osimertinib
(DUYJMQONPNNFPI-UHFFFAOYSA-N)
Structure
- SMILES
- C=CC(=O)Nc1cc(Nc2nccc(n2)c2cn(c3c2cccc3)C)c(cc1N(CCN(C)C)C)OC
- Type(s)
- Approved
- ATC code(s)
- L01XE35
- Molecular Formula:
- C28H33N7O2
- Molecular Weight:
- 499.607
- Log P:
- 4.6558
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 2
- TPSA:
- 87.55
- CAS Number(s):
- 1421373-65-0
Synonym(s)
1.
osimertinib
2.
Tagrisso
External Link(s)
| MeSH | C000603933 |
| PubChem Compound | 71496458 |
| BindingDB | 50029668 |
| ChEBI | 90943 |
| CHEMBL | CHEMBL3353410 |
| DrugBank | DB09330 |
| DrugCentral | 5062 |
| IUPHAR/BPS Guide to PHARMACOLOGY | 7719 |
| Therapeutic Target Database | D0RT2C |
| ZINC | 98023177 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Malignant neoplasm progression | FAERS: 290 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 2 | Disease Progression | FAERS: 98 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Fatigue | FAERS: 83 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 4 | Nausea | FAERS: 62 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 5 | Drug ineffective | FAERS: 47 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 6 | Pneumonitis | FAERS: 47 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 7 | Pulmonary Embolism | FAERS: 43 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Pneumonia | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 9 | Drug resistance | FAERS: 37 | US FAERS | |
| 10 | Vomiting | FAERS: 37 | US FAERS | |
| 11 | Weight decreased | FAERS: 37 | US FAERS | |
| 12 | Dry skin | FAERS: 35 | US FAERS | |
| 13 | Malaise | FAERS: 35 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 14 | Asthenia | FAERS: 31 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 15 | Deep Vein Thrombosis | FAERS: 28 | US FAERS | |
| 16 | Thrombocytopenia | FAERS: 28 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 17 | Stomatitis | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 18 | Dehydration | FAERS: 24 | US FAERS | |
| 19 | Pruritus | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 20 | Respiratory Failure | FAERS: 23 | US FAERS | |
| 21 | Dizziness | FAERS: 22 | US FAERS | |
| 22 | Headache | FAERS: 22 | US FAERS | |
| 23 | Erythema Multiforme | FAERS: 21 | US FAERS | |
| 24 | Dermatitis acneiform | FAERS: 20 | US FAERS | |
| 25 | Thrombosis | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 26 | Pain | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 27 | Ejection Fraction Decreased | FAERS: 18 | US FAERS | |
| 28 | Arthralgia | FAERS: 16 | US FAERS | |
| 29 | Constipation | FAERS: 16 | US FAERS | |
| 30 | Pericardial effusion | FAERS: 16 | US FAERS | |
| 31 | Product use in unapproved indication | FAERS: 16 | US FAERS | |
| 32 | Cerebral Infarction | FAERS: 15 | US FAERS | |
| 33 | Chest Pain | FAERS: 15 | US FAERS | |
| 34 | Erythema | FAERS: 15 | US FAERS | |
| 35 | Urticaria | FAERS: 15 | US FAERS | |
| 36 | Alopecia | FAERS: 14 | US FAERS | |
| 37 | General physical health deterioration | FAERS: 14 | US FAERS | |
| 38 | Infection | FAERS: 14 | US FAERS | |
| 39 | Onychoclasis | FAERS: 14 | US FAERS | |
| 40 | Product use issue | FAERS: 14 | US FAERS | |
