | |
| 103 | Memory impairment | FAERS: 11 | US FAERS | |
| 104 | Formication | FAERS: 10 | US FAERS | |
| 105 | Obsessive-Compulsive Disorder | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 106 | Pallor | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 107 | Suicide attempt | FAERS: 10 | US FAERS | |
| 108 | Application site papules | FAERS: 9 | US FAERS | |
| 109 | Application site scar | FAERS: 9 | US FAERS | |
| 110 | Change in sustained attention | FAERS: 9 | US FAERS | |
| 111 | Intentional product misuse | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 112 | Nasopharyngitis | FAERS: 9 | US FAERS | |
| 113 | Product physical issue | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 114 | Rebound effect | FAERS: 9 | US FAERS | |
| 115 | Sluggishness | FAERS: 9 | US FAERS | |
| 116 | Dysphemia | FAERS: 8 | US FAERS | |
| 117 | Inappropriate schedule of drug administration | FAERS: 8 | US FAERS | |
| 118 | Oropharyngeal pain | FAERS: 8 | US FAERS | |
| 119 | Performance status decreased | FAERS: 8 | US FAERS | |
| 120 | Psychological Trauma | FAERS: 8 | US FAERS | |
| 121 | Syncope | FAERS: 8 | US FAERS | |
| 122 | Application site laceration | FAERS: 7 | US FAERS | |
| 123 | Blepharospasm | FAERS: 7 | US FAERS | |
| 124 | Dehydration | FAERS: 7 | US FAERS | |
| 125 | Drug administered to patient of inappropriate age | FAERS: 7 | US FAERS | |
| 126 | Drug effect incomplete | FAERS: 7 | US FAERS | |
| 127 | Dyspepsia | FAERS: 7 | US FAERS | |
| 128 | Dystonia | FAERS: 7 | US FAERS | |
| 129 | Hunger | FAERS: 7 | US FAERS | |
| 130 | Rash erythematous | FAERS: 7 | US FAERS | |
| 131 | Staring | FAERS: 7 | US FAERS | |
| 132 | Amnesia | FAERS: 6 | US FAERS | |
| 133 | Back Pain | FAERS: 6 | US FAERS | |
| 134 | Chest discomfort | FAERS: 6 | US FAERS | |
| 135 | Disorientation | FAERS: 6 | US FAERS | |
| 136 | Enuresis | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 137 | Hallucinations, mixed | FAERS: 6 | US FAERS | |
| 138 | Intentional self-injury | FAERS: 6 | US FAERS | |
| 139 | Lip swelling | FAERS: 6 | US FAERS | |
| 140 | Physical assault | FAERS: 6 | US FAERS | |
| 141 | Product administration error | FAERS: 6 | US FAERS | |
| 142 | Product outer packaging issue | FAERS: 6 | US FAERS | |
| 143 | Retching | FAERS: 6 | US FAERS | |
| 144 | Skin reaction | FAERS: 6 | US FAERS | |
| 145 | Therapeutic response delayed | FAERS: 6 | US FAERS | |
| 146 | Trichotillomania | FAERS: 6 | US FAERS | |
| 147 | Unevaluable event | FAERS: 6 | US FAERS | |
| 148 | Acne | FAERS: 5 | US FAERS | |
| 149 | Acute myocardial infarction | FAERS: 5 | US FAERS | |
| 150 | Amphetamines positive | FAERS: 5 | US FAERS | |
| 151 | Blood glucose decreased | FAERS: 5 | US FAERS | |
| 152 | Cyanosis | FAERS: 5 | US FAERS | |
| 153 | Dysarthria | FAERS: 5 | US FAERS | |
| 154 | Eczema | FAERS: 5 | US FAERS | |
| 155 | Epistaxis | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 156 | Eye pain | FAERS: 5 | US FAERS | |
| 157 | Hyperphagia | FAERS: 5 | US FAERS | |
| 158 | Inappropriate affect | FAERS: 5 | US FAERS | |
| 159 | Poor quality sleep | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 160 | Product packaging issue | FAERS: 5 | US FAERS | |
| 161 | Product prescribing error | FAERS: 5 | US FAERS | |
| 162 | Product storage error | FAERS: 5 | US FAERS | |
| 163 | Product use issue | FAERS: 5 | US FAERS | |
| 164 | Stress | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 165 | Swelling | FAERS: 5 | US FAERS | |
| 166 | White blood cell count decreased | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 167 | Akathisia | FAERS: 4 | US FAERS | |
