Dabigatran
(YBSJFWOBGCMAKL-UHFFFAOYSA-N)
Structure
- SMILES
- OC(=O)CCN(C(=O)c1ccc2c(c1)nc(n2C)CNc1ccc(cc1)C(=N)N)c1ccccn1
- Type(s)
- Investigational
- Molecular Formula:
- C25H25N7O3
- Molecular Weight:
- 471.511
- Log P:
- 3.8590
- Hydrogen Bond Acceptor:
- 10
- Hydrogen Bond Donor:
- 4
- TPSA:
- 150.22
- CAS Number(s):
- 211914-51-1
Synonym(s)
1.
Dabigatran
2.
BIBR 1048
3.
Dabigatran Etexilate
4.
Dabigatran Etexilate Mesylate
5.
N-((2-(((4-(aminoiminomethyl)phenyl)amino)methyl)-1-methyl-1H-benzimidazol-5-yl)carbonyl)-N-2-pyridinyl-beta-alanine
6.
Pradaxa
7.
Etexilate Mesylate, Dabigatran
8.
Etexilate, Dabigatran
9.
Mesylate, Dabigatran Etexilate
External Link(s)
| MeSH | D000069604 |
| PubChem Compound | 216210 |
| BindingDB | 50112086 |
| ChEBI | 70752 |
| CHEMBL | CHEMBL48361 |
| DrugBank | DB14726 |
| IUPHAR/BPS Guide to PHARMACOLOGY | 6380 |
| KEGG | cpd:C21556 dr:D09707 |
| Therapeutic Target Database | D0M7JT |
| ZINC | 1910616 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Dyspepsia | FAERS: 59 | SIDER US FAERS | |
| 2 | Nausea | FAERS: 57 | SIDER US FAERS | |
| 3 | Vomiting | FAERS: 52 | SIDER US FAERS | |
| 4 | Dizziness | FAERS: 34 | SIDER US FAERS | |
| 5 | Abdominal Pain | FAERS: 33 | SIDER US FAERS | |
| 6 | Cerebrovascular accident | FAERS: 27 | US FAERS | |
| 7 | Asthenia | FAERS: 26 | SIDER US FAERS | |
| 8 | Deep Vein Thrombosis | FAERS: 26 | US FAERS | |
| 9 | Hypotension | FAERS: 25 | SIDER US FAERS | |
| 10 | Headache | FAERS: 24 | SIDER US FAERS | |
| 11 | Epistaxis | FAERS: 22 | SIDER US FAERS | |
| 12 | Abdominal discomfort | FAERS: 21 | SIDER US FAERS | |
| 13 | Pulmonary Embolism | FAERS: 20 | US FAERS | |
| 14 | Fatigue | FAERS: 16 | SIDER US FAERS | |
| 15 | Chest Pain | FAERS: 15 | SIDER US FAERS | |
| 16 | Acute kidney injury | FAERS: 11 | US FAERS | |
| 17 | Blood creatinine increased | FAERS: 10 | US FAERS | |
| 18 | Diverticulum | FAERS: 9 | US FAERS | |
| 19 | Occult blood positive | FAERS: 9 | SIDER US FAERS | |
| 20 | Pruritus | FAERS: 9 | SIDER US FAERS | |
| 21 | Urticaria | FAERS: 9 | SIDER US FAERS | |
| 22 | Atrial Fibrillation | FAERS: 8 | US FAERS | |
| 23 | Drug ineffective | FAERS: 8 | US FAERS | |
| 24 | Flatulence | FAERS: 8 | SIDER US FAERS | |
| 25 | Palpitations | FAERS: 8 | SIDER US FAERS | |
| 26 | Thrombocytopenia | FAERS: 8 | SIDER US FAERS | |
| 27 | Gastric ulcer | FAERS: 7 | US FAERS | |
| 28 | Malaise | FAERS: 7 | US FAERS | |
| 29 | Syncope | FAERS: 7 | SIDER US FAERS | |
| 30 | Acute myocardial infarction | FAERS: 6 | US FAERS | |
| 31 | Arthralgia | FAERS: 6 | SIDER US FAERS | |
| 32 | Cardiac Arrest | FAERS: 6 | US FAERS | |
| 33 | Cardiac Tamponade | FAERS: 6 | US FAERS | |
| 34 | Cerebral Infarction | FAERS: 6 | US FAERS | |
| 35 | Creatinine renal clearance decreased | FAERS: 6 | US FAERS | |
| 36 | Gastritis | FAERS: 6 | SIDER US FAERS | |
| 37 | Pneumonia | FAERS: 6 | SIDER US FAERS | |
| 38 | Therapy cessation | FAERS: 6 | US FAERS | |
| 39 | Thrombosis | FAERS: 6 | SIDER US FAERS | |
| 40 | Blood urea increased | FAERS: 5 | US FAERS | |