| 41 | White blood cell count decreased | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 42 | Alanine Aminotransferase Increased | FAERS: 13 | US FAERS | |
| 43 | Atrial Fibrillation | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 44 | Back Pain | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Aspartate Aminotransferase Increased | FAERS: 12 | US FAERS | |
| 46 | Cardiac Arrest | FAERS: 12 | US FAERS | |
| 47 | Cerebrovascular accident | FAERS: 12 | US FAERS | |
| 48 | Hepatitis | FAERS: 12 | US FAERS | |
| 49 | Myocardial Infarction | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 50 | No adverse event | FAERS: 12 | US FAERS | |
| 51 | Pneumothorax | FAERS: 12 | US FAERS | |
| 52 | Haematotoxicity | FAERS: 11 | US FAERS | |
| 53 | Myalgia | FAERS: 11 | US FAERS | |
| 54 | Neutrophil count decreased | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 55 | Acne | FAERS: 10 | US FAERS | |
| 56 | Acquired gene mutation | FAERS: 10 | US FAERS | |
| 57 | Drug dose omission | FAERS: 10 | US FAERS | |
| 58 | Intentional product misuse | FAERS: 10 | US FAERS | |
| 59 | Metastasis | FAERS: 10 | US FAERS | |
| 60 | Urinary tract infection | FAERS: 10 | US FAERS | |
| 61 | Abdominal Pain | FAERS: 9 | US FAERS | |
| 62 | Blood alkaline phosphatase increased | FAERS: 9 | US FAERS | |
| 63 | Blood creatine phosphokinase increased | FAERS: 9 | US FAERS | |
| 64 | Carcinoembryonic antigen increased | FAERS: 9 | US FAERS | |
| 65 | Dysgeusia | FAERS: 9 | US FAERS | |
| 66 | Peripheral swelling | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 67 | Blood sodium decreased | FAERS: 8 | US FAERS | |
| 68 | Epistaxis | FAERS: 8 | US FAERS | |
| 69 | Fracture | FAERS: 8 | US FAERS | |
| 70 | Lymphangiosis carcinomatosa | FAERS: 8 | US FAERS | |
| 71 | Pancreatitis | FAERS: 8 | US FAERS | |
| 72 | Pancytopenia | FAERS: 8 | US FAERS | |
| 73 | Visual Impairment | FAERS: 8 | US FAERS | |
| 74 | Abdominal discomfort | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 75 | Disseminated Intravascular Coagulation | FAERS: 7 | US FAERS | |
| 76 | Dysphonia | FAERS: 7 | US FAERS | |
| 77 | Hypophagia | FAERS: 7 | US FAERS | |
| 78 | Skin Ulcer | FAERS: 7 | US FAERS | |
| 79 | Therapy cessation | FAERS: 7 | US FAERS | |
| 80 | Transaminases increased | FAERS: 7 | US FAERS | |
| 81 | Venous thrombosis limb | FAERS: 7 | US FAERS | |
| 82 | Acute myocardial infarction | FAERS: 6 | US FAERS | |
| 83 | Blood creatinine increased | FAERS: 6 | US FAERS | |
| 84 | Gamma-Glutamyltransferase Increased | FAERS: 6 | US FAERS | |
| 85 | Nasopharyngitis | FAERS: 6 | US FAERS | |
| 86 | Neutropenia | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 87 | Product dose omission | FAERS: 6 | US FAERS | |
| 88 | Toxicity to various agents | FAERS: 6 | US FAERS | |
| 89 | Acute kidney injury | FAERS: 5 | US FAERS | |
| 90 | Altered state of consciousness | FAERS: 5 | US FAERS | |
| 91 | Blood lactate dehydrogenase increased | FAERS: 5 | US FAERS | |
| 92 | Cataract | FAERS: 5 | US FAERS | |
| 93 | Dyspepsia | FAERS: 5 | US FAERS | |
| 94 | Hepatotoxicity | FAERS: 5 | US FAERS | |
| 95 | Hypotension | FAERS: 5 | US FAERS | |
