Cabozantinib S-malate
(HFCFMRYTXDINDK-WNQIDUERSA-N)
Structure
- SMILES
- OC(=O)C[C@@H](C(=O)O)O.COc1cc2c(ccnc2cc1OC)Oc1ccc(cc1)NC(=O)C1(CC1)C(=O)Nc1ccc(cc1)F
- Molecular Formula:
- C32H30FN3O10
- Molecular Weight:
- 635.593
- Log P:
- 4.5934
- Hydrogen Bond Acceptor:
- 13
- Hydrogen Bond Donor:
- 5
- TPSA:
- 193.61
- CAS Number(s):
- 942407-59-2; 1140909-48-3
Synonym(s)
1.
Cabozantinib S-malate
External Link(s)
| PubChem Compound | 25102846 |
| ChEBI | 72319 |
| CHEMBL | CHEMBL2103868 |
| KEGG | dr:D10095 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Fatigue | FAERS: 466 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 2 | Nausea | FAERS: 294 | US FAERS | |
| 3 | Malignant neoplasm progression | FAERS: 230 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 4 | Stomatitis | FAERS: 183 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Weight decreased | FAERS: 173 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 6 | Vomiting | FAERS: 126 | US FAERS | |
| 7 | Asthenia | FAERS: 124 | US FAERS | |
| 8 | Constipation | FAERS: 121 | US FAERS | |
| 9 | Dysgeusia | FAERS: 107 | US FAERS | |
| 10 | Oral pain | FAERS: 105 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 11 | Dysphonia | FAERS: 97 | US FAERS | |
| 12 | Skin Ulcer | FAERS: 92 | US FAERS | |
| 13 | Malaise | FAERS: 87 | US FAERS | |
| 14 | Dry skin | FAERS: 78 | US FAERS | |
| 15 | Drug ineffective | FAERS: 76 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 16 | Headache | FAERS: 70 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | Dizziness | FAERS: 69 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 18 | Erythema | FAERS: 64 | US FAERS | |
| 19 | Arthralgia | FAERS: 62 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 20 | Pain | FAERS: 62 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 21 | Dehydration | FAERS: 61 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 22 | Alopecia | FAERS: 58 | US FAERS | |
| 23 | Oropharyngeal pain | FAERS: 57 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 24 | Abdominal discomfort | FAERS: 52 | US FAERS | |
| 25 | Pruritus | FAERS: 49 | US FAERS | |
| 26 | Peripheral swelling | FAERS: 47 | US FAERS | |
| 27 | Dyspepsia | FAERS: 42 | US FAERS | |
| 28 | Hypothyroidism | FAERS: 41 | US FAERS | |
| 29 | Back Pain | FAERS: 39 | US FAERS | |
| 30 | Pneumonia | FAERS: 38 | US FAERS | |
| 31 | Ageusia | FAERS: 37 | US FAERS | |
| 32 | Abdominal Pain | FAERS: 35 | US FAERS | |
| 33 | Flatulence | FAERS: 34 | US FAERS | |
| 34 | Pulmonary Embolism | FAERS: 33 | US FAERS | |
| 35 | Thrombosis | FAERS: 31 | US FAERS | |
| 36 | Burning sensation | FAERS: 29 | US FAERS | |
| 37 | Myalgia | FAERS: 29 | US FAERS | |
| 38 | Nasopharyngitis | FAERS: 29 | US FAERS | |
| 39 | Toxicity to various agents | FAERS: 29 | US FAERS | |
| 40 | Epistaxis | FAERS: 25 | US FAERS | |
| 41 | Urinary tract infection | FAERS: 25 | US FAERS | |
| 42 | Feeling abnormal | FAERS: 24 | US FAERS | |
| 43 | Hyperkeratosis | FAERS: 24 | US FAERS | |
| 44 | Lethargy | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Acne | FAERS: 21 | US FAERS | |
| 46 | Chest Pain | FAERS: 21 | US FAERS | |
| 47 | Bone pain | FAERS: 20 | US FAERS | |
| 48 | Memory impairment | FAERS: 20 | US FAERS | |
| 49 | Proteinuria | FAERS: 20 | US FAERS | |
| 50 | Adverse event | FAERS: 18 | US FAERS | |
| 51 | Cerebrovascular accident | FAERS: 18 | US FAERS | |
| 52 | Infection | FAERS: 18 | US FAERS | |
