Bendamustine Hydrochloride
(ZHSKUOZOLHMKEA-UHFFFAOYSA-N)
Structure
- SMILES
- ClCCN(c1ccc2c(c1)nc(n2C)CCCC(=O)O)CCCl.Cl
- Molecular Formula:
- C16H22Cl3N3O2
- Molecular Weight:
- 394.724
- Log P:
- 4.0666
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 2
- TPSA:
- 58.36
- CAS Number(s):
- 3543-75-7; 97832-05-8
Synonym(s)
1.
Bendamustine Hydrochloride
2.
Bendamustin
3.
Bendamustine
4.
Cytostasan
5.
IMET 3393
6.
Ribomustin
7.
Treanda
8.
Zimet 3393
9.
Hydrochloride, Bendamustine
External Link(s)
| MeSH | D000069461 |
| PubChem Compound | 77082 46863991 |
| CHEMBL | CHEMBL1201734 |
| KEGG | dr:D07085 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Neutropenia | FAERS: 63 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 2 | Extravasation | FAERS: 61 | US FAERS | |
| 3 | Infusion site pain | FAERS: 52 | US FAERS | |
| 4 | Pancytopenia | FAERS: 52 | US FAERS | |
| 5 | Thrombocytopenia | FAERS: 48 | US FAERS | |
| 6 | Febrile Neutropenia | FAERS: 44 | US FAERS | |
| 7 | Fatigue | FAERS: 39 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Disease Progression | FAERS: 37 | US FAERS | |
| 9 | Nausea | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 10 | Infusion Site Extravasation | FAERS: 35 | US FAERS | |
| 11 | Infusion site reaction | FAERS: 33 | US FAERS | |
| 12 | Sepsis | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 13 | Burning sensation | FAERS: 31 | US FAERS | |
| 14 | Infusion site irritation | FAERS: 31 | US FAERS | |
| 15 | White blood cell count decreased | FAERS: 28 | US FAERS | |
| 16 | Pneumonia | FAERS: 27 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 17 | Erythema | FAERS: 26 | US FAERS | |
| 18 | Phlebitis | FAERS: 25 | US FAERS | |
| 19 | Infection | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 20 | Hypotension | FAERS: 23 | US FAERS | |
| 21 | Injection site pain | FAERS: 23 | US FAERS | |
| 22 | Vomiting | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 23 | Chills | FAERS: 22 | US FAERS | |
| 24 | Lymphadenopathy | FAERS: 22 | US FAERS | |
| 25 | Neutrophil count decreased | FAERS: 22 | US FAERS | |
| 26 | Hypersensitivity | FAERS: 21 | US FAERS | |
| 27 | Infusion site phlebitis | FAERS: 21 | US FAERS | |
| 28 | Vasculitis | FAERS: 21 | US FAERS | |
| 29 | Leukopenia | FAERS: 20 | US FAERS | |
| 30 | Prescribed underdose | FAERS: 20 | US FAERS | |
| 31 | Asthenia | FAERS: 19 | US FAERS | |
| 32 | General physical health deterioration | FAERS: 18 | US FAERS | |
| 33 | Drug ineffective | FAERS: 17 | US FAERS | |
| 34 | Pain | FAERS: 17 | US FAERS | |
| 35 | Pruritus | FAERS: 17 | US FAERS | |
| 36 | Septic Shock | FAERS: 17 | US FAERS | |
| 37 | Atrial Fibrillation | FAERS: 16 | US FAERS | |
| 38 | Blood count abnormal | FAERS: 16 | US FAERS | |
| 39 | Blood creatinine increased | FAERS: 15 | US FAERS | |
| 40 | Flushing | FAERS: 14 | US FAERS | |
| 41 | Infusion site swelling | FAERS: 14 | US FAERS | |
| 42 | MYELODYSPLASTIC SYNDROME | FAERS: 14 | US FAERS | |
| 43 | Hypoxia | FAERS: 13 | US FAERS | |