| 168 | Altered state of consciousness | FAERS: 4 | US FAERS | |
| 169 | Angina Pectoris | FAERS: 4 | US FAERS | |
| 170 | Application site discharge | FAERS: 4 | US FAERS | |
| 171 | Application site induration | FAERS: 4 | US FAERS | |
| 172 | Application site infection | FAERS: 4 | US FAERS | |
| 173 | Blindness | FAERS: 4 | US FAERS | |
| 174 | Blood creatine phosphokinase increased | FAERS: 4 | US FAERS | |
| 175 | Bruxism | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 176 | Carotid Artery Thrombosis | FAERS: 4 | US FAERS | |
| 177 | Catatonia | FAERS: 4 | US FAERS | |
| 178 | Depressed Level of Consciousness | FAERS: 4 | US FAERS | |
| 179 | Drug Dependence | FAERS: 4 | US FAERS | |
| 180 | Drug abuse | FAERS: 4 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 181 | Dysgeusia | FAERS: 4 | US FAERS | |
| 182 | Electrocardiogram abnormal | FAERS: 4 | US FAERS | |
| 183 | Flat affect | FAERS: 4 | US FAERS | |
| 184 | General physical health deterioration | FAERS: 4 | US FAERS | |
| 185 | Hypersomnia | FAERS: 4 | US FAERS | |
| 186 | Hypophagia | FAERS: 4 | US FAERS | |
| 187 | Influenza | FAERS: 4 | US FAERS | |
| 188 | Musculoskeletal stiffness | FAERS: 4 | US FAERS | |
| 189 | Negative thoughts | FAERS: 4 | US FAERS | |
| 190 | Stevens-Johnson Syndrome | FAERS: 4 | US FAERS | |
| 191 | Supraventricular tachycardia | FAERS: 4 | US FAERS | |
| 192 | Unresponsive to stimuli | FAERS: 4 | US FAERS | |
| 193 | Urinary Incontinence | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 194 | Accessory cardiac pathway | FAERS: 3 | US FAERS | |
| 195 | Accidental overdose | FAERS: 3 | US FAERS | |
| 196 | Application site excoriation | FAERS: 3 | US FAERS | |
| 197 | Aspartate Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 198 | Bipolar Disorder | FAERS: 3 | US FAERS | |
| 199 | Blood glucose increased | FAERS: 3 | US FAERS | |
| 200 | Burning sensation | FAERS: 3 | US FAERS | |
| 201 | Cerebral disorder | FAERS: 3 | US FAERS | |
| 202 | Constipation | FAERS: 3 | US FAERS | |
| 203 | Diabetes Mellitus | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 204 | Drug effect variable | FAERS: 3 | US FAERS | |
| 205 | Drug ineffective for unapproved indication | FAERS: 3 | US FAERS | |
| 206 | Drug toxicity | FAERS: 3 | US FAERS | |
| 207 | Drug withdrawal headache | FAERS: 3 | US FAERS | |
| 208 | Epilepsy | FAERS: 3 | US FAERS | |
| 209 | Eye irritation | FAERS: 3 | US FAERS | |
| 210 | Feeling Cold | FAERS: 3 | US FAERS | |
| 211 | Hyperacusis | FAERS: 3 | US FAERS | |
| 212 | Impaired work ability | FAERS: 3 | US FAERS | |
| 213 | Incorrect product administration duration | FAERS: 3 | US FAERS | |
| 214 | Infectious Mononucleosis | FAERS: 3 | US FAERS | |
| 215 | Loss of personal independence in daily activities | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 216 | Malnutrition | FAERS: 3 | US FAERS | |
| 217 | Maternal exposure during pregnancy | FAERS: 3 | US FAERS | |
| 218 | Mental impairment | FAERS: 3 | US FAERS | |
| 219 | Nail picking | FAERS: 3 | US FAERS | |
| 220 | Neck Pain | FAERS: 3 | US FAERS | |
| 221 | Petechiae | FAERS: 3 | US FAERS | |
| 222 | Purpura | FAERS: 3 | US FAERS | |
| 223 | Sinus Arrhythmia | FAERS: 3 | US FAERS | |
| 224 | Tardive Dyskinesia | FAERS: 3 | US FAERS | |
| 225 | Thirst | FAERS: 3 | US FAERS | |
| 226 | Throat irritation | FAERS: 3 | US FAERS | |
| 227 | Thrombocytopenia | FAERS: 3 | US FAERS | |
| 228 | Tinnitus | FAERS: 3 | US FAERS | |
| 229 | Troponin increased | FAERS: 3 | US FAERS | |
| 230 | jaundice | FAERS: 3 | US FAERS | |
| 231 | Accidental exposure to product by child | FAERS: 2 | US FAERS | |
