Lacosamide
(VPPJLAIAVCUEMN-GFCCVEGCSA-N)
Structure
- SMILES
- COC[C@H](C(=O)NCc1ccccc1)NC(=O)C
- Type(s)
- Approved
- ATC code(s)
- N03AX18
- Molecular Formula:
- C13H18N2O3
- Molecular Weight:
- 250.294
- Log P:
- 1.2357
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 2
- TPSA:
- 67.43
- CAS Number(s):
- 175481-36-4
Synonym(s)
1.
Lacosamide
2.
N-benzyl-2-acetamido-3-methoxypropionamide
3.
N-benzyl-AcMeOPrNH2
4.
Vimpat
5.
N benzyl 2 acetamido 3 methoxypropionamide
6.
N benzyl AcMeOPrNH2
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Dizziness | FAERS: 98 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 2 | Epilepsy | FAERS: 83 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Drug ineffective | FAERS: 78 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 4 | Overdose | FAERS: 72 | US FAERS | |
| 5 | Nausea | FAERS: 57 | OFFSIDES SIDER US FAERS | |
| 6 | Status Epilepticus | FAERS: 55 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 7 | Somnolence | FAERS: 52 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 8 | Vomiting | FAERS: 49 | SIDER US FAERS | |
| 9 | Fatigue | FAERS: 48 | OFFSIDES SIDER US FAERS | |
| 10 | Headache | FAERS: 48 | SIDER US FAERS | |
| 11 | Malaise | FAERS: 43 | US FAERS | |
| 12 | Cerebrovascular accident | FAERS: 41 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 13 | Pregnancy | FAERS: 41 | US FAERS | |
| 14 | Bradycardia | FAERS: 39 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 15 | Intentional product misuse | FAERS: 37 | US FAERS | |
| 16 | Memory impairment | FAERS: 36 | SIDER US FAERS | |
| 17 | Tremor | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 18 | Drug dose omission | FAERS: 34 | OFFSIDES US FAERS | |
| 19 | Atrioventricular Block | FAERS: 32 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 20 | Diplopia | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 21 | Pneumonia | FAERS: 28 | US FAERS | |
| 22 | Anxiety | FAERS: 26 | US FAERS | |
| 23 | Syncope | FAERS: 26 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 24 | Product dose omission | FAERS: 25 | US FAERS | |
| 25 | Amnesia | FAERS: 23 | US FAERS | |
| 26 | Asthenia | FAERS: 22 | SIDER US FAERS | |
| 27 | Cardiac Arrest | FAERS: 22 | US FAERS | |
| 28 | Feeling abnormal | FAERS: 22 | SIDER US FAERS | |
| 29 | Agitation | FAERS: 20 | SIDER US FAERS | |
| 30 | Pruritus | FAERS: 20 | SIDER US FAERS | |
| 31 | Tachycardia | FAERS: 19 | US FAERS | |
| 32 | Atrial Fibrillation | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 33 | Unevaluable event | FAERS: 16 | US FAERS | |
| 34 | Alopecia | FAERS: 15 | US FAERS | |
| 35 | Chest Pain | FAERS: 15 | OFFSIDES SIDER US FAERS | |
| 36 | Myocardial Infarction | FAERS: 14 | US FAERS | |
| 37 | Nervousness | FAERS: 14 | US FAERS | |
| 38 | Crying | FAERS: 13 | OFFSIDES US FAERS | |
| 39 | No adverse event | FAERS: 13 | US FAERS | |
| 40 | Palpitations | FAERS: 13 | SIDER US FAERS | |
| 41 | Sepsis | FAERS: 13 | US FAERS | |
| 42 | Suicide attempt | FAERS: 13 | SIDER US FAERS | |
| 43 | Vertigo | FAERS: 13 | SIDER US FAERS | |
| 44 | Wrong technique in product usage process | FAERS: 13 | US FAERS | |
| 45 | Anger | FAERS: 12 | OFFSIDES US FAERS | |
| 46 | Activities of daily living impaired | FAERS: 11 | US FAERS | |
| 47 | Atrial Flutter | FAERS: 11 | OFFSIDES SIDER US FAERS | |
| 48 | Hypotension | FAERS: 11 | US FAERS | |