| 53 | Tongue discomfort | FAERS: 18 | US FAERS | |
| 54 | Alanine Aminotransferase Increased | FAERS: 16 | US FAERS | |
| 55 | Anxiety | FAERS: 16 | US FAERS | |
| 56 | Aphonia | FAERS: 16 | US FAERS | |
| 57 | Blood thyroid stimulating hormone increased | FAERS: 16 | US FAERS | |
| 58 | Skin lesion | FAERS: 16 | US FAERS | |
| 59 | General physical health deterioration | FAERS: 15 | US FAERS | |
| 60 | Influenza | FAERS: 15 | US FAERS | |
| 61 | Joint swelling | FAERS: 15 | US FAERS | |
| 62 | Sinusitis | FAERS: 15 | US FAERS | |
| 63 | Skin irritation | FAERS: 15 | US FAERS | |
| 64 | Somnolence | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 65 | Hypotension | FAERS: 14 | US FAERS | |
| 66 | Nasal discomfort | FAERS: 14 | US FAERS | |
| 67 | Pain of skin | FAERS: 14 | US FAERS | |
| 68 | Glossitis | FAERS: 13 | US FAERS | |
| 69 | Myocardial Infarction | FAERS: 13 | US FAERS | |
| 70 | Retching | FAERS: 13 | US FAERS | |
| 71 | Sepsis | FAERS: 13 | US FAERS | |
| 72 | Skin toxicity | FAERS: 13 | US FAERS | |
| 73 | Blood magnesium decreased | FAERS: 12 | US FAERS | |
| 74 | Gout | FAERS: 12 | US FAERS | |
| 75 | Throat irritation | FAERS: 12 | US FAERS | |
| 76 | Tongue blistering | FAERS: 12 | US FAERS | |
| 77 | Toothache | FAERS: 12 | US FAERS | |
| 78 | White blood cell count decreased | FAERS: 12 | US FAERS | |
| 79 | Amnesia | FAERS: 11 | US FAERS | |
| 80 | Chills | FAERS: 11 | US FAERS | |
| 81 | Depressed mood | FAERS: 11 | US FAERS | |
| 82 | Drug dose omission | FAERS: 11 | US FAERS | |
| 83 | Intestinal Obstruction | FAERS: 11 | US FAERS | |
| 84 | Neuralgia | FAERS: 11 | US FAERS | |
| 85 | Ejection Fraction Decreased | FAERS: 10 | US FAERS | |
| 86 | Hepatotoxicity | FAERS: 10 | US FAERS | |
| 87 | Limb discomfort | FAERS: 10 | US FAERS | |
| 88 | Swelling | FAERS: 10 | US FAERS | |
| 89 | Thrombocytopenia | FAERS: 10 | US FAERS | |
| 90 | Tremor | FAERS: 10 | US FAERS | |
| 91 | Visual Impairment | FAERS: 10 | US FAERS | |
| 92 | Blood sodium decreased | FAERS: 9 | US FAERS | |
| 93 | Disease Progression | FAERS: 9 | US FAERS | |
| 94 | Lower respiratory tract infection | FAERS: 9 | US FAERS | |
| 95 | Mouth swelling | FAERS: 9 | US FAERS | |
| 96 | Productive Cough | FAERS: 9 | US FAERS | |
| 97 | Transaminases increased | FAERS: 9 | US FAERS | |
| 98 | Wrong technique in product usage process | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 99 | Acute kidney injury | FAERS: 8 | US FAERS | |
| 100 | Feeling Cold | FAERS: 8 | US FAERS | |
| 101 | Genital rash | FAERS: 8 | US FAERS | |
| 102 | Inflammation | FAERS: 8 | US FAERS | |
| 103 | Ulcer | FAERS: 8 | US FAERS | |
| 104 | Blood creatinine increased | FAERS: 7 | US FAERS | |
| 105 | Blood potassium decreased | FAERS: 7 | US FAERS | |
| 106 | Blood potassium increased | FAERS: 7 | US FAERS | |
| 107 | Blood pressure fluctuation | FAERS: 7 | US FAERS | |
| 108 | Blood urine present | FAERS: 7 | US FAERS | |
| 109 | Discomfort | FAERS: 7 | US FAERS | |
| 110 | Disorientation | FAERS: 7 | US FAERS | |
| 111 | Hypersomnia | FAERS: 7 | US FAERS | |
| 112 | Hyperthyroidism | FAERS: 7 | US FAERS | |
| 113 | Musculoskeletal stiffness | FAERS: 7 | US FAERS | |
| 114 | Product dose omission | FAERS: 7 | US FAERS | |
| 115 | Therapy cessation | FAERS: 7 | US FAERS | |
| 116 | Arthropathy | FAERS: 6 | US FAERS | |
| 117 | Aspartate Aminotransferase Increased | FAERS: 6 | US FAERS | |
| 118 | Blood alkaline phosphatase increased | FAERS: 6 | US FAERS | |
