Donepezil
(ADEBPBSSDYVVLD-UHFFFAOYSA-N)
Structure
- SMILES
- COc1cc2c(cc1OC)CC(C2=O)CC1CCN(CC1)Cc1ccccc1
- Type(s)
- Approved
- ATC code(s)
- N06DA02; N06DA52; N06DA53
- Molecular Formula:
- C24H29NO3
- Molecular Weight:
- 379.492
- Log P:
- 4.2990
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 0
- TPSA:
- 38.77
- CAS Number(s):
- 120014-06-4; 142057-79-2
Synonym(s)
1.
Donepezil
2.
1-Benzyl-4-((5,6-dimethoxy-1-indanon)-2-yl)methylpiperidine hydrochloride
3.
Aricept
4.
Donepezil Hydrochloride
5.
Donepezilium Oxalate Trihydrate
6.
E 2020
7.
E-2020
8.
E2020
9.
Eranz
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Vomiting | FAERS: 72 Canada Vigilance: 3 | 12109969 | CTD SIDER Canada Vigilance US FAERS |
| 2 | Bradycardia | FAERS: 60 Canada Vigilance: 3 | 19793162 20505440 | CTD SIDER Canada Vigilance US FAERS |
| 3 | Nausea | FAERS: 47 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 4 | Dizziness | FAERS: 36 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 5 | Syncope | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 6 | Delirium | FAERS: 27 | 11926729 12921925 15038335 | CTD US FAERS |
| 7 | Agitation | FAERS: 26 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 8 | Accidental overdose | FAERS: 21 | US FAERS | |
| 9 | Atrial tachycardia | FAERS: 20 | US FAERS | |
| 10 | Asthenia | FAERS: 19 | SIDER US FAERS | |
| 11 | Suicide attempt | FAERS: 18 | US FAERS | |
| 12 | Tremor | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 13 | Drug ineffective | FAERS: 16 | US FAERS | |
| 14 | Urinary Incontinence | FAERS: 16 | 10084551 | CTD SIDER US FAERS |
| 15 | Drug abuse | FAERS: 15 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 16 | Fatigue | FAERS: 15 | SIDER US FAERS | |
| 17 | Pleurothotonus | FAERS: 15 | US FAERS | |
| 18 | Somnolence | FAERS: 15 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 19 | Crying | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 20 | Cardiac Arrest | FAERS: 11 | US FAERS | |
| 21 | Dementia | FAERS: 11 | 18494081 24189446 | CTD SIDER US FAERS |
| 22 | Drooling | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 23 | Headache | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 24 | Medication Error | FAERS: 11 | US FAERS | |
| 25 | Memory impairment | FAERS: 11 | US FAERS | |
| 26 | Myoclonus | FAERS: 11 | 15038335 | CTD US FAERS |
| 27 | Overdose | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Behavioural and psychiatric symptoms of dementia | FAERS: 10 | US FAERS | |
| 29 | Malaise | FAERS: 10 | SIDER US FAERS | |
| 30 | Blood glucose fluctuation | FAERS: 9 | US FAERS | |
| 31 | Dysphonia | FAERS: 9 | US FAERS | |
| 32 | Polydipsia | FAERS: 9 | SIDER US FAERS | |
| 33 | Retinal Detachment | FAERS: 9 | US FAERS | |
| 34 | Acute kidney injury | FAERS: 8 | US FAERS | |
| 35 | Aphasia | FAERS: 8 | SIDER US FAERS | |
| 36 | Hypophagia | FAERS: 8 | US FAERS | |
| 37 | Product substitution issue | FAERS: 8 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 38 | Torticollis | FAERS: 8 | US FAERS | |
| 39 | Apathy | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 40 | Automatism | FAERS: 7 | OFFSIDES US FAERS | |
| 41 | Depressed Level of Consciousness | FAERS: 7 | OFFSIDES US FAERS | |
| 42 | Duodenal Ulcer | FAERS: 7 | SIDER US FAERS | |
| 43 | Executive dysfunction | FAERS: 7 | US FAERS | |
| 44 | Ileus | FAERS: 7 | SIDER US FAERS | |
