iopromide
(DGAIEPBNLOQYER-UHFFFAOYSA-N)
Structure
- SMILES
- COCC(=O)Nc1c(I)c(C(=O)NCC(CO)O)c(c(c1I)C(=O)N(CC(CO)O)C)I
- Type(s)
- Approved
- ATC code(s)
- V08AB05
- Molecular Formula:
- C18H24I3N3O8
- Molecular Weight:
- 791.112
- Log P:
- 0.0574
- Hydrogen Bond Acceptor:
- 11
- Hydrogen Bond Donor:
- 6
- TPSA:
- 168.66
- CAS Number(s):
- 73334-07-3
Synonym(s)
1.
iopromide
2.
Clarograf
3.
N,N'-bis(2,3-dihydroxypropyl)-2,4,6-triiodo-5-(2-methoxyacetamido)-N-methylisophthalamide
4.
Ultravist
5.
Ultravist 300
6.
iopromid
7.
lopromid
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Urticaria | FAERS: 1447 Canada Vigilance: 4 | 9211770 16628721 | CTD SIDER Canada Vigilance US FAERS |
| 2 | Pruritus | FAERS: 624 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 3 | Erythema | FAERS: 371 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 4 | Nausea | FAERS: 355 Canada Vigilance: 3 | 9211770 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 5 | Vomiting | FAERS: 346 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 6 | Sneezing | FAERS: 332 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 7 | Contrast media reaction | FAERS: 206 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Anaphylactic shock | FAERS: 197 | SIDER US FAERS | |
| 9 | Chest discomfort | FAERS: 146 | SIDER US FAERS | |
| 10 | Throat irritation | FAERS: 145 | SIDER US FAERS | |
| 11 | Cardiac Arrest | FAERS: 139 | SIDER US FAERS | |
| 12 | Hypotension | FAERS: 137 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 13 | Flushing | FAERS: 124 | SIDER US FAERS | |
| 14 | Adverse event | FAERS: 111 | OFFSIDES US FAERS | |
| 15 | Dizziness | FAERS: 107 | SIDER US FAERS | |
| 16 | Hypersensitivity | FAERS: 105 | SIDER US FAERS | |
| 17 | Chills | FAERS: 93 | SIDER US FAERS | |
| 18 | Respiratory arrest | FAERS: 87 | SIDER US FAERS | |
| 19 | Cyanosis | FAERS: 86 | OFFSIDES SIDER US FAERS | |
| 20 | Headache | FAERS: 75 | SIDER US FAERS | |
| 21 | Lip swelling | FAERS: 73 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 22 | Tremor | FAERS: 71 | SIDER US FAERS | |
| 23 | Chest Pain | FAERS: 68 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 24 | Shock | FAERS: 60 | SIDER US FAERS | |
| 25 | Pallor | FAERS: 55 | SIDER US FAERS | |
| 26 | Tachycardia | FAERS: 55 | SIDER US FAERS | |
| 27 | Dysphonia | FAERS: 51 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 28 | Extravasation | FAERS: 49 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 29 | Urinary Incontinence | FAERS: 49 | US FAERS | |
| 30 | Depressed Level of Consciousness | FAERS: 48 | US FAERS | |
| 31 | Wheezing | FAERS: 48 | SIDER US FAERS | |
| 32 | Bronchospasm | FAERS: 46 | SIDER US FAERS | |
| 33 | Malaise | FAERS: 46 | SIDER US FAERS | |
| 34 | Respiratory distress | FAERS: 44 | SIDER US FAERS | |
| 35 | Blood pressure immeasurable | FAERS: 43 | US FAERS | |
| 36 | Syncope | FAERS: 43 | SIDER US FAERS | |
| 37 | Angioedema | FAERS: 42 | OFFSIDES SIDER US FAERS | |
| 38 | Bradycardia | FAERS: 40 | SIDER US FAERS | |
| 39 | Palpitations | FAERS: 40 | SIDER US FAERS | |
| 40 | Swelling | FAERS: 40 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 41 | Asthenia | FAERS: 38 | SIDER US FAERS | |
| 42 | Product quality issue | FAERS: 36 | US FAERS | |
| 43 | Anxiety | FAERS: 33 | SIDER US FAERS | |
| 44 | Myocardial Infarction | FAERS: 32 | SIDER US FAERS | |
| 45 | Procedural complication | FAERS: 32 | US FAERS | |
| 46 | Unevaluable event | FAERS: 31 | OFFSIDES US FAERS | |
| 47 | Burning sensation | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 48 | Contrast media allergy | FAERS: 28 | US FAERS | |
| 49 | Oral pruritus | FAERS: 28 | US FAERS | |
| 50 | Rash erythematous | FAERS: 28 | US FAERS | |
| 51 | Agitation | FAERS: 25 | SIDER US FAERS | |
| 52 | Back Pain | FAERS: 25 | SIDER US FAERS | |
| 53 | Respiratory Failure | FAERS: 24 | SIDER US FAERS | |
| 54 | Oropharyngeal discomfort | FAERS: 22 | OFFSIDES SIDER US FAERS | |