| 232 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 233 | Alanine Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 234 | Angioedema | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 235 | Ankle Fracture | FAERS: 2 | US FAERS | |
| 236 | Anorexia | FAERS: 2 | US FAERS | |
| 237 | Aphasia | FAERS: 2 | US FAERS | |
| 238 | Appendicitis | FAERS: 2 | US FAERS | |
| 239 | Arthralgia | FAERS: 2 | US FAERS | |
| 240 | Asthma | FAERS: 2 | US FAERS | |
| 241 | Breast hyperplasia | FAERS: 2 | US FAERS | |
| 242 | Capsule physical issue | FAERS: 2 | US FAERS | |
| 243 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 244 | Chills | FAERS: 2 | US FAERS | |
| 245 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 246 | Cold sweat | FAERS: 2 | US FAERS | |
| 247 | Completed Suicide | FAERS: 2 | US FAERS | |
| 248 | Concomitant disease aggravated | FAERS: 2 | US FAERS | |
| 249 | Delusional perception | FAERS: 2 | US FAERS | |
| 250 | Drug level decreased | FAERS: 2 | US FAERS | |
| 251 | Drug screen negative | FAERS: 2 | US FAERS | |
| 252 | Erectile dysfunction | FAERS: 2 | US FAERS | |
| 253 | Erection increased | FAERS: 2 | US FAERS | |
| 254 | Eructation | FAERS: 2 | US FAERS | |
| 255 | Euphoric mood | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 256 | Head Banging | FAERS: 2 | US FAERS | |
| 257 | Head discomfort | FAERS: 2 | US FAERS | |
| 258 | Head titubation | FAERS: 2 | US FAERS | |
| 259 | Hypermetabolism | FAERS: 2 | US FAERS | |
| 260 | Hyperventilation | FAERS: 2 | US FAERS | |
| 261 | Hypokinesia | FAERS: 2 | US FAERS | |
| 262 | Hypotension | FAERS: 2 | US FAERS | |
| 263 | Incoherent | FAERS: 2 | US FAERS | |
| 264 | Intracranial Aneurysm | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 265 | Joint stiffness | FAERS: 2 | US FAERS | |
| 266 | Lymphadenopathy | FAERS: 2 | US FAERS | |
| 267 | Multiple allergies | FAERS: 2 | US FAERS | |
| 268 | Muscle tightness | FAERS: 2 | US FAERS | |
| 269 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 270 | Myalgia | FAERS: 2 | US FAERS | |
| 271 | Narcolepsy | FAERS: 2 | US FAERS | |
| 272 | Oculogyric crisis | FAERS: 2 | US FAERS | |
| 273 | Oppositional Defiant Disorder | FAERS: 2 | US FAERS | |
| 274 | Optic Neuritis | FAERS: 2 | US FAERS | |
| 275 | Oral candidiasis | FAERS: 2 | US FAERS | |
| 276 | Panic Disorder | FAERS: 2 | US FAERS | |
| 277 | Papule | FAERS: 2 | US FAERS | |
| 278 | Pharyngitis | FAERS: 2 | US FAERS | |
| 279 | Photophobia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 280 | Poor quality drug administered | FAERS: 2 | US FAERS | |
| 281 | Prescribed underdose | FAERS: 2 | US FAERS | |
| 282 | Priapism | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 283 | Product formulation issue | FAERS: 2 | US FAERS | |
| 284 | Product measured potency issue | FAERS: 2 | US FAERS | |
| 285 | Product use complaint | FAERS: 2 | US FAERS | |
| 286 | Psychotic symptom | FAERS: 2 | US FAERS | |
| 287 | Rheumatoid Arthritis | FAERS: 2 | US FAERS | |
| 288 | Sexual activity increased | FAERS: 2 | US FAERS | |
| 289 | Sinus bradycardia | FAERS: 2 | US FAERS | |
| 290 | Sinusitis | FAERS: 2 | US FAERS | |
| 291 | Skin Ulcer | FAERS: 2 | US FAERS | |
| 292 | Slow speech | FAERS: 2 | US FAERS | |
| 293 | Somnambulism | FAERS: 2 | US FAERS | |
| 294 | Therapeutic product effect decreased | FAERS: 2 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 295 | Therapeutic product effect delayed | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 296 | Therapeutic product effect increased | FAERS: 2 | US FAERS | |
| 297 | Therapeutic response changed | FAERS: 2 | US FAERS | |
