Clindamycin
(AUODDLQVRAJAJM-XJQDNNTCSA-N)
Structure
- SMILES
- CCC[C@H]1CN([C@@H](C1)C(=O)N[C@@H]([C@H]1O[C@H](SC)[C@@H]([C@H]([C@H]1O)O)O)[C@@H](Cl)C)C.Cl
- Molecular Formula:
- C18H34Cl2N2O5S
- Molecular Weight:
- 461.444
- Log P:
- 1.5203
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 5
- TPSA:
- 127.56
- CAS Number(s):
- 21462-39-5; 58207-19-5
Synonym(s)
1.
Clindamycin
2.
7-Chloro-7-deoxylincomycin
3.
Chlolincocin
4.
Chlorlincocin
5.
Cleocin
6.
Clindamycin Hydrochloride
7.
Clindamycin Monohydrochloride
8.
Clindamycin Monohydrochloride, Monohydrate
9.
Dalacin C
10.
7 Chloro 7 deoxylincomycin
11.
Hydrochloride, Clindamycin
12.
Monohydrate Clindamycin Monohydrochloride
13.
Monohydrochloride, Clindamycin
14.
Monohydrochloride, Monohydrate Clindamycin
External Link(s)
| MeSH | D002981 |
| PubChem Compound | 16051951 118705388 |
| CHEMBL | CHEMBL1200588 |
| KEGG | dr:D02132 cpd:C13684 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nausea | FAERS: 105 | US FAERS | |
| 2 | Urticaria | FAERS: 105 | US FAERS | |
| 3 | Pruritus | FAERS: 79 | US FAERS | |
| 4 | Vomiting | FAERS: 74 | US FAERS | |
| 5 | Drug ineffective | FAERS: 73 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 6 | Abdominal Pain | FAERS: 43 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Abdominal discomfort | FAERS: 39 | US FAERS | |
| 8 | Dizziness | FAERS: 33 | US FAERS | |
| 9 | Weight decreased | FAERS: 33 | US FAERS | |
| 10 | Hypersensitivity | FAERS: 32 | US FAERS | |
| 11 | Erythema | FAERS: 30 | US FAERS | |
| 12 | Headache | FAERS: 28 | US FAERS | |
| 13 | Malaise | FAERS: 27 | US FAERS | |
| 14 | Clostridium difficile colitis | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 15 | Chest Pain | FAERS: 25 | US FAERS | |
| 16 | Dyspepsia | FAERS: 25 | US FAERS | |
| 17 | Pain | FAERS: 25 | US FAERS | |
| 18 | Arthralgia | FAERS: 23 | US FAERS | |
| 19 | Dysgeusia | FAERS: 23 | US FAERS | |
| 20 | Feeling abnormal | FAERS: 23 | US FAERS | |
| 21 | Asthenia | FAERS: 21 | US FAERS | |
| 22 | Burning sensation | FAERS: 20 | US FAERS | |
| 23 | Clostridium difficile infection | FAERS: 20 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 24 | Dehydration | FAERS: 20 | US FAERS | |
| 25 | Fatigue | FAERS: 20 | US FAERS | |
| 26 | Angioedema | FAERS: 18 | US FAERS | |
| 27 | Palpitations | FAERS: 17 | US FAERS | |
| 28 | Syncope | FAERS: 15 | US FAERS | |
| 29 | pseudomembranous colitis | FAERS: 15 | US FAERS | |
| 30 | Lip swelling | FAERS: 14 | US FAERS | |
| 31 | Swelling | FAERS: 14 | US FAERS | |
| 32 | Foreign body trauma | FAERS: 13 | US FAERS | |
| 33 | Colitis | FAERS: 12 | US FAERS | |
| 34 | Product taste abnormal | FAERS: 12 | US FAERS | |
| 35 | Chills | FAERS: 11 | US FAERS | |
| 36 | Throat irritation | FAERS: 11 | US FAERS | |
| 37 | Chest discomfort | FAERS: 10 | US FAERS | |
| 38 | Rash erythematous | FAERS: 10 | US FAERS | |
| 39 | Flatulence | FAERS: 9 | US FAERS | |
| 40 | Flushing | FAERS: 9 | US FAERS | |
| 41 | No adverse event | FAERS: 9 | US FAERS | |
| 42 | Product quality issue | FAERS: 9 | US FAERS | |
| 43 | Back Pain | FAERS: 8 | US FAERS | |
| 44 | Hypotension | FAERS: 8 | US FAERS | |
| 45 | Joint swelling | FAERS: 8 | US FAERS | |
| 46 | Oropharyngeal pain | FAERS: 8 | US FAERS | |
| 47 | Pathogen resistance | FAERS: 8 | US FAERS | |
| 48 | Peripheral swelling | FAERS: 8 | US FAERS | |
| 49 | Somnolence | FAERS: 8 | US FAERS | |
| 50 | Clostridium colitis | FAERS: 7 | US FAERS | |