| 55 | Asphyxia | FAERS: 21 | US FAERS | |
| 56 | Anaphylactoid Reaction | FAERS: 20 | SIDER US FAERS | |
| 57 | Fatigue | FAERS: 19 | US FAERS | |
| 58 | Feeling abnormal | FAERS: 19 | SIDER US FAERS | |
| 59 | Post procedural complication | FAERS: 19 | US FAERS | |
| 60 | nervous system disorder | FAERS: 19 | SIDER US FAERS | |
| 61 | Abdominal Pain | FAERS: 18 | SIDER US FAERS | |
| 62 | Choking sensation | FAERS: 18 | OFFSIDES US FAERS | |
| 63 | Discomfort | FAERS: 18 | SIDER US FAERS | |
| 64 | Disorientation | FAERS: 18 | US FAERS | |
| 65 | Injection site extravasation | FAERS: 18 | US FAERS | |
| 66 | Unresponsive to stimuli | FAERS: 18 | US FAERS | |
| 67 | Ventricular Fibrillation | FAERS: 18 | 1997305 10823730 | CTD SIDER US FAERS |
| 68 | Feeling Cold | FAERS: 17 | US FAERS | |
| 69 | Somnolence | FAERS: 17 | SIDER US FAERS | |
| 70 | Angina Pectoris | FAERS: 16 | SIDER US FAERS | |
| 71 | Aphasia | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 72 | Foaming at mouth | FAERS: 16 | US FAERS | |
| 73 | Injection Site Reaction | FAERS: 16 | SIDER US FAERS | |
| 74 | Presyncope | FAERS: 16 | US FAERS | |
| 75 | Contrast encephalopathy | FAERS: 15 | US FAERS | |
| 76 | Hypoaesthesia facial | FAERS: 15 | OFFSIDES US FAERS | |
| 77 | Restlessness | FAERS: 15 | US FAERS | |
| 78 | Oropharyngeal swelling | FAERS: 14 | OFFSIDES US FAERS | |
| 79 | Pain | FAERS: 14 Canada Vigilance: 1 | 9211770 | CTD SIDER Canada Vigilance US FAERS |
| 80 | Retching | FAERS: 14 | US FAERS | |
| 81 | Skin reaction | FAERS: 14 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 82 | Abdominal discomfort | FAERS: 13 | SIDER US FAERS | |
| 83 | Altered state of consciousness | FAERS: 13 | US FAERS | |
| 84 | Aphonia | FAERS: 13 | OFFSIDES US FAERS | |
| 85 | Laryngospasm | FAERS: 13 | SIDER US FAERS | |
| 86 | Acute myocardial infarction | FAERS: 12 | US FAERS | |
| 87 | Cerebrovascular accident | FAERS: 12 | SIDER US FAERS | |
| 88 | Cold sweat | FAERS: 12 | US FAERS | |
| 89 | Infusion Site Extravasation | FAERS: 12 | US FAERS | |
| 90 | Stridor | FAERS: 12 | OFFSIDES US FAERS | |
| 91 | Vertigo | FAERS: 12 | SIDER US FAERS | |
| 92 | Blindness | FAERS: 11 | US FAERS | |
| 93 | Epilepsy | FAERS: 11 | US FAERS | |
| 94 | Lip pruritus | FAERS: 11 | US FAERS | |
| 95 | Mydriasis | FAERS: 11 | SIDER US FAERS | |
| 96 | Nasal discomfort | FAERS: 11 | OFFSIDES US FAERS | |
| 97 | Dysarthria | FAERS: 10 | US FAERS | |
| 98 | Eye irritation | FAERS: 10 | US FAERS | |
| 99 | General physical health deterioration | FAERS: 10 | US FAERS | |
| 100 | Muscle tightness | FAERS: 10 | US FAERS | |
| 101 | Acute kidney injury | FAERS: 9 | 15986266 17001234 17715118 | CTD US FAERS |
| 102 | Atrial Fibrillation | FAERS: 9 | SIDER US FAERS | |
| 103 | Blood creatinine increased | FAERS: 9 | US FAERS | |
| 104 | Drug administration error | FAERS: 9 | US FAERS | |
| 105 | Musculoskeletal stiffness | FAERS: 9 | US FAERS | |
| 106 | Oropharyngeal pain | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 107 | Papule | FAERS: 9 | US FAERS | |
| 108 | Pharyngolaryngeal discomfort | FAERS: 9 | OFFSIDES US FAERS | |
| 109 | Tongue pruritus | FAERS: 9 | US FAERS | |
| 110 | Trismus | FAERS: 9 | US FAERS | |
| 111 | Visual Impairment | FAERS: 9 | SIDER US FAERS | |
| 112 | Arthralgia | FAERS: 8 | SIDER US FAERS | |
| 113 | Choking | FAERS: 8 | US FAERS | |
| 114 | Diplopia | FAERS: 8 | OFFSIDES US FAERS | |
| 115 | Enuresis | FAERS: 8 | OFFSIDES US FAERS | |
| 116 | Hemiparesis | FAERS: 8 | US FAERS | |
| 117 | Hypoxia | FAERS: 8 | 12631011 | CTD US FAERS |
| 118 | Productive Cough | FAERS: 8 | US FAERS | |
| 119 | Anuria | FAERS: 7 | US FAERS | |
| 120 | Asthma | FAERS: 7 | SIDER US FAERS | |
| 121 | Drug toxicity | FAERS: 7 | US FAERS | |
| 122 | Joint swelling | FAERS: 7 | SIDER US FAERS | |
| 123 | Monoparesis | FAERS: 7 | US FAERS | |
| 124 | Musculoskeletal discomfort | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 125 | Peripheral swelling | FAERS: 7 | US FAERS | |