| 96 | Joint swelling | FAERS: 5 | US FAERS | |
| 97 | Productive Cough | FAERS: 5 | US FAERS | |
| 98 | Proteinuria | FAERS: 5 | US FAERS | |
| 99 | Rash erythematous | FAERS: 5 | US FAERS | |
| 100 | Somnolence | FAERS: 5 | US FAERS | |
| 101 | Trousseau's syndrome | FAERS: 5 | US FAERS | |
| 102 | Amylase increased | FAERS: 4 | US FAERS | |
| 103 | Ascites | FAERS: 4 | US FAERS | |
| 104 | Blood chloride decreased | FAERS: 4 | US FAERS | |
| 105 | Cancer Pain | FAERS: 4 | US FAERS | |
| 106 | Central nervous system lesion | FAERS: 4 | US FAERS | |
| 107 | Deafness | FAERS: 4 | US FAERS | |
| 108 | EGFR gene mutation | FAERS: 4 | US FAERS | |
| 109 | Embolism | FAERS: 4 | US FAERS | |
| 110 | Febrile Neutropenia | FAERS: 4 | US FAERS | |
| 111 | Feeling abnormal | FAERS: 4 | US FAERS | |
| 112 | Full blood count decreased | FAERS: 4 | US FAERS | |
| 113 | Gene Mutation | FAERS: 4 | US FAERS | |
| 114 | Hypoxia | FAERS: 4 | US FAERS | |
| 115 | Influenza | FAERS: 4 | US FAERS | |
| 116 | Lethargy | FAERS: 4 | US FAERS | |
| 117 | Leukopenia | FAERS: 4 | US FAERS | |
| 118 | Loss of personal independence in daily activities | FAERS: 4 | US FAERS | |
| 119 | Musculoskeletal stiffness | FAERS: 4 | US FAERS | |
| 120 | Neck Pain | FAERS: 4 | US FAERS | |
| 121 | Onychalgia | FAERS: 4 | US FAERS | |
| 122 | Oral pain | FAERS: 4 | US FAERS | |
| 123 | Purpura | FAERS: 4 | US FAERS | |
| 124 | Respiratory distress | FAERS: 4 | US FAERS | |
| 125 | Rhabdomyolysis | FAERS: 4 | US FAERS | |
| 126 | Sepsis | FAERS: 4 | US FAERS | |
| 127 | Skin Erosion | FAERS: 4 | US FAERS | |
| 128 | Skin lesion | FAERS: 4 | US FAERS | |
| 129 | Therapy non-responder | FAERS: 4 | US FAERS | |
| 130 | Wheezing | FAERS: 4 | US FAERS | |
| 131 | Acute respiratory failure | FAERS: 3 | US FAERS | |
| 132 | Adverse event | FAERS: 3 | US FAERS | |
| 133 | Arthritis | FAERS: 3 | US FAERS | |
| 134 | BRAF gene mutation | FAERS: 3 | US FAERS | |
| 135 | Blood blister | FAERS: 3 | US FAERS | |
| 136 | Blood potassium decreased | FAERS: 3 | US FAERS | |
| 137 | Bone pain | FAERS: 3 | US FAERS | |
| 138 | Cardiac Tamponade | FAERS: 3 | US FAERS | |
| 139 | Cardiotoxicity | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 140 | Chills | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 141 | Colitis | FAERS: 3 | US FAERS | |
| 142 | Dysarthria | FAERS: 3 | US FAERS | |
| 143 | Eosinophilic Pneumonia | FAERS: 3 | US FAERS | |
| 144 | Flatulence | FAERS: 3 | US FAERS | |
| 145 | Gastrointestinal perforation | FAERS: 3 | US FAERS | |
| 146 | Inflammation | FAERS: 3 | US FAERS | |
| 147 | Large intestine perforation | FAERS: 3 | US FAERS | |
| 148 | Lymphadenopathy | FAERS: 3 | US FAERS | |
| 149 | Lymphangitis | FAERS: 3 | US FAERS | |
| 150 | Malignant transformation | FAERS: 3 | US FAERS | |
| 151 | Memory impairment | FAERS: 3 | US FAERS | |
| 152 | Metastases to adrenals | FAERS: 3 | US FAERS | |
| 153 | Musculoskeletal Pain | FAERS: 3 | US FAERS | |
| 154 | Myocarditis | FAERS: 3 | US FAERS | |
| 155 | Myositis | FAERS: 3 | US FAERS | |
| 156 | Nail Infection | FAERS: 3 | US FAERS | |
| 157 | Night sweats | FAERS: 3 | US FAERS | |