| 45 | Pancytopenia | FAERS: 7 | US FAERS | |
| 46 | Rheumatoid Arthritis | FAERS: 7 | US FAERS | |
| 47 | Chorea | FAERS: 6 | US FAERS | |
| 48 | Disorientation | FAERS: 6 | US FAERS | |
| 49 | Drug withdrawal syndrome | FAERS: 6 | US FAERS | |
| 50 | Elevated mood | FAERS: 6 | US FAERS | |
| 51 | Feeling abnormal | FAERS: 6 | SIDER US FAERS | |
| 52 | Hypotension | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 53 | Jealous delusion | FAERS: 6 | US FAERS | |
| 54 | Mental status changes | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 55 | Presyncope | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 56 | Sinus bradycardia | FAERS: 6 | OFFSIDES US FAERS | |
| 57 | Sopor | FAERS: 6 | US FAERS | |
| 58 | Weight decreased | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 59 | Abdominal discomfort | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 60 | Dehydration | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 61 | Electrolyte imbalance | FAERS: 5 | US FAERS | |
| 62 | Epilepsy | FAERS: 5 | OFFSIDES US FAERS | |
| 63 | Eructation | FAERS: 5 | SIDER US FAERS | |
| 64 | Frontotemporal dementia | FAERS: 5 | US FAERS | |
| 65 | Toxicity to various agents | FAERS: 5 | US FAERS | |
| 66 | Anxiety | FAERS: 4 | SIDER US FAERS | |
| 67 | Drug administration error | FAERS: 4 | US FAERS | |
| 68 | Hypersensitivity | FAERS: 4 | SIDER US FAERS | |
| 69 | Hypomania | FAERS: 4 | US FAERS | |
| 70 | Intentional product misuse | FAERS: 4 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 71 | Overconfidence | FAERS: 4 | US FAERS | |
| 72 | Product dispensing error | FAERS: 4 | US FAERS | |
| 73 | Vertigo | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 74 | Cerebral atrophy | FAERS: 3 | OFFSIDES US FAERS | |
| 75 | Dropped head syndrome | FAERS: 3 | US FAERS | |
| 76 | Drug level increased | FAERS: 3 | US FAERS | |
| 77 | Dystonia | FAERS: 3 | 12782913 20235482 | CTD US FAERS |
| 78 | Eczema | FAERS: 3 | SIDER US FAERS | |
| 79 | Epistaxis | FAERS: 3 | SIDER US FAERS | |
| 80 | Flight of ideas | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 81 | Long QT Syndrome | FAERS: 3 | 19602789 | CTD US FAERS |
| 82 | Myalgia | FAERS: 3 | SIDER US FAERS | |
| 83 | Neurodermatitis | FAERS: 3 | SIDER US FAERS | |
| 84 | Neuroleptic Malignant Syndrome | FAERS: 3 | 12654986 14731314 | CTD OFFSIDES SIDER US FAERS |
| 85 | Paranoia | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 86 | Pressure of speech | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 87 | Respiratory Failure | FAERS: 3 | OFFSIDES US FAERS | |
| 88 | Restlessness | FAERS: 3 | US FAERS | |
| 89 | Rhabdomyolysis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 90 | Shock | FAERS: 3 | SIDER US FAERS | |
| 91 | Thirst | FAERS: 3 | SIDER US FAERS | |
| 92 | Urticaria | FAERS: 3 | SIDER US FAERS | |
| 93 | Wrong technique in product usage process | FAERS: 3 | US FAERS | |
| 94 | Accidental exposure to product | FAERS: 2 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 95 | Accidental exposure to product by child | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 96 | Adverse event | FAERS: 2 | US FAERS | |
| 97 | Anger | FAERS: 2 | US FAERS | |
| 98 | Angioedema | FAERS: 2 | US FAERS | |
| 99 | Arthralgia | FAERS: 2 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 100 | Athetosis | FAERS: 2 | US FAERS | |