| 126 | Sinus Tachycardia | FAERS: 7 | US FAERS | |
| 127 | Urticaria localised | FAERS: 7 | OFFSIDES US FAERS | |
| 128 | Brain Death | FAERS: 6 | US FAERS | |
| 129 | Cardiovascular insufficiency | FAERS: 6 | US FAERS | |
| 130 | Cheilitis | FAERS: 6 | US FAERS | |
| 131 | Disseminated Intravascular Coagulation | FAERS: 6 | US FAERS | |
| 132 | Dysgeusia | FAERS: 6 | SIDER US FAERS | |
| 133 | Incontinence | FAERS: 6 | OFFSIDES US FAERS | |
| 134 | Inflammation | FAERS: 6 | SIDER US FAERS | |
| 135 | Pulmonary Embolism | FAERS: 6 | US FAERS | |
| 136 | Upper airway obstruction | FAERS: 6 | OFFSIDES US FAERS | |
| 137 | Blood creatine phosphokinase increased | FAERS: 5 | US FAERS | |
| 138 | Blood urea increased | FAERS: 5 | SIDER US FAERS | |
| 139 | Cardiac procedure complication | FAERS: 5 | US FAERS | |
| 140 | Cerebral artery occlusion | FAERS: 5 | US FAERS | |
| 141 | Coronary Artery Disease | FAERS: 5 | US FAERS | |
| 142 | Crying | FAERS: 5 | OFFSIDES US FAERS | |
| 143 | Ear discomfort | FAERS: 5 | US FAERS | |
| 144 | Electrocardiogram abnormal | FAERS: 5 | US FAERS | |
| 145 | Electrocardiogram change | FAERS: 5 | OFFSIDES US FAERS | |
| 146 | Formication | FAERS: 5 | US FAERS | |
| 147 | Hyperpyrexia | FAERS: 5 | US FAERS | |
| 148 | Incorrect drug administration rate | FAERS: 5 | OFFSIDES US FAERS | |
| 149 | Intubation complication | FAERS: 5 | US FAERS | |
| 150 | Laryngeal discomfort | FAERS: 5 | OFFSIDES US FAERS | |
| 151 | Lethargy | FAERS: 5 | US FAERS | |
| 152 | Medication Error | FAERS: 5 | US FAERS | |
| 153 | Mental status changes | FAERS: 5 | US FAERS | |
| 154 | Respiratory Depression | FAERS: 5 | US FAERS | |
| 155 | Upper respiratory tract congestion | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 156 | Acute respiratory failure | FAERS: 4 | US FAERS | |
| 157 | Arthropathy | FAERS: 4 | SIDER US FAERS | |
| 158 | Bradyphrenia | FAERS: 4 | US FAERS | |
| 159 | Cerebral Infarction | FAERS: 4 | SIDER US FAERS | |
| 160 | Delirium | FAERS: 4 | US FAERS | |
| 161 | Dystonia | FAERS: 4 | US FAERS | |
| 162 | Hypertensive crisis | FAERS: 4 | US FAERS | |
| 163 | Injection site erythema | FAERS: 4 | US FAERS | |
| 164 | Limb discomfort | FAERS: 4 | US FAERS | |
| 165 | Medical device complication | FAERS: 4 | US FAERS | |
| 166 | Myoclonus | FAERS: 4 | US FAERS | |
| 167 | Nervousness | FAERS: 4 | US FAERS | |
| 168 | Nonspecific reaction | FAERS: 4 | US FAERS | |
| 169 | Paraplegia | FAERS: 4 | US FAERS | |
| 170 | Photophobia | FAERS: 4 | SIDER US FAERS | |
| 171 | Respiratory tract congestion | FAERS: 4 | OFFSIDES US FAERS | |
| 172 | Rhinitis | FAERS: 4 | SIDER US FAERS | |
| 173 | Sense of oppression | FAERS: 4 | US FAERS | |
| 174 | Skin discomfort | FAERS: 4 | US FAERS | |
| 175 | Skin tightness | FAERS: 4 | US FAERS | |
| 176 | Sudden death | FAERS: 4 | US FAERS | |
| 177 | Supraventricular tachycardia | FAERS: 4 | US FAERS | |
| 178 | VIIth nerve paralysis | FAERS: 4 | US FAERS | |
| 179 | Visual disturbance | FAERS: 4 | US FAERS | |
| 180 | Abasia | FAERS: 3 | US FAERS | |
| 181 | Abscess | FAERS: 3 | US FAERS | |
| 182 | Acne | FAERS: 3 | US FAERS | |
| 183 | Alanine Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 184 | Amnesia | FAERS: 3 | SIDER US FAERS | |
| 185 | Anal sphincter atony | FAERS: 3 | US FAERS | |
| 186 | Anoxic Encephalopathy | FAERS: 3 | OFFSIDES US FAERS | |
| 187 | Apallic syndrome | FAERS: 3 | US FAERS | |
| 188 | Aspartate Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 189 | Ataxia | FAERS: 3 | US FAERS | |
| 190 | Blood creatine increased | FAERS: 3 | US FAERS | |
| 191 | Blood glucose decreased | FAERS: 3 | US FAERS | |
| 192 | Cholangitis | FAERS: 3 | US FAERS | |
| 193 | Dermatitis | FAERS: 3 | SIDER US FAERS | |
| 194 | Documented hypersensitivity to administered product | FAERS: 3 | US FAERS | |
| 195 | Emotional distress | FAERS: 3 | US FAERS | |
| 196 | Epistaxis | FAERS: 3 | SIDER US FAERS | |
| 197 | Exophthalmos | FAERS: 3 | US FAERS | |
