Enalapril
(OYFJQPXVCSSHAI-QFPUQLAESA-N)
Structure
- SMILES
- OC(=O)/C=C\C(=O)O.CCOC(=O)[C@@H](N[C@H](C(=O)N1CCC[C@H]1C(=O)O)C)CCc1ccccc1
- Molecular Formula:
- C24H32N2O9
- Molecular Weight:
- 492.519
- Log P:
- 1.6452
- Hydrogen Bond Acceptor:
- 11
- Hydrogen Bond Donor:
- 4
- TPSA:
- 170.54
- CAS Number(s):
- 76095-16-4
Synonym(s)
1.
Enalapril
2.
Enalapril Maleate
3.
MK-421
4.
MK421
5.
Renitec
6.
Renitek
7.
MK 421
8.
Maleate, Enalapril
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Angioedema | FAERS: 80 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 2 | Dizziness | FAERS: 35 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 3 | Drug ineffective | FAERS: 29 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 4 | Headache | FAERS: 29 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 5 | Pharmaceutical product complaint | FAERS: 26 | US FAERS | |
| 6 | Blood pressure inadequately controlled | FAERS: 18 | US FAERS | |
| 7 | Drug exposure during pregnancy | FAERS: 18 | US FAERS | |
| 8 | Nausea | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 9 | Product substitution issue | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 10 | Chest Pain | FAERS: 15 | US FAERS | |
| 11 | Hypersensitivity | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 12 | Hypotension | FAERS: 14 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 13 | Therapeutic response unexpected with drug substitution | FAERS: 13 | US FAERS | |
| 14 | Asthenia | FAERS: 12 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 15 | Lip swelling | FAERS: 11 | US FAERS | |
| 16 | Pruritus | FAERS: 10 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 17 | Respiratory Failure | FAERS: 10 | US FAERS | |
| 18 | Syncope | FAERS: 9 | US FAERS | |
| 19 | Malaise | FAERS: 8 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 20 | Urticaria | FAERS: 8 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 21 | Vomiting | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 22 | Alanine Aminotransferase Increased | FAERS: 7 | US FAERS | |
| 23 | Aspartate Aminotransferase Increased | FAERS: 7 | US FAERS | |
| 24 | Blood pressure fluctuation | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 25 | Dysphonia | FAERS: 7 | US FAERS | |
| 26 | Fatigue | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 27 | Pancytopenia | FAERS: 7 | US FAERS | |
| 28 | Product quality issue | FAERS: 7 | US FAERS | |
| 29 | Cerebrovascular accident | FAERS: 6 | US FAERS | |
| 30 | Feeling abnormal | FAERS: 6 | US FAERS | |
| 31 | Flushing | FAERS: 6 | US FAERS | |
| 32 | Hypertensive crisis | FAERS: 6 | US FAERS | |
| 33 | Pain | FAERS: 6 | US FAERS | |
| 34 | Pneumonia | FAERS: 6 | US FAERS | |
| 35 | Weight decreased | FAERS: 6 | US FAERS | |
| 36 | Blood potassium increased | FAERS: 5 | US FAERS | |
| 37 | Cardiac Arrest | FAERS: 5 | US FAERS | |
| 38 | Chest discomfort | FAERS: 5 | US FAERS | |
| 39 | Drug dispensing error | FAERS: 5 | US FAERS | |
| 40 | Incorrect dose administered | FAERS: 5 | US FAERS | |
| 41 | Palpitations | FAERS: 5 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 42 | Somnolence | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 43 | Suicide attempt | FAERS: 5 | US FAERS | |
| 44 | Tremor | FAERS: 5 | US FAERS | |
| 45 | Abdominal Pain | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 46 | Abdominal discomfort | FAERS: 4 | US FAERS | |
| 47 | Angiotensin converting enzyme inhibitor foetopathy | FAERS: 4 | US FAERS | |
| 48 | Anuria | FAERS: 4 | US FAERS | |
| 49 | Arthralgia | FAERS: 4 | US FAERS | |
| 50 | Asphyxia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 51 | Blood glucose increased | FAERS: 4 | US FAERS | |
| 52 | Bronchitis | FAERS: 4 | US FAERS | |
| 53 | Burning sensation | FAERS: 4 | US FAERS | |
| 54 | Discomfort | FAERS: 4 | US FAERS | |
| 55 | Drug toxicity | FAERS: 4 | US FAERS | |