| 49 | Incorrect dose administered | FAERS: 11 | OFFSIDES US FAERS | |
| 50 | Mood swings | FAERS: 11 | SIDER US FAERS | |
| 51 | Tinnitus | FAERS: 11 | SIDER US FAERS | |
| 52 | Weight decreased | FAERS: 11 | US FAERS | |
| 53 | Congenital hydronephrosis | FAERS: 10 | US FAERS | |
| 54 | Drug ineffective for unapproved indication | FAERS: 10 | US FAERS | |
| 55 | Hypersomnia | FAERS: 10 | US FAERS | |
| 56 | Leukopenia | FAERS: 10 | US FAERS | |
| 57 | Thrombocytopenia | FAERS: 10 | US FAERS | |
| 58 | Urinary tract infection | FAERS: 10 | US FAERS | |
| 59 | Abdominal Pain | FAERS: 9 | US FAERS | |
| 60 | Blindness | FAERS: 9 | US FAERS | |
| 61 | Medication Error | FAERS: 9 | US FAERS | |
| 62 | Pain | FAERS: 9 | US FAERS | |
| 63 | Restlessness | FAERS: 9 | US FAERS | |
| 64 | Dehydration | FAERS: 8 | US FAERS | |
| 65 | Epistaxis | FAERS: 8 | US FAERS | |
| 66 | Hypersensitivity | FAERS: 8 | SIDER US FAERS | |
| 67 | Lethargy | FAERS: 8 | US FAERS | |
| 68 | Oropharyngeal pain | FAERS: 8 | US FAERS | |
| 69 | Pancytopenia | FAERS: 8 | US FAERS | |
| 70 | Paranoia | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 71 | Acne | FAERS: 7 | OFFSIDES US FAERS | |
| 72 | Adverse event | FAERS: 7 | US FAERS | |
| 73 | Aphasia | FAERS: 7 | US FAERS | |
| 74 | Aura | FAERS: 7 | US FAERS | |
| 75 | Chromaturia | FAERS: 7 | OFFSIDES US FAERS | |
| 76 | Erythema | FAERS: 7 | SIDER US FAERS | |
| 77 | Focal dyscognitive seizures | FAERS: 7 | US FAERS | |
| 78 | Inappropriate schedule of drug administration | FAERS: 7 | OFFSIDES US FAERS | |
| 79 | Mental status changes | FAERS: 7 | US FAERS | |
| 80 | Nasopharyngitis | FAERS: 7 | US FAERS | |
| 81 | Sinus bradycardia | FAERS: 7 | US FAERS | |
| 82 | Visual Impairment | FAERS: 7 | US FAERS | |
| 83 | Ataxia | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 84 | Disorientation | FAERS: 6 | US FAERS | |
| 85 | Drug exposure during pregnancy | FAERS: 6 | US FAERS | |
| 86 | Dysarthria | FAERS: 6 | SIDER US FAERS | |
| 87 | Lymphadenopathy | FAERS: 6 | US FAERS | |
| 88 | Maternal exposure during pregnancy | FAERS: 6 | US FAERS | |
| 89 | Myoclonus | FAERS: 6 | US FAERS | |
| 90 | Pancreatitis | FAERS: 6 | US FAERS | |
| 91 | Product quality issue | FAERS: 6 | US FAERS | |
| 92 | Rhabdomyolysis | FAERS: 6 | US FAERS | |
| 93 | Stress | FAERS: 6 | US FAERS | |
| 94 | Urticaria | FAERS: 6 | SIDER US FAERS | |
| 95 | Wrong technique in drug usage process | FAERS: 6 | US FAERS | |
| 96 | Ankle Fracture | FAERS: 5 | US FAERS | |
| 97 | Back Pain | FAERS: 5 | US FAERS | |
| 98 | Change in seizure presentation | FAERS: 5 | US FAERS | |
| 99 | Delirium | FAERS: 5 | US FAERS | |
| 100 | Drug Dependence | FAERS: 5 | US FAERS | |
| 101 | Emotional disorder | FAERS: 5 | US FAERS | |
| 102 | General physical health deterioration | FAERS: 5 | US FAERS | |
| 103 | Lip swelling | FAERS: 5 | US FAERS | |
| 104 | Myoclonic Epilepsy | FAERS: 5 | OFFSIDES US FAERS | |
| 105 | Nystagmus | FAERS: 5 | SIDER US FAERS | |
| 106 | Respiratory arrest | FAERS: 5 | US FAERS | |
| 107 | Sopor | FAERS: 5 | US FAERS | |
| 108 | Sudden death | FAERS: 5 | US FAERS | |
| 109 | Unresponsive to stimuli | FAERS: 5 | US FAERS | |
| 110 | Acute myocardial infarction | FAERS: 4 | US FAERS | |
| 111 | Arthralgia | FAERS: 4 | US FAERS | |
| 112 | Bipolar Disorder | FAERS: 4 | US FAERS | |