| 198 | Eyelid Function Disorder | FAERS: 3 | OFFSIDES US FAERS | |
| 199 | Hyperventilation | FAERS: 3 | OFFSIDES US FAERS | |
| 200 | Hypothyroidism | FAERS: 3 | SIDER US FAERS | |
| 201 | Hypoventilation | FAERS: 3 | US FAERS | |
| 202 | Injection site urticaria | FAERS: 3 | US FAERS | |
| 203 | Larynx irritation | FAERS: 3 | US FAERS | |
| 204 | Leukocytosis | FAERS: 3 | US FAERS | |
| 205 | Lymphadenopathy | FAERS: 3 | US FAERS | |
| 206 | Memory impairment | FAERS: 3 | US FAERS | |
| 207 | Mental impairment | FAERS: 3 | US FAERS | |
| 208 | Mouth swelling | FAERS: 3 | US FAERS | |
| 209 | Muscle Rigidity | FAERS: 3 | US FAERS | |
| 210 | Nasal pruritus | FAERS: 3 | US FAERS | |
| 211 | Neck Pain | FAERS: 3 | SIDER US FAERS | |
| 212 | Neurological decompensation | FAERS: 3 | US FAERS | |
| 213 | No reaction on previous exposure to drug | FAERS: 3 | US FAERS | |
| 214 | Obstruction | FAERS: 3 | US FAERS | |
| 215 | Opisthotonus | FAERS: 3 | US FAERS | |
| 216 | Pneumonia | FAERS: 3 | US FAERS | |
| 217 | Product use issue | FAERS: 3 | US FAERS | |
| 218 | Quadriplegia | FAERS: 3 | US FAERS | |
| 219 | Sepsis | FAERS: 3 | SIDER US FAERS | |
| 220 | Septic Shock | FAERS: 3 | US FAERS | |
| 221 | Sinus headache | FAERS: 3 | OFFSIDES US FAERS | |
| 222 | Skin lesion | FAERS: 3 | US FAERS | |
| 223 | Skin necrosis | FAERS: 3 | US FAERS | |
| 224 | Status Epilepticus | FAERS: 3 | OFFSIDES US FAERS | |
| 225 | Strabismus | FAERS: 3 | US FAERS | |
| 226 | Therapy non-responder | FAERS: 3 | US FAERS | |
| 227 | Thrombosis | FAERS: 3 | SIDER US FAERS | |
| 228 | Tinnitus | FAERS: 3 | SIDER US FAERS | |
| 229 | Accidental exposure | FAERS: 2 | US FAERS | |
| 230 | Acute Coronary Syndrome | FAERS: 2 | SIDER US FAERS | |
| 231 | Administration site extravasation | FAERS: 2 | US FAERS | |
| 232 | Amimia | FAERS: 2 | US FAERS | |
| 233 | Aneurysm | FAERS: 2 | US FAERS | |
| 234 | Apathy | FAERS: 2 | US FAERS | |
| 235 | Arthritis | FAERS: 2 | US FAERS | |
| 236 | Ascites | FAERS: 2 | US FAERS | |
| 237 | Atelectasis | FAERS: 2 | US FAERS | |
| 238 | Auricular swelling | FAERS: 2 | OFFSIDES US FAERS | |
| 239 | Blood chloride increased | FAERS: 2 | US FAERS | |
| 240 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 241 | Blood mercury abnormal | FAERS: 2 | US FAERS | |
| 242 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 243 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 244 | Blood sodium increased | FAERS: 2 | US FAERS | |
| 245 | Brain Hypoxia | FAERS: 2 | US FAERS | |
| 246 | Cardiac enzymes normal | FAERS: 2 | US FAERS | |
| 247 | Cellulitis | FAERS: 2 | US FAERS | |
| 248 | Chemical burn of skin | FAERS: 2 | US FAERS | |
| 249 | Concomitant disease progression | FAERS: 2 | US FAERS | |
| 250 | Conjunctivitis | FAERS: 2 | SIDER US FAERS | |
| 251 | Consciousness fluctuating | FAERS: 2 | US FAERS | |
| 252 | Conversion disorder | FAERS: 2 | US FAERS | |
| 253 | Coronary artery insufficiency | FAERS: 2 | US FAERS | |
| 254 | Deafness | FAERS: 2 | US FAERS | |
| 255 | Dehydration | FAERS: 2 | US FAERS | |
| 256 | Drug clearance increased | FAERS: 2 | US FAERS | |
| 257 | Drug ineffective | FAERS: 2 | US FAERS | |
| 258 | Dysgraphia | FAERS: 2 | OFFSIDES US FAERS | |
| 259 | Embolism | FAERS: 2 | US FAERS | |
| 260 | Eye pain | FAERS: 2 | US FAERS | |
| 261 | Facial Pain | FAERS: 2 | US FAERS | |
| 262 | Febrile infection | FAERS: 2 | OFFSIDES US FAERS | |
| 263 | Food Allergy | FAERS: 2 | OFFSIDES US FAERS | |
| 264 | Head discomfort | FAERS: 2 | US FAERS | |
| 265 | Hepatitis C | FAERS: 2 | US FAERS | |
| 266 | Hepatitis | FAERS: 2 | US FAERS | |
| 267 | Hepatotoxicity | FAERS: 2 | US FAERS | |
| 268 | Hydrothorax | FAERS: 2 | US FAERS | |
| 269 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 270 | Increased upper airway secretion | FAERS: 2 | US FAERS | |
| 271 | Infection | FAERS: 2 | US FAERS | |
| 272 | Injection site pain | FAERS: 2 | SIDER US FAERS | |
| 273 | Iodine allergy | FAERS: 2 | US FAERS | |
