Tamsulosin
(DRHKJLXJIQTDTD-OAHLLOKOSA-N)
Structure
- SMILES
- CCOc1ccccc1OCCN[C@@H](Cc1ccc(c(c1)S(=O)(=O)N)OC)C
- Type(s)
- Approved; Investigational
- ATC code(s)
- G04CA02; G04CA52; G04CA53
- Molecular Formula:
- C20H28N2O5S
- Molecular Weight:
- 408.512
- Log P:
- 4.5129
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 2
- TPSA:
- 108.26
- CAS Number(s):
- 106133-20-4
Synonym(s)
1.
Tamsulosin
2.
5-(2-((2-(2-Ethoxyphenoxy)ethyl)amino)propyl)-2-methoxybenzenesulfonamide
3.
Flomax
4.
LY 253352
5.
LY-253352
6.
Tamsulosin Hydrochloride
7.
YM 617
8.
YM-617
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Dizziness | FAERS: 63 Canada Vigilance: 13 | 10676828 19837435 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 2 | Syncope | FAERS: 51 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 3 | Drug ineffective | FAERS: 49 Canada Vigilance: 42 | Canada Vigilance US FAERS | |
| 4 | Urinary Retention | FAERS: 32 Canada Vigilance: 4 | 10676828 | CTD Canada Vigilance US FAERS |
| 5 | Visual Impairment | FAERS: 25 | SIDER US FAERS | |
| 6 | Product substitution issue | FAERS: 24 Canada Vigilance: 40 | Canada Vigilance US FAERS | |
| 7 | Macular fibrosis | FAERS: 20 | US FAERS | |
| 8 | Cataract | FAERS: 19 | SIDER US FAERS | |
| 9 | Nausea | FAERS: 19 Canada Vigilance: 8 | Canada Vigilance SIDER US FAERS | |
| 10 | Asthenia | FAERS: 17 Canada Vigilance: 1 | 10676828 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 11 | Eye pain | FAERS: 17 | US FAERS | |
| 12 | Headache | FAERS: 17 Canada Vigilance: 2 | 10676828 | CTD SIDER Canada Vigilance US FAERS |
| 13 | Malaise | FAERS: 15 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 14 | Dysuria | FAERS: 14 Canada Vigilance: 5 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 15 | Hypotension | FAERS: 14 | SIDER US FAERS | |
| 16 | Atrial Flutter | FAERS: 13 | US FAERS | |
| 17 | Floppy iris syndrome | FAERS: 12 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 18 | Myalgia | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 19 | Product quality issue | FAERS: 11 | US FAERS | |
| 20 | Abdominal Pain | FAERS: 10 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 21 | Tachycardia | FAERS: 10 | SIDER US FAERS | |
| 22 | Vomiting | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 23 | Arthralgia | FAERS: 9 | SIDER US FAERS | |
| 24 | Medication Error | FAERS: 9 | US FAERS | |
| 25 | Pruritus | FAERS: 9 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 26 | Urticaria | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 27 | Cataract operation complication | FAERS: 8 | US FAERS | |
| 28 | Depressed mood | FAERS: 8 | US FAERS | |
| 29 | Drug prescribing error | FAERS: 8 | US FAERS | |
| 30 | Product use issue | FAERS: 8 | US FAERS | |
| 31 | Pulmonary Embolism | FAERS: 8 | US FAERS | |
| 32 | Amnesia | FAERS: 7 | US FAERS | |
| 33 | Choroidal Detachment | FAERS: 7 | US FAERS | |
| 34 | Dacryocystitis | FAERS: 7 | US FAERS | |
| 35 | Dacryostenosis acquired | FAERS: 7 | US FAERS | |
| 36 | Diplopia | FAERS: 7 | US FAERS | |
| 37 | Dyspepsia | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 38 | Eye Burns | FAERS: 7 | US FAERS | |
| 39 | Gamma-Glutamyltransferase Increased | FAERS: 7 | US FAERS | |
| 40 | Gout | FAERS: 7 | US FAERS | |
| 41 | Lip swelling | FAERS: 7 | US FAERS | |