| 101 | Atrial Fibrillation | FAERS: 2 | SIDER US FAERS | |
| 102 | Atrioventricular Block | FAERS: 2 | 19602789 | CTD SIDER US FAERS |
| 103 | Bedridden | FAERS: 2 | OFFSIDES US FAERS | |
| 104 | Cerebrovascular accident | FAERS: 2 | SIDER US FAERS | |
| 105 | Chills | FAERS: 2 | SIDER US FAERS | |
| 106 | Disease recurrence | FAERS: 2 | US FAERS | |
| 107 | Drug diversion | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 108 | Feeling of body temperature change | FAERS: 2 | US FAERS | |
| 109 | Gait inability | FAERS: 2 | US FAERS | |
| 110 | Gastroenteritis | FAERS: 2 | SIDER US FAERS | |
| 111 | General physical health deterioration | FAERS: 2 | US FAERS | |
| 112 | Inappropriate affect | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 113 | Incoherent | FAERS: 2 | US FAERS | |
| 114 | Lip swelling | FAERS: 2 | US FAERS | |
| 115 | Obsessive thoughts | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 116 | Pain | FAERS: 2 | 16820527 | CTD SIDER US FAERS |
| 117 | Pallor | FAERS: 2 | OFFSIDES US FAERS | |
| 118 | Palpitations | FAERS: 2 | US FAERS | |
| 119 | Perseveration | FAERS: 2 | US FAERS | |
| 120 | Pneumonia | FAERS: 2 | SIDER US FAERS | |
| 121 | Product taste abnormal | FAERS: 2 | US FAERS | |
| 122 | Therapeutic response unexpected | FAERS: 2 | US FAERS | |
| 123 | Unresponsive to stimuli | FAERS: 2 | OFFSIDES US FAERS | |
| 124 | nervous system disorder | FAERS: 2 | SIDER US FAERS | |
| 125 | Abdominal Pain | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 126 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 127 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 128 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 129 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 130 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 131 | Asphyxia | FAERS: 1 | US FAERS | |
| 132 | Back Pain | FAERS: 1 | SIDER US FAERS | |
| 133 | Blood creatinine increased | FAERS: 1 | SIDER US FAERS | |
| 134 | Blood pressure orthostatic abnormal | FAERS: 1 | US FAERS | |
| 135 | Blood urea increased | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 136 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 137 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 138 | Cachexia | FAERS: 1 | SIDER US FAERS | |
| 139 | Cardiomegaly | FAERS: 1 | 19879468 | CTD SIDER US FAERS |
| 140 | Cardiotoxicity | FAERS: 1 | US FAERS | |
| 141 | Carotid artery occlusion | FAERS: 1 | OFFSIDES US FAERS | |
| 142 | Change in sustained attention | FAERS: 1 | US FAERS | |
| 143 | Cholestatic liver injury | FAERS: 1 | US FAERS | |
| 144 | Chromaturia | FAERS: 1 | US FAERS | |
| 145 | Cold sweat | FAERS: 1 | US FAERS | |
| 146 | Colitis | FAERS: 1 | US FAERS | |
| 147 | Concomitant disease progression | FAERS: 1 | US FAERS | |
| 148 | Depressed mood | FAERS: 1 | US FAERS | |
| 149 | Disease Progression | FAERS: 1 | US FAERS | |
| 150 | Drowning | FAERS: 1 | US FAERS | |
| 151 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 152 | Drug dose omission | FAERS: 1 | OFFSIDES US FAERS | |
| 153 | Drug level above therapeutic | FAERS: 1 | US FAERS | |
| 154 | Dyscalculia | FAERS: 1 | US FAERS | |
| 155 | Dysgraphia | FAERS: 1 | US FAERS | |
| 156 | Dysuria | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 157 | Emotional distress | FAERS: 1 | US FAERS | |