| 298 | Ventricular Fibrillation | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 299 | Ventricular hypertrophy | FAERS: 2 | US FAERS | |
| 300 | Yawning | FAERS: 2 | US FAERS | |
| 301 | treatment failure | FAERS: 2 | US FAERS | |
| 302 | Abasia | FAERS: 1 | US FAERS | |
| 303 | Acarodermatitis | FAERS: 1 | US FAERS | |
| 304 | Apparent death | FAERS: 1 | US FAERS | |
| 305 | Application site alopecia | FAERS: 1 | US FAERS | |
| 306 | Application site eczema | FAERS: 1 | US FAERS | |
| 307 | Application site fissure | FAERS: 1 | US FAERS | |
| 308 | Arachnophobia | FAERS: 1 | US FAERS | |
| 309 | Asphyxia | FAERS: 1 | US FAERS | |
| 310 | Atrial tachycardia | FAERS: 1 | US FAERS | |
| 311 | Aura | FAERS: 1 | US FAERS | |
| 312 | Back disorder | FAERS: 1 | US FAERS | |
| 313 | Biopsy bone marrow abnormal | FAERS: 1 | US FAERS | |
| 314 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 315 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 316 | Blood heavy metal abnormal | FAERS: 1 | US FAERS | |
| 317 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 318 | Blood urine present | FAERS: 1 | US FAERS | |
| 319 | Blood zinc decreased | FAERS: 1 | US FAERS | |
| 320 | Body height below normal | FAERS: 1 | US FAERS | |
| 321 | Boredom | FAERS: 1 | US FAERS | |
| 322 | Brain scan abnormal | FAERS: 1 | US FAERS | |
| 323 | Breast discomfort | FAERS: 1 | US FAERS | |
| 324 | Burn infection | FAERS: 1 | US FAERS | |
| 325 | Cachexia | FAERS: 1 | US FAERS | |
| 326 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 327 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 328 | Cataract | FAERS: 1 | US FAERS | |
| 329 | Cerebral Palsy | FAERS: 1 | US FAERS | |
| 330 | Cluster Headache | FAERS: 1 | US FAERS | |
| 331 | Cogwheel Rigidity | FAERS: 1 | US FAERS | |
| 332 | Colitis | FAERS: 1 | US FAERS | |
| 333 | Complex partial seizures | FAERS: 1 | US FAERS | |
| 334 | Compulsive lip biting | FAERS: 1 | US FAERS | |
| 335 | Conduct Disorder | FAERS: 1 | US FAERS | |
| 336 | Conversion disorder | FAERS: 1 | US FAERS | |
| 337 | Cystic Fibrosis | FAERS: 1 | US FAERS | |
| 338 | Dark circles under eyes | FAERS: 1 | US FAERS | |
| 339 | Deformity | FAERS: 1 | US FAERS | |
| 340 | Dental caries | FAERS: 1 | US FAERS | |
| 341 | Dependence | FAERS: 1 | US FAERS | |
| 342 | Depression suicidal | FAERS: 1 | US FAERS | |
| 343 | Dermatitis | FAERS: 1 | US FAERS | |
| 344 | Device Failure | FAERS: 1 | US FAERS | |
| 345 | Device adhesion issue | FAERS: 1 | US FAERS | |
| 346 | Device damage | FAERS: 1 | US FAERS | |
| 347 | Device difficult to use | FAERS: 1 | US FAERS | |
| 348 | Device malfunction | FAERS: 1 | US FAERS | |
| 349 | Diplopia | FAERS: 1 | US FAERS | |
| 350 | Discomfort | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 351 | Disease Progression | FAERS: 1 | US FAERS | |
| 352 | Drooling | FAERS: 1 | US FAERS | |
| 353 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 354 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 355 | Drug monitoring procedure not performed | FAERS: 1 | US FAERS | |
| 356 | Drug screen positive | FAERS: 1 | US FAERS | |
| 357 | Dry skin | FAERS: 1 | US FAERS | |
| 358 | Dysgraphia | FAERS: 1 | US FAERS | |
| 359 | Dyslexia | FAERS: 1 | US FAERS | |
| 360 | Dysuria | FAERS: 1 | US FAERS | |
| 361 | Ear discomfort | FAERS: 1 | US FAERS | |
| 362 | Economic problem | FAERS: 1 | US FAERS | |
| 363 | Epiphyseal injury | FAERS: 1 | US FAERS | |
| 364 | Erythema Infectiosum | FAERS: 1 | US FAERS | |
| 365 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 366 | Exophthalmos | FAERS: 1 | US FAERS | |