| 42 | Palpitations | FAERS: 7 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 43 | Peripheral swelling | FAERS: 7 | US FAERS | |
| 44 | Retinal Vein Occlusion | FAERS: 7 | US FAERS | |
| 45 | Retrograde ejaculation | FAERS: 7 | SIDER US FAERS | |
| 46 | Urinary tract infection | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 47 | Angle Closure Glaucoma | FAERS: 6 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 48 | Bradycardia | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 49 | Constipation | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 50 | Disorientation | FAERS: 6 | US FAERS | |
| 51 | Erectile dysfunction | FAERS: 6 | 16526818 | CTD OFFSIDES SIDER US FAERS |
| 52 | Hallucinations, mixed | FAERS: 6 | US FAERS | |
| 53 | Product formulation issue | FAERS: 6 | US FAERS | |
| 54 | Product use in unapproved indication | FAERS: 6 | US FAERS | |
| 55 | Urinary Incontinence | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 56 | Uveitis | FAERS: 6 | US FAERS | |
| 57 | Abdominal discomfort | FAERS: 5 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 58 | Conjunctivitis | FAERS: 5 | US FAERS | |
| 59 | Drug withdrawal syndrome | FAERS: 5 | US FAERS | |
| 60 | Hypersensitivity | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 61 | Hypotonic urinary bladder | FAERS: 5 | US FAERS | |
| 62 | Overdose | FAERS: 5 | US FAERS | |
| 63 | Presyncope | FAERS: 5 | US FAERS | |
| 64 | Product physical issue | FAERS: 5 | US FAERS | |
| 65 | Pupillary block | FAERS: 5 | US FAERS | |
| 66 | Ageusia | FAERS: 4 | US FAERS | |
| 67 | Angioedema | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 68 | Anxiety | FAERS: 4 | OFFSIDES US FAERS | |
| 69 | Benign Prostatic Hyperplasia | FAERS: 4 | OFFSIDES US FAERS | |
| 70 | Blood glucose increased | FAERS: 4 | US FAERS | |
| 71 | Drug ineffective for unapproved indication | FAERS: 4 | US FAERS | |
| 72 | Erythropenia | FAERS: 4 | US FAERS | |
| 73 | Folliculitis | FAERS: 4 | OFFSIDES US FAERS | |
| 74 | Hypophagia | FAERS: 4 | US FAERS | |
| 75 | Night sweats | FAERS: 4 | US FAERS | |
| 76 | Priapism | FAERS: 4 | SIDER US FAERS | |
| 77 | Psoriasis | FAERS: 4 | US FAERS | |
| 78 | Respiratory distress | FAERS: 4 | US FAERS | |
| 79 | Rhinitis | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 80 | Thrombocytopenia | FAERS: 4 | US FAERS | |
| 81 | Vitreous loss | FAERS: 4 | US FAERS | |
| 82 | Chest Pain | FAERS: 3 | SIDER US FAERS | |
| 83 | Circumstance or information capable of leading to medication error | FAERS: 3 | US FAERS | |
| 84 | Dysphonia | FAERS: 3 | US FAERS | |
| 85 | Erythema | FAERS: 3 | US FAERS | |
| 86 | Iatrogenic injury | FAERS: 3 | US FAERS | |
| 87 | Male Orgasmic Disorder | FAERS: 3 | US FAERS | |
| 88 | Megakaryocytes increased | FAERS: 3 | US FAERS | |
| 89 | Middle insomnia | FAERS: 3 | OFFSIDES US FAERS | |
| 90 | Myoglobinuria | FAERS: 3 | US FAERS | |
| 91 | Nocturia | FAERS: 3 Canada Vigilance: 6 | Canada Vigilance OFFSIDES US FAERS | |
| 92 | Occupational exposure to product | FAERS: 3 | US FAERS | |
| 93 | Painful ejaculation | FAERS: 3 | US FAERS | |
| 94 | Rash erythematous | FAERS: 3 | US FAERS | |
| 95 | Therapeutic response unexpected | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 96 | Throat irritation | FAERS: 3 | US FAERS | |
| 97 | Urinary hesitation | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 98 | Weight decreased | FAERS: 3 | US FAERS | |