| 274 | Joint stiffness | FAERS: 2 | US FAERS | |
| 275 | Kounis Syndrome | FAERS: 2 | US FAERS | |
| 276 | Labile blood pressure | FAERS: 2 | US FAERS | |
| 277 | Macroglossia | FAERS: 2 | US FAERS | |
| 278 | Maternal exposure during pregnancy | FAERS: 2 | US FAERS | |
| 279 | Mechanical ventilation | FAERS: 2 | US FAERS | |
| 280 | Mesenteritis | FAERS: 2 | US FAERS | |
| 281 | Metamorphopsia | FAERS: 2 | US FAERS | |
| 282 | Monoplegia | FAERS: 2 | US FAERS | |
| 283 | No adverse event | FAERS: 2 | US FAERS | |
| 284 | Non-cardiac chest pain | FAERS: 2 | US FAERS | |
| 285 | Noninfective sialoadenitis | FAERS: 2 | US FAERS | |
| 286 | Nystagmus | FAERS: 2 | US FAERS | |
| 287 | Ophthalmoplegia | FAERS: 2 | US FAERS | |
| 288 | Palmar erythema | FAERS: 2 | US FAERS | |
| 289 | Petechiae | FAERS: 2 | US FAERS | |
| 290 | Pharyngolaryngeal Pain | FAERS: 2 | US FAERS | |
| 291 | Piloerection | FAERS: 2 | OFFSIDES US FAERS | |
| 292 | Poor peripheral circulation | FAERS: 2 | US FAERS | |
| 293 | Poor quality drug administered | FAERS: 2 | US FAERS | |
| 294 | Posturing | FAERS: 2 | OFFSIDES US FAERS | |
| 295 | Procedural hypotension | FAERS: 2 | OFFSIDES US FAERS | |
| 296 | Product contamination | FAERS: 2 | US FAERS | |
| 297 | Purpura | FAERS: 2 | US FAERS | |
| 298 | Rales | FAERS: 2 | US FAERS | |
| 299 | Renal pain | FAERS: 2 | SIDER US FAERS | |
| 300 | Renal tubular necrosis | FAERS: 2 | US FAERS | |
| 301 | Ruptured cerebral aneurysm | FAERS: 2 | US FAERS | |
| 302 | Seizure like phenomena | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 303 | Sinus bradycardia | FAERS: 2 | US FAERS | |
| 304 | Skin irritation | FAERS: 2 | US FAERS | |
| 305 | Stomatitis | FAERS: 2 | US FAERS | |
| 306 | Subcutaneous Emphysema | FAERS: 2 | US FAERS | |
| 307 | Suspected product quality issue | FAERS: 2 | US FAERS | |
| 308 | Tachyarrhythmia | FAERS: 2 | US FAERS | |
| 309 | Tracheobronchitis | FAERS: 2 | OFFSIDES US FAERS | |
| 310 | Transient psychosis | FAERS: 2 | OFFSIDES US FAERS | |
| 311 | Vascular insufficiency | FAERS: 2 | US FAERS | |
| 312 | Ventricular hypertrophy | FAERS: 2 | US FAERS | |
| 313 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 314 | Accidental overdose | FAERS: 1 | US FAERS | |
| 315 | Acquired diaphragmatic eventration | FAERS: 1 | US FAERS | |
| 316 | Acute Lung Injury | FAERS: 1 | US FAERS | |
| 317 | Acute tonsillitis | FAERS: 1 | US FAERS | |
| 318 | Ageusia | FAERS: 1 | US FAERS | |
| 319 | Air Embolism | FAERS: 1 | US FAERS | |
| 320 | Allergy to chemicals | FAERS: 1 | US FAERS | |
| 321 | Amaurosis | FAERS: 1 | US FAERS | |
| 322 | Anorectal discomfort | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 323 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 324 | Apparent death | FAERS: 1 | US FAERS | |
| 325 | Application site extravasation | FAERS: 1 | US FAERS | |
| 326 | Atrioventricular Block | FAERS: 1 | SIDER US FAERS | |
| 327 | Autoimmune thyroiditis | FAERS: 1 | US FAERS | |
| 328 | Autonomic nervous system imbalance | FAERS: 1 | SIDER US FAERS | |
| 329 | Bacterial sepsis | FAERS: 1 | US FAERS | |
| 330 | Band sensation | FAERS: 1 | US FAERS | |
| 331 | Bladder sphincter atony | FAERS: 1 | US FAERS | |
| 332 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 333 | Blood parathyroid hormone decreased | FAERS: 1 | US FAERS | |
| 334 | Blood thyroid stimulating hormone increased | FAERS: 1 | OFFSIDES US FAERS | |
| 335 | Brain scan abnormal | FAERS: 1 | US FAERS | |
| 336 | Brain stem syndrome | FAERS: 1 | US FAERS | |
| 337 | Breath Holding | FAERS: 1 | US FAERS | |
| 338 | Bronchial Obstruction | FAERS: 1 | US FAERS | |
| 339 | Bronchiolitis | FAERS: 1 | US FAERS | |
| 340 | Bronchitis | FAERS: 1 | US FAERS | |
| 341 | Cardiac stress test abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 342 | Cardio-respiratory distress | FAERS: 1 | US FAERS | |
| 343 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 344 | Carotid pulse abnormal | FAERS: 1 | US FAERS | |