| 113 | Blood creatine phosphokinase increased | FAERS: 4 | US FAERS | |
| 114 | Blood urine present | FAERS: 4 | US FAERS | |
| 115 | Brain Contusion | FAERS: 4 | US FAERS | |
| 116 | Cataract | FAERS: 4 | US FAERS | |
| 117 | Complex partial seizures | FAERS: 4 | US FAERS | |
| 118 | Deafness | FAERS: 4 | US FAERS | |
| 119 | Dementia | FAERS: 4 | US FAERS | |
| 120 | Discomfort | FAERS: 4 | SIDER US FAERS | |
| 121 | Drowning | FAERS: 4 | OFFSIDES US FAERS | |
| 122 | Drug prescribing error | FAERS: 4 | US FAERS | |
| 123 | Encephalitis | FAERS: 4 | US FAERS | |
| 124 | Flatulence | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 125 | Flushing | FAERS: 4 | US FAERS | |
| 126 | Gamma-Glutamyltransferase Increased | FAERS: 4 | US FAERS | |
| 127 | Influenza | FAERS: 4 | US FAERS | |
| 128 | Mental impairment | FAERS: 4 | US FAERS | |
| 129 | Neutropenia | FAERS: 4 | SIDER US FAERS | |
| 130 | Personality Change | FAERS: 4 | OFFSIDES US FAERS | |
| 131 | Prescribed overdose | FAERS: 4 | US FAERS | |
| 132 | Pulmonary Embolism | FAERS: 4 | US FAERS | |
| 133 | Stevens-Johnson Syndrome | FAERS: 4 | SIDER US FAERS | |
| 134 | Therapeutic response unexpected | FAERS: 4 | US FAERS | |
| 135 | Toxicity to various agents | FAERS: 4 | US FAERS | |
| 136 | Abdominal discomfort | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 137 | Accidental exposure to product | FAERS: 3 | US FAERS | |
| 138 | Accidental overdose | FAERS: 3 | US FAERS | |
| 139 | Acute Coronary Syndrome | FAERS: 3 | US FAERS | |
| 140 | Altered state of consciousness | FAERS: 3 | US FAERS | |
| 141 | Arthritis | FAERS: 3 | US FAERS | |
| 142 | Blood lactate dehydrogenase increased | FAERS: 3 | US FAERS | |
| 143 | Breast tenderness | FAERS: 3 | US FAERS | |
| 144 | Completed Suicide | FAERS: 3 | US FAERS | |
| 145 | Constipation | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 146 | Drug effect incomplete | FAERS: 3 | US FAERS | |
| 147 | Drug withdrawal convulsions | FAERS: 3 | US FAERS | |
| 148 | Dyspepsia | FAERS: 3 | SIDER US FAERS | |
| 149 | Dysphemia | FAERS: 3 | US FAERS | |
| 150 | Erectile dysfunction | FAERS: 3 | US FAERS | |
| 151 | Flank Pain | FAERS: 3 | OFFSIDES US FAERS | |
| 152 | Glioblastoma | FAERS: 3 | US FAERS | |
| 153 | Hemiparesis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 154 | Hypophagia | FAERS: 3 | US FAERS | |
| 155 | Impaired driving ability | FAERS: 3 | US FAERS | |
| 156 | Impaired work ability | FAERS: 3 | US FAERS | |
| 157 | Infection | FAERS: 3 | US FAERS | |
| 158 | Intentional self-injury | FAERS: 3 | US FAERS | |
| 159 | Joint injury | FAERS: 3 | US FAERS | |
| 160 | Laceration | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 161 | Limb injury | FAERS: 3 | US FAERS | |
| 162 | Musculoskeletal stiffness | FAERS: 3 | US FAERS | |
| 163 | Mydriasis | FAERS: 3 | US FAERS | |
| 164 | Neck Pain | FAERS: 3 | US FAERS | |
| 165 | Nephrolithiasis | FAERS: 3 | OFFSIDES US FAERS | |
| 166 | Psychiatric symptom | FAERS: 3 | US FAERS | |
| 167 | Respiratory Failure | FAERS: 3 | US FAERS | |
| 168 | Septic Shock | FAERS: 3 | US FAERS | |
| 169 | Skin laceration | FAERS: 3 | SIDER US FAERS | |
| 170 | Skin reaction | FAERS: 3 | US FAERS | |
| 171 | Supraventricular tachycardia | FAERS: 3 | OFFSIDES US FAERS | |
| 172 | Transaminases increased | FAERS: 3 | US FAERS | |