| 99 | Atrial Fibrillation | FAERS: 2 | SIDER US FAERS | |
| 100 | Back Pain | FAERS: 2 | SIDER US FAERS | |
| 101 | Blood urine present | FAERS: 2 | OFFSIDES US FAERS | |
| 102 | Cerebral Infarction | FAERS: 2 | US FAERS | |
| 103 | Disease recurrence | FAERS: 2 | US FAERS | |
| 104 | Drug Tolerance | FAERS: 2 | US FAERS | |
| 105 | Eyelid rash | FAERS: 2 | US FAERS | |
| 106 | Fatigue | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 107 | Glaucoma | FAERS: 2 | US FAERS | |
| 108 | Hormone level abnormal | FAERS: 2 | US FAERS | |
| 109 | Incontinence | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 110 | Intentional product misuse | FAERS: 2 | US FAERS | |
| 111 | Laceration | FAERS: 2 | US FAERS | |
| 112 | Memory impairment | FAERS: 2 | US FAERS | |
| 113 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 114 | Musculoskeletal stiffness | FAERS: 2 | OFFSIDES US FAERS | |
| 115 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 116 | Nervousness | FAERS: 2 | US FAERS | |
| 117 | Oropharyngeal pain | FAERS: 2 | US FAERS | |
| 118 | Papule | FAERS: 2 | US FAERS | |
| 119 | Phlebitis | FAERS: 2 | US FAERS | |
| 120 | Photophobia | FAERS: 2 | US FAERS | |
| 121 | Premature Ejaculation | FAERS: 2 | US FAERS | |
| 122 | Product commingling | FAERS: 2 | US FAERS | |
| 123 | Product label issue | FAERS: 2 | US FAERS | |
| 124 | Prostatism | FAERS: 2 Canada Vigilance: 4 | 10364649 10503165 | CTD Canada Vigilance US FAERS |
| 125 | Restlessness | FAERS: 2 | US FAERS | |
| 126 | Septic Shock | FAERS: 2 | US FAERS | |
| 127 | Sexual Dysfunction | FAERS: 2 | US FAERS | |
| 128 | Somnolence | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 129 | Spontaneous penile erection | FAERS: 2 | US FAERS | |
| 130 | Stevens-Johnson Syndrome | FAERS: 2 | 25811541 | CTD SIDER US FAERS |
| 131 | Strabismus | FAERS: 2 | US FAERS | |
| 132 | Surgical failure | FAERS: 2 | US FAERS | |
| 133 | Thrombosis | FAERS: 2 | US FAERS | |
| 134 | Urinary tract obstruction | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 135 | Urine flow decreased | FAERS: 2 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 136 | Wheezing | FAERS: 2 | US FAERS | |
| 137 | nervous system disorder | FAERS: 2 | SIDER US FAERS | |
| 138 | treatment failure | FAERS: 2 | US FAERS | |
| 139 | Abasia | FAERS: 1 | US FAERS | |
| 140 | Abulia | FAERS: 1 | US FAERS | |
| 141 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 142 | Agitation | FAERS: 1 | US FAERS | |
| 143 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 144 | Anal sphincter atony | FAERS: 1 | US FAERS | |
| 145 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 146 | Aneurysm | FAERS: 1 | US FAERS | |
| 147 | Anger | FAERS: 1 | US FAERS | |
| 148 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 149 | Anosmia | FAERS: 1 | US FAERS | |
| 150 | Aphasia | FAERS: 1 | US FAERS | |
| 151 | Aphonia | FAERS: 1 | US FAERS | |
| 152 | Bacterial prostatitis | FAERS: 1 | US FAERS | |
| 153 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 154 | Bladder Diverticulum | FAERS: 1 | US FAERS | |
| 155 | Blepharitis | FAERS: 1 | OFFSIDES US FAERS | |
| 156 | Blindness | FAERS: 1 | US FAERS | |
| 157 | Blood Pressure | FAERS: 1 | US FAERS | |
| 158 | Cataract operation | FAERS: 1 | OFFSIDES US FAERS | |