| 119 | Blood glucose decreased | FAERS: 6 | US FAERS | |
| 120 | Cataract | FAERS: 6 | US FAERS | |
| 121 | Colitis | FAERS: 6 | US FAERS | |
| 122 | Dysuria | FAERS: 6 | US FAERS | |
| 123 | Gastric ulcer | FAERS: 6 | US FAERS | |
| 124 | Gastrointestinal perforation | FAERS: 6 | US FAERS | |
| 125 | Large intestine perforation | FAERS: 6 | US FAERS | |
| 126 | Musculoskeletal Pain | FAERS: 6 | US FAERS | |
| 127 | Night sweats | FAERS: 6 | US FAERS | |
| 128 | Osteonecrosis of Jaw | FAERS: 6 | US FAERS | |
| 129 | Performance status decreased | FAERS: 6 | US FAERS | |
| 130 | Skin reaction | FAERS: 6 | US FAERS | |
| 131 | Therapeutic response unexpected | FAERS: 6 | US FAERS | |
| 132 | Anorectal discomfort | FAERS: 5 | US FAERS | |
| 133 | Blood cholesterol increased | FAERS: 5 | US FAERS | |
| 134 | Blood glucose increased | FAERS: 5 | US FAERS | |
| 135 | Bronchitis | FAERS: 5 | US FAERS | |
| 136 | Cancer Pain | FAERS: 5 | US FAERS | |
| 137 | Cheilitis | FAERS: 5 | US FAERS | |
| 138 | Chromaturia | FAERS: 5 | US FAERS | |
| 139 | Cold sweat | FAERS: 5 | US FAERS | |
| 140 | Dermatitis | FAERS: 5 | US FAERS | |
| 141 | Diverticulitis | FAERS: 5 | US FAERS | |
| 142 | Flushing | FAERS: 5 | US FAERS | |
| 143 | Gait inability | FAERS: 5 | US FAERS | |
| 144 | Hospice Care | FAERS: 5 | US FAERS | |
| 145 | Lymphadenopathy | FAERS: 5 | US FAERS | |
| 146 | Osteomyelitis | FAERS: 5 | US FAERS | |
| 147 | Pancreatitis | FAERS: 5 | US FAERS | |
| 148 | Secretion discharge | FAERS: 5 | US FAERS | |
| 149 | Stress | FAERS: 5 | US FAERS | |
| 150 | Tachycardia | FAERS: 5 | US FAERS | |
| 151 | Therapy change | FAERS: 5 | US FAERS | |
| 152 | Wound Infection | FAERS: 5 | US FAERS | |
| 153 | Acute myocardial infarction | FAERS: 4 | US FAERS | |
| 154 | Arthritis | FAERS: 4 | US FAERS | |
| 155 | Atrial Fibrillation | FAERS: 4 | US FAERS | |
| 156 | Chest discomfort | FAERS: 4 | US FAERS | |
| 157 | Cholecystitis | FAERS: 4 | US FAERS | |
| 158 | Clostridium difficile infection | FAERS: 4 | US FAERS | |
| 159 | Cystitis | FAERS: 4 | US FAERS | |
| 160 | Deep Vein Thrombosis | FAERS: 4 | US FAERS | |
| 161 | Electrolyte imbalance | FAERS: 4 | US FAERS | |
| 162 | Eructation | FAERS: 4 | US FAERS | |
| 163 | Facial Pain | FAERS: 4 | US FAERS | |
| 164 | Gastrointestinal toxicity | FAERS: 4 | US FAERS | |
| 165 | Hypersensitivity | FAERS: 4 | US FAERS | |
| 166 | Incorrect dose administered | FAERS: 4 | US FAERS | |
| 167 | Intestinal Perforation | FAERS: 4 | US FAERS | |
| 168 | Limb injury | FAERS: 4 | US FAERS | |
| 169 | Loss of personal independence in daily activities | FAERS: 4 | US FAERS | |
| 170 | Musculoskeletal discomfort | FAERS: 4 | US FAERS | |
| 171 | Neutropenia | FAERS: 4 | US FAERS | |
| 172 | Onychalgia | FAERS: 4 | US FAERS | |
| 173 | Palpitations | FAERS: 4 | US FAERS | |
| 174 | Pathological fracture | FAERS: 4 | US FAERS | |
| 175 | Photophobia | FAERS: 4 | US FAERS | |
| 176 | Posterior reversible encephalopathy syndrome | FAERS: 4 | US FAERS | |
| 177 | Respiratory Failure | FAERS: 4 | US FAERS | |
| 178 | Scab | FAERS: 4 | US FAERS | |
| 179 | Skin Erosion | FAERS: 4 | US FAERS | |
| 180 | Sluggishness | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 181 | Upper-airway cough syndrome | FAERS: 4 | US FAERS | |
| 182 | Urinary Retention | FAERS: 4 | US FAERS | |
| 183 | Wound dehiscence | FAERS: 4 | US FAERS | |
| 184 | skin abrasion | FAERS: 4 | US FAERS | |
| 185 | Acute respiratory failure | FAERS: 3 | US FAERS | |