| 345 | Central Nervous System Infection | FAERS: 1 | US FAERS | |
| 346 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 347 | Cerebral dysgenesis | FAERS: 1 | US FAERS | |
| 348 | Cerebrovascular Insufficiency | FAERS: 1 | US FAERS | |
| 349 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 350 | Cholestasis | FAERS: 1 | US FAERS | |
| 351 | Clonus | FAERS: 1 | US FAERS | |
| 352 | Coma scale abnormal | FAERS: 1 | US FAERS | |
| 353 | Conjunctival irritation | FAERS: 1 | US FAERS | |
| 354 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 355 | Device malfunction | FAERS: 1 | US FAERS | |
| 356 | Device related infection | FAERS: 1 | US FAERS | |
| 357 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 358 | Diffuse alveolar damage | FAERS: 1 | OFFSIDES US FAERS | |
| 359 | Disease Progression | FAERS: 1 | US FAERS | |
| 360 | Distributive shock | FAERS: 1 | US FAERS | |
| 361 | Diverticular perforation | FAERS: 1 | OFFSIDES US FAERS | |
| 362 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 363 | Dry skin | FAERS: 1 | US FAERS | |
| 364 | Dyslexia | FAERS: 1 | US FAERS | |
| 365 | Eczema | FAERS: 1 | US FAERS | |
| 366 | Electromechanical dissociation | FAERS: 1 | US FAERS | |
| 367 | Emotional disorder | FAERS: 1 | US FAERS | |
| 368 | Enlarged uvula | FAERS: 1 | US FAERS | |
| 369 | Epidermolysis | FAERS: 1 | US FAERS | |
| 370 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 371 | Erythema Nodosum | FAERS: 1 | US FAERS | |
| 372 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 373 | Eye Redness | FAERS: 1 | US FAERS | |
| 374 | Eyelids pruritus | FAERS: 1 | OFFSIDES US FAERS | |
| 375 | Facial Paresis | FAERS: 1 | US FAERS | |
| 376 | Feeling jittery | FAERS: 1 | US FAERS | |
| 377 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 378 | Fracture | FAERS: 1 | US FAERS | |
| 379 | Gastrointestinal Pain | FAERS: 1 | SIDER US FAERS | |
| 380 | Gastrointestinal erosion | FAERS: 1 | US FAERS | |
| 381 | Gaze palsy | FAERS: 1 | US FAERS | |
| 382 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 383 | Glossitis | FAERS: 1 | US FAERS | |
| 384 | Hemiplegia | FAERS: 1 | US FAERS | |
| 385 | Hospice Care | FAERS: 1 | US FAERS | |
| 386 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 387 | Hyperthyroidism | FAERS: 1 | SIDER US FAERS | |
| 388 | Incoherent | FAERS: 1 | US FAERS | |
| 389 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 390 | Increased bronchial secretion | FAERS: 1 | US FAERS | |
| 391 | Induration | FAERS: 1 | US FAERS | |
| 392 | Influenza | FAERS: 1 | US FAERS | |
| 393 | Infusion site mobility decreased | FAERS: 1 | US FAERS | |
| 394 | Infusion site pain | FAERS: 1 | US FAERS | |
| 395 | Injection site bruising | FAERS: 1 | US FAERS | |
| 396 | Injection site mass | FAERS: 1 | US FAERS | |
| 397 | Injection site vesicles | FAERS: 1 | US FAERS | |
| 398 | Intestinal angioedema | FAERS: 1 | US FAERS | |
| 399 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 400 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 401 | Ketoacidosis | FAERS: 1 | US FAERS | |
| 402 | Large intestine erosion | FAERS: 1 | US FAERS | |
| 403 | Lateral Medullary Syndrome | FAERS: 1 | US FAERS | |
| 404 | Leukocytoclastic vasculitis | FAERS: 1 | US FAERS | |
| 405 | Leukopenia | FAERS: 1 | US FAERS | |
| 406 | Lichen Planus | FAERS: 1 | US FAERS | |
| 407 | Livedo Reticularis | FAERS: 1 | US FAERS | |
| 408 | Lymphocyte percentage decreased | FAERS: 1 | US FAERS | |
| 409 | Malnutrition | FAERS: 1 | US FAERS | |
| 410 | Mechanical urticaria | FAERS: 1 | US FAERS | |
| 411 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 412 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 413 | Muscle Spasticity | FAERS: 1 | US FAERS | |
| 414 | Musculoskeletal Pain | FAERS: 1 | SIDER US FAERS | |
| 415 | Myalgia | FAERS: 1 | US FAERS | |
| 416 | Neonatal disorder | FAERS: 1 | US FAERS | |
| 417 | Nephrogenic Systemic Fibrosis | FAERS: 1 | US FAERS | |