| 41 | Disseminated Intravascular Coagulation | FAERS: 5 | US FAERS | |
| 42 | Ecchymosis | FAERS: 5 | SIDER US FAERS | |
| 43 | Lethargy | FAERS: 5 | US FAERS | |
| 44 | Mental status changes | FAERS: 5 | US FAERS | |
| 45 | Myocardial Infarction | FAERS: 5 | SIDER US FAERS | |
| 46 | Pericardial effusion | FAERS: 5 | US FAERS | |
| 47 | Septic Shock | FAERS: 5 | US FAERS | |
| 48 | Tachycardia | FAERS: 5 | US FAERS | |
| 49 | Urinary Retention | FAERS: 5 | US FAERS | |
| 50 | Wound Complication | FAERS: 5 | US FAERS | |
| 51 | Wound dehiscence | FAERS: 5 | US FAERS | |
| 52 | Atrial thrombosis | FAERS: 4 | US FAERS | |
| 53 | Constipation | FAERS: 4 | SIDER US FAERS | |
| 54 | Embolic stroke | FAERS: 4 | SIDER US FAERS | |
| 55 | Presyncope | FAERS: 4 | US FAERS | |
| 56 | Rectal polyp | FAERS: 4 | US FAERS | |
| 57 | Urinary tract infection | FAERS: 4 | SIDER US FAERS | |
| 58 | Angina Pectoris | FAERS: 3 | SIDER US FAERS | |
| 59 | Back Pain | FAERS: 3 | SIDER US FAERS | |
| 60 | Blood urine present | FAERS: 3 | SIDER US FAERS | |
| 61 | Drug dose omission | FAERS: 3 | US FAERS | |
| 62 | Drug level increased | FAERS: 3 | US FAERS | |
| 63 | Infection | FAERS: 3 | SIDER US FAERS | |
| 64 | Medication Error | FAERS: 3 | US FAERS | |
| 65 | Myalgia | FAERS: 3 | US FAERS | |
| 66 | Pain | FAERS: 3 | US FAERS | |
| 67 | Peritonitis | FAERS: 3 | US FAERS | |
| 68 | Respiratory distress | FAERS: 3 | US FAERS | |
| 69 | Shock | FAERS: 3 | SIDER US FAERS | |
| 70 | Toxicity to various agents | FAERS: 3 | US FAERS | |
| 71 | Unresponsive to stimuli | FAERS: 3 | US FAERS | |
| 72 | treatment failure | FAERS: 3 | US FAERS | |
| 73 | Acute respiratory failure | FAERS: 2 | US FAERS | |
| 74 | Angioedema | FAERS: 2 | SIDER US FAERS | |
| 75 | Aspartate Aminotransferase Increased | FAERS: 2 | SIDER US FAERS | |
| 76 | Atrial Flutter | FAERS: 2 | US FAERS | |
| 77 | Atrial tachycardia | FAERS: 2 | US FAERS | |
| 78 | Benign Prostatic Hyperplasia | FAERS: 2 | US FAERS | |
| 79 | Blood alkaline phosphatase increased | FAERS: 2 | US FAERS | |
| 80 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 81 | Burning sensation | FAERS: 2 | US FAERS | |
| 82 | Cellulitis | FAERS: 2 | US FAERS | |
| 83 | Chest discomfort | FAERS: 2 | SIDER US FAERS | |
| 84 | Colon adenoma | FAERS: 2 | US FAERS | |
| 85 | Dementia | FAERS: 2 | US FAERS | |
| 86 | Diverticulitis | FAERS: 2 | US FAERS | |
| 87 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 88 | Epigastric discomfort | FAERS: 2 | SIDER US FAERS | |
| 89 | Erosive Duodenitis | FAERS: 2 | US FAERS | |
| 90 | Eye pain | FAERS: 2 | US FAERS | |
| 91 | Fluid overload | FAERS: 2 | US FAERS | |
| 92 | Gastrointestinal erosion | FAERS: 2 | US FAERS | |
| 93 | Gastrointestinal telangiectasia | FAERS: 2 | US FAERS | |
| 94 | General physical health deterioration | FAERS: 2 | US FAERS | |
| 95 | Helicobacter test positive | FAERS: 2 | US FAERS | |
| 96 | Hypoxia | FAERS: 2 | US FAERS | |
| 97 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 98 | Intestinal Obstruction | FAERS: 2 | US FAERS | |
| 99 | Joint swelling | FAERS: 2 | US FAERS | |