| 159 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 160 | Chills | FAERS: 1 | SIDER US FAERS | |
| 161 | Cholestasis | FAERS: 1 | US FAERS | |
| 162 | Ciliary zonular dehiscence | FAERS: 1 | US FAERS | |
| 163 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 164 | Cystitis | FAERS: 1 | US FAERS | |
| 165 | Dehydration | FAERS: 1 | OFFSIDES US FAERS | |
| 166 | Delirium | FAERS: 1 | US FAERS | |
| 167 | Dementia | FAERS: 1 | US FAERS | |
| 168 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 169 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 170 | Disability | FAERS: 1 | US FAERS | |
| 171 | Diverticulitis | FAERS: 1 | US FAERS | |
| 172 | Drug administration error | FAERS: 1 | US FAERS | |
| 173 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 174 | Drug dose omission | FAERS: 1 | US FAERS | |
| 175 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 176 | Dysgeusia | FAERS: 1 | US FAERS | |
| 177 | Embolism | FAERS: 1 | US FAERS | |
| 178 | Epididymitis | FAERS: 1 | US FAERS | |
| 179 | Epilepsy | FAERS: 1 | US FAERS | |
| 180 | Epistaxis | FAERS: 1 | SIDER US FAERS | |
| 181 | Erection increased | FAERS: 1 | US FAERS | |
| 182 | Exophthalmos | FAERS: 1 | US FAERS | |
| 183 | Eye irritation | FAERS: 1 | US FAERS | |
| 184 | Feeling abnormal | FAERS: 1 | SIDER US FAERS | |
| 185 | Feeling jittery | FAERS: 1 | US FAERS | |
| 186 | Feelings of worthlessness | FAERS: 1 | US FAERS | |
| 187 | Gastric ulcer | FAERS: 1 | OFFSIDES US FAERS | |
| 188 | Gastritis | FAERS: 1 | US FAERS | |
| 189 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 190 | Gingivitis | FAERS: 1 | US FAERS | |
| 191 | Hydrocephalus | FAERS: 1 | OFFSIDES US FAERS | |
| 192 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 193 | Hyperosmolar state | FAERS: 1 | US FAERS | |
| 194 | Immobile | FAERS: 1 | OFFSIDES US FAERS | |
| 195 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 196 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 197 | Interstitial granulomatous dermatitis | FAERS: 1 | US FAERS | |
| 198 | Iridocele | FAERS: 1 | US FAERS | |
| 199 | Left Ventricular Hypertrophy | FAERS: 1 | OFFSIDES US FAERS | |
| 200 | Lenticular injury | FAERS: 1 | US FAERS | |
| 201 | Lichenification | FAERS: 1 | US FAERS | |
| 202 | Limb injury | FAERS: 1 | US FAERS | |
| 203 | Male sexual dysfunction | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 204 | Manufacturing materials issue | FAERS: 1 | US FAERS | |
| 205 | Mental impairment | FAERS: 1 | OFFSIDES US FAERS | |
| 206 | Mood swings | FAERS: 1 | US FAERS | |
| 207 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 208 | Musculoskeletal discomfort | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 209 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 210 | Nasopharyngitis | FAERS: 1 | SIDER US FAERS | |
| 211 | Necrosis | FAERS: 1 | US FAERS | |
| 212 | Nephrolithiasis | FAERS: 1 | OFFSIDES US FAERS | |
| 213 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 214 | Pain | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 215 | Pancreatitis | FAERS: 1 | US FAERS | |
| 216 | Paraneoplastic pemphigus | FAERS: 1 | US FAERS | |
| 217 | Pharyngeal swelling | FAERS: 1 | US FAERS | |
| 218 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 219 | Positron emission tomogram abnormal | FAERS: 1 | US FAERS | |
| 220 | Posterior capsule rupture | FAERS: 1 | US FAERS | |