| 418 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 419 | Nerve injury | FAERS: 1 | US FAERS | |
| 420 | Neuropathy | FAERS: 1 | SIDER US FAERS | |
| 421 | Neutrophil percentage increased | FAERS: 1 | US FAERS | |
| 422 | Night sweats | FAERS: 1 | US FAERS | |
| 423 | Oculomucocutaneous syndrome | FAERS: 1 | US FAERS | |
| 424 | Oliguria | FAERS: 1 | US FAERS | |
| 425 | Oral mucosal erythema | FAERS: 1 | US FAERS | |
| 426 | Orthostatic intolerance | FAERS: 1 | US FAERS | |
| 427 | Oxygen saturation abnormal | FAERS: 1 | US FAERS | |
| 428 | Pancreatitis | FAERS: 1 | SIDER US FAERS | |
| 429 | Pancytopenia | FAERS: 1 | US FAERS | |
| 430 | Paravenous drug administration | FAERS: 1 | US FAERS | |
| 431 | Pathogen resistance | FAERS: 1 | US FAERS | |
| 432 | Peritonitis | FAERS: 1 | US FAERS | |
| 433 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 434 | Pharyngeal swelling | FAERS: 1 | US FAERS | |
| 435 | Pharyngolaryngeal abscess | FAERS: 1 | OFFSIDES US FAERS | |
| 436 | Pneumothorax | FAERS: 1 | US FAERS | |
| 437 | Posterior reversible encephalopathy syndrome | FAERS: 1 | US FAERS | |
| 438 | Postresuscitation encephalopathy | FAERS: 1 | US FAERS | |
| 439 | Procedural nausea | FAERS: 1 | US FAERS | |
| 440 | Procedural vomiting | FAERS: 1 | US FAERS | |
| 441 | Product deposit | FAERS: 1 | US FAERS | |
| 442 | Prurigo | FAERS: 1 | US FAERS | |
| 443 | Pseudoangina | FAERS: 1 | US FAERS | |
| 444 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 445 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 446 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 447 | Red man syndrome | FAERS: 1 | OFFSIDES US FAERS | |
| 448 | Respiratory tract inflammation | FAERS: 1 | US FAERS | |
| 449 | Rhinalgia | FAERS: 1 | US FAERS | |
| 450 | Saliva altered | FAERS: 1 | US FAERS | |
| 451 | Sinusitis | FAERS: 1 | US FAERS | |
| 452 | Skin Induration | FAERS: 1 | US FAERS | |
| 453 | Somatoform Disorder | FAERS: 1 | US FAERS | |
| 454 | Status Asthmaticus | FAERS: 1 | SIDER US FAERS | |
| 455 | Stevens-Johnson Syndrome | FAERS: 1 | 25811541 | CTD SIDER US FAERS |
| 456 | Stress ulcer | FAERS: 1 | US FAERS | |
| 457 | Stress | FAERS: 1 | US FAERS | |
| 458 | Submandibular mass | FAERS: 1 | OFFSIDES US FAERS | |
| 459 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 460 | Swelling of eyelid | FAERS: 1 | US FAERS | |
| 461 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 462 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 463 | Tension Headache | FAERS: 1 | US FAERS | |
| 464 | Therapeutic product effect incomplete | FAERS: 1 | US FAERS | |
| 465 | Thermal burn | FAERS: 1 | US FAERS | |
| 466 | Thirst | FAERS: 1 | SIDER US FAERS | |
| 467 | Thrombocytopenia | FAERS: 1 | 7671781 | CTD US FAERS |
| 468 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 469 | Tonic clonic movements | FAERS: 1 | OFFSIDES US FAERS | |
| 470 | Toxic Epidermal Necrolysis | FAERS: 1 | SIDER US FAERS | |
| 471 | Tracheal Stenosis | FAERS: 1 | US FAERS | |
| 472 | Transaminases increased | FAERS: 1 | US FAERS | |
| 473 | Traumatic fracture | FAERS: 1 | US FAERS | |
| 474 | Troponin increased | FAERS: 1 | US FAERS | |
| 475 | Tryptase decreased | FAERS: 1 | US FAERS | |
| 476 | Tryptase increased | FAERS: 1 | US FAERS | |
| 477 | Ulcer | FAERS: 1 | US FAERS | |
| 478 | Unresponsive to verbal stimuli | FAERS: 1 | US FAERS | |
| 479 | Urinary Retention | FAERS: 1 | SIDER US FAERS | |
| 480 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 481 | Urine output increased | FAERS: 1 | US FAERS | |
| 482 | Vanillyl mandelic acid urine increased | FAERS: 1 | US FAERS | |
| 483 | Vascular rupture | FAERS: 1 | US FAERS | |
| 484 | Vascular stent occlusion | FAERS: 1 | US FAERS | |
| 485 | Vasculitis | FAERS: 1 | SIDER US FAERS | |
| 486 | Vasoplegia syndrome | FAERS: 1 | US FAERS | |
| 487 | Vein collapse | FAERS: 1 | US FAERS | |
| 488 | Venous thrombosis limb | FAERS: 1 | US FAERS | |