| 44 | Malaise | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Myocardial Infarction | FAERS: 13 | US FAERS | |
| 46 | Respiratory Failure | FAERS: 13 | US FAERS | |
| 47 | Skin reaction | FAERS: 13 | US FAERS | |
| 48 | Stevens-Johnson Syndrome | FAERS: 13 | 25811541 | CTD US FAERS |
| 49 | Abdominal Pain | FAERS: 11 | US FAERS | |
| 50 | Infusion site erythema | FAERS: 11 | US FAERS | |
| 51 | Lymphocyte count decreased | FAERS: 11 | US FAERS | |
| 52 | Wrong technique in drug usage process | FAERS: 11 | US FAERS | |
| 53 | Dehydration | FAERS: 10 | US FAERS | |
| 54 | Headache | FAERS: 10 | US FAERS | |
| 55 | Lymphopenia | FAERS: 10 | US FAERS | |
| 56 | Pneumonitis | FAERS: 10 | US FAERS | |
| 57 | Cellulitis | FAERS: 9 | US FAERS | |
| 58 | Disseminated Intravascular Coagulation | FAERS: 9 | US FAERS | |
| 59 | Multiple Myeloma | FAERS: 9 | US FAERS | |
| 60 | Constipation | FAERS: 8 | US FAERS | |
| 61 | Dizziness | FAERS: 8 | US FAERS | |
| 62 | Rash erythematous | FAERS: 8 | US FAERS | |
| 63 | Urticaria | FAERS: 8 | US FAERS | |
| 64 | Aspergillosis | FAERS: 7 | US FAERS | |
| 65 | Back Pain | FAERS: 7 | US FAERS | |
| 66 | Chest Pain | FAERS: 7 | US FAERS | |
| 67 | Malignant neoplasm progression | FAERS: 7 | US FAERS | |
| 68 | Unevaluable event | FAERS: 7 | US FAERS | |
| 69 | Accidental exposure to product | FAERS: 6 | US FAERS | |
| 70 | Cerebrovascular accident | FAERS: 6 | US FAERS | |
| 71 | Gastrointestinal toxicity | FAERS: 6 | US FAERS | |
| 72 | Haematotoxicity | FAERS: 6 | US FAERS | |
| 73 | Portal Vein Thrombosis | FAERS: 6 | US FAERS | |
| 74 | Product preparation error | FAERS: 6 | US FAERS | |
| 75 | Product use issue | FAERS: 6 | US FAERS | |
| 76 | Tachycardia | FAERS: 6 | US FAERS | |
| 77 | Acute respiratory failure | FAERS: 5 | US FAERS | |
| 78 | Bronchitis | FAERS: 5 | US FAERS | |
| 79 | Cytopenia | FAERS: 5 | US FAERS | |
| 80 | Depressed Level of Consciousness | FAERS: 5 | US FAERS | |
| 81 | Discomfort | FAERS: 5 | US FAERS | |
| 82 | Feeling abnormal | FAERS: 5 | US FAERS | |
| 83 | Infusion site induration | FAERS: 5 | US FAERS | |
| 84 | Lymphoma | FAERS: 5 | US FAERS | |
| 85 | Mental status changes | FAERS: 5 | US FAERS | |
| 86 | Musculoskeletal stiffness | FAERS: 5 | US FAERS | |
| 87 | Oropharyngeal pain | FAERS: 5 | US FAERS | |
| 88 | Pericardial effusion | FAERS: 5 | US FAERS | |
| 89 | Product use in unapproved indication | FAERS: 5 | US FAERS | |
| 90 | Rales | FAERS: 5 | US FAERS | |
| 91 | Swelling | FAERS: 5 | US FAERS | |
| 92 | Thrombophlebitis | FAERS: 5 | US FAERS | |
| 93 | Urinary Retention | FAERS: 5 | US FAERS | |
| 94 | Urinary tract infection | FAERS: 5 | US FAERS | |
| 95 | Weight decreased | FAERS: 5 | US FAERS | |
| 96 | Acute kidney injury | FAERS: 4 | 16313266 | CTD US FAERS |
| 97 | Adverse event | FAERS: 4 | US FAERS | |
| 98 | Agranulocytosis | FAERS: 4 | US FAERS | |
| 99 | Alanine Aminotransferase Increased | FAERS: 4 | US FAERS | |
| 100 | Disease complication | FAERS: 4 | US FAERS | |