| 221 | Presbyopia | FAERS: 1 | US FAERS | |
| 222 | Product coating issue | FAERS: 1 | US FAERS | |
| 223 | Product counterfeit | FAERS: 1 | US FAERS | |
| 224 | Product label on wrong product | FAERS: 1 | US FAERS | |
| 225 | Product storage error | FAERS: 1 | US FAERS | |
| 226 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 227 | Product use complaint | FAERS: 1 | US FAERS | |
| 228 | Prostatic Adenoma | FAERS: 1 | US FAERS | |
| 229 | Prostatic Obstruction | FAERS: 1 | US FAERS | |
| 230 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 231 | Purpura | FAERS: 1 | US FAERS | |
| 232 | Quality of life decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 233 | Rectal tenesmus | FAERS: 1 | US FAERS | |
| 234 | Renal tubular atrophy | FAERS: 1 | US FAERS | |
| 235 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 236 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 237 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 238 | Similar reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 239 | Sinusitis | FAERS: 1 | SIDER US FAERS | |
| 240 | Skin Induration | FAERS: 1 | OFFSIDES US FAERS | |
| 241 | Sudden Visual Loss | FAERS: 1 | US FAERS | |
| 242 | Sudden death | FAERS: 1 | US FAERS | |
| 243 | Symptom recurrence | FAERS: 1 | US FAERS | |
| 244 | Tachyarrhythmia | FAERS: 1 | US FAERS | |
| 245 | Taciturnity | FAERS: 1 | US FAERS | |
| 246 | Therapeutic product effect variable | FAERS: 1 | US FAERS | |
| 247 | Therapy cessation | FAERS: 1 | US FAERS | |
| 248 | Therapy change | FAERS: 1 | US FAERS | |
| 249 | Tooth Loss | FAERS: 1 | US FAERS | |
| 250 | Toothache | FAERS: 1 | US FAERS | |
| 251 | Tremor | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 252 | Urinary straining | FAERS: 1 | US FAERS | |
| 253 | Vasculitis | FAERS: 1 | US FAERS | |
| 254 | Vertigo | FAERS: 1 | SIDER US FAERS | |
| 255 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 256 | Abdominal strangulated hernia | OFFSIDES | ||
| 257 | Abdominal wall infection | OFFSIDES | ||
| 258 | Abnormal ejaculation | SIDER | ||
| 259 | Abuse | OFFSIDES | ||
| 260 | Actinic keratosis | OFFSIDES | ||
| 261 | Acute Coronary Syndrome | OFFSIDES | ||
| 262 | Acute bronchitis | OFFSIDES | ||
| 263 | Alopecia | OFFSIDES | ||
| 264 | Alveolitis | OFFSIDES | ||
| 265 | Alveoloplasty | OFFSIDES | ||
| 266 | Amaurosis Fugax | OFFSIDES | ||
| 267 | Amblyopia | SIDER | ||
| 268 | Amphetamines | OFFSIDES | ||
| 269 | Anorectal operation | OFFSIDES | ||
| 270 | Apathy | OFFSIDES | ||
| 271 | Aphagia | OFFSIDES | ||
| 272 | Application site erythema | OFFSIDES | ||
| 273 | Application site excoriation | OFFSIDES | ||
| 274 | Application site reaction | OFFSIDES | ||
| 275 | Application site scab | OFFSIDES | ||
| 276 | Arteriovenous fistula thrombosis | OFFSIDES | ||
| 277 | Arthritis | SIDER | ||
| 278 | Aspiration Pneumonia | OFFSIDES | ||
| 279 | Asthenopia | OFFSIDES | ||
| 280 | Ataxia | OFFSIDES | ||
| 281 | Atelectasis | OFFSIDES | ||
| 282 | Atrial tachycardia | OFFSIDES | ||
| 283 | Bacterial sepsis | OFFSIDES | ||
| 284 | Bedridden | OFFSIDES | ||
| 285 | Blood Glucose | OFFSIDES | ||
| 286 | Blood alkaline phosphatase increased | OFFSIDES | ||
| 287 | Blood amylase decreased | OFFSIDES | ||
| 288 | Blood chloride decreased | OFFSIDES | ||
| 289 | Blood glucose decreased | OFFSIDES | ||
| 290 | Blood glucose fluctuation | OFFSIDES | ||