| 51 | Pharmaceutical product complaint | FAERS: 7 | US FAERS | |
| 52 | Polyarthritis | FAERS: 7 | US FAERS | |
| 53 | Tremor | FAERS: 7 | US FAERS | |
| 54 | Vasculitis | FAERS: 7 | US FAERS | |
| 55 | jaundice | FAERS: 7 | US FAERS | |
| 56 | Anxiety | FAERS: 6 | US FAERS | |
| 57 | Choking | FAERS: 6 | US FAERS | |
| 58 | Dysphonia | FAERS: 6 | US FAERS | |
| 59 | Medication Error | FAERS: 6 | US FAERS | |
| 60 | Skin reaction | FAERS: 6 | US FAERS | |
| 61 | Urinary tract infection | FAERS: 6 | US FAERS | |
| 62 | Vulvovaginal burning sensation | FAERS: 6 | US FAERS | |
| 63 | Activities of daily living impaired | FAERS: 5 | US FAERS | |
| 64 | Ageusia | FAERS: 5 | US FAERS | |
| 65 | Anaphylactic shock | FAERS: 5 | US FAERS | |
| 66 | Disease recurrence | FAERS: 5 | US FAERS | |
| 67 | Foreign body aspiration | FAERS: 5 | US FAERS | |
| 68 | Gastritis | FAERS: 5 | US FAERS | |
| 69 | Incorrect route of drug administration | FAERS: 5 | US FAERS | |
| 70 | Postoperative wound complication | FAERS: 5 | US FAERS | |
| 71 | Purulent discharge | FAERS: 5 | US FAERS | |
| 72 | Stomatitis | FAERS: 5 | US FAERS | |
| 73 | Tinnitus | FAERS: 5 | US FAERS | |
| 74 | Vertigo | FAERS: 5 | US FAERS | |
| 75 | Wound dehiscence | FAERS: 5 | US FAERS | |
| 76 | Abscess | FAERS: 4 | US FAERS | |
| 77 | Anorexia | FAERS: 4 | US FAERS | |
| 78 | Aphonia | FAERS: 4 | US FAERS | |
| 79 | Arthritis | FAERS: 4 | US FAERS | |
| 80 | Asthma | FAERS: 4 | US FAERS | |
| 81 | Blood potassium decreased | FAERS: 4 | US FAERS | |
| 82 | Candidiasis | FAERS: 4 | US FAERS | |
| 83 | Caustic injury | FAERS: 4 | US FAERS | |
| 84 | Discomfort | FAERS: 4 | US FAERS | |
| 85 | Drug dispensing error | FAERS: 4 | US FAERS | |
| 86 | Drug dose omission | FAERS: 4 | US FAERS | |
| 87 | Drug exposure during pregnancy | FAERS: 4 | US FAERS | |
| 88 | Frustration | FAERS: 4 | US FAERS | |
| 89 | Hepatitis | FAERS: 4 | US FAERS | |
| 90 | Influenza | FAERS: 4 | US FAERS | |
| 91 | Irritable Bowel Syndrome | FAERS: 4 | US FAERS | |
| 92 | Lymphadenopathy | FAERS: 4 | US FAERS | |
| 93 | Myocardial Infarction | FAERS: 4 | US FAERS | |
| 94 | Oral pain | FAERS: 4 | US FAERS | |
| 95 | Pallor | FAERS: 4 | US FAERS | |
| 96 | Product use issue | FAERS: 4 | US FAERS | |
| 97 | Respiratory distress | FAERS: 4 | US FAERS | |
| 98 | Restlessness | FAERS: 4 | US FAERS | |
| 99 | Retching | FAERS: 4 | US FAERS | |
| 100 | Shock | FAERS: 4 | US FAERS | |
| 101 | Suicide attempt | FAERS: 4 | US FAERS | |
| 102 | Therapeutic response unexpected | FAERS: 4 | US FAERS | |
| 103 | Tracheitis | FAERS: 4 | US FAERS | |
| 104 | Vaginal Discharge | FAERS: 4 | US FAERS | |
| 105 | Vascular rupture | FAERS: 4 | US FAERS | |
| 106 | Vulvovaginal discomfort | FAERS: 4 | US FAERS | |
| 107 | Vulvovaginal pruritus | FAERS: 4 | US FAERS | |
| 108 | treatment failure | FAERS: 4 | US FAERS | |
| 109 | Acne | FAERS: 3 | US FAERS | |
| 110 | Anger | FAERS: 3 | US FAERS | |
| 111 | Application site pain | FAERS: 3 | US FAERS | |
| 112 | Chromaturia | FAERS: 3 | US FAERS | |
| 113 | Constipation | FAERS: 3 | US FAERS | |
| 114 | Crying | FAERS: 3 | US FAERS | |
| 115 | Drug effect incomplete | FAERS: 3 | US FAERS | |
| 116 | Dry skin | FAERS: 3 | US FAERS | |
| 117 | Gastrointestinal infection | FAERS: 3 | US FAERS | |
| 118 | General physical health deterioration | FAERS: 3 | US FAERS | |
| 119 | Hoarseness | FAERS: 3 | US FAERS | |
| 120 | Hypophagia | FAERS: 3 | US FAERS | |