| 158 | Non-small cell lung cancer recurrent | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 159 | Palpitations | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 160 | Performance status decreased | FAERS: 3 | US FAERS | |
| 161 | Peritonitis | FAERS: 3 | US FAERS | |
| 162 | Pneumatosis intestinalis | FAERS: 3 | US FAERS | |
| 163 | Pneumobilia | FAERS: 3 | US FAERS | |
| 164 | Pulmonary thrombosis | FAERS: 3 | US FAERS | |
| 165 | Pulmonary toxicity | FAERS: 3 | US FAERS | |
| 166 | Septic Shock | FAERS: 3 | US FAERS | |
| 167 | Sinusitis | FAERS: 3 | US FAERS | |
| 168 | Sudden Cardiac Death | FAERS: 3 | US FAERS | |
| 169 | Sudden death | FAERS: 3 | US FAERS | |
| 170 | Tachycardia | FAERS: 3 | US FAERS | |
| 171 | Therapy partial responder | FAERS: 3 | US FAERS | |
| 172 | Toxic Epidermal Necrolysis | FAERS: 3 | US FAERS | |
| 173 | Upper respiratory tract inflammation | FAERS: 3 | US FAERS | |
| 174 | Ventricular Dysfunction | FAERS: 3 | US FAERS | |
| 175 | Ventricular hypokinesia | FAERS: 3 | US FAERS | |
| 176 | Wrong technique in product usage process | FAERS: 3 | US FAERS | |
| 177 | Xeroderma | FAERS: 3 | US FAERS | |
| 178 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 179 | Anxiety | FAERS: 2 | US FAERS | |
| 180 | Aphasia | FAERS: 2 | US FAERS | |
| 181 | Asthma | FAERS: 2 | US FAERS | |
| 182 | Atelectasis | FAERS: 2 | US FAERS | |
| 183 | Bronchiolitis | FAERS: 2 | US FAERS | |
| 184 | Burning sensation | FAERS: 2 | US FAERS | |
| 185 | Cachexia | FAERS: 2 | US FAERS | |
| 186 | Cerebral Thrombosis | FAERS: 2 | US FAERS | |
| 187 | Cheilitis | FAERS: 2 | US FAERS | |
| 188 | Cholangitis | FAERS: 2 | US FAERS | |
| 189 | Cholestasis | FAERS: 2 | US FAERS | |
| 190 | Demyelination | FAERS: 2 | US FAERS | |
| 191 | Eczema | FAERS: 2 | US FAERS | |
| 192 | Electrolyte imbalance | FAERS: 2 | US FAERS | |
| 193 | Enterocolitis | FAERS: 2 | US FAERS | |
| 194 | Eosinophilia | FAERS: 2 | US FAERS | |
| 195 | Eye irritation | FAERS: 2 | US FAERS | |
| 196 | Gait inability | FAERS: 2 | US FAERS | |
| 197 | Glaucoma | FAERS: 2 | US FAERS | |
| 198 | Hunger | FAERS: 2 | US FAERS | |
| 199 | Hypersensitivity | FAERS: 2 | US FAERS | |
| 200 | Influenza A virus test positive | FAERS: 2 | US FAERS | |
| 201 | Intentional product use issue | FAERS: 2 | US FAERS | |
| 202 | Intestinal Obstruction | FAERS: 2 | US FAERS | |
| 203 | Intestinal metastasis | FAERS: 2 | US FAERS | |
| 204 | Intracranial mass | FAERS: 2 | US FAERS | |
| 205 | Keratitis | FAERS: 2 | US FAERS | |
| 206 | Leukoencephalopathy | FAERS: 2 | US FAERS | |
| 207 | Lip swelling | FAERS: 2 | US FAERS | |
| 208 | Lymphadenitis | FAERS: 2 | US FAERS | |
| 209 | Meningitis | FAERS: 2 | US FAERS | |
| 210 | Metabolic acidosis | FAERS: 2 | US FAERS | |
| 211 | Metastases to pelvis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 212 | Monoplegia | FAERS: 2 | US FAERS | |
| 213 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 214 | Myopathy | FAERS: 2 | US FAERS | |
| 215 | Nephrotic Syndrome | FAERS: 2 | US FAERS | |
| 216 | Nocturia | FAERS: 2 | US FAERS | |
| 217 | Nodule | FAERS: 2 | US FAERS | |
| 218 | Osteonecrosis of Jaw | FAERS: 2 | US FAERS | |