| 100 | Mallory-Weiss Syndrome | FAERS: 2 | US FAERS | |
| 101 | Metabolic acidosis | FAERS: 2 | US FAERS | |
| 102 | Neuralgia | FAERS: 2 | US FAERS | |
| 103 | Pallor | FAERS: 2 | US FAERS | |
| 104 | Pneumothorax | FAERS: 2 | US FAERS | |
| 105 | Productive Cough | FAERS: 2 | US FAERS | |
| 106 | Pulmonary artery thrombosis | FAERS: 2 | US FAERS | |
| 107 | Purpura | FAERS: 2 | US FAERS | |
| 108 | Rash erythematous | FAERS: 2 | US FAERS | |
| 109 | Right Ventricular Dysfunction | FAERS: 2 | US FAERS | |
| 110 | Sepsis | FAERS: 2 | US FAERS | |
| 111 | Sudden Cardiac Death | FAERS: 2 | US FAERS | |
| 112 | Tachyarrhythmia | FAERS: 2 | US FAERS | |
| 113 | Unevaluable event | FAERS: 2 | US FAERS | |
| 114 | Venous Thrombosis | FAERS: 2 | 17911567 | CTD US FAERS |
| 115 | Weight decreased | FAERS: 2 | US FAERS | |
| 116 | Accidental overdose | FAERS: 1 | US FAERS | |
| 117 | Acute Coronary Syndrome | FAERS: 1 | SIDER US FAERS | |
| 118 | Ageusia | FAERS: 1 | US FAERS | |
| 119 | Agitation | FAERS: 1 | US FAERS | |
| 120 | Alanine Aminotransferase Increased | FAERS: 1 | SIDER US FAERS | |
| 121 | Alopecia | FAERS: 1 | US FAERS | |
| 122 | Anal Fissure | FAERS: 1 | US FAERS | |
| 123 | Anticoagulation drug level above therapeutic | FAERS: 1 | US FAERS | |
| 124 | Anxiety | FAERS: 1 | US FAERS | |
| 125 | Aortic Rupture | FAERS: 1 | US FAERS | |
| 126 | Aortic Valve Stenosis | FAERS: 1 | US FAERS | |
| 127 | Arthropathy | FAERS: 1 | US FAERS | |
| 128 | Ascites | FAERS: 1 | US FAERS | |
| 129 | Aspartate aminotransferase decreased | FAERS: 1 | US FAERS | |
| 130 | Autopsy | FAERS: 1 | US FAERS | |
| 131 | Axillary vein thrombosis | FAERS: 1 | US FAERS | |
| 132 | Bacterial test positive | FAERS: 1 | US FAERS | |
| 133 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 134 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 135 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 136 | Brain Contusion | FAERS: 1 | US FAERS | |
| 137 | Brain Hypoxia | FAERS: 1 | US FAERS | |
| 138 | Cardiac procedure complication | FAERS: 1 | US FAERS | |
| 139 | Cardiac valve replacement complication | FAERS: 1 | US FAERS | |
| 140 | Carotid artery occlusion | FAERS: 1 | US FAERS | |
| 141 | Catheter site injury | FAERS: 1 | US FAERS | |
| 142 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 143 | Cervicobrachial syndrome | FAERS: 1 | US FAERS | |
| 144 | Choking sensation | FAERS: 1 | US FAERS | |
| 145 | Cholangiocarcinoma | FAERS: 1 | US FAERS | |
| 146 | Cholangitis | FAERS: 1 | US FAERS | |
| 147 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 148 | Chromaturia | FAERS: 1 | US FAERS | |
| 149 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 150 | Colitis | FAERS: 1 | US FAERS | |
| 151 | Contraindicated drug administered | FAERS: 1 | US FAERS | |
| 152 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 153 | Coronary artery insufficiency | FAERS: 1 | US FAERS | |
| 154 | Cyanosis | FAERS: 1 | US FAERS | |
| 155 | Deafness | FAERS: 1 | US FAERS | |
| 156 | Delirium | FAERS: 1 | US FAERS | |