| 173 | Tuberculosis | FAERS: 3 | US FAERS | |
| 174 | Abasia | FAERS: 2 | US FAERS | |
| 175 | Acute kidney injury | FAERS: 2 | US FAERS | |
| 176 | Acute psychosis | FAERS: 2 | US FAERS | |
| 177 | Acute respiratory failure | FAERS: 2 | US FAERS | |
| 178 | Alanine Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 179 | Alcohol abuse | FAERS: 2 | US FAERS | |
| 180 | Allergic reaction to excipient | FAERS: 2 | US FAERS | |
| 181 | Angina Pectoris | FAERS: 2 | US FAERS | |
| 182 | Anticonvulsant drug level decreased | FAERS: 2 | US FAERS | |
| 183 | Anticonvulsant drug level increased | FAERS: 2 | US FAERS | |
| 184 | Apathy | FAERS: 2 | US FAERS | |
| 185 | Aphonia | FAERS: 2 | US FAERS | |
| 186 | Appendicitis | FAERS: 2 | US FAERS | |
| 187 | Arthropathy | FAERS: 2 | US FAERS | |
| 188 | Aspartate Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 189 | Asphyxia | FAERS: 2 | US FAERS | |
| 190 | Blood sodium decreased | FAERS: 2 | US FAERS | |
| 191 | Blood triglycerides increased | FAERS: 2 | US FAERS | |
| 192 | Bone pain | FAERS: 2 | US FAERS | |
| 193 | Cerebral disorder | FAERS: 2 | US FAERS | |
| 194 | Cold sweat | FAERS: 2 | OFFSIDES US FAERS | |
| 195 | Deep Vein Thrombosis | FAERS: 2 | US FAERS | |
| 196 | Dengue Fever | FAERS: 2 | US FAERS | |
| 197 | Depressed Level of Consciousness | FAERS: 2 | US FAERS | |
| 198 | Depressed mood | FAERS: 2 | SIDER US FAERS | |
| 199 | Diabetes mellitus inadequate control | FAERS: 2 | US FAERS | |
| 200 | Disability | FAERS: 2 | US FAERS | |
| 201 | Disease Progression | FAERS: 2 | US FAERS | |
| 202 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 203 | Drug withdrawal syndrome | FAERS: 2 | US FAERS | |
| 204 | Dysgraphia | FAERS: 2 | US FAERS | |
| 205 | Dyslexia | FAERS: 2 | US FAERS | |
| 206 | Dysphonia | FAERS: 2 | US FAERS | |
| 207 | Extraocular Muscle Paresis | FAERS: 2 | US FAERS | |
| 208 | Food Allergy | FAERS: 2 | US FAERS | |
| 209 | Gastrostomy | FAERS: 2 | US FAERS | |
| 210 | Glioblastoma Multiforme | FAERS: 2 | OFFSIDES US FAERS | |
| 211 | Grip strength decreased | FAERS: 2 | US FAERS | |
| 212 | Growth retardation | FAERS: 2 | US FAERS | |
| 213 | Head Banging | FAERS: 2 | US FAERS | |
| 214 | Hepatic Encephalopathy | FAERS: 2 | US FAERS | |
| 215 | Hepatitis C | FAERS: 2 | US FAERS | |
| 216 | Hepatitis | FAERS: 2 | SIDER US FAERS | |
| 217 | Hostility | FAERS: 2 | OFFSIDES US FAERS | |
| 218 | Hunger | FAERS: 2 | US FAERS | |
| 219 | Hypertensive crisis | FAERS: 2 | US FAERS | |
| 220 | Hypoxia | FAERS: 2 | US FAERS | |
| 221 | Ileus | FAERS: 2 | US FAERS | |
| 222 | Incorrect drug administration rate | FAERS: 2 | US FAERS | |
| 223 | Infusion site swelling | FAERS: 2 | US FAERS | |
| 224 | Intestinal Obstruction | FAERS: 2 | US FAERS | |
| 225 | Joint swelling | FAERS: 2 | US FAERS | |
| 226 | Lipase increased | FAERS: 2 | US FAERS | |
| 227 | Lymphadenitis | FAERS: 2 | US FAERS | |
| 228 | Malaria | FAERS: 2 | US FAERS | |
| 229 | Musculoskeletal Pain | FAERS: 2 | US FAERS | |
| 230 | Neurostimulator implantation | FAERS: 2 | US FAERS | |
| 231 | Night sweats | FAERS: 2 | US FAERS | |
| 232 | Obsessive-Compulsive Disorder | FAERS: 2 | US FAERS | |
| 233 | Optic Neuritis | FAERS: 2 | US FAERS | |
| 234 | Photophobia | FAERS: 2 | US FAERS | |
| 235 | Poisoning | FAERS: 2 | US FAERS | |
| 236 | Polyhydramnios | FAERS: 2 | OFFSIDES US FAERS | |