| 56 | Dysmorphism | FAERS: 4 | US FAERS | |
| 57 | Gastritis | FAERS: 4 | US FAERS | |
| 58 | Hepatotoxicity | FAERS: 4 | US FAERS | |
| 59 | Medication Error | FAERS: 4 | US FAERS | |
| 60 | Musculoskeletal stiffness | FAERS: 4 | US FAERS | |
| 61 | Myocardial Infarction | FAERS: 4 | US FAERS | |
| 62 | Neck Pain | FAERS: 4 | US FAERS | |
| 63 | Presyncope | FAERS: 4 | US FAERS | |
| 64 | Swelling | FAERS: 4 | US FAERS | |
| 65 | Tinnitus | FAERS: 4 | US FAERS | |
| 66 | Accidental drug intake by child | FAERS: 3 | US FAERS | |
| 67 | Accidental overdose | FAERS: 3 | US FAERS | |
| 68 | Alopecia | FAERS: 3 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 69 | Amnesia | FAERS: 3 | US FAERS | |
| 70 | Anaphylactic shock | FAERS: 3 | US FAERS | |
| 71 | Anxiety | FAERS: 3 | US FAERS | |
| 72 | Aortic Valve Stenosis | FAERS: 3 | US FAERS | |
| 73 | Aphasia | FAERS: 3 | US FAERS | |
| 74 | Arthritis | FAERS: 3 | US FAERS | |
| 75 | Blood creatinine increased | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 76 | Blood lactate dehydrogenase increased | FAERS: 3 | US FAERS | |
| 77 | Dysgeusia | FAERS: 3 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 78 | Dyspepsia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 79 | Expired product administered | FAERS: 3 | US FAERS | |
| 80 | Eye irritation | FAERS: 3 | US FAERS | |
| 81 | Gamma-Glutamyltransferase Increased | FAERS: 3 | US FAERS | |
| 82 | Hepatic necrosis | FAERS: 3 | US FAERS | |
| 83 | Inflammation | FAERS: 3 | US FAERS | |
| 84 | Intestinal Obstruction | FAERS: 3 | US FAERS | |
| 85 | Medication residue | FAERS: 3 | US FAERS | |
| 86 | Neonatal anuria | FAERS: 3 | US FAERS | |
| 87 | Nephrotic Syndrome | FAERS: 3 | US FAERS | |
| 88 | Nervousness | FAERS: 3 | US FAERS | |
| 89 | No adverse effect | FAERS: 3 | US FAERS | |
| 90 | Oligohydramnios | FAERS: 3 | US FAERS | |
| 91 | Overdose | FAERS: 3 | US FAERS | |
| 92 | Pancreatitis | FAERS: 3 | US FAERS | |
| 93 | Paresis | FAERS: 3 | US FAERS | |
| 94 | Peritoneal Dialysis | FAERS: 3 | US FAERS | |
| 95 | Pharyngolaryngeal Pain | FAERS: 3 | US FAERS | |
| 96 | Pneumothorax | FAERS: 3 | US FAERS | |
| 97 | Pregnancy | FAERS: 3 | US FAERS | |
| 98 | Pseudolymphoma | FAERS: 3 | US FAERS | |
| 99 | Pulmonary malformation | FAERS: 3 | US FAERS | |
| 100 | Rash erythematous | FAERS: 3 | US FAERS | |
| 101 | Renal failure neonatal | FAERS: 3 | US FAERS | |
| 102 | Renal tubular disorder | FAERS: 3 | US FAERS | |
| 103 | Respiratory distress | FAERS: 3 | US FAERS | |
| 104 | Sinus headache | FAERS: 3 | US FAERS | |
| 105 | Tachycardia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 106 | Talipes | FAERS: 3 | US FAERS | |
| 107 | Therapy non-responder | FAERS: 3 | US FAERS | |
| 108 | Unevaluable event | FAERS: 3 | US FAERS | |
| 109 | Abdominal Infection | FAERS: 2 | US FAERS | |
| 110 | Ageusia | FAERS: 2 | US FAERS | |
| 111 | Agitation | FAERS: 2 | US FAERS | |
| 112 | Anaphylactoid Reaction | FAERS: 2 | US FAERS | |
| 113 | Anger | FAERS: 2 | US FAERS | |
| 114 | Anoxic Encephalopathy | FAERS: 2 | US FAERS | |
| 115 | Aphagia | FAERS: 2 | US FAERS | |
| 116 | Arthropod bite | FAERS: 2 | US FAERS | |
| 117 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 118 | Back Pain | FAERS: 2 | US FAERS | |
| 119 | Bilirubinuria | FAERS: 2 | US FAERS | |
| 120 | Blood erythropoietin decreased | FAERS: 2 | US FAERS | |
| 121 | Chills | FAERS: 2 | US FAERS | |
| 122 | Choking | FAERS: 2 | US FAERS | |
| 123 | Cholelithiasis | FAERS: 2 | US FAERS | |
| 124 | Chromaturia | FAERS: 2 | US FAERS | |
| 125 | Crying | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 126 | Cystitis | FAERS: 2 | US FAERS | |
| 127 | Deafness | FAERS: 2 | US FAERS | |
| 128 | Dehydration | FAERS: 2 | US FAERS | |
| 129 | Depressed Level of Consciousness | FAERS: 2 | US FAERS | |