| 219 | Overdose | FAERS: 2 | US FAERS | |
| 220 | Peptic Ulcer | FAERS: 2 | US FAERS | |
| 221 | Pericarditis | FAERS: 2 | US FAERS | |
| 222 | Peripheral artery occlusion | FAERS: 2 | US FAERS | |
| 223 | Photophobia | FAERS: 2 | US FAERS | |
| 224 | Product use complaint | FAERS: 2 | US FAERS | |
| 225 | RET gene mutation | FAERS: 2 | US FAERS | |
| 226 | Radiation Pneumonitis | FAERS: 2 | US FAERS | |
| 227 | Retinal Artery Occlusion | FAERS: 2 | US FAERS | |
| 228 | Retinal Detachment | FAERS: 2 | US FAERS | |
| 229 | Retinal Vein Occlusion | FAERS: 2 | US FAERS | |
| 230 | Rhinitis | FAERS: 2 | US FAERS | |
| 231 | Seronegative arthritis | FAERS: 2 | US FAERS | |
| 232 | Sinus bradycardia | FAERS: 2 | US FAERS | |
| 233 | Sinus headache | FAERS: 2 | US FAERS | |
| 234 | Stevens-Johnson Syndrome | FAERS: 2 | US FAERS | |
| 235 | Supraventricular tachycardia | FAERS: 2 | US FAERS | |
| 236 | Swelling | FAERS: 2 | US FAERS | |
| 237 | Syncope | FAERS: 2 | US FAERS | |
| 238 | Tension | FAERS: 2 | US FAERS | |
| 239 | Therapeutic response unexpected | FAERS: 2 | US FAERS | |
| 240 | Throat irritation | FAERS: 2 | US FAERS | |
| 241 | Tremor | FAERS: 2 | US FAERS | |
| 242 | Ulcer | FAERS: 2 | US FAERS | |
| 243 | Urinary Retention | FAERS: 2 | US FAERS | |
| 244 | Vertigo | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 245 | jaundice | FAERS: 2 | US FAERS | |
| 246 | Abnormal sleep-related event | FAERS: 1 | US FAERS | |
| 247 | Abscess | FAERS: 1 | US FAERS | |
| 248 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 249 | Acute left ventricular failure | FAERS: 1 | US FAERS | |
| 250 | Agitation | FAERS: 1 | US FAERS | |
| 251 | Alveolitis | FAERS: 1 | US FAERS | |
| 252 | Amnesia | FAERS: 1 | US FAERS | |
| 253 | Anal erosion | FAERS: 1 | US FAERS | |
| 254 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 255 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 256 | Antemortem blood drug level increased | FAERS: 1 | US FAERS | |
| 257 | Appendicitis | FAERS: 1 | US FAERS | |
| 258 | Arthropathy | FAERS: 1 | US FAERS | |
| 259 | Asthenopia | FAERS: 1 | US FAERS | |
| 260 | Ataxia | FAERS: 1 | US FAERS | |
| 261 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 262 | Atrial thrombosis | FAERS: 1 | US FAERS | |
| 263 | Bedridden | FAERS: 1 | US FAERS | |
| 264 | Blindness | FAERS: 1 | US FAERS | |
| 265 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 266 | Blood creatinine decreased | FAERS: 1 | US FAERS | |
| 267 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 268 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 269 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 270 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 271 | Blood urine present | FAERS: 1 | US FAERS | |
| 272 | Bronchitis | FAERS: 1 | US FAERS | |
| 273 | Cardiac asthma | FAERS: 1 | US FAERS | |
| 274 | Cardiac dysfunction | FAERS: 1 | US FAERS | |
| 275 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 276 | Cauda Equina Syndrome | FAERS: 1 | US FAERS | |
| 277 | Cell marker increased | FAERS: 1 | US FAERS | |
| 278 | Cerebellar infarction | FAERS: 1 | US FAERS | |
| 279 | Cerebral atrophy | FAERS: 1 | US FAERS | |