| 186 | Anal Fistula | FAERS: 3 | US FAERS | |
| 187 | Arthropod bite | FAERS: 3 | US FAERS | |
| 188 | Back disorder | FAERS: 3 | US FAERS | |
| 189 | Blood count abnormal | FAERS: 3 | US FAERS | |
| 190 | Blood lactate dehydrogenase increased | FAERS: 3 | US FAERS | |
| 191 | Blood urea increased | FAERS: 3 | US FAERS | |
| 192 | Cardiac Arrest | FAERS: 3 | US FAERS | |
| 193 | Cholestasis | FAERS: 3 | US FAERS | |
| 194 | Coronary Artery Disease | FAERS: 3 | US FAERS | |
| 195 | Dental caries | FAERS: 3 | US FAERS | |
| 196 | Drug dispensing error | FAERS: 3 | US FAERS | |
| 197 | Ear discomfort | FAERS: 3 | US FAERS | |
| 198 | Emotional distress | FAERS: 3 | US FAERS | |
| 199 | Epilepsy | FAERS: 3 | US FAERS | |
| 200 | Exfoliative rash | FAERS: 3 | US FAERS | |
| 201 | Failure to Thrive | FAERS: 3 | US FAERS | |
| 202 | Gastroenteritis | FAERS: 3 | US FAERS | |
| 203 | Gastrointestinal stoma complication | FAERS: 3 | US FAERS | |
| 204 | Head discomfort | FAERS: 3 | US FAERS | |
| 205 | Hepatitis | FAERS: 3 | US FAERS | |
| 206 | Hypogeusia | FAERS: 3 | US FAERS | |
| 207 | Hypophagia | FAERS: 3 | US FAERS | |
| 208 | Infrequent bowel movements | FAERS: 3 | US FAERS | |
| 209 | Joint stiffness | FAERS: 3 | US FAERS | |
| 210 | Neck Pain | FAERS: 3 | US FAERS | |
| 211 | Nervousness | FAERS: 3 | US FAERS | |
| 212 | No adverse event | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 213 | Oral candidiasis | FAERS: 3 | US FAERS | |
| 214 | Oral mucosal eruption | FAERS: 3 | US FAERS | |
| 215 | Overdose | FAERS: 3 | US FAERS | |
| 216 | Pallor | FAERS: 3 | US FAERS | |
| 217 | Perianal erythema | FAERS: 3 | US FAERS | |
| 218 | Plantar erythema | FAERS: 3 | US FAERS | |
| 219 | Poor peripheral circulation | FAERS: 3 | US FAERS | |
| 220 | Rhinitis | FAERS: 3 | US FAERS | |
| 221 | Syncope | FAERS: 3 | US FAERS | |
| 222 | Thermal burn | FAERS: 3 | US FAERS | |
| 223 | Thyroid hormones increased | FAERS: 3 | US FAERS | |
| 224 | Thyroiditis | FAERS: 3 | US FAERS | |
| 225 | Tooth Infection | FAERS: 3 | US FAERS | |
| 226 | Wrong dose | FAERS: 3 | US FAERS | |
| 227 | Agitation | FAERS: 2 | US FAERS | |
| 228 | Angioedema | FAERS: 2 | US FAERS | |
| 229 | Anorectal infection | FAERS: 2 | US FAERS | |
| 230 | Aortic Aneurysm | FAERS: 2 | US FAERS | |
| 231 | Aphasia | FAERS: 2 | US FAERS | |
| 232 | Ascites | FAERS: 2 | US FAERS | |
| 233 | Benign Prostatic Hyperplasia | FAERS: 2 | US FAERS | |
| 234 | Blindness | FAERS: 2 | US FAERS | |
| 235 | Blood albumin abnormal | FAERS: 2 | US FAERS | |
| 236 | Blood glucose abnormal | FAERS: 2 | US FAERS | |
| 237 | Blood sodium increased | FAERS: 2 | US FAERS | |
| 238 | Bone lesion | FAERS: 2 | US FAERS | |
| 239 | Cataract operation | FAERS: 2 | US FAERS | |
| 240 | Choking | FAERS: 2 | US FAERS | |
| 241 | Cholelithiasis | FAERS: 2 | US FAERS | |
| 242 | Clostridium difficile colitis | FAERS: 2 | US FAERS | |
| 243 | Cyst | FAERS: 2 | US FAERS | |
| 244 | Dental cleaning | FAERS: 2 | US FAERS | |
| 245 | Device occlusion | FAERS: 2 | US FAERS | |
| 246 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 247 | Drug administration error | FAERS: 2 | US FAERS | |
| 248 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 249 | Dysarthria | FAERS: 2 | US FAERS | |
| 250 | Embolism | FAERS: 2 | US FAERS | |
| 251 | Endodontic procedure | FAERS: 2 | US FAERS | |
| 252 | Escherichia sepsis | FAERS: 2 | US FAERS | |
| 253 | Exposed bone in jaw | FAERS: 2 | US FAERS | |