| 101 | Dysgeusia | FAERS: 4 | US FAERS | |
| 102 | Escherichia infection | FAERS: 4 | US FAERS | |
| 103 | Hepatotoxicity | FAERS: 4 | US FAERS | |
| 104 | Ileus | FAERS: 4 | US FAERS | |
| 105 | Injection Site Reaction | FAERS: 4 | US FAERS | |
| 106 | Limb discomfort | FAERS: 4 | US FAERS | |
| 107 | Pancreatitis | FAERS: 4 | US FAERS | |
| 108 | Performance status decreased | FAERS: 4 | US FAERS | |
| 109 | Pneumocystis jiroveci pneumonia | FAERS: 4 | US FAERS | |
| 110 | Respiratory distress | FAERS: 4 | US FAERS | |
| 111 | Stomatitis | FAERS: 4 | US FAERS | |
| 112 | Thrombosis | FAERS: 4 | US FAERS | |
| 113 | jaundice | FAERS: 4 | US FAERS | |
| 114 | Acarodermatitis | FAERS: 3 | US FAERS | |
| 115 | Alopecia | FAERS: 3 | US FAERS | |
| 116 | Atrial Flutter | FAERS: 3 | US FAERS | |
| 117 | Bacterial sepsis | FAERS: 3 | US FAERS | |
| 118 | Bone marrow toxicity | FAERS: 3 | US FAERS | |
| 119 | Cardiac Tamponade | FAERS: 3 | US FAERS | |
| 120 | Circumstance or information capable of leading to medication error | FAERS: 3 | US FAERS | |
| 121 | Colitis | FAERS: 3 | US FAERS | |
| 122 | Cytomegalovirus test positive | FAERS: 3 | US FAERS | |
| 123 | Dermatitis acneiform | FAERS: 3 | US FAERS | |
| 124 | Disease recurrence | FAERS: 3 | US FAERS | |
| 125 | Drug dispensing error | FAERS: 3 | US FAERS | |
| 126 | Drug dose omission | FAERS: 3 | US FAERS | |
| 127 | Ejection Fraction Decreased | FAERS: 3 | US FAERS | |
| 128 | Exposure via contaminated device | FAERS: 3 | US FAERS | |
| 129 | Febrile bone marrow aplasia | FAERS: 3 | US FAERS | |
| 130 | Hepatitis B | FAERS: 3 | US FAERS | |
| 131 | Incorrect drug administration duration | FAERS: 3 | US FAERS | |
| 132 | Injection site extravasation | FAERS: 3 | US FAERS | |
| 133 | Injection site phlebitis | FAERS: 3 | US FAERS | |
| 134 | Lethargy | FAERS: 3 | US FAERS | |
| 135 | Myalgia | FAERS: 3 | US FAERS | |
| 136 | Neutrophil count abnormal | FAERS: 3 | US FAERS | |
| 137 | Occupational exposure to product | FAERS: 3 | US FAERS | |
| 138 | Pallor | FAERS: 3 | US FAERS | |
| 139 | Paraparesis | FAERS: 3 | US FAERS | |
| 140 | Pemphigus | FAERS: 3 | US FAERS | |
| 141 | Peripheral swelling | FAERS: 3 | US FAERS | |
| 142 | Prescribed overdose | FAERS: 3 | US FAERS | |
| 143 | Product administration error | FAERS: 3 | US FAERS | |
| 144 | Product storage error | FAERS: 3 | US FAERS | |
| 145 | Purpura | FAERS: 3 | US FAERS | |
| 146 | Retinitis | FAERS: 3 | US FAERS | |
| 147 | Squamous cell carcinoma | FAERS: 3 | US FAERS | |
| 148 | Syncope | FAERS: 3 | US FAERS | |
| 149 | Systemic Inflammatory Response Syndrome | FAERS: 3 | US FAERS | |
| 150 | Toxic Epidermal Necrolysis | FAERS: 3 | US FAERS | |
| 151 | Toxicity to various agents | FAERS: 3 | US FAERS | |
| 152 | Tremor | FAERS: 3 | US FAERS | |
| 153 | Wheezing | FAERS: 3 | US FAERS | |
| 154 | Accidental exposure | FAERS: 2 | US FAERS | |
| 155 | Acute myocardial infarction | FAERS: 2 | US FAERS | |
| 156 | Anxiety | FAERS: 2 | US FAERS | |