| 367 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 368 | Facial paralysis | FAERS: 1 | US FAERS | |
| 369 | Fibromuscular Dysplasia | FAERS: 1 | US FAERS | |
| 370 | Flank Pain | FAERS: 1 | US FAERS | |
| 371 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 372 | Foreign body trauma | FAERS: 1 | US FAERS | |
| 373 | Frustration tolerance decreased | FAERS: 1 | US FAERS | |
| 374 | Frustration | FAERS: 1 | US FAERS | |
| 375 | Gastric Lavage | FAERS: 1 | US FAERS | |
| 376 | Gastrointestinal viral infection | FAERS: 1 | US FAERS | |
| 377 | General symptom | FAERS: 1 | US FAERS | |
| 378 | Genital discomfort | FAERS: 1 | US FAERS | |
| 379 | Glaucoma | FAERS: 1 | US FAERS | |
| 380 | Heart sounds abnormal | FAERS: 1 | US FAERS | |
| 381 | Heat Exhaustion | FAERS: 1 | US FAERS | |
| 382 | Heat Stroke | FAERS: 1 | US FAERS | |
| 383 | Hormone level abnormal | FAERS: 1 | US FAERS | |
| 384 | Hypervigilance | FAERS: 1 | US FAERS | |
| 385 | Hypomania | FAERS: 1 | US FAERS | |
| 386 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 387 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 388 | Impaired reasoning | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 389 | Impetigo | FAERS: 1 | US FAERS | |
| 390 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 391 | Incorrect disposal of product | FAERS: 1 | US FAERS | |
| 392 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 393 | Inflammation | FAERS: 1 | US FAERS | |
| 394 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 395 | Intercepted drug prescribing error | FAERS: 1 | US FAERS | |
| 396 | Intercepted wrong patient selected | FAERS: 1 | US FAERS | |
| 397 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 398 | Investigation abnormal | FAERS: 1 | US FAERS | |
| 399 | Leukoderma | FAERS: 1 | US FAERS | |
| 400 | Limb discomfort | FAERS: 1 | US FAERS | |
| 401 | Liquid product physical issue | FAERS: 1 | US FAERS | |
| 402 | Macular degeneration | FAERS: 1 | US FAERS | |
| 403 | Medical device complication | FAERS: 1 | US FAERS | |
| 404 | Mental status changes | FAERS: 1 | US FAERS | |
| 405 | Metabolic function test abnormal | FAERS: 1 | US FAERS | |
| 406 | Metamorphopsia | FAERS: 1 | US FAERS | |
| 407 | Middle insomnia | FAERS: 1 | US FAERS | |
| 408 | Mixed liver injury | FAERS: 1 | US FAERS | |
| 409 | Multi-organ disorder | FAERS: 1 | US FAERS | |
| 410 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 411 | Muscle Spasticity | FAERS: 1 | US FAERS | |
| 412 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 413 | Myoglobinuria | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 414 | Myopia | FAERS: 1 | US FAERS | |
| 415 | Neuralgia | FAERS: 1 | US FAERS | |
| 416 | Neuroleptic Malignant Syndrome | FAERS: 1 | US FAERS | |
| 417 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 418 | Night sweats | FAERS: 1 | US FAERS | |
| 419 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 420 | Nuchal Rigidity | FAERS: 1 | US FAERS | |
| 421 | Obsessive thoughts | FAERS: 1 | US FAERS | |
| 422 | Obsessive-compulsive symptom | FAERS: 1 | US FAERS | |
| 423 | Opiates positive | FAERS: 1 | US FAERS | |
| 424 | Oral pain | FAERS: 1 | US FAERS | |
| 425 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 426 | Osteopenia | FAERS: 1 | US FAERS | |
| 427 | Palmar erythema | FAERS: 1 | US FAERS | |
| 428 | Pityriasis Rosea | FAERS: 1 | US FAERS | |
| 429 | Pneumonia | FAERS: 1 | US FAERS | |
| 430 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 431 | Potentiating drug interaction | FAERS: 1 | US FAERS | |
| 432 | Pregnancy | FAERS: 1 | US FAERS | |
| 433 | Premature Ejaculation | FAERS: 1 | US FAERS | |