| 130 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 131 | Disease recurrence | FAERS: 2 | US FAERS | |
| 132 | Diverticulitis | FAERS: 2 | US FAERS | |
| 133 | Duodenitis | FAERS: 2 | US FAERS | |
| 134 | Dysarthria | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 135 | Emotional disorder | FAERS: 2 | US FAERS | |
| 136 | Erythema | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 137 | Erythrodermic psoriasis | FAERS: 2 | US FAERS | |
| 138 | Exfoliative rash | FAERS: 2 | US FAERS | |
| 139 | Eye pain | FAERS: 2 | US FAERS | |
| 140 | Feeling Cold | FAERS: 2 | US FAERS | |
| 141 | Formication | FAERS: 2 | US FAERS | |
| 142 | Gastroenteritis | FAERS: 2 | US FAERS | |
| 143 | General physical health deterioration | FAERS: 2 | US FAERS | |
| 144 | Gluten sensitivity | FAERS: 2 | US FAERS | |
| 145 | Hypoxia | FAERS: 2 | US FAERS | |
| 146 | Idiosyncratic drug reaction | FAERS: 2 | US FAERS | |
| 147 | Increased upper airway secretion | FAERS: 2 | US FAERS | |
| 148 | Intermittent Claudication | FAERS: 2 | US FAERS | |
| 149 | Lipoma | FAERS: 2 | US FAERS | |
| 150 | Memory impairment | FAERS: 2 | US FAERS | |
| 151 | Monoparesis | FAERS: 2 | US FAERS | |
| 152 | Night sweats | FAERS: 2 | US FAERS | |
| 153 | Post procedural complication | FAERS: 2 | US FAERS | |
| 154 | Productive Cough | FAERS: 2 | US FAERS | |
| 155 | Proteinuria | FAERS: 2 | US FAERS | |
| 156 | Reaction to drug excipients | FAERS: 2 | US FAERS | |
| 157 | Renal Artery Stenosis | FAERS: 2 | US FAERS | |
| 158 | Restlessness | FAERS: 2 | US FAERS | |
| 159 | Shoulder Pain | FAERS: 2 | US FAERS | |
| 160 | Sluggishness | FAERS: 2 | US FAERS | |
| 161 | Small bowel angioedema | FAERS: 2 | US FAERS | |
| 162 | Sudden death | FAERS: 2 | US FAERS | |
| 163 | Tension | FAERS: 2 | US FAERS | |
| 164 | Throat irritation | FAERS: 2 | US FAERS | |
| 165 | Upper airway obstruction | FAERS: 2 | US FAERS | |
| 166 | Vertigo | FAERS: 2 | US FAERS | |
| 167 | Wheezing | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 168 | Wolff-Parkinson-White Syndrome | FAERS: 2 | US FAERS | |
| 169 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 170 | nervous system disorder | FAERS: 2 | US FAERS | |
| 171 | Abortion late | FAERS: 1 | US FAERS | |
| 172 | Accidental exposure | FAERS: 1 | US FAERS | |
| 173 | Acne | FAERS: 1 | US FAERS | |
| 174 | Actinic keratosis | FAERS: 1 | US FAERS | |
| 175 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 176 | Adverse event | FAERS: 1 | US FAERS | |
| 177 | Agranulocytosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 178 | Alkalosis | FAERS: 1 | US FAERS | |
| 179 | Allergic cough | FAERS: 1 | US FAERS | |
| 180 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 181 | Anorexia | FAERS: 1 | US FAERS | |
| 182 | Arteritis | FAERS: 1 | US FAERS | |
| 183 | Atelectasis | FAERS: 1 | US FAERS | |
| 184 | Autoimmune Pancreatitis | FAERS: 1 | US FAERS | |
| 185 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 186 | Autoimmune thyroiditis | FAERS: 1 | US FAERS | |
| 187 | Basal cell carcinoma | FAERS: 1 | US FAERS | |
| 188 | Biopsy kidney abnormal | FAERS: 1 | US FAERS | |
| 189 | Blindness | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 190 | Blood chloride decreased | FAERS: 1 | US FAERS | |
| 191 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 192 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 193 | Blood creatinine decreased | FAERS: 1 | US FAERS | |
| 194 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 195 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 196 | Blood phosphorus decreased | FAERS: 1 | US FAERS | |
| 197 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 198 | Blood urea increased | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 199 | Bone Tuberculosis | FAERS: 1 | US FAERS | |
| 200 | Bone marrow depression | FAERS: 1 | US FAERS | |
| 201 | Bradycardia | FAERS: 1 | US FAERS | |