| 157 | Appendicitis | FAERS: 2 | US FAERS | |
| 158 | Ascites | FAERS: 2 | US FAERS | |
| 159 | Aspartate Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 160 | Autoimmune thrombocytopenia | FAERS: 2 | US FAERS | |
| 161 | Blindness | FAERS: 2 | US FAERS | |
| 162 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 163 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 164 | Blood urea increased | FAERS: 2 | US FAERS | |
| 165 | Bronchopulmonary Aspergillosis | FAERS: 2 | US FAERS | |
| 166 | Capillary Leak Syndrome | FAERS: 2 | US FAERS | |
| 167 | Cardiotoxicity | FAERS: 2 | US FAERS | |
| 168 | Chest discomfort | FAERS: 2 | US FAERS | |
| 169 | Cholangitis | FAERS: 2 | US FAERS | |
| 170 | Clostridium difficile colitis | FAERS: 2 | US FAERS | |
| 171 | Creatinine renal clearance increased | FAERS: 2 | US FAERS | |
| 172 | Crystalluria | FAERS: 2 | US FAERS | |
| 173 | Cytolytic hepatitis | FAERS: 2 | US FAERS | |
| 174 | Cytomegalovirus chorioretinitis | FAERS: 2 | US FAERS | |
| 175 | Delirium | FAERS: 2 | US FAERS | |
| 176 | Disorientation | FAERS: 2 | US FAERS | |
| 177 | Dyspepsia | FAERS: 2 | US FAERS | |
| 178 | Eczema | FAERS: 2 | US FAERS | |
| 179 | Encephalitis | FAERS: 2 | US FAERS | |
| 180 | Enteritis | FAERS: 2 | US FAERS | |
| 181 | Epistaxis | FAERS: 2 | US FAERS | |
| 182 | Exposure to body fluid | FAERS: 2 | US FAERS | |
| 183 | Eye irritation | FAERS: 2 | US FAERS | |
| 184 | Gastrointestinal infection | FAERS: 2 | US FAERS | |
| 185 | Gastrointestinal perforation | FAERS: 2 | US FAERS | |
| 186 | Hepatitis B DNA increased | FAERS: 2 | US FAERS | |
| 187 | Hepatitis | FAERS: 2 | US FAERS | |
| 188 | Immune thrombocytopenic purpura | FAERS: 2 | US FAERS | |
| 189 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 190 | Inflammation | FAERS: 2 | US FAERS | |
| 191 | Infusion site mass | FAERS: 2 | US FAERS | |
| 192 | Injection site bruising | FAERS: 2 | US FAERS | |
| 193 | Injection site irritation | FAERS: 2 | US FAERS | |
| 194 | Injection site thrombosis | FAERS: 2 | US FAERS | |
| 195 | Intestinal Perforation | FAERS: 2 | US FAERS | |
| 196 | Joint swelling | FAERS: 2 | US FAERS | |
| 197 | Lymphoplasmacytoid lymphoma/immunocytoma | FAERS: 2 | US FAERS | |
| 198 | Mantle cell lymphoma recurrent | FAERS: 2 | US FAERS | |
| 199 | Mantle cell lymphoma | FAERS: 2 | US FAERS | |
| 200 | Metabolic acidosis | FAERS: 2 | US FAERS | |
| 201 | Myocarditis | FAERS: 2 | US FAERS | |
| 202 | Necrosis | FAERS: 2 | US FAERS | |
| 203 | Palpitations | FAERS: 2 | US FAERS | |
| 204 | Peritonitis | FAERS: 2 | US FAERS | |
| 205 | Platelet count abnormal | FAERS: 2 | US FAERS | |
| 206 | Pleurisy | FAERS: 2 | US FAERS | |
| 207 | Polyneuropathy | FAERS: 2 | US FAERS | |
| 208 | Polyuria | FAERS: 2 | US FAERS | |
| 209 | Pulmonary Embolism | FAERS: 2 | US FAERS | |
| 210 | Pulmonary Hypertension | FAERS: 2 | US FAERS | |
| 211 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 212 | Respiratory tract infection fungal | FAERS: 2 | US FAERS | |