| 489 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 490 | Verbigeration | FAERS: 1 | US FAERS | |
| 491 | Vertebral artery occlusion | FAERS: 1 | US FAERS | |
| 492 | Vessel puncture site pain | FAERS: 1 | OFFSIDES US FAERS | |
| 493 | Vessel puncture site pruritus | FAERS: 1 | US FAERS | |
| 494 | Vital functions abnormal | FAERS: 1 | US FAERS | |
| 495 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 496 | Wound Infection | FAERS: 1 | US FAERS | |
| 497 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 498 | intensive care | FAERS: 1 | US FAERS | |
| 499 | jaundice | FAERS: 1 | US FAERS | |
| 500 | Abdominal Compartment Syndrome | OFFSIDES | ||
| 501 | Abnormal vision | SIDER | ||
| 502 | Amnestic Disorder | OFFSIDES | ||
| 503 | Anticholinergic Syndrome | OFFSIDES | ||
| 504 | Antidepressant drug clearance increased | OFFSIDES | ||
| 505 | Atherosclerosis | OFFSIDES | ||
| 506 | Blindness, Cortical | 10974726 | CTD | |
| 507 | Blood glucose abnormal | OFFSIDES | ||
| 508 | Blood immunoglobulin A decreased | OFFSIDES | ||
| 509 | Blood immunoglobulin M decreased | OFFSIDES | ||
| 510 | Blood lactate dehydrogenase increased | SIDER | ||
| 511 | Body temperature fluctuation | SIDER | ||
| 512 | Bone pain | OFFSIDES | ||
| 513 | Brain Ischemia | 16628721 | CTD | |
| 514 | Bruxism | OFFSIDES | ||
| 515 | Bullous conditions | SIDER | ||
| 516 | Catheter related complication | OFFSIDES | ||
| 517 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 518 | Conjunctival deposit | OFFSIDES | ||
| 519 | Constipation | SIDER | ||
| 520 | Coronary angioplasty | OFFSIDES | ||
| 521 | Diabetes Insipidus | SIDER | ||
| 522 | Diabetes mellitus inadequate control | OFFSIDES | ||
| 523 | Dysmorphism | OFFSIDES | ||
| 524 | Dyspepsia | SIDER | ||
| 525 | Dyspnea | 8761866 | CTD | |
| 526 | Dysuria | SIDER | ||
| 527 | Ear and labyrinth disorders | SIDER | ||
| 528 | Ear congestion | OFFSIDES | ||
| 529 | Electrocardiogram ST-T segment depression | OFFSIDES | ||
| 530 | Erythema Multiforme | SIDER | ||
| 531 | Femoral pulse decreased | OFFSIDES | ||
| 532 | Glasgow coma scale | OFFSIDES | ||
| 533 | Heart Diseases | 19021282 | CTD | |
| 534 | Hoarseness | SIDER | ||
| 535 | Infarction | SIDER | ||
| 536 | Intestinal infarction | OFFSIDES | ||
| 537 | Intracranial injury | OFFSIDES | ||
| 538 | Intubation | OFFSIDES | ||
| 539 | Iodine uptake increased | OFFSIDES | ||
| 540 | Kidney Diseases | CTD | ||
| 541 | Lacrimal structural disorder | SIDER | ||
| 542 | Lacrimation | SIDER | ||
| 543 | Lividity | OFFSIDES | ||
| 544 | Meningism | SIDER | ||
| 545 | Mental disorder due to a general medical condition | OFFSIDES | ||
| 546 | Mood swings | SIDER | ||
| 547 | Muscle relaxant therapy | SIDER | ||
| 548 | Myoglobin blood increased | OFFSIDES | ||
| 549 | Necrosis | SIDER | ||
| 550 | Numbness | SIDER | ||
| 551 | Paresis | SIDER | ||
| 552 | Pedal pulse decreased | OFFSIDES | ||
| 553 | Pharyngitis | SIDER | ||
| 554 | Pinguecula | OFFSIDES | ||
| 555 | Polyneuropathy | OFFSIDES | ||
| 556 | Pulmonary Hypertension | SIDER | ||
| 557 | Rectal tenesmus | SIDER | ||
| 558 | Respiratory Insufficiency | SIDER | ||
| 559 | Risus sardonicus | OFFSIDES | ||
| 560 | Scotoma | SIDER | ||
| 561 | Seizures | 8761866 | CTD | |
| 562 | Sensation of warmth | SIDER | ||
| 563 | Septicemia | SIDER | ||
| 564 | Shivering | SIDER | ||
| 565 | Shoulder Pain | SIDER | ||
| 566 | Sopor | OFFSIDES | ||
| 567 | Subglottic edema | SIDER | ||
| 568 | Superior Vena Cava Syndrome | OFFSIDES | ||
| 569 | Sweating | SIDER | ||
| 570 | Tension | SIDER | ||
| 571 | Thrombophlebitis | SIDER | ||
| 572 | Upset stomach | SIDER | ||
| 573 | Vascular anomaly | SIDER | ||
| 574 | Vasodilation procedure | SIDER | ||
| 575 | Vasodilation | SIDER | ||
| 576 | Vasospasm | SIDER | ||
| 577 | Vegetative dystonia | SIDER | ||
| 578 | Venous Thrombosis | SIDER | ||
| 579 | effusion | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120295
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.