| 121 | Incorrect dose administered | FAERS: 3 | US FAERS | |
| 122 | Infection | FAERS: 3 | US FAERS | |
| 123 | Inflammation | FAERS: 3 | US FAERS | |
| 124 | Injection site pain | FAERS: 3 | US FAERS | |
| 125 | Laryngitis | FAERS: 3 | US FAERS | |
| 126 | Laryngospasm | FAERS: 3 | US FAERS | |
| 127 | Medical device site joint infection | FAERS: 3 | US FAERS | |
| 128 | Memory impairment | FAERS: 3 | US FAERS | |
| 129 | Mucosal erosion | FAERS: 3 | US FAERS | |
| 130 | Neck Pain | FAERS: 3 | US FAERS | |
| 131 | Pancreatitis | FAERS: 3 | US FAERS | |
| 132 | Pharyngolaryngeal Pain | FAERS: 3 | US FAERS | |
| 133 | Pneumonia | FAERS: 3 | US FAERS | |
| 134 | Polyneuropathy | FAERS: 3 | US FAERS | |
| 135 | Post procedural complication | FAERS: 3 | US FAERS | |
| 136 | Rectal discharge | FAERS: 3 | US FAERS | |
| 137 | Respiratory Failure | FAERS: 3 | US FAERS | |
| 138 | Restless Legs Syndrome | FAERS: 3 | US FAERS | |
| 139 | Skin Ulcer | FAERS: 3 | US FAERS | |
| 140 | Skin lesion | FAERS: 3 | US FAERS | |
| 141 | Tachycardia | FAERS: 3 | US FAERS | |
| 142 | Visual Impairment | FAERS: 3 | US FAERS | |
| 143 | Visual disturbance | FAERS: 3 | US FAERS | |
| 144 | Wheezing | FAERS: 3 | US FAERS | |
| 145 | Wrong technique in drug usage process | FAERS: 3 | US FAERS | |
| 146 | Abasia | FAERS: 2 | US FAERS | |
| 147 | Accidental exposure | FAERS: 2 | US FAERS | |
| 148 | Administration related reaction | FAERS: 2 | US FAERS | |
| 149 | Alanine Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 150 | Angina Pectoris | FAERS: 2 | US FAERS | |
| 151 | Application site swelling | FAERS: 2 | US FAERS | |
| 152 | Aspartate Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 153 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 154 | Bacteria stool identified | FAERS: 2 | US FAERS | |
| 155 | Bedridden | FAERS: 2 | US FAERS | |
| 156 | Blood alkaline phosphatase increased | FAERS: 2 | US FAERS | |
| 157 | Blood phosphorus increased | FAERS: 2 | US FAERS | |
| 158 | Bone pain | FAERS: 2 | US FAERS | |
| 159 | Bowel movement irregularity | FAERS: 2 | US FAERS | |
| 160 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 161 | Cellulitis | FAERS: 2 | US FAERS | |
| 162 | Clostridium difficile toxin test positive | FAERS: 2 | US FAERS | |
| 163 | Cold sweat | FAERS: 2 | US FAERS | |
| 164 | Cytolytic hepatitis | FAERS: 2 | US FAERS | |
| 165 | Delirium | FAERS: 2 | US FAERS | |
| 166 | Device ineffective | FAERS: 2 | US FAERS | |
| 167 | Disease Progression | FAERS: 2 | US FAERS | |
| 168 | Dysbacteriosis | FAERS: 2 | US FAERS | |
| 169 | Eosinophilia | FAERS: 2 | US FAERS | |
| 170 | Epistaxis | FAERS: 2 | US FAERS | |
| 171 | Eructation | FAERS: 2 | US FAERS | |
| 172 | Erythema Multiforme | FAERS: 2 | US FAERS | |
| 173 | Facial Pain | FAERS: 2 | US FAERS | |
| 174 | Fibrin abnormal | FAERS: 2 | US FAERS | |
| 175 | Food Allergy | FAERS: 2 | US FAERS | |
| 176 | Gamma-Glutamyltransferase Increased | FAERS: 2 | US FAERS | |
| 177 | Gastrointestinal Pain | FAERS: 2 | US FAERS | |
| 178 | Gastrointestinal ulcer | FAERS: 2 | US FAERS | |
| 179 | Genital rash | FAERS: 2 | US FAERS | |
| 180 | Hemiparesis | FAERS: 2 | US FAERS | |
| 181 | Hemiplegia | FAERS: 2 | US FAERS | |
| 182 | Impaired work ability | FAERS: 2 | US FAERS | |
| 183 | Injection site cellulitis | FAERS: 2 | US FAERS | |
| 184 | Injection site erythema | FAERS: 2 | US FAERS | |
| 185 | Injury associated with device | FAERS: 2 | US FAERS | |