| 213 | Respiratory tract inflammation | FAERS: 2 | US FAERS | |
| 214 | Respiratory tract irritation | FAERS: 2 | US FAERS | |
| 215 | Rheumatoid Arthritis | FAERS: 2 | US FAERS | |
| 216 | Septic phlebitis | FAERS: 2 | US FAERS | |
| 217 | Skin Ulcer | FAERS: 2 | US FAERS | |
| 218 | Skin irritation | FAERS: 2 | US FAERS | |
| 219 | Somnolence | FAERS: 2 | US FAERS | |
| 220 | Splenomegaly | FAERS: 2 | US FAERS | |
| 221 | Spontaneous penile erection | FAERS: 2 | US FAERS | |
| 222 | Sudden death | FAERS: 2 | US FAERS | |
| 223 | Transaminases increased | FAERS: 2 | US FAERS | |
| 224 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 225 | Urinary Incontinence | FAERS: 2 | US FAERS | |
| 226 | Venous stenosis | FAERS: 2 | US FAERS | |
| 227 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 228 | Adenocarcinoma | FAERS: 1 | US FAERS | |
| 229 | Administration site reaction | FAERS: 1 | US FAERS | |
| 230 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 231 | Amaurosis | FAERS: 1 | US FAERS | |
| 232 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 233 | Anticholinergic Syndrome | FAERS: 1 | US FAERS | |
| 234 | Arthralgia | FAERS: 1 | US FAERS | |
| 235 | Arthritis | FAERS: 1 | US FAERS | |
| 236 | Asthma | FAERS: 1 | US FAERS | |
| 237 | Atelectasis | FAERS: 1 | US FAERS | |
| 238 | Biopsy bone marrow abnormal | FAERS: 1 | US FAERS | |
| 239 | Blastic plasmacytoid dendritic cell neoplasia | FAERS: 1 | US FAERS | |
| 240 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 241 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 242 | Blood creatinine decreased | FAERS: 1 | US FAERS | |
| 243 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 244 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 245 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 246 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 247 | Blood lactic acid abnormal | FAERS: 1 | US FAERS | |
| 248 | Blood phosphorus increased | FAERS: 1 | US FAERS | |
| 249 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 250 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 251 | Blood uric acid abnormal | FAERS: 1 | US FAERS | |
| 252 | Bone marrow infiltration | FAERS: 1 | US FAERS | |
| 253 | Bone pain | FAERS: 1 | US FAERS | |
| 254 | Bradycardia | FAERS: 1 | US FAERS | |
| 255 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 256 | CD4 Lymphocytes Decreased | FAERS: 1 | US FAERS | |
| 257 | Cachexia | FAERS: 1 | US FAERS | |
| 258 | Candidiasis | FAERS: 1 | US FAERS | |
| 259 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 260 | Cardiac Death | FAERS: 1 | US FAERS | |
| 261 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 262 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 263 | Catatonia | FAERS: 1 | US FAERS | |
| 264 | Central Nervous System Infection | FAERS: 1 | US FAERS | |
| 265 | Cerebral aspergillosis | FAERS: 1 | US FAERS | |
| 266 | Cholestasis | FAERS: 1 | US FAERS | |
| 267 | Chromaturia | FAERS: 1 | US FAERS | |
| 268 | Chronic sinusitis | FAERS: 1 | US FAERS | |