| 280 | Chest discomfort | FAERS: 1 | US FAERS | |
| 281 | Cholecystitis | FAERS: 1 | US FAERS | |
| 282 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 283 | Chromaturia | FAERS: 1 | US FAERS | |
| 284 | Chronic gastritis | FAERS: 1 | US FAERS | |
| 285 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 286 | Coagulation test abnormal | FAERS: 1 | US FAERS | |
| 287 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 288 | Cornea verticillata | FAERS: 1 | US FAERS | |
| 289 | Counterfeit drug administered | FAERS: 1 | US FAERS | |
| 290 | Cystitis | FAERS: 1 | US FAERS | |
| 291 | Cytopenia | FAERS: 1 | US FAERS | |
| 292 | Delirium | FAERS: 1 | US FAERS | |
| 293 | Dementia | FAERS: 1 | US FAERS | |
| 294 | Dengue Fever | FAERS: 1 | US FAERS | |
| 295 | Dermatitis | FAERS: 1 | US FAERS | |
| 296 | Device related infection | FAERS: 1 | US FAERS | |
| 297 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 298 | Diplopia | FAERS: 1 | US FAERS | |
| 299 | Discomfort | FAERS: 1 | US FAERS | |
| 300 | Disease complication | FAERS: 1 | US FAERS | |
| 301 | Disorientation | FAERS: 1 | US FAERS | |
| 302 | Disuse syndrome | FAERS: 1 | US FAERS | |
| 303 | Diverticulitis | FAERS: 1 | US FAERS | |
| 304 | Drowning | FAERS: 1 | US FAERS | |
| 305 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 306 | Drug level decreased | FAERS: 1 | US FAERS | |
| 307 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 308 | Dyslalia | FAERS: 1 | US FAERS | |
| 309 | Dysuria | FAERS: 1 | US FAERS | |
| 310 | Ejection fraction abnormal | FAERS: 1 | US FAERS | |
| 311 | Embolic cerebral infarction | FAERS: 1 | US FAERS | |
| 312 | Endometriosis | FAERS: 1 | US FAERS | |
| 313 | Enterocolitis bacterial | FAERS: 1 | US FAERS | |
| 314 | Enterocutaneous Fistula | FAERS: 1 | US FAERS | |
| 315 | Epilepsy | FAERS: 1 | US FAERS | |
| 316 | Erysipelas | FAERS: 1 | US FAERS | |
| 317 | Eschar | FAERS: 1 | US FAERS | |
| 318 | Exposure via body fluid | FAERS: 1 | US FAERS | |
| 319 | Extra dose administered | FAERS: 1 | US FAERS | |
| 320 | Eye inflammation | FAERS: 1 | US FAERS | |
| 321 | Eye pain | FAERS: 1 | US FAERS | |
| 322 | Facial Pain | FAERS: 1 | US FAERS | |
| 323 | Facial Paresis | FAERS: 1 | US FAERS | |
| 324 | Feeling Cold | FAERS: 1 | US FAERS | |
| 325 | Flank Pain | FAERS: 1 | US FAERS | |
| 326 | Gastritis | FAERS: 1 | US FAERS | |
| 327 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 328 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 329 | Gastrointestinal obstruction | FAERS: 1 | US FAERS | |
| 330 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 331 | Head discomfort | FAERS: 1 | US FAERS | |
| 332 | Hepatic calcification | FAERS: 1 | US FAERS | |
| 333 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 334 | Herpes pharyngitis | FAERS: 1 | US FAERS | |
| 335 | Hordeolum | FAERS: 1 | US FAERS | |
| 336 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 337 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 338 | Hypercapnia | FAERS: 1 | US FAERS | |
| 339 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 340 | Hyperpyrexia | FAERS: 1 | US FAERS | |
| 341 | Hypersomnia | FAERS: 1 | US FAERS | |