| 158 | Encephalomalacia | FAERS: 1 | US FAERS | |
| 159 | Euphoric mood | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 160 | Excessive masturbation | FAERS: 1 | US FAERS | |
| 161 | Extra dose administered | FAERS: 1 | US FAERS | |
| 162 | Fluid overload | FAERS: 1 | OFFSIDES US FAERS | |
| 163 | Gastric ulcer | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 164 | Gastritis | FAERS: 1 | SIDER US FAERS | |
| 165 | Glabellar reflex abnormal | FAERS: 1 | US FAERS | |
| 166 | Gliosis | FAERS: 1 | US FAERS | |
| 167 | Hallucinations, mixed | FAERS: 1 | US FAERS | |
| 168 | Heart sounds abnormal | FAERS: 1 | US FAERS | |
| 169 | Histone antibody positive | FAERS: 1 | US FAERS | |
| 170 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 171 | Hypokinesia | FAERS: 1 Canada Vigilance: 3 | 16054679 | CTD SIDER Canada Vigilance US FAERS |
| 172 | Immobile | FAERS: 1 | US FAERS | |
| 173 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 174 | Inappropriate schedule of drug administration | FAERS: 1 | OFFSIDES US FAERS | |
| 175 | Incontinence | FAERS: 1 | OFFSIDES US FAERS | |
| 176 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 177 | Initial insomnia | FAERS: 1 | US FAERS | |
| 178 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 179 | Loose associations | FAERS: 1 | US FAERS | |
| 180 | Lupus-like syndrome | FAERS: 1 | US FAERS | |
| 181 | Mood swings | FAERS: 1 | SIDER US FAERS | |
| 182 | Muscle Rigidity | FAERS: 1 | 14731314 | CTD US FAERS |
| 183 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 184 | Myocardial Infarction | FAERS: 1 | 21750701 | CTD SIDER US FAERS |
| 185 | Nasopharyngitis | FAERS: 1 | SIDER US FAERS | |
| 186 | Nervousness | FAERS: 1 | SIDER US FAERS | |
| 187 | Neurological decompensation | FAERS: 1 | US FAERS | |
| 188 | Oral pain | FAERS: 1 | US FAERS | |
| 189 | Panic Disorder | FAERS: 1 | US FAERS | |
| 190 | Pericarditis | FAERS: 1 | US FAERS | |
| 191 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 192 | Petechiae | FAERS: 1 | US FAERS | |
| 193 | Physical abuse | FAERS: 1 | US FAERS | |
| 194 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 195 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 196 | Product administration error | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 197 | Product quality issue | FAERS: 1 | US FAERS | |
| 198 | Pruritus | FAERS: 1 | SIDER US FAERS | |
| 199 | Rash erythematous | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 200 | Rebound effect | FAERS: 1 | US FAERS | |
| 201 | Retching | FAERS: 1 | US FAERS | |
| 202 | Sick Sinus Syndrome | FAERS: 1 | OFFSIDES US FAERS | |
| 203 | Sinus Arrhythmia | FAERS: 1 | US FAERS | |
| 204 | Sinus rhythm | FAERS: 1 | US FAERS | |
| 205 | Skin reaction | FAERS: 1 | US FAERS | |
| 206 | Somnambulism | FAERS: 1 | US FAERS | |
| 207 | Tachyphrenia | FAERS: 1 | US FAERS | |
| 208 | Therapy change | FAERS: 1 | US FAERS | |
| 209 | Victim of elder abuse | FAERS: 1 | US FAERS | |
| 210 | Visual Impairment | FAERS: 1 | SIDER US FAERS | |
| 211 | Abasia | OFFSIDES | ||
| 212 | Abdominal bloating | SIDER | ||
| 213 | Abnormal vision | OFFSIDES SIDER | ||
| 214 | Abscess | SIDER | ||
| 215 | Abulia | OFFSIDES | ||
| 216 | Acute Coronary Syndrome | SIDER | ||
| 217 | Acute psychosis | OFFSIDES | ||
| 218 | Alanine Aminotransferase Increased | SIDER | ||
| 219 | Albuminuria | SIDER | ||