| 254 | Facial paralysis | FAERS: 2 | US FAERS | |
| 255 | Feeling jittery | FAERS: 2 | US FAERS | |
| 256 | Fistula of small intestine | FAERS: 2 | US FAERS | |
| 257 | Flank Pain | FAERS: 2 | US FAERS | |
| 258 | Frustration tolerance decreased | FAERS: 2 | US FAERS | |
| 259 | Full blood count abnormal | FAERS: 2 | US FAERS | |
| 260 | Full blood count decreased | FAERS: 2 | US FAERS | |
| 261 | Gamma-Glutamyltransferase Increased | FAERS: 2 | US FAERS | |
| 262 | Gastrointestinal Pain | FAERS: 2 | US FAERS | |
| 263 | Gastrointestinal infection | FAERS: 2 | US FAERS | |
| 264 | General physical condition abnormal | FAERS: 2 | US FAERS | |
| 265 | Gingivitis | FAERS: 2 | US FAERS | |
| 266 | Hepatic Encephalopathy | FAERS: 2 | US FAERS | |
| 267 | Hyperchlorhydria | FAERS: 2 | US FAERS | |
| 268 | Hypertransaminasaemia | FAERS: 2 | US FAERS | |
| 269 | Hyperventilation | FAERS: 2 | US FAERS | |
| 270 | Hypokinesia | FAERS: 2 | US FAERS | |
| 271 | Hypopituitarism | FAERS: 2 | US FAERS | |
| 272 | Hypoxia | FAERS: 2 | US FAERS | |
| 273 | Increased tendency to bruise | FAERS: 2 | US FAERS | |
| 274 | Infected seroma | FAERS: 2 | US FAERS | |
| 275 | Liver Abscess | FAERS: 2 | US FAERS | |
| 276 | Lymphopenia | FAERS: 2 | US FAERS | |
| 277 | Mastication disorder | FAERS: 2 | US FAERS | |
| 278 | Mental impairment | FAERS: 2 | US FAERS | |
| 279 | Mental status changes | FAERS: 2 | US FAERS | |
| 280 | Muscle Fatigue | FAERS: 2 | US FAERS | |
| 281 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 282 | Nail Infection | FAERS: 2 | US FAERS | |
| 283 | Nasal mucosal disorder | FAERS: 2 | US FAERS | |
| 284 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 285 | Nephrotic Syndrome | FAERS: 2 | US FAERS | |
| 286 | Nerve injury | FAERS: 2 | US FAERS | |
| 287 | Nocturia | FAERS: 2 | US FAERS | |
| 288 | Non-cardiac chest pain | FAERS: 2 | US FAERS | |
| 289 | Osteoporosis | FAERS: 2 | US FAERS | |
| 290 | Pelvic Pain | FAERS: 2 | US FAERS | |
| 291 | Penile burning sensation | FAERS: 2 | US FAERS | |
| 292 | Pharyngitis | FAERS: 2 | US FAERS | |
| 293 | Pneumothorax | FAERS: 2 | US FAERS | |
| 294 | Poor personal hygiene | FAERS: 2 | US FAERS | |
| 295 | Postoperative wound complication | FAERS: 2 | US FAERS | |
| 296 | Procedural intestinal perforation | FAERS: 2 | US FAERS | |
| 297 | Radiation Pneumonitis | FAERS: 2 | US FAERS | |
| 298 | Radiculopathy | FAERS: 2 | US FAERS | |
| 299 | Regurgitation | FAERS: 2 | US FAERS | |
| 300 | Renal pain | FAERS: 2 | US FAERS | |
| 301 | Restlessness | FAERS: 2 | US FAERS | |
| 302 | Scrotal irritation | FAERS: 2 | US FAERS | |
| 303 | Septic Shock | FAERS: 2 | US FAERS | |
| 304 | Skin discomfort | FAERS: 2 | US FAERS | |
| 305 | Skin hypertrophy | FAERS: 2 | US FAERS | |
| 306 | Spinal column injury | FAERS: 2 | US FAERS | |
| 307 | Temperature intolerance | FAERS: 2 | US FAERS | |
| 308 | Tetany | FAERS: 2 | US FAERS | |
| 309 | Thirst decreased | FAERS: 2 | US FAERS | |
| 310 | Thirst | FAERS: 2 | US FAERS | |
| 311 | Thyroglobulin increased | FAERS: 2 | US FAERS | |
| 312 | Tinea cruris | FAERS: 2 | US FAERS | |
| 313 | Tinnitus | FAERS: 2 | US FAERS | |
| 314 | Tongue erythema | FAERS: 2 | US FAERS | |
| 315 | Tooth Loss | FAERS: 2 | US FAERS | |
| 316 | Umbilical hernia | FAERS: 2 | US FAERS | |
| 317 | Urine output increased | FAERS: 2 | US FAERS | |
| 318 | Vertebral lesion | FAERS: 2 | US FAERS | |
| 319 | Vitamin D Deficiency | FAERS: 2 | US FAERS | |