| 157 | Device occlusion | FAERS: 1 | US FAERS | |
| 158 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 159 | Diastolic dysfunction | FAERS: 1 | US FAERS | |
| 160 | Drug screen positive | FAERS: 1 | US FAERS | |
| 161 | Embolic cerebral infarction | FAERS: 1 | US FAERS | |
| 162 | Embolism | FAERS: 1 | US FAERS | |
| 163 | Emotional distress | FAERS: 1 | US FAERS | |
| 164 | Endotracheal intubation complication | FAERS: 1 | US FAERS | |
| 165 | Eructation | FAERS: 1 | US FAERS | |
| 166 | Escherichia test positive | FAERS: 1 | US FAERS | |
| 167 | False positive investigation result | FAERS: 1 | US FAERS | |
| 168 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 169 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 170 | Fracture | FAERS: 1 | US FAERS | |
| 171 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 172 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 173 | Gastrointestinal angiodysplasia | FAERS: 1 | US FAERS | |
| 174 | Gastrointestinal arteriovenous malformation | FAERS: 1 | US FAERS | |
| 175 | Gout | FAERS: 1 | SIDER US FAERS | |
| 176 | Heart alternation | FAERS: 1 | US FAERS | |
| 177 | Hernia | FAERS: 1 | US FAERS | |
| 178 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 179 | Hypertensive emergency | FAERS: 1 | US FAERS | |
| 180 | Hypoperfusion | FAERS: 1 | US FAERS | |
| 181 | Hypophagia | FAERS: 1 | US FAERS | |
| 182 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 183 | Ileus | FAERS: 1 | US FAERS | |
| 184 | Immobile | FAERS: 1 | US FAERS | |
| 185 | Immunosuppressant drug level decreased | FAERS: 1 | US FAERS | |
| 186 | Incontinence | FAERS: 1 | US FAERS | |
| 187 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 188 | Inflammation | FAERS: 1 | 25138021 | CTD US FAERS |
| 189 | Infrequent bowel movements | FAERS: 1 | US FAERS | |
| 190 | Intestinal resection | FAERS: 1 | US FAERS | |
| 191 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 192 | Intrapericardial thrombosis | FAERS: 1 | US FAERS | |
| 193 | Iron Overload | FAERS: 1 | US FAERS | |
| 194 | Joint debridement | FAERS: 1 | US FAERS | |
| 195 | Joint stiffness | FAERS: 1 | US FAERS | |
| 196 | Laboratory test interference | FAERS: 1 | US FAERS | |
| 197 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 198 | Limb injury | FAERS: 1 | US FAERS | |
| 199 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 200 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 201 | Medical device site thrombosis | FAERS: 1 | US FAERS | |
| 202 | Megacolon | FAERS: 1 | US FAERS | |
| 203 | Mesothelioma | FAERS: 1 | US FAERS | |
| 204 | Middle insomnia | FAERS: 1 | US FAERS | |
| 205 | Mood swings | FAERS: 1 | US FAERS | |
| 206 | Nasopharyngitis | FAERS: 1 | SIDER US FAERS | |
| 207 | Neck Pain | FAERS: 1 | US FAERS | |
| 208 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 209 | Nervousness | FAERS: 1 | US FAERS | |
| 210 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 211 | Oropharyngeal spasm | FAERS: 1 | US FAERS | |
| 212 | Pancytopenia | FAERS: 1 | US FAERS | |
| 213 | Paranoia | FAERS: 1 | US FAERS | |