| 220 | Alkalosis | OFFSIDES | ||
| 221 | Alopecia | SIDER | ||
| 222 | Alveolitis | OFFSIDES | ||
| 223 | Amnesia, Anterograde | 12589378 | CTD | |
| 224 | Amnesia | 9228650 18496672 19345205 | CTD | |
| 225 | Amphetamine-Related Disorders | 16820538 | CTD | |
| 226 | Angina Pectoris | SIDER | ||
| 227 | Anorexia | OFFSIDES SIDER | ||
| 228 | Anticholinergic Syndrome | OFFSIDES | ||
| 229 | Anticonvulsant drug level below therapeutic | OFFSIDES | ||
| 230 | Aortic embolus | OFFSIDES | ||
| 231 | Aphagia | OFFSIDES | ||
| 232 | Arteriovenous fistula thrombosis | OFFSIDES | ||
| 233 | Arteritis | SIDER | ||
| 234 | Arthritis | SIDER | ||
| 235 | Arthropathy | SIDER | ||
| 236 | Aspartate Aminotransferase Increased | SIDER | ||
| 237 | Aspiration Pneumonia | OFFSIDES | ||
| 238 | Assault | SIDER | ||
| 239 | Asthma | SIDER | ||
| 240 | Ataxia | SIDER | ||
| 241 | Atelectasis | SIDER | ||
| 242 | Aura | OFFSIDES | ||
| 243 | Basal Ganglia Diseases | 9766783 12109969 | CTD | |
| 244 | Benign Prostatic Hyperplasia | OFFSIDES | ||
| 245 | Biopsy bone abnormal | OFFSIDES | ||
| 246 | Bladder discomfort | OFFSIDES | ||
| 247 | Bladder pain | SIDER | ||
| 248 | Blepharitis | SIDER | ||
| 249 | Blood 1,25-dihydroxycholecalciferol decreased | OFFSIDES | ||
| 250 | Blood albumin decreased | OFFSIDES | ||
| 251 | Blood alkaline phosphatase increased | SIDER | ||
| 252 | Blood amylase increased | OFFSIDES | ||
| 253 | Blood creatine phosphokinase increased | SIDER | ||
| 254 | Blood lactate dehydrogenase increased | SIDER | ||
| 255 | Blood magnesium decreased | OFFSIDES | ||
| 256 | Blood potassium increased | OFFSIDES | ||
| 257 | Blood pressure fluctuation | OFFSIDES | ||
| 258 | Blood sodium increased | OFFSIDES | ||
| 259 | Blood urine present | OFFSIDES | ||
| 260 | Breath Holding | OFFSIDES | ||
| 261 | Bronchitis | SIDER | ||
| 262 | Bulbar palsy | OFFSIDES | ||
| 263 | Camptocormia | 14638981 | CTD | |
| 264 | Cataract | SIDER | ||
| 265 | Catatonia | 15609676 | CTD | |
| 266 | Catheter related complication | OFFSIDES | ||
| 267 | Cellulitis | SIDER | ||
| 268 | Central line infection | OFFSIDES | ||
| 269 | Cerebral Infarction | SIDER | ||
| 270 | Cerebral artery occlusion | OFFSIDES | ||
| 271 | Cerebral ventricle dilatation | OFFSIDES | ||
| 272 | Chemical and Drug Induced Liver Injury | 19186568 | CTD | |
| 273 | Chest Pain | SIDER | ||
| 274 | Cholecystitis | SIDER | ||
| 275 | Cholelithiasis | SIDER | ||
| 276 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 277 | Cocaine-Related Disorders | 12721372 17105940 | CTD | |
| 278 | Cognition Disorders | CTD | ||
| 279 | Common Cold | SIDER | ||
| 280 | Confabulation | OFFSIDES | ||
| 281 | Conjunctival deposit | OFFSIDES | ||
| 282 | Conjunctivitis | SIDER | ||
| 283 | Constipation | SIDER | ||
| 284 | Cramps of lower extremities | SIDER | ||
| 285 | Creatine Phosphokinase Increased | SIDER | ||
| 286 | Creatinine increased | SIDER | ||
| 287 | Cutaneous Candidiasis | OFFSIDES | ||
| 288 | Cystitis | SIDER | ||
| 289 | Cyst | SIDER | ||
| 290 | Deep Vein Thrombosis | SIDER | ||
| 291 | Deglutition Disorders | 14731314 | CTD | |
| 292 | Depressive disorder | 12667174 | CTD | |
| 293 | Dermatitis | SIDER | ||
| 294 | Device capturing issue | SIDER | ||
| 295 | Diabetes Mellitus | SIDER | ||
| 296 | Diarrhea | 16054679 | CTD OFFSIDES | |