| 269 | Coombs test positive | FAERS: 1 | US FAERS | |
| 270 | Cyanosis | FAERS: 1 | US FAERS | |
| 271 | Cytokine Release Syndrome | FAERS: 1 | US FAERS | |
| 272 | Cytomegalovirus gastroenteritis | FAERS: 1 | US FAERS | |
| 273 | Cytomegalovirus test | FAERS: 1 | US FAERS | |
| 274 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 275 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 276 | Dementia | FAERS: 1 | US FAERS | |
| 277 | Depressed mood | FAERS: 1 | US FAERS | |
| 278 | Diplopia | FAERS: 1 | US FAERS | |
| 279 | Diverticulitis | FAERS: 1 | US FAERS | |
| 280 | Diverticulum | FAERS: 1 | US FAERS | |
| 281 | Drug administration error | FAERS: 1 | US FAERS | |
| 282 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 283 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 284 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 285 | Drug resistance | FAERS: 1 | US FAERS | |
| 286 | Drug toxicity | FAERS: 1 | US FAERS | |
| 287 | Dry skin | FAERS: 1 | US FAERS | |
| 288 | Dysplasia | FAERS: 1 | US FAERS | |
| 289 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 290 | Embolism | FAERS: 1 | US FAERS | |
| 291 | Enterocolitis | FAERS: 1 | US FAERS | |
| 292 | Eosinophilia | FAERS: 1 | US FAERS | |
| 293 | Epilepsy | FAERS: 1 | US FAERS | |
| 294 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 295 | Eschar | FAERS: 1 | US FAERS | |
| 296 | Exposure to contaminated device | FAERS: 1 | US FAERS | |
| 297 | Exposure via father | FAERS: 1 | US FAERS | |
| 298 | Extranodal marginal zone B-cell lymphoma (MALT type) | FAERS: 1 | US FAERS | |
| 299 | Eye Infection | FAERS: 1 | US FAERS | |
| 300 | Facial Paresis | FAERS: 1 | US FAERS | |
| 301 | Feeling Cold | FAERS: 1 | US FAERS | |
| 302 | Fingerprint loss | FAERS: 1 | US FAERS | |
| 303 | Fluid overload | FAERS: 1 | US FAERS | |
| 304 | Folliculitis | FAERS: 1 | US FAERS | |
| 305 | Food Allergy | FAERS: 1 | US FAERS | |
| 306 | Full blood count abnormal | FAERS: 1 | US FAERS | |
| 307 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 308 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 309 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 310 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 311 | Gastrointestinal mucosal disorder | FAERS: 1 | US FAERS | |
| 312 | Gaze palsy | FAERS: 1 | US FAERS | |
| 313 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 314 | Genital rash | FAERS: 1 | US FAERS | |
| 315 | Glomerular Filtration Rate | FAERS: 1 | US FAERS | |
| 316 | Granulocyte count decreased | FAERS: 1 | US FAERS | |
| 317 | Guillain-Barre Syndrome | FAERS: 1 | US FAERS | |
| 318 | Histiocytosis haematophagic | FAERS: 1 | US FAERS | |
| 319 | Hospice Care | FAERS: 1 | US FAERS | |
| 320 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 321 | Hypokinesia | FAERS: 1 | US FAERS | |
| 322 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 323 | Immunosuppression | FAERS: 1 | US FAERS | |
| 324 | Incorrect product administration duration | FAERS: 1 | US FAERS | |