| 214 | Peptic Ulcer Perforation | FAERS: 1 | US FAERS | |
| 215 | Peptic Ulcer | FAERS: 1 | US FAERS | |
| 216 | Pericarditis | FAERS: 1 | US FAERS | |
| 217 | Peripheral embolism | FAERS: 1 | US FAERS | |
| 218 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 219 | Personality Change | FAERS: 1 | US FAERS | |
| 220 | Petechiae | FAERS: 1 | US FAERS | |
| 221 | Pneumonitis | FAERS: 1 | US FAERS | |
| 222 | Product quality issue | FAERS: 1 | US FAERS | |
| 223 | Rales | FAERS: 1 | US FAERS | |
| 224 | Refusal of treatment by relative | FAERS: 1 | US FAERS | |
| 225 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 226 | Restlessness | FAERS: 1 | US FAERS | |
| 227 | Retching | FAERS: 1 | US FAERS | |
| 228 | Right ventricular failure | FAERS: 1 | US FAERS | |
| 229 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 230 | Somnolence | FAERS: 1 | US FAERS | |
| 231 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 232 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 233 | Swelling | FAERS: 1 | US FAERS | |
| 234 | Symptom recurrence | FAERS: 1 | US FAERS | |
| 235 | Tension Headache | FAERS: 1 | US FAERS | |
| 236 | Therapy change | FAERS: 1 | US FAERS | |
| 237 | Thirst | FAERS: 1 | US FAERS | |
| 238 | Throat irritation | FAERS: 1 | US FAERS | |
| 239 | Thrombosis in device | FAERS: 1 | US FAERS | |
| 240 | Tinnitus | FAERS: 1 | US FAERS | |
| 241 | Tongue biting | FAERS: 1 | US FAERS | |
| 242 | Transaminases increased | FAERS: 1 | SIDER US FAERS | |
| 243 | Transfusion related complication | FAERS: 1 | US FAERS | |
| 244 | Tremor | FAERS: 1 | US FAERS | |
| 245 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 246 | Vasculitis | FAERS: 1 | US FAERS | |
| 247 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 248 | Vertigo | FAERS: 1 | US FAERS | |
| 249 | Visual Impairment | FAERS: 1 | US FAERS | |
| 250 | Vitamin K Deficiency | FAERS: 1 | US FAERS | |
| 251 | Wheezing | FAERS: 1 | US FAERS | |
| 252 | Wound Infection | FAERS: 1 | US FAERS | |
| 253 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 254 | jaundice | FAERS: 1 | US FAERS | |
| 255 | Anaphylactic shock | SIDER | ||
| 256 | Blood and lymphatic system disorders | SIDER | ||
| 257 | Bronchitis | SIDER | ||
| 258 | Bronchospasm | SIDER | ||
| 259 | Dermatitis | SIDER | ||
| 260 | Gastrointestinal Pain | SIDER | ||
| 261 | Gastrointestinal ulcer | SIDER | ||
| 262 | Hemorrhage symptom | SIDER | ||
| 263 | Hemorrhage | 17764540 | CTD | |
| 264 | Hypersensitivity | SIDER | ||
| 265 | Infestation | SIDER | ||
| 266 | Influenza | SIDER | ||
| 267 | Intraspinal bleeding | SIDER | ||
| 268 | Major bleed | SIDER | ||
| 269 | Malnutrition | SIDER | ||
| 270 | Musculoskeletal Pain | SIDER | ||
| 271 | Musculoskeletal discomfort | SIDER | ||
| 272 | Non-alcoholic Fatty Liver Disease | 25138021 | CTD | |
| 273 | Post procedural discharge | SIDER | ||
| 274 | Sinusitis | SIDER | ||
| 275 | Thromboembolic stroke | SIDER | ||
| 276 | Venous Thromboembolism | 17764540 | CTD | |
| 277 | Weight Gain | 25138021 | CTD | |
| 278 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.