| 186 | Kounis Syndrome | FAERS: 2 | US FAERS | |
| 187 | Lethargy | FAERS: 2 | US FAERS | |
| 188 | Leukocytosis | FAERS: 2 | US FAERS | |
| 189 | Musculoskeletal Pain | FAERS: 2 | US FAERS | |
| 190 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 191 | Myalgia | FAERS: 2 | US FAERS | |
| 192 | Myasthenia Gravis | FAERS: 2 | US FAERS | |
| 193 | Nervousness | FAERS: 2 | US FAERS | |
| 194 | Neuralgia | FAERS: 2 | US FAERS | |
| 195 | Overdose | FAERS: 2 | US FAERS | |
| 196 | Pain of skin | FAERS: 2 | US FAERS | |
| 197 | Pancytopenia | FAERS: 2 | US FAERS | |
| 198 | Pharyngitis | FAERS: 2 | US FAERS | |
| 199 | Poisoning | FAERS: 2 | US FAERS | |
| 200 | Polymyalgia Rheumatica | FAERS: 2 | US FAERS | |
| 201 | Product dose omission | FAERS: 2 | US FAERS | |
| 202 | Product label confusion | FAERS: 2 | US FAERS | |
| 203 | Product measured potency issue | FAERS: 2 | US FAERS | |
| 204 | Product physical issue | FAERS: 2 | US FAERS | |
| 205 | Product use in unapproved indication | FAERS: 2 | US FAERS | |
| 206 | Rectal Prolapse | FAERS: 2 | US FAERS | |
| 207 | Salivary gland scan abnormal | FAERS: 2 | US FAERS | |
| 208 | Secretion discharge | FAERS: 2 | US FAERS | |
| 209 | Sepsis | FAERS: 2 | US FAERS | |
| 210 | Skin irritation | FAERS: 2 | US FAERS | |
| 211 | Stevens-Johnson Syndrome | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 212 | Thermal burn | FAERS: 2 | US FAERS | |
| 213 | Thirst | FAERS: 2 | US FAERS | |
| 214 | Toothache | FAERS: 2 | US FAERS | |
| 215 | Unevaluable event | FAERS: 2 | US FAERS | |
| 216 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 217 | Urinary Retention | FAERS: 2 | US FAERS | |
| 218 | Vulvovaginal pain | FAERS: 2 | US FAERS | |
| 219 | Vulvovaginal swelling | FAERS: 2 | US FAERS | |
| 220 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 221 | Acquired macroglossia | FAERS: 1 | US FAERS | |
| 222 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 223 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 224 | Agitation | FAERS: 1 | US FAERS | |
| 225 | Agranulocytosis | FAERS: 1 | US FAERS | |
| 226 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 227 | Amnesia | FAERS: 1 | US FAERS | |
| 228 | Anal Fissure | FAERS: 1 | US FAERS | |
| 229 | Anal abscess | FAERS: 1 | US FAERS | |
| 230 | Apparent death | FAERS: 1 | US FAERS | |
| 231 | Application site dryness | FAERS: 1 | US FAERS | |
| 232 | Application site reaction | FAERS: 1 | US FAERS | |
| 233 | Arthropathy | FAERS: 1 | US FAERS | |
| 234 | Auricular swelling | FAERS: 1 | US FAERS | |
| 235 | Back disorder | FAERS: 1 | US FAERS | |
| 236 | Bacterial Vaginosis | FAERS: 1 | US FAERS | |
| 237 | Blood blister | FAERS: 1 | US FAERS | |
| 238 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 239 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 240 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 241 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 242 | Bone marrow depression | FAERS: 1 | US FAERS | |
| 243 | Breast discomfort | FAERS: 1 | US FAERS | |
| 244 | Capsule issue | FAERS: 1 | US FAERS | |
| 245 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 246 | Cheilosis | FAERS: 1 | US FAERS | |
| 247 | Choking sensation | FAERS: 1 | US FAERS | |
| 248 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 249 | Clostridium difficile sepsis | FAERS: 1 | US FAERS | |
| 250 | Clostridium test positive | FAERS: 1 | US FAERS | |
| 251 | Cystitis escherichia | FAERS: 1 | US FAERS | |