| 320 | Wheelchair user | FAERS: 2 | US FAERS | |
| 321 | Wheezing | FAERS: 2 | US FAERS | |
| 322 | Xerosis | FAERS: 2 | US FAERS | |
| 323 | jaundice | FAERS: 2 | US FAERS | |
| 324 | Abasia | FAERS: 1 | US FAERS | |
| 325 | Abdominal Abscess | FAERS: 1 | US FAERS | |
| 326 | Abscess | FAERS: 1 | US FAERS | |
| 327 | Accidental overdose | FAERS: 1 | US FAERS | |
| 328 | Adrenal cortex necrosis | FAERS: 1 | US FAERS | |
| 329 | Adrenal thrombosis | FAERS: 1 | US FAERS | |
| 330 | Alanine aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 331 | Albinism | FAERS: 1 | US FAERS | |
| 332 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 333 | Ammonia increased | FAERS: 1 | US FAERS | |
| 334 | Anal Ulcer | FAERS: 1 | US FAERS | |
| 335 | Anal inflammation | FAERS: 1 | US FAERS | |
| 336 | Anal polyp | FAERS: 1 | US FAERS | |
| 337 | Anger | FAERS: 1 | US FAERS | |
| 338 | Anorectal swelling | FAERS: 1 | US FAERS | |
| 339 | Anosmia | FAERS: 1 | US FAERS | |
| 340 | Apathy | FAERS: 1 | US FAERS | |
| 341 | Appendicitis | FAERS: 1 | US FAERS | |
| 342 | Arterial thrombosis | FAERS: 1 | US FAERS | |
| 343 | Basal cell carcinoma | FAERS: 1 | US FAERS | |
| 344 | Bedridden | FAERS: 1 | US FAERS | |
| 345 | Bladder pain | FAERS: 1 | US FAERS | |
| 346 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 347 | Blood bilirubin unconjugated increased | FAERS: 1 | US FAERS | |
| 348 | Blood iron increased | FAERS: 1 | US FAERS | |
| 349 | Blood thyroid stimulating hormone abnormal | FAERS: 1 | US FAERS | |
| 350 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 351 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 352 | Bradycardia | FAERS: 1 | US FAERS | |
| 353 | Brain Death | FAERS: 1 | US FAERS | |
| 354 | Bronchopulmonary Aspergillosis | FAERS: 1 | US FAERS | |
| 355 | Bruxism | FAERS: 1 | US FAERS | |
| 356 | Cell Death | FAERS: 1 | US FAERS | |
| 357 | Cellulitis | FAERS: 1 | US FAERS | |
| 358 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 359 | Cerebral ventricle dilatation | FAERS: 1 | US FAERS | |
| 360 | Cerebrospinal fluid circulation disorder | FAERS: 1 | US FAERS | |
| 361 | Chronic Fatigue Syndrome | FAERS: 1 | US FAERS | |
| 362 | Complication associated with device | FAERS: 1 | US FAERS | |
| 363 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 364 | Dementia | FAERS: 1 | US FAERS | |
| 365 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 366 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 367 | Diplopia | FAERS: 1 | US FAERS | |
| 368 | Disseminated Intravascular Coagulation | FAERS: 1 | US FAERS | |
| 369 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 370 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 371 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 372 | Dysentery | FAERS: 1 | US FAERS | |
| 373 | Eastern Cooperative Oncology Group performance status improved | FAERS: 1 | US FAERS | |
| 374 | Eczema | FAERS: 1 | US FAERS | |
| 375 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 376 | Encephalitis | FAERS: 1 | US FAERS | |
| 377 | Enteritis | FAERS: 1 | US FAERS | |
| 378 | Eosinophilia | FAERS: 1 | US FAERS | |
| 379 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 380 | Exposure via body fluid | FAERS: 1 | US FAERS | |
| 381 | Eye irritation | FAERS: 1 | US FAERS | |
| 382 | Eye pain | FAERS: 1 | US FAERS | |
| 383 | Eye ulcer | FAERS: 1 | US FAERS | |
| 384 | Eyelid pain | FAERS: 1 | US FAERS | |
| 385 | Eyelid rash | FAERS: 1 | US FAERS | |