| 291 | Blood immunoglobulin G increased | OFFSIDES | ||
| 292 | Blood lactate dehydrogenase increased | OFFSIDES | ||
| 293 | Blood magnesium decreased | OFFSIDES | ||
| 294 | Blood potassium decreased | OFFSIDES | ||
| 295 | Blood sodium | OFFSIDES | ||
| 296 | Blood urea increased | OFFSIDES | ||
| 297 | Bone lesion | OFFSIDES | ||
| 298 | Bone pain | OFFSIDES | ||
| 299 | Bone swelling | OFFSIDES | ||
| 300 | Bone trimming | OFFSIDES | ||
| 301 | Brain natriuretic peptide increased | OFFSIDES | ||
| 302 | Carnitine decreased | OFFSIDES | ||
| 303 | Catheter placement | OFFSIDES | ||
| 304 | Catheter related infection | OFFSIDES | ||
| 305 | Catheter site pain | OFFSIDES | ||
| 306 | Cellulitis | OFFSIDES | ||
| 307 | Chemotherapeutic drug level increased | OFFSIDES | ||
| 308 | Claustrophobia | OFFSIDES | ||
| 309 | Clonus | OFFSIDES | ||
| 310 | Clostridium colitis | OFFSIDES | ||
| 311 | Common Cold | SIDER | ||
| 312 | Complex partial seizures | OFFSIDES | ||
| 313 | Crystalluria | OFFSIDES | ||
| 314 | Cyst | OFFSIDES | ||
| 315 | Decreased Libido | OFFSIDES | ||
| 316 | Demyelination | OFFSIDES | ||
| 317 | Dental Plaque | OFFSIDES | ||
| 318 | Dental abscess | OFFSIDES | ||
| 319 | Dental caries | OFFSIDES | ||
| 320 | Denture wearer | OFFSIDES | ||
| 321 | Dermatitis | SIDER | ||
| 322 | Device breakage | OFFSIDES | ||
| 323 | Device related infection | OFFSIDES | ||
| 324 | Diarrhea | OFFSIDES | ||
| 325 | Diffuse Large B-Cell Lymphoma | OFFSIDES | ||
| 326 | Discomfort | SIDER | ||
| 327 | Disseminated Intravascular Coagulation | OFFSIDES | ||
| 328 | Disturbance in sexual arousal | SIDER | ||
| 329 | Dizziness aggravated | SIDER | ||
| 330 | Dizzy spells | SIDER | ||
| 331 | Drowsiness | OFFSIDES | ||
| 332 | Drug administered at inappropriate site | OFFSIDES | ||
| 333 | Drug screen positive | OFFSIDES | ||
| 334 | Dry skin | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 335 | Emotional distress | OFFSIDES | ||
| 336 | Enterococcal infection | OFFSIDES | ||
| 337 | Epigastric discomfort | Canada Vigilance: 1 | Canada Vigilance | |
| 338 | Erosive gastritis | OFFSIDES | ||
| 339 | Erythema Multiforme | SIDER | ||
| 340 | Excoriation | OFFSIDES | ||
| 341 | Femoral pulse decreased | OFFSIDES | ||
| 342 | Fluid overload | OFFSIDES | ||
| 343 | Formication | OFFSIDES | ||
| 344 | Fungus sputum test positive | OFFSIDES | ||
| 345 | Gambling | OFFSIDES | ||
| 346 | Gastrointestinal Pain | SIDER | ||
| 347 | Granulocytosis | OFFSIDES | ||
| 348 | Hemiparesis | OFFSIDES | ||
| 349 | Heparin-induced thrombocytopenia | OFFSIDES | ||
| 350 | Hidradenitis | OFFSIDES | ||
| 351 | Hydronephrosis | OFFSIDES | ||
| 352 | Hyperkeratosis | OFFSIDES | ||
| 353 | Hyperreflexia | OFFSIDES | ||
| 354 | Hypocomplementaemia | OFFSIDES | ||
| 355 | Hypokinesia | OFFSIDES | ||
| 356 | Hypotension orthostatic symptomatic | SIDER | ||
| 357 | Hypotension, Orthostatic | 9643668 | CTD | |
| 358 | Immune reconstitution syndrome | OFFSIDES | ||
| 359 | Impatience | OFFSIDES | ||
| 360 | Infection | OFFSIDES SIDER | ||
| 361 | Infestation | SIDER | ||
| 362 | Influenza-like symptoms | SIDER | ||
| 363 | Influenza | SIDER | ||
| 364 | Infusion site mobility decreased | OFFSIDES | ||
| 365 | Intestinal anastomosis complication | OFFSIDES | ||
| 366 | Intestinal infarction | OFFSIDES | ||