| 252 | Cyst | FAERS: 1 | US FAERS | |
| 253 | Dental caries | FAERS: 1 | US FAERS | |
| 254 | Dermatitis | FAERS: 1 | US FAERS | |
| 255 | Diplegia | FAERS: 1 | US FAERS | |
| 256 | Disorientation | FAERS: 1 | US FAERS | |
| 257 | Drug administration error | FAERS: 1 | US FAERS | |
| 258 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 259 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 260 | Drug resistance | FAERS: 1 | US FAERS | |
| 261 | Drug screen positive | FAERS: 1 | US FAERS | |
| 262 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 263 | Dysacusis | FAERS: 1 | US FAERS | |
| 264 | Dyschezia | FAERS: 1 | US FAERS | |
| 265 | Economic problem | FAERS: 1 | US FAERS | |
| 266 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 267 | Electromechanical dissociation | FAERS: 1 | US FAERS | |
| 268 | Emergency Care | FAERS: 1 | US FAERS | |
| 269 | Enteritis | FAERS: 1 | US FAERS | |
| 270 | Enterocolitis | FAERS: 1 | US FAERS | |
| 271 | Epidermolysis | FAERS: 1 | US FAERS | |
| 272 | Epiglottis ulcer | FAERS: 1 | US FAERS | |
| 273 | Epilepsy | FAERS: 1 | US FAERS | |
| 274 | Escherichia infection | FAERS: 1 | US FAERS | |
| 275 | Expired product administered | FAERS: 1 | US FAERS | |
| 276 | Eye Infection | FAERS: 1 | US FAERS | |
| 277 | Eye Redness | FAERS: 1 | US FAERS | |
| 278 | Feeling Cold | FAERS: 1 | US FAERS | |
| 279 | Formication | FAERS: 1 | US FAERS | |
| 280 | Gallbladder pain | FAERS: 1 | US FAERS | |
| 281 | Gas Gangrene | FAERS: 1 | US FAERS | |
| 282 | Gastric ulcer helicobacter | FAERS: 1 | US FAERS | |
| 283 | Gastrointestinal hypermotility | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 284 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 285 | General symptom | FAERS: 1 | US FAERS | |
| 286 | Genital injury | FAERS: 1 | US FAERS | |
| 287 | Hepatitis A | FAERS: 1 | US FAERS | |
| 288 | Hepatosplenomegaly | FAERS: 1 | US FAERS | |
| 289 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 290 | Hyperacusis | FAERS: 1 | US FAERS | |
| 291 | Hypersomnia | FAERS: 1 | US FAERS | |
| 292 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 293 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 294 | Hypogeusia | FAERS: 1 | US FAERS | |
| 295 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 296 | Impaired self-care | FAERS: 1 | US FAERS | |
| 297 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 298 | Infusion Site Extravasation | FAERS: 1 | US FAERS | |
| 299 | Injury asphyxiation | FAERS: 1 | US FAERS | |
| 300 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 301 | Intestinal hypomotility | FAERS: 1 | US FAERS | |
| 302 | Lactose Intolerance | FAERS: 1 | US FAERS | |
| 303 | Larynx irritation | FAERS: 1 | US FAERS | |
| 304 | Lemierre Syndrome | FAERS: 1 | US FAERS | |
| 305 | Leukocytoclastic vasculitis | FAERS: 1 | US FAERS | |
| 306 | Local reaction | FAERS: 1 | US FAERS | |
| 307 | Lung consolidation | FAERS: 1 | US FAERS | |
| 308 | Malignant dysphagia | FAERS: 1 | US FAERS | |
| 309 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 310 | Megacolon | FAERS: 1 | US FAERS | |
| 311 | Meningitis | FAERS: 1 | US FAERS | |
| 312 | Mental status changes | FAERS: 1 | US FAERS | |
| 313 | Mononucleosis syndrome | FAERS: 1 | US FAERS | |
| 314 | Muscle Cramp | FAERS: 1 | US FAERS | |
| 315 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 316 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 317 | Myocardial bridging | FAERS: 1 | US FAERS | |