| 386 | Fracture | FAERS: 1 | US FAERS | |
| 387 | Full blood count increased | FAERS: 1 | US FAERS | |
| 388 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 389 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 390 | Gastrointestinal ulcer | FAERS: 1 | US FAERS | |
| 391 | Gastropleural fistula | FAERS: 1 | US FAERS | |
| 392 | Gastrostomy tube site complication | FAERS: 1 | US FAERS | |
| 393 | Genital burning sensation | FAERS: 1 | US FAERS | |
| 394 | Genital pain | FAERS: 1 | US FAERS | |
| 395 | Gingival blister | FAERS: 1 | US FAERS | |
| 396 | Glaucoma | FAERS: 1 | US FAERS | |
| 397 | Hemiparesis | FAERS: 1 | US FAERS | |
| 398 | Hernia | FAERS: 1 | US FAERS | |
| 399 | Hidradenitis | FAERS: 1 | US FAERS | |
| 400 | Hypercreatininaemia | FAERS: 1 | US FAERS | |
| 401 | Hyperpyrexia | FAERS: 1 | US FAERS | |
| 402 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 403 | Hypocapnia | FAERS: 1 | US FAERS | |
| 404 | Hypoperfusion | FAERS: 1 | US FAERS | |
| 405 | Ileus | FAERS: 1 | US FAERS | |
| 406 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 407 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 408 | Incoherent | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 409 | Infected cyst | FAERS: 1 | US FAERS | |
| 410 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 411 | Intertrigo | FAERS: 1 | US FAERS | |
| 412 | Intervertebral disc disorder | FAERS: 1 | US FAERS | |
| 413 | Intra-abdominal fluid collection | FAERS: 1 | US FAERS | |
| 414 | Intrathecal pump insertion | FAERS: 1 | US FAERS | |
| 415 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 416 | Laryngitis | FAERS: 1 | US FAERS | |
| 417 | Leukopenia | FAERS: 1 | US FAERS | |
| 418 | Loose tooth | FAERS: 1 | US FAERS | |
| 419 | Lymphocyte percentage decreased | FAERS: 1 | US FAERS | |
| 420 | Malnutrition | FAERS: 1 | US FAERS | |
| 421 | Measles | FAERS: 1 | US FAERS | |
| 422 | Medial Tibial Stress Syndrome | FAERS: 1 | US FAERS | |
| 423 | Medical device site injury | FAERS: 1 | US FAERS | |
| 424 | Meningioma | FAERS: 1 | US FAERS | |
| 425 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 426 | Miliaria | FAERS: 1 | US FAERS | |
| 427 | Monoplegia | FAERS: 1 | US FAERS | |
| 428 | Multimorbidity | FAERS: 1 | US FAERS | |
| 429 | Myopathy | FAERS: 1 | US FAERS | |
| 430 | Myositis | FAERS: 1 | US FAERS | |
| 431 | Nail toxicity | FAERS: 1 | US FAERS | |
| 432 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 433 | Neutrophil percentage increased | FAERS: 1 | US FAERS | |
| 434 | Noninfective gingivitis | FAERS: 1 | US FAERS | |
| 435 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 436 | Oncologic complication | FAERS: 1 | US FAERS | |
| 437 | Oral fungal infection | FAERS: 1 | US FAERS | |
| 438 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 439 | Orthostatic hypertension | FAERS: 1 | US FAERS | |
| 440 | Osteolysis | FAERS: 1 | US FAERS | |
| 441 | Otitis Media | FAERS: 1 | US FAERS | |
| 442 | Oxygen consumption increased | FAERS: 1 | US FAERS | |
| 443 | Palmar erythema | FAERS: 1 | US FAERS | |
| 444 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 445 | Paranasal sinus hypersecretion | FAERS: 1 | US FAERS | |
| 446 | Paresis | FAERS: 1 | US FAERS | |
| 447 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 448 | Periodontitis | FAERS: 1 | US FAERS | |
| 449 | Peripheral artery thrombosis | FAERS: 1 | US FAERS | |
| 450 | Peripheral embolism | FAERS: 1 | US FAERS | |