| 237 | Presyncope | FAERS: 2 | US FAERS | |
| 238 | Sciatica | FAERS: 2 | US FAERS | |
| 239 | Splenomegaly | FAERS: 2 | US FAERS | |
| 240 | Sputum retention | FAERS: 2 | US FAERS | |
| 241 | Thermal burn | FAERS: 2 | US FAERS | |
| 242 | Toxic Epidermal Necrolysis | FAERS: 2 | SIDER US FAERS | |
| 243 | Urinary Retention | FAERS: 2 | US FAERS | |
| 244 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 245 | jaundice | FAERS: 2 | US FAERS | |
| 246 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 247 | Accidental drug intake by child | FAERS: 1 | US FAERS | |
| 248 | Acidosis | FAERS: 1 | OFFSIDES US FAERS | |
| 249 | Adnexa uteri pain | FAERS: 1 | US FAERS | |
| 250 | Ageusia | FAERS: 1 | US FAERS | |
| 251 | Agranulocytosis | FAERS: 1 | SIDER US FAERS | |
| 252 | Ammonia increased | FAERS: 1 | US FAERS | |
| 253 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 254 | Anaplastic astrocytoma | FAERS: 1 | US FAERS | |
| 255 | Aneurysm | FAERS: 1 | US FAERS | |
| 256 | Angioedema | FAERS: 1 | SIDER US FAERS | |
| 257 | Anosmia | FAERS: 1 | US FAERS | |
| 258 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 259 | Atypical pneumonia | FAERS: 1 | US FAERS | |
| 260 | Autonomic nervous system imbalance | FAERS: 1 | US FAERS | |
| 261 | Autonomic neuropathy | FAERS: 1 | US FAERS | |
| 262 | Azoospermia | FAERS: 1 | US FAERS | |
| 263 | Bedridden | FAERS: 1 | US FAERS | |
| 264 | Blepharitis | FAERS: 1 | US FAERS | |
| 265 | Blepharospasm | FAERS: 1 | US FAERS | |
| 266 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 267 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 268 | Blood phosphorus increased | FAERS: 1 | US FAERS | |
| 269 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 270 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 271 | Breast Feeding | FAERS: 1 | US FAERS | |
| 272 | Bronchitis | FAERS: 1 | US FAERS | |
| 273 | Bronchospasm | FAERS: 1 | US FAERS | |
| 274 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 275 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 276 | Cerebral calcification | FAERS: 1 | US FAERS | |
| 277 | Cerebral ventricle dilatation | FAERS: 1 | US FAERS | |
| 278 | Chest discomfort | FAERS: 1 | US FAERS | |
| 279 | Choking | FAERS: 1 | US FAERS | |
| 280 | Cholestasis | FAERS: 1 | US FAERS | |
| 281 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 282 | Colectomy | FAERS: 1 | US FAERS | |
| 283 | Colitis | FAERS: 1 | US FAERS | |
| 284 | Culture urine positive | FAERS: 1 | US FAERS | |
| 285 | Cyst | FAERS: 1 | US FAERS | |
| 286 | Dark circles under eyes | FAERS: 1 | US FAERS | |
| 287 | Delusional perception | FAERS: 1 | OFFSIDES US FAERS | |
| 288 | Dental caries | FAERS: 1 | US FAERS | |
| 289 | Dermatomyositis | FAERS: 1 | US FAERS | |
| 290 | Device malfunction | FAERS: 1 | US FAERS | |
| 291 | Device related infection | FAERS: 1 | US FAERS | |
| 292 | Disease complication | FAERS: 1 | US FAERS | |
| 293 | Dissociative Identity Disorder | FAERS: 1 | US FAERS | |
| 294 | Dissociative disorder | FAERS: 1 | US FAERS | |
| 295 | Drooling | FAERS: 1 | US FAERS | |
| 296 | Drug abuse | FAERS: 1 | US FAERS | |
| 297 | Drug administration error | FAERS: 1 | US FAERS | |
| 298 | Drug diversion | FAERS: 1 | US FAERS | |
| 299 | Drug exposure via breast milk | FAERS: 1 | US FAERS | |
| 300 | Drug level increased | FAERS: 1 | US FAERS | |