| 342 | Hyperventilation | FAERS: 1 | US FAERS | |
| 343 | Hypohidrosis | FAERS: 1 | US FAERS | |
| 344 | Hyporesponsive to stimuli | FAERS: 1 | US FAERS | |
| 345 | Ileus | FAERS: 1 | US FAERS | |
| 346 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 347 | Incarcerated hernia | FAERS: 1 | US FAERS | |
| 348 | Incision site pain | FAERS: 1 | US FAERS | |
| 349 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 350 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 351 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 352 | Intestinal scarring | FAERS: 1 | US FAERS | |
| 353 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 354 | Invasive Ductal Breast Carcinoma | FAERS: 1 | US FAERS | |
| 355 | Joint abscess | FAERS: 1 | US FAERS | |
| 356 | Keratopathy | FAERS: 1 | US FAERS | |
| 357 | Laceration | FAERS: 1 | US FAERS | |
| 358 | Lid sulcus deepened | FAERS: 1 | US FAERS | |
| 359 | Limbic Encephalitis | FAERS: 1 | US FAERS | |
| 360 | Lipase increased | FAERS: 1 | US FAERS | |
| 361 | Liver Abscess | FAERS: 1 | US FAERS | |
| 362 | Low Cardiac Output Syndrome | FAERS: 1 | US FAERS | |
| 363 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 364 | Lung consolidation | FAERS: 1 | US FAERS | |
| 365 | Lupus-like syndrome | FAERS: 1 | US FAERS | |
| 366 | Lymphopenia | FAERS: 1 | US FAERS | |
| 367 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 368 | Macular degeneration | FAERS: 1 | US FAERS | |
| 369 | Macule | FAERS: 1 | US FAERS | |
| 370 | Malignant ascites | FAERS: 1 | US FAERS | |
| 371 | Malnutrition | FAERS: 1 | US FAERS | |
| 372 | Medical device site infection | FAERS: 1 | US FAERS | |
| 373 | Menorrhagia | FAERS: 1 | US FAERS | |
| 374 | Mental impairment | FAERS: 1 | US FAERS | |
| 375 | Mental status changes | FAERS: 1 | US FAERS | |
| 376 | Metastases to stomach | FAERS: 1 | US FAERS | |
| 377 | Metastases to thorax | FAERS: 1 | US FAERS | |
| 378 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 379 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 380 | Nail bed disorder | FAERS: 1 | US FAERS | |
| 381 | Nail cuticle fissure | FAERS: 1 | US FAERS | |
| 382 | Nail toxicity | FAERS: 1 | US FAERS | |
| 383 | Neurone-specific enolase increased | FAERS: 1 | US FAERS | |
| 384 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 385 | Oncologic complication | FAERS: 1 | US FAERS | |
| 386 | Onychomycosis | FAERS: 1 | US FAERS | |
| 387 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 388 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 389 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 390 | Pain of skin | FAERS: 1 | US FAERS | |
| 391 | Paresis | FAERS: 1 | US FAERS | |
| 392 | Pathological fracture | FAERS: 1 | US FAERS | |
| 393 | Penile swelling | FAERS: 1 | US FAERS | |
| 394 | Petechiae | FAERS: 1 | US FAERS | |
| 395 | Pharyngitis | FAERS: 1 | US FAERS | |
| 396 | Pleural infection bacterial | FAERS: 1 | US FAERS | |
| 397 | Pleurisy | FAERS: 1 | US FAERS | |
| 398 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 399 | Polyuria | FAERS: 1 | US FAERS | |
| 400 | Procedural complication | FAERS: 1 | US FAERS | |