| 297 | Diplopia | OFFSIDES | ||
| 298 | Discomfort | SIDER | ||
| 299 | Dissociative disorder | OFFSIDES | ||
| 300 | Disturbance in sexual arousal | SIDER | ||
| 301 | Diverticulitis | SIDER | ||
| 302 | Drowsiness | OFFSIDES | ||
| 303 | Dry skin | SIDER | ||
| 304 | Dysarthria | SIDER | ||
| 305 | Dysgeusia | SIDER | ||
| 306 | Dyspepsia | SIDER | ||
| 307 | Dysphasia | SIDER | ||
| 308 | Ecchymosis | SIDER | ||
| 309 | Electrocardiogram ST-T change | OFFSIDES | ||
| 310 | Electrocardiogram abnormal | SIDER | ||
| 311 | Emotional poverty | SIDER | ||
| 312 | Endocarditis | OFFSIDES | ||
| 313 | Enterococcal sepsis | OFFSIDES | ||
| 314 | Enuresis | SIDER | ||
| 315 | Eosinophilia | SIDER | ||
| 316 | Epigastric distress | SIDER | ||
| 317 | Epigastric pain | SIDER | ||
| 318 | Erythema Multiforme | OFFSIDES | ||
| 319 | Erythema | SIDER | ||
| 320 | Erythropenia | SIDER | ||
| 321 | Eschar | OFFSIDES | ||
| 322 | Excoriation | SIDER | ||
| 323 | Eye irritation | SIDER | ||
| 324 | Feeling Cold | SIDER | ||
| 325 | Fibroadenoma of breast | SIDER | ||
| 326 | Fibroadenosis of breast | SIDER | ||
| 327 | Flat affect | SIDER | ||
| 328 | Flatulence | SIDER | ||
| 329 | Foreign body trauma | OFFSIDES | ||
| 330 | Fracture | SIDER | ||
| 331 | Gambling | OFFSIDES | ||
| 332 | Gastrointestinal Diseases | 16820527 | CTD | |
| 333 | Gastrointestinal Pain | SIDER | ||
| 334 | Gingivitis | SIDER | ||
| 335 | Glaucoma | SIDER | ||
| 336 | Glycosuria | SIDER | ||
| 337 | Gout | SIDER | ||
| 338 | Head pressure | SIDER | ||
| 339 | Headache fullness | SIDER | ||
| 340 | Heart Rupture, Post-Infarction | 21750701 | CTD | |
| 341 | Hemiplegia | OFFSIDES SIDER | ||
| 342 | Hepatitis | SIDER | ||
| 343 | Hernia | SIDER | ||
| 344 | Herpes Labialis | SIDER | ||
| 345 | Hiccough | OFFSIDES | ||
| 346 | Hirsutism | SIDER | ||
| 347 | Hostility | SIDER | ||
| 348 | Hyperkeratosis | SIDER | ||
| 349 | Hypersomnia | Canada Vigilance: 1 | Canada Vigilance | |
| 350 | Hypertrophy | SIDER | ||
| 351 | Hyperventilation | OFFSIDES SIDER | ||
| 352 | Hypoxia | OFFSIDES | ||
| 353 | Increased thirst | SIDER | ||
| 354 | Infection | SIDER | ||
| 355 | Infestation | SIDER | ||
| 356 | Influenza | SIDER | ||
| 357 | Intention tremor | OFFSIDES | ||
| 358 | Irritable Bowel Syndrome | SIDER | ||
| 359 | Kidney Failure | OFFSIDES | ||
| 360 | Laceration | OFFSIDES SIDER | ||
| 361 | Lacrimal structural disorder | SIDER | ||
| 362 | Lactic dehydrogenase activity increased | SIDER | ||
| 363 | Left atrial dilatation | OFFSIDES | ||
| 364 | Lethargy | OFFSIDES | ||
| 365 | Leukocytosis | SIDER | ||
| 366 | Leukoencephalopathy | OFFSIDES | ||
| 367 | Leukopenia neonatal | OFFSIDES | ||
| 368 | Lewy Body Disease | 20505440 | CTD | |
| 369 | Localised intraabdominal fluid collection | OFFSIDES | ||
| 370 | Low Cardiac Output Syndrome | OFFSIDES | ||
| 371 | Lymphoplasmacytoid lymphoma/immunocytoma | OFFSIDES | ||
| 372 | Malnutrition | SIDER | ||
| 373 | Mastitis | SIDER | ||
| 374 | Melancholia | SIDER | ||
| 375 | Memory Disorders | CTD | ||
| 376 | Meningorrhagia | OFFSIDES | ||
| 377 | Mental disorders | 16820527 | CTD | |
| 378 | Mental impairment | OFFSIDES | ||
| 379 | Metrorrhagia | SIDER | ||
| 380 | Mixed liver injury | OFFSIDES | ||
| 381 | Motion Sickness | SIDER | ||
| 382 | Motor retardation | OFFSIDES | ||
| 383 | Multiple Myeloma | OFFSIDES | ||