| 367 | Intraoperative floppy iris syndrome | SIDER | ||
| 368 | Iris Diseases | 18299077 | CTD | |
| 369 | Joint Instability | OFFSIDES | ||
| 370 | Joint Range of Motion Decreased | OFFSIDES | ||
| 371 | Joint injury | OFFSIDES | ||
| 372 | Joint stiffness | OFFSIDES | ||
| 373 | Kidney Failure | OFFSIDES | ||
| 374 | Large intestine perforation | OFFSIDES | ||
| 375 | Lethargy | OFFSIDES | ||
| 376 | Leukopenia neonatal | OFFSIDES | ||
| 377 | Lightheadedness | SIDER | ||
| 378 | Limb discomfort | Canada Vigilance: 1 | Canada Vigilance | |
| 379 | Lung consolidation | OFFSIDES | ||
| 380 | Male Urogenital Diseases | 15705083 16842616 | CTD | |
| 381 | Malnutrition | SIDER | ||
| 382 | Markedly reduced dietary intake | OFFSIDES | ||
| 383 | Medication residue | OFFSIDES | ||
| 384 | Mental status changes | OFFSIDES | ||
| 385 | Metastatic Neoplasm | OFFSIDES | ||
| 386 | Mouth Diseases | 19837435 | CTD | |
| 387 | Muscle Weakness | OFFSIDES | ||
| 388 | Muscle strain | OFFSIDES | ||
| 389 | Muscle tightness | OFFSIDES | ||
| 390 | Neck Pain | SIDER | ||
| 391 | Nephrogenic Fibrosing Dermopathy | OFFSIDES | ||
| 392 | Neutropenic infection | OFFSIDES | ||
| 393 | Nodule | OFFSIDES | ||
| 394 | Occult blood positive | OFFSIDES | ||
| 395 | Oliguria | OFFSIDES | ||
| 396 | Onychoclasis | OFFSIDES | ||
| 397 | Orchitis | OFFSIDES | ||
| 398 | Oxygen saturation abnormal | OFFSIDES | ||
| 399 | Paranasal sinus hypersecretion | OFFSIDES | ||
| 400 | Pelvic mass | OFFSIDES | ||
| 401 | Periodontitis | OFFSIDES | ||
| 402 | Pharyngitis | SIDER | ||
| 403 | Postoperative infection | OFFSIDES | ||
| 404 | Product complaint | Canada Vigilance: 6 | Canada Vigilance | |
| 405 | Product dosage form issue | Canada Vigilance: 1 | Canada Vigilance | |
| 406 | Product substitution | Canada Vigilance: 1 | Canada Vigilance | |
| 407 | Productive Cough | OFFSIDES | ||
| 408 | Prostatic Diseases | 20981257 | CTD | |
| 409 | Prostatic Hyperplasia | CTD | ||
| 410 | Reaction gastrointestinal | SIDER | ||
| 411 | Rectal discharge | OFFSIDES | ||
| 412 | Respiratory Failure | OFFSIDES | ||
| 413 | Rhinorrhea | OFFSIDES | ||
| 414 | Seizures | 17054698 | CTD | |
| 415 | Semen volume decreased | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 416 | Senile dementia | OFFSIDES | ||
| 417 | Serratia sepsis | OFFSIDES | ||
| 418 | Shock | SIDER | ||
| 419 | Sick Sinus Syndrome | OFFSIDES | ||
| 420 | Sinus bradycardia | OFFSIDES | ||
| 421 | Skin hypertrophy | OFFSIDES | ||
| 422 | Skin laceration | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 423 | Skin tightness | OFFSIDES | ||
| 424 | Sputum retention | OFFSIDES | ||
| 425 | Subcutaneous nodule | OFFSIDES | ||
| 426 | Suture related complication | OFFSIDES | ||
| 427 | Sweating | SIDER | ||
| 428 | Therapeutic product effect decreased | Canada Vigilance: 3 | Canada Vigilance | |
| 429 | Therapeutic response changed | Canada Vigilance: 7 | Canada Vigilance | |
| 430 | Tooth Extraction | OFFSIDES | ||
| 431 | Transfusion Reaction | OFFSIDES | ||
| 432 | Unresponsive to stimuli | OFFSIDES | ||
| 433 | Urinary tract infection pseudomonal | OFFSIDES | ||
| 434 | Urologic Diseases | 20126606 | CTD | |
| 435 | Vitamin A Deficiency | OFFSIDES | ||
| 436 | Weight Gain | OFFSIDES | ||
| 437 | Wound dehiscence | OFFSIDES | ||
| 438 | prostatitis | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.