| 401 | Product quality issue | FAERS: 1 | US FAERS | |
| 402 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 403 | Prosopagnosia | FAERS: 1 | US FAERS | |
| 404 | Prostate cancer recurrent | FAERS: 1 | US FAERS | |
| 405 | Protein total decreased | FAERS: 1 | US FAERS | |
| 406 | Psoriasis | FAERS: 1 | US FAERS | |
| 407 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 408 | Pulmonary Infarction | FAERS: 1 | US FAERS | |
| 409 | Pulmonary Nocardiosis | FAERS: 1 | US FAERS | |
| 410 | Pulmonary arterial hypertension | FAERS: 1 | US FAERS | |
| 411 | Pulmonary artery thrombosis | FAERS: 1 | US FAERS | |
| 412 | Pulmonary pain | FAERS: 1 | US FAERS | |
| 413 | Purulent discharge | FAERS: 1 | US FAERS | |
| 414 | Renal tubular injury | FAERS: 1 | US FAERS | |
| 415 | Renal tubular necrosis | FAERS: 1 | US FAERS | |
| 416 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 417 | Retinal vascular occlusion | FAERS: 1 | US FAERS | |
| 418 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 419 | Right ventricular failure | FAERS: 1 | US FAERS | |
| 420 | Right ventricular systolic pressure decreased | FAERS: 1 | US FAERS | |
| 421 | Rubella | FAERS: 1 | US FAERS | |
| 422 | Sarcoma | FAERS: 1 | US FAERS | |
| 423 | Secretion discharge | FAERS: 1 | US FAERS | |
| 424 | Shock symptom | FAERS: 1 | US FAERS | |
| 425 | Sinus Arrhythmia | FAERS: 1 | US FAERS | |
| 426 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 427 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 428 | Skin discomfort | FAERS: 1 | US FAERS | |
| 429 | Skin toxicity | FAERS: 1 | US FAERS | |
| 430 | Sneezing | FAERS: 1 | US FAERS | |
| 431 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 432 | Splenic Infarction | FAERS: 1 | US FAERS | |
| 433 | Splenic thrombosis | FAERS: 1 | US FAERS | |
| 434 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 435 | Suicide attempt | FAERS: 1 | US FAERS | |
| 436 | Sunburn | FAERS: 1 | US FAERS | |
| 437 | Superior Vena Cava Syndrome | FAERS: 1 | US FAERS | |
| 438 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 439 | Systolic hypertension | FAERS: 1 | US FAERS | |
| 440 | Tetany | FAERS: 1 | US FAERS | |
| 441 | Therapy change | FAERS: 1 | US FAERS | |
| 442 | Thirst decreased | FAERS: 1 | US FAERS | |
| 443 | Thrombophlebitis | FAERS: 1 | US FAERS | |
| 444 | Thrombotic cerebral infarction | FAERS: 1 | US FAERS | |
| 445 | Tinnitus | FAERS: 1 | US FAERS | |
| 446 | Tongue biting | FAERS: 1 | US FAERS | |
| 447 | Tricuspid Valve Prolapse | FAERS: 1 | US FAERS | |
| 448 | Troponin increased | FAERS: 1 | US FAERS | |
| 449 | Tumour haemorrhage | FAERS: 1 | US FAERS | |
| 450 | Urinary Incontinence | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 451 | Urinary tract inflammation | FAERS: 1 | US FAERS | |
| 452 | Vasculitis | FAERS: 1 | US FAERS | |
| 453 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 454 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 455 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 456 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 457 | furuncle | FAERS: 1 | US FAERS | |
| 458 | Palliative Care | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.