| 384 | Multiple Sclerosis | OFFSIDES | ||
| 385 | Muscle Weakness | 12109969 | CTD | |
| 386 | Musculoskeletal discomfort | SIDER | ||
| 387 | Myoclonic Epilepsy | OFFSIDES | ||
| 388 | Neuralgia | SIDER | ||
| 389 | Neurobehavioral Manifestations | 11180473 | CTD | |
| 390 | Night Terrors | 15630600 | CTD | |
| 391 | Night sweats | SIDER | ||
| 392 | Nocturia | SIDER | ||
| 393 | Numbness | SIDER | ||
| 394 | Nystagmus | SIDER | ||
| 395 | Oral torus | OFFSIDES | ||
| 396 | Oropharyngeal discomfort | SIDER | ||
| 397 | Oropharyngeal pain | SIDER | ||
| 398 | Osteoporosis | SIDER | ||
| 399 | Otitis Externa | SIDER | ||
| 400 | Otitis Media | SIDER | ||
| 401 | Pancreatitis | SIDER | ||
| 402 | Parkinsonian Disorders | 11180473 14638981 | CTD | |
| 403 | Pelvic fluid collection | OFFSIDES | ||
| 404 | Periodontitis | SIDER | ||
| 405 | Personality Change | Canada Vigilance: 1 | Canada Vigilance | |
| 406 | Pharyngitis | SIDER | ||
| 407 | Physical assault | SIDER | ||
| 408 | Physical wandering | SIDER | ||
| 409 | Pleurisy | SIDER | ||
| 410 | Pneumothorax | SIDER | ||
| 411 | Post procedural pneumonia | OFFSIDES | ||
| 412 | Protein total decreased | OFFSIDES | ||
| 413 | Pseudobulbar Palsy | OFFSIDES | ||
| 414 | Psoriasis | SIDER | ||
| 415 | Pulmonary congestion | SIDER | ||
| 416 | Pyelonephritis | SIDER | ||
| 417 | Pyuria | SIDER | ||
| 418 | Respiratory tract congestion | SIDER | ||
| 419 | Rhinitis | SIDER | ||
| 420 | Seizures | 10084551 | CTD | |
| 421 | Sepsis | SIDER | ||
| 422 | Sinoatrial Block | SIDER | ||
| 423 | Skin Ulcer | SIDER | ||
| 424 | Skin laceration | OFFSIDES SIDER | ||
| 425 | Sleep Wake Disorders | 19305123 19326812 | CTD | |
| 426 | Sleep disorder due to general medical condition, insomnia type | Canada Vigilance: 1 | Canada Vigilance | |
| 427 | Snoring | SIDER | ||
| 428 | Spots before eyes | SIDER | ||
| 429 | Stereotypic Movement Disorder | 31369746 | CTD | |
| 430 | Stupor | 14731314 | CTD | |
| 431 | Substance Withdrawal Syndrome | 12721372 | CTD | |
| 432 | Substance-Related Disorders | 12721372 | CTD | |
| 433 | Sudden Cardiac Death | OFFSIDES | ||
| 434 | Sudden death | OFFSIDES | ||
| 435 | Supraventricular tachycardia | SIDER | ||
| 436 | Sweating | SIDER | ||
| 437 | Tachycardia | 14731314 | CTD | |
| 438 | Tension | SIDER | ||
| 439 | Thrombocytopenia | SIDER | ||
| 440 | Thrombocytosis | SIDER | ||
| 441 | Tinnitus | SIDER | ||
| 442 | Toothache | SIDER | ||
| 443 | Torsades de Pointes | 19358226 19602789 | CTD | |
| 444 | Tracheal Stenosis | OFFSIDES | ||
| 445 | Transaminases increased | SIDER | ||
| 446 | Triple vessel bypass graft | OFFSIDES | ||
| 447 | Type III immune complex mediated reaction | OFFSIDES | ||
| 448 | Upper-airway cough syndrome | SIDER | ||
| 449 | Upset stomach | SIDER | ||
| 450 | Urinary Retention | SIDER | ||
| 451 | Urinary tract infection | SIDER | ||
| 452 | Urine flow decreased | OFFSIDES | ||
| 453 | Uterine Prolapse | OFFSIDES | ||
| 454 | Vaginal lesion | OFFSIDES | ||
| 455 | Vasodilation procedure | SIDER | ||
| 456 | Vasodilation | SIDER | ||
| 457 | Ventricular Flutter | OFFSIDES | ||
| 458 | Vesiculobullous rash | SIDER | ||
| 459 | Wheezing | SIDER | ||
| 460 | Withdrawal emotional | SIDER | ||
| 461 | bad taste | SIDER | ||
| 462 | jaundice | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.