| 325 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 326 | Induration | FAERS: 1 | US FAERS | |
| 327 | Infection reactivation | FAERS: 1 | US FAERS | |
| 328 | Influenza | FAERS: 1 | US FAERS | |
| 329 | Infusion site cellulitis | FAERS: 1 | US FAERS | |
| 330 | Infusion site discomfort | FAERS: 1 | US FAERS | |
| 331 | Infusion site injury | FAERS: 1 | US FAERS | |
| 332 | Infusion site scar | FAERS: 1 | US FAERS | |
| 333 | Infusion site streaking | FAERS: 1 | US FAERS | |
| 334 | Infusion site thrombosis | FAERS: 1 | US FAERS | |
| 335 | Infusion site warmth | FAERS: 1 | US FAERS | |
| 336 | Injection site erythema | FAERS: 1 | US FAERS | |
| 337 | Injection site mass | FAERS: 1 | US FAERS | |
| 338 | Injection site necrosis | FAERS: 1 | US FAERS | |
| 339 | Injection site pruritus | FAERS: 1 | US FAERS | |
| 340 | Injection site streaking | FAERS: 1 | US FAERS | |
| 341 | Injection site vasculitis | FAERS: 1 | US FAERS | |
| 342 | Injection site vesicles | FAERS: 1 | US FAERS | |
| 343 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 344 | Interleukin-2 receptor increased | FAERS: 1 | US FAERS | |
| 345 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 346 | Intestinal Pseudo-Obstruction | FAERS: 1 | US FAERS | |
| 347 | JC virus infection | FAERS: 1 | US FAERS | |
| 348 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 349 | Leukoencephalopathy | FAERS: 1 | US FAERS | |
| 350 | Liquid product physical issue | FAERS: 1 | US FAERS | |
| 351 | Lobar Pneumonia | FAERS: 1 | US FAERS | |
| 352 | Lung Abscess | FAERS: 1 | US FAERS | |
| 353 | Lung consolidation | FAERS: 1 | US FAERS | |
| 354 | Lung infiltration malignant | FAERS: 1 | US FAERS | |
| 355 | Lyme Disease | FAERS: 1 | US FAERS | |
| 356 | Lymphocyte count increased | FAERS: 1 | US FAERS | |
| 357 | Lymphoplasmacytoid lymphoma/immunocytoma recurrent | FAERS: 1 | US FAERS | |
| 358 | Malnutrition | FAERS: 1 | US FAERS | |
| 359 | Medication Error | FAERS: 1 | US FAERS | |
| 360 | Megacolon | FAERS: 1 | US FAERS | |
| 361 | Memory impairment | FAERS: 1 | US FAERS | |
| 362 | Meningitis | FAERS: 1 | US FAERS | |
| 363 | Multi-organ disorder | FAERS: 1 | US FAERS | |
| 364 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 365 | Myositis | FAERS: 1 | US FAERS | |
| 366 | Neisseria test positive | FAERS: 1 | US FAERS | |
| 367 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 368 | Nervousness | FAERS: 1 | US FAERS | |
| 369 | Neuralgia | FAERS: 1 | US FAERS | |
| 370 | Neutropenic sepsis | FAERS: 1 | US FAERS | |
| 371 | Night sweats | FAERS: 1 | US FAERS | |
| 372 | No adverse event | FAERS: 1 | US FAERS | |
| 373 | Nodule | FAERS: 1 | US FAERS | |
| 374 | Ocular icterus | FAERS: 1 | US FAERS | |
| 375 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 376 | Osteonecrosis of Jaw | FAERS: 1 | US FAERS | |
| 377 | Pericarditis | FAERS: 1 | US FAERS | |
| 378 | Peritoneal perforation | FAERS: 1 | US FAERS | |
| 379 | Petechiae | FAERS: 1 | US FAERS | |
| 380 | Piloerection | FAERS: 1 | US FAERS | |