| 301 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 302 | Drug screen positive | FAERS: 1 | OFFSIDES US FAERS | |
| 303 | Dystonia | FAERS: 1 | OFFSIDES US FAERS | |
| 304 | Ear discomfort | FAERS: 1 | OFFSIDES US FAERS | |
| 305 | Eczema | FAERS: 1 | US FAERS | |
| 306 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 307 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 308 | Epilepsy surgery | FAERS: 1 | US FAERS | |
| 309 | Eructation | FAERS: 1 | US FAERS | |
| 310 | Erythema Multiforme | FAERS: 1 | SIDER US FAERS | |
| 311 | Excoriation | FAERS: 1 | US FAERS | |
| 312 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 313 | Extravasation | FAERS: 1 | US FAERS | |
| 314 | Eyelid Function Disorder | FAERS: 1 | US FAERS | |
| 315 | Familial Periodic Paralysis | FAERS: 1 | US FAERS | |
| 316 | Febrile infection | FAERS: 1 | US FAERS | |
| 317 | Feeling Cold | FAERS: 1 | OFFSIDES US FAERS | |
| 318 | Feeling jittery | FAERS: 1 | US FAERS | |
| 319 | Female Orgasmic Disorder | FAERS: 1 | US FAERS | |
| 320 | Fine motor delay | FAERS: 1 | US FAERS | |
| 321 | Gait inability | FAERS: 1 | US FAERS | |
| 322 | Gastric Bypass | FAERS: 1 | US FAERS | |
| 323 | Gastric infection | FAERS: 1 | US FAERS | |
| 324 | Gastritis | FAERS: 1 | US FAERS | |
| 325 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 326 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 327 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 328 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 329 | Gastrostomy tube site complication | FAERS: 1 | US FAERS | |
| 330 | Gaze palsy | FAERS: 1 | US FAERS | |
| 331 | Genital Herpes | FAERS: 1 | US FAERS | |
| 332 | Gingival Recession | FAERS: 1 | US FAERS | |
| 333 | Gingivitis | FAERS: 1 | US FAERS | |
| 334 | Granuloma | FAERS: 1 | US FAERS | |
| 335 | Hallucinations, mixed | FAERS: 1 | US FAERS | |
| 336 | Head discomfort | FAERS: 1 | US FAERS | |
| 337 | Head titubation | FAERS: 1 | US FAERS | |
| 338 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 339 | Hip surgery | FAERS: 1 | US FAERS | |
| 340 | Hippocampal sclerosis | FAERS: 1 | US FAERS | |
| 341 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 342 | Hyperacusis | FAERS: 1 | US FAERS | |
| 343 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 344 | Hyperreflexia | FAERS: 1 | US FAERS | |
| 345 | Immature respiratory system | FAERS: 1 | US FAERS | |
| 346 | Immobile | FAERS: 1 | US FAERS | |
| 347 | Inadequate aseptic technique in use of product | FAERS: 1 | US FAERS | |
| 348 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 349 | Incontinence | FAERS: 1 | US FAERS | |
| 350 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 351 | Infarction | FAERS: 1 | US FAERS | |
| 352 | Initial insomnia | FAERS: 1 | US FAERS | |
| 353 | Injection site erythema | FAERS: 1 | US FAERS | |
| 354 | Injection site irritation | FAERS: 1 | US FAERS | |
| 355 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 356 | Intercepted product dispensing error | FAERS: 1 | US FAERS | |
| 357 | Intervertebral disc disorder | FAERS: 1 | US FAERS | |
| 358 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 359 | Joint stiffness | FAERS: 1 | US FAERS | |
| 360 | Juvenile Myoclonic Epilepsy | FAERS: 1 | US FAERS | |
| 361 | Klebsiella test positive | FAERS: 1 | US FAERS | |
| 362 | Lacrimation decreased | FAERS: 1 | US FAERS | |