| 434 | Pressure of speech | FAERS: 1 | US FAERS | |
| 435 | Presyncope | FAERS: 1 | US FAERS | |
| 436 | Product container seal issue | FAERS: 1 | US FAERS | |
| 437 | Product contamination | FAERS: 1 | US FAERS | |
| 438 | Product distribution issue | FAERS: 1 | US FAERS | |
| 439 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 440 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 441 | Psychogenic seizure | FAERS: 1 | US FAERS | |
| 442 | Removal of foreign body from gastrointestinal tract | FAERS: 1 | US FAERS | |
| 443 | Respiratory distress | FAERS: 1 | US FAERS | |
| 444 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 445 | Rhabdomyolysis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 446 | Scab | FAERS: 1 | US FAERS | |
| 447 | Scarlet Fever | FAERS: 1 | US FAERS | |
| 448 | Schizophrenia | FAERS: 1 | US FAERS | |
| 449 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 450 | Self-induced vomiting | FAERS: 1 | US FAERS | |
| 451 | Sensory processing disorder | FAERS: 1 | US FAERS | |
| 452 | Sepsis | FAERS: 1 | US FAERS | |
| 453 | Skin lesion | FAERS: 1 | US FAERS | |
| 454 | Soliloquy | FAERS: 1 | US FAERS | |
| 455 | Somatic symptom disorder | FAERS: 1 | US FAERS | |
| 456 | Stomatitis | FAERS: 1 | US FAERS | |
| 457 | Strabismus | FAERS: 1 | US FAERS | |
| 458 | Stubbornness | FAERS: 1 | US FAERS | |
| 459 | Sudden death | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 460 | Sunburn | FAERS: 1 | US FAERS | |
| 461 | Syringe issue | FAERS: 1 | US FAERS | |
| 462 | Tension | FAERS: 1 | US FAERS | |
| 463 | Therapeutic drug monitoring analysis incorrectly performed | FAERS: 1 | US FAERS | |
| 464 | Therapeutic product effect incomplete | FAERS: 1 | US FAERS | |
| 465 | Therapeutic response unexpected with drug substitution | FAERS: 1 | US FAERS | |
| 466 | Therapy non-responder | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 467 | Thirst decreased | FAERS: 1 | US FAERS | |
| 468 | Thyroiditis | FAERS: 1 | US FAERS | |
| 469 | Tongue movement disturbance | FAERS: 1 | US FAERS | |
| 470 | Torticollis | FAERS: 1 | US FAERS | |
| 471 | Transcription medication error | FAERS: 1 | US FAERS | |
| 472 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 473 | Tuberculosis | FAERS: 1 | US FAERS | |
| 474 | Ulcer | FAERS: 1 | US FAERS | |
| 475 | Underweight | FAERS: 1 | US FAERS | |
| 476 | Urinary Retention | FAERS: 1 | US FAERS | |
| 477 | Urine amphetamine positive | FAERS: 1 | US FAERS | |
| 478 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 479 | Varicocele | FAERS: 1 | US FAERS | |
| 480 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 481 | Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 482 | Vertebral wedging | FAERS: 1 | US FAERS | |
| 483 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 484 | Visual disturbance | FAERS: 1 | US FAERS | |
| 485 | Vitamin B6 decreased | FAERS: 1 | US FAERS | |
| 486 | Vulvovaginal mycotic infection | FAERS: 1 | US FAERS | |
| 487 | Wrong patient received medication | FAERS: 1 | US FAERS | |
| 488 | nervous system disorder | FAERS: 1 | US FAERS | |
| 489 | Apathy | Canada Vigilance: 1 | Canada Vigilance | |
| 490 | Egocentrism | Canada Vigilance: 1 | Canada Vigilance | |
| 491 | Intellectual Disability | Canada Vigilance: 1 | Canada Vigilance | |
| 492 | Intentional product use issue | Canada Vigilance: 1 | Canada Vigilance | |
| 493 | Product complaint | Canada Vigilance: 1 | Canada Vigilance | |
| 494 | Product residue present | Canada Vigilance: 1 | Canada Vigilance | |
| 495 | Sudden Cardiac Death | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.