| 451 | Peritonitis | FAERS: 1 | US FAERS | |
| 452 | Peritonsillar Abscess | FAERS: 1 | US FAERS | |
| 453 | Petechiae | FAERS: 1 | US FAERS | |
| 454 | Pharyngeal swelling | FAERS: 1 | US FAERS | |
| 455 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 456 | Post procedural infection | FAERS: 1 | US FAERS | |
| 457 | Procedural complication | FAERS: 1 | US FAERS | |
| 458 | Product dispensing error | FAERS: 1 | US FAERS | |
| 459 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 460 | Protein total abnormal | FAERS: 1 | US FAERS | |
| 461 | Protein total increased | FAERS: 1 | US FAERS | |
| 462 | Protein urine present | FAERS: 1 | US FAERS | |
| 463 | Pulmonary arterial hypertension | FAERS: 1 | US FAERS | |
| 464 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 465 | Pulmonary sepsis | FAERS: 1 | US FAERS | |
| 466 | Purpura | FAERS: 1 | US FAERS | |
| 467 | Pyoderma Gangrenosum | FAERS: 1 | US FAERS | |
| 468 | Pyogenic granuloma | FAERS: 1 | US FAERS | |
| 469 | Radiation associated pain | FAERS: 1 | US FAERS | |
| 470 | Radiation injury | FAERS: 1 | US FAERS | |
| 471 | Radicular pain | FAERS: 1 | US FAERS | |
| 472 | Recall phenomenon | FAERS: 1 | US FAERS | |
| 473 | Rectal abscess | FAERS: 1 | US FAERS | |
| 474 | Refractory cancer | FAERS: 1 | US FAERS | |
| 475 | Rehabilitation therapy | FAERS: 1 | US FAERS | |
| 476 | Remission not achieved | FAERS: 1 | US FAERS | |
| 477 | Resting Tremor | FAERS: 1 | US FAERS | |
| 478 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 479 | Retro-orbital neoplasm | FAERS: 1 | US FAERS | |
| 480 | Right Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 481 | Saliva altered | FAERS: 1 | US FAERS | |
| 482 | Sarcopenia | FAERS: 1 | US FAERS | |
| 483 | Sciatica | FAERS: 1 | US FAERS | |
| 484 | Sinus headache | FAERS: 1 | US FAERS | |
| 485 | Sputum retention | FAERS: 1 | US FAERS | |
| 486 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 487 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 488 | Subcutaneous Abscess | FAERS: 1 | US FAERS | |
| 489 | Sudden death | FAERS: 1 | US FAERS | |
| 490 | Sunburn | FAERS: 1 | US FAERS | |
| 491 | Suture related complication | FAERS: 1 | US FAERS | |
| 492 | Terminal state | FAERS: 1 | US FAERS | |
| 493 | Thrombocytosis | FAERS: 1 | US FAERS | |
| 494 | Thrombophlebitis | FAERS: 1 | US FAERS | |
| 495 | Thyroid hormones decreased | FAERS: 1 | US FAERS | |
| 496 | Tongue eruption | FAERS: 1 | US FAERS | |
| 497 | Tooth Extraction | FAERS: 1 | US FAERS | |
| 498 | Tracheal fistula | FAERS: 1 | US FAERS | |
| 499 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 500 | Trismus | FAERS: 1 | US FAERS | |
| 501 | Troponin increased | FAERS: 1 | US FAERS | |
| 502 | Unevaluable event | FAERS: 1 | US FAERS | |
| 503 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 504 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 505 | Urinary hesitation | FAERS: 1 | US FAERS | |
| 506 | Urine albumin/creatinine ratio increased | FAERS: 1 | US FAERS | |
| 507 | Urticaria | FAERS: 1 | US FAERS | |
| 508 | Vascular stent insertion | FAERS: 1 | US FAERS | |
| 509 | Vertigo | FAERS: 1 | US FAERS | |
| 510 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 511 | Vulvovaginal discomfort | FAERS: 1 | US FAERS | |
| 512 | White blood cell count abnormal | FAERS: 1 | US FAERS | |
| 513 | Xeroderma | FAERS: 1 | US FAERS | |
| 514 | treatment failure | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.