| 381 | Platelet Transfusion | FAERS: 1 | US FAERS | |
| 382 | Postoperative ileus | FAERS: 1 | US FAERS | |
| 383 | Product dosage form issue | FAERS: 1 | US FAERS | |
| 384 | Product formulation issue | FAERS: 1 | US FAERS | |
| 385 | Product label issue | FAERS: 1 | US FAERS | |
| 386 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 387 | Product preparation issue | FAERS: 1 | US FAERS | |
| 388 | Product quality issue | FAERS: 1 | US FAERS | |
| 389 | Product selection error | FAERS: 1 | US FAERS | |
| 390 | Pseudomonal sepsis | FAERS: 1 | US FAERS | |
| 391 | Pulmonary Eosinophilia | FAERS: 1 | US FAERS | |
| 392 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 393 | Pulmonary function test decreased | FAERS: 1 | US FAERS | |
| 394 | QRS axis abnormal | FAERS: 1 | US FAERS | |
| 395 | Quadriplegia | FAERS: 1 | US FAERS | |
| 396 | Radicular pain | FAERS: 1 | US FAERS | |
| 397 | Sensorimotor disorder | FAERS: 1 | US FAERS | |
| 398 | Shock | FAERS: 1 | US FAERS | |
| 399 | Sick Sinus Syndrome | FAERS: 1 | US FAERS | |
| 400 | Simplex virus test positive | FAERS: 1 | US FAERS | |
| 401 | Sinobronchitis | FAERS: 1 | US FAERS | |
| 402 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 403 | Skin discomfort | FAERS: 1 | US FAERS | |
| 404 | Skin lesion | FAERS: 1 | US FAERS | |
| 405 | Skin necrosis | FAERS: 1 | US FAERS | |
| 406 | Sluggishness | FAERS: 1 | US FAERS | |
| 407 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 408 | Streptococcus test positive | FAERS: 1 | US FAERS | |
| 409 | Subcutaneous nodule | FAERS: 1 | US FAERS | |
| 410 | Superinfection bacterial | FAERS: 1 | US FAERS | |
| 411 | Superinfection | FAERS: 1 | US FAERS | |
| 412 | Suprapubic pain | FAERS: 1 | US FAERS | |
| 413 | T-Cell Lymphoma | FAERS: 1 | US FAERS | |
| 414 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 415 | Therapy partial responder | FAERS: 1 | US FAERS | |
| 416 | Thirst | FAERS: 1 | US FAERS | |
| 417 | Throat irritation | FAERS: 1 | US FAERS | |
| 418 | Vascular pain | FAERS: 1 | US FAERS | |
| 419 | Vein pain | FAERS: 1 | US FAERS | |
| 420 | Venous Injury | FAERS: 1 | US FAERS | |
| 421 | Venous occlusion | FAERS: 1 | US FAERS | |
| 422 | Venous thrombosis limb | FAERS: 1 | US FAERS | |
| 423 | Visual Impairment | FAERS: 1 | US FAERS | |
| 424 | Vulvovaginal dryness | FAERS: 1 | US FAERS | |
| 425 | Vulvovaginal pruritus | FAERS: 1 | US FAERS | |
| 426 | White blood cell count abnormal | FAERS: 1 | US FAERS | |
| 427 | nervous system disorder | FAERS: 1 | US FAERS | |
| 428 | pseudomembranous colitis | FAERS: 1 | US FAERS | |
| 429 | treatment failure | FAERS: 1 | US FAERS | |
| 430 | Bone Marrow Diseases | 3868382 | CTD | |
| 431 | Intestinal Diseases | 3868382 | CTD | |
| 432 | Kidney Diseases | 3868382 | CTD | |
| 433 | Lymphatic Diseases | 3868382 | CTD | |
| 434 | Neoplasm Metastasis | 17667603 | CTD | |
| 435 | Oliguria | 16313266 | CTD | |
| 436 | Tumor Lysis Syndrome | 16313266 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.