| 318 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 319 | Necrosis | FAERS: 1 | US FAERS | |
| 320 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 321 | Nerve Block | FAERS: 1 | US FAERS | |
| 322 | Neuroborreliosis | FAERS: 1 | US FAERS | |
| 323 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 324 | Night sweats | FAERS: 1 | US FAERS | |
| 325 | Nodule | FAERS: 1 | US FAERS | |
| 326 | Ocular icterus | FAERS: 1 | US FAERS | |
| 327 | Onychoclasis | FAERS: 1 | US FAERS | |
| 328 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 329 | Oral fungal infection | FAERS: 1 | US FAERS | |
| 330 | Oropharyngeal swelling | FAERS: 1 | US FAERS | |
| 331 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 332 | Paranoia | FAERS: 1 | US FAERS | |
| 333 | Paresis | FAERS: 1 | US FAERS | |
| 334 | Petechiae | FAERS: 1 | US FAERS | |
| 335 | Pharyngitis bacterial | FAERS: 1 | US FAERS | |
| 336 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 337 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 338 | Procedural complication | FAERS: 1 | US FAERS | |
| 339 | Product closure issue | FAERS: 1 | US FAERS | |
| 340 | Product complaint | FAERS: 1 | US FAERS | |
| 341 | Product contamination | FAERS: 1 | US FAERS | |
| 342 | Product dosage form issue | FAERS: 1 | US FAERS | |
| 343 | Product label issue | FAERS: 1 | US FAERS | |
| 344 | Product packaging issue | FAERS: 1 | US FAERS | |
| 345 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 346 | Product use complaint | FAERS: 1 | US FAERS | |
| 347 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 348 | Pus in stool | FAERS: 1 | US FAERS | |
| 349 | Rectal spasm | FAERS: 1 | US FAERS | |
| 350 | Red man syndrome | FAERS: 1 | US FAERS | |
| 351 | Rosacea | FAERS: 1 | US FAERS | |
| 352 | Scarlet Fever | FAERS: 1 | US FAERS | |
| 353 | Septic Shock | FAERS: 1 | US FAERS | |
| 354 | Similar reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 355 | Sinusitis | FAERS: 1 | US FAERS | |
| 356 | Skin test positive | FAERS: 1 | US FAERS | |
| 357 | Sleep disorder due to a general medical condition | FAERS: 1 | US FAERS | |
| 358 | Sleep disorder due to general medical condition, insomnia type | FAERS: 1 | US FAERS | |
| 359 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 360 | Stress | FAERS: 1 | US FAERS | |
| 361 | Subcutaneous Abscess | FAERS: 1 | US FAERS | |
| 362 | Symmetrical drug-related intertriginous and flexural exanthema | FAERS: 1 | US FAERS | |
| 363 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 364 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 365 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 366 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 367 | Tooth Infection | FAERS: 1 | US FAERS | |
| 368 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 369 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 370 | Trismus | FAERS: 1 | US FAERS | |
| 371 | Urine output increased | FAERS: 1 | US FAERS | |
| 372 | Vanishing bile duct syndrome | FAERS: 1 | US FAERS | |
| 373 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 374 | Visual brightness | FAERS: 1 | US FAERS | |
| 375 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 376 | Vulvovaginal erythema | FAERS: 1 | US FAERS | |
| 377 | Vulvovaginal mycotic infection | FAERS: 1 | US FAERS | |
| 378 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 379 | nervous system disorder | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.