| 363 | Leukocytosis | FAERS: 1 | US FAERS | |
| 364 | Libido disorder | FAERS: 1 | US FAERS | |
| 365 | Limbic Encephalitis | FAERS: 1 | US FAERS | |
| 366 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 367 | Live Birth | FAERS: 1 | US FAERS | |
| 368 | Low birth weight baby | FAERS: 1 | US FAERS | |
| 369 | Lymphoma | FAERS: 1 | US FAERS | |
| 370 | Maternal exposure before pregnancy | FAERS: 1 | US FAERS | |
| 371 | Medical device change | FAERS: 1 | US FAERS | |
| 372 | Meningioma surgery | FAERS: 1 | US FAERS | |
| 373 | Meningitis | FAERS: 1 | US FAERS | |
| 374 | Menorrhagia | FAERS: 1 | US FAERS | |
| 375 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 376 | Micturition frequency decreased | FAERS: 1 | US FAERS | |
| 377 | Middle insomnia | FAERS: 1 | OFFSIDES US FAERS | |
| 378 | Morbid thoughts | FAERS: 1 | US FAERS | |
| 379 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 380 | Muscle Spasticity | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 381 | Nerve injury | FAERS: 1 | US FAERS | |
| 382 | Neuralgia | FAERS: 1 | US FAERS | |
| 383 | Nocturia | FAERS: 1 | US FAERS | |
| 384 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 385 | Obsessive thoughts | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 386 | Organic brain syndrome | FAERS: 1 | US FAERS | |
| 387 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 388 | Osteogenesis Imperfecta | FAERS: 1 | US FAERS | |
| 389 | Osteoporosis | FAERS: 1 | US FAERS | |
| 390 | Overweight | FAERS: 1 | US FAERS | |
| 391 | Oxygen consumption decreased | FAERS: 1 | US FAERS | |
| 392 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 393 | Pathogen resistance | FAERS: 1 | US FAERS | |
| 394 | Peritonitis | FAERS: 1 | US FAERS | |
| 395 | Pneumothorax | FAERS: 1 | US FAERS | |
| 396 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 397 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 398 | Pregnancy test false positive | FAERS: 1 | US FAERS | |
| 399 | Pregnancy with contraceptive device | FAERS: 1 | US FAERS | |
| 400 | Priapism | FAERS: 1 | US FAERS | |
| 401 | Procedural complication | FAERS: 1 | US FAERS | |
| 402 | Product container issue | FAERS: 1 | US FAERS | |
| 403 | Product dispensing error | FAERS: 1 | US FAERS | |
| 404 | Product formulation issue | FAERS: 1 | US FAERS | |
| 405 | Product packaging issue | FAERS: 1 | US FAERS | |
| 406 | Product preparation error | FAERS: 1 | US FAERS | |
| 407 | Pseudocyst | FAERS: 1 | US FAERS | |
| 408 | Psychogenic seizure | FAERS: 1 | US FAERS | |
| 409 | Psychotic disorder due to a general medical condition | FAERS: 1 | US FAERS | |
| 410 | Pulmonary malformation | FAERS: 1 | US FAERS | |
| 411 | Pyelocaliectasis | FAERS: 1 | US FAERS | |
| 412 | Rash erythematous | FAERS: 1 | US FAERS | |
| 413 | Renal tubular necrosis | FAERS: 1 | US FAERS | |
| 414 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 415 | Retching | FAERS: 1 | US FAERS | |
| 416 | Screaming | FAERS: 1 | US FAERS | |
| 417 | Shock | FAERS: 1 | SIDER US FAERS | |
| 418 | Shunt malfunction | FAERS: 1 | US FAERS | |
| 419 | Sick Sinus Syndrome | FAERS: 1 | US FAERS | |
| 420 | Simple Partial Seizures | FAERS: 1 | US FAERS | |
| 421 | Sinus Arrhythmia | FAERS: 1 | US FAERS | |
| 422 | Sinus headache | FAERS: 1 | US FAERS | |
| 423 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 424 | Skin lesion | FAERS: 1 | US FAERS | |
| 425 | Sluggishness | FAERS: 1 | US FAERS | |
| 426 | Somatoform Disorder | FAERS: 1 | US FAERS | |
| 427 | Stomatitis | FAERS: 1 | US FAERS | |
| 428 | Stroke in evolution | FAERS: 1 | US FAERS | |
| 429 | Sudden onset of sleep | FAERS: 1 | US FAERS | |
| 430 | Swelling | FAERS: 1 | US FAERS | |
| 431 | Systolic dysfunction | FAERS: 1 | US FAERS | |
| 432 | Tachyphrenia | FAERS: 1 | US FAERS | |
| 433 | Tension | FAERS: 1 | US FAERS | |
| 434 | Thirst | FAERS: 1 | US FAERS | |
| 435 | Thrombosis | FAERS: 1 | US FAERS | |
| 436 | Tongue biting | FAERS: 1 | US FAERS | |
| 437 | Tonic clonic movements | FAERS: 1 | US FAERS | |
| 438 | Tooth Extraction | FAERS: 1 | US FAERS | |
| 439 | Tooth Loss | FAERS: 1 | US FAERS | |
| 440 | Toothache | FAERS: 1 | US FAERS | |
| 441 | Transcription medication error | FAERS: 1 | US FAERS | |
| 442 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 443 | Unmasking of previously unidentified disease | FAERS: 1 | US FAERS | |
| 444 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 445 | Vagal nerve stimulator implantation | FAERS: 1 | US FAERS | |
| 446 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 447 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 448 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 449 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 450 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 451 | intensive care | FAERS: 1 | US FAERS | |
| 452 | nervous system disorder | FAERS: 1 | SIDER US FAERS | |
| 453 | Anticonvulsant drug level | OFFSIDES | ||
| 454 | Anticonvulsant drug level abnormal | OFFSIDES | ||
| 455 | Bacterial test positive | OFFSIDES | ||
| 456 | Band neutrophil percentage increased | OFFSIDES | ||
| 457 | Blood Glucose | OFFSIDES | ||
| 458 | Blood and lymphatic system disorders | SIDER | ||
| 459 | Blood cholesterol increased | Canada Vigilance: 1 | Canada Vigilance | |
| 460 | Blood count abnormal | OFFSIDES | ||
| 461 | Blood urea increased | OFFSIDES | ||
| 462 | Blurred vision | OFFSIDES | ||
| 463 | Brain Concussion | OFFSIDES | ||
| 464 | Deja Vu | OFFSIDES | ||
| 465 | Depression suicidal | OFFSIDES | ||
| 466 | Dermatitis | SIDER | ||
| 467 | Diastolic dysfunction | OFFSIDES | ||
| 468 | Dysthymic Disorder | OFFSIDES | ||
| 469 | Ear and labyrinth disorders | SIDER | ||
| 470 | Encephalomalacia | OFFSIDES | ||
| 471 | Eosinophilia | SIDER | ||
| 472 | Euphoric mood | SIDER | ||
| 473 | Food craving | OFFSIDES | ||
| 474 | Hypervigilance | OFFSIDES | ||
| 475 | Incoherent | OFFSIDES | ||
| 476 | Injection site pain | SIDER | ||
| 477 | Labyrinthine disorder | SIDER | ||
| 478 | Mitral valve sclerosis | OFFSIDES | ||
| 479 | Moaning | OFFSIDES | ||
| 480 | Nephritis | SIDER | ||
| 481 | Nipple pain | OFFSIDES | ||
| 482 | Ocular icterus | OFFSIDES | ||
| 483 | Optic Neuropathy | OFFSIDES | ||
| 484 | Pregnancy on contraceptive | OFFSIDES | ||
| 485 | Product substitution issue | Canada Vigilance: 3 | Canada Vigilance | |
| 486 | Protein urine present | SIDER | ||
| 487 | Proteinuria | SIDER | ||
| 488 | Snoring | OFFSIDES | ||
| 489 | Traumatic fracture | OFFSIDES | ||
| 490 | Urinary sediment present | OFFSIDES | ||
| 491 | Vascular insufficiency | OFFSIDES | ||
| 492 | Weight Gain | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.