| 202 | Brain Hypoxia | FAERS: 1 | US FAERS | |
| 203 | Bronchial Hyperreactivity | FAERS: 1 | US FAERS | |
| 204 | Bronchospasm | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 205 | Carcinoma in situ of skin | FAERS: 1 | US FAERS | |
| 206 | Cardiac dysfunction | FAERS: 1 | US FAERS | |
| 207 | Cardiac imaging procedure abnormal | FAERS: 1 | US FAERS | |
| 208 | Cataract | FAERS: 1 | US FAERS | |
| 209 | Cauda Equina Syndrome | FAERS: 1 | US FAERS | |
| 210 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 211 | Cholestasis | FAERS: 1 | US FAERS | |
| 212 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 213 | Coagulation factor XII level increased | FAERS: 1 | US FAERS | |
| 214 | Colitis | FAERS: 1 | US FAERS | |
| 215 | Congenital Hypothyroidism | FAERS: 1 | US FAERS | |
| 216 | Congenital anomaly in offspring | FAERS: 1 | US FAERS | |
| 217 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 218 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 219 | Delirium | FAERS: 1 | US FAERS | |
| 220 | Developmental regression | FAERS: 1 | US FAERS | |
| 221 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 222 | Diaphragmatic Hernia | FAERS: 1 | US FAERS | |
| 223 | Difficult to wean from ventilator | FAERS: 1 | US FAERS | |
| 224 | Disorientation | FAERS: 1 | US FAERS | |
| 225 | Drug administration error | FAERS: 1 | US FAERS | |
| 226 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 227 | Eosinophilia | FAERS: 1 | US FAERS | |
| 228 | Erectile dysfunction | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 229 | Eructation | FAERS: 1 | US FAERS | |
| 230 | Facial Paresis | FAERS: 1 | US FAERS | |
| 231 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 232 | Gout | FAERS: 1 | US FAERS | |
| 233 | Hemiparesis | FAERS: 1 | US FAERS | |
| 234 | Hepatitis | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 235 | Hoarseness | FAERS: 1 | US FAERS | |
| 236 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 237 | Hypersomnia | FAERS: 1 | US FAERS | |
| 238 | Hypocalvaria | FAERS: 1 | US FAERS | |
| 239 | Hypohidrosis | FAERS: 1 | US FAERS | |
| 240 | Hypoperfusion | FAERS: 1 | US FAERS | |
| 241 | Hypopituitarism | FAERS: 1 | US FAERS | |
| 242 | Ileus | FAERS: 1 | US FAERS | |
| 243 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 244 | Impaired work ability | FAERS: 1 | US FAERS | |
| 245 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 246 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 247 | Infection | FAERS: 1 | US FAERS | |
| 248 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 249 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 250 | Joint swelling | FAERS: 1 | US FAERS | |
| 251 | Laboratory test interference | FAERS: 1 | US FAERS | |
| 252 | Lactose Intolerance | FAERS: 1 | US FAERS | |
| 253 | Laryngospasm | FAERS: 1 | US FAERS | |
| 254 | Lethargy | FAERS: 1 | US FAERS | |
| 255 | Leukocytosis | FAERS: 1 | US FAERS | |
| 256 | Low birth weight baby | FAERS: 1 | US FAERS | |
| 257 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 258 | Malabsorption | FAERS: 1 | US FAERS | |
| 259 | Manufacturing issue | FAERS: 1 | US FAERS | |
| 260 | Markedly reduced dietary intake | FAERS: 1 | US FAERS | |
| 261 | Medication residue present | FAERS: 1 | US FAERS | |
| 262 | Mental impairment | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 263 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 264 | Middle insomnia | FAERS: 1 | US FAERS | |
| 265 | Mononeuropathy Multiplex | FAERS: 1 | US FAERS | |
| 266 | Muscle strain | FAERS: 1 | US FAERS | |
| 267 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 268 | Mycosis Fungoides | FAERS: 1 | US FAERS | |
| 269 | Myoglobin blood increased | FAERS: 1 | US FAERS | |
| 270 | Myositis | FAERS: 1 | US FAERS | |
| 271 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 272 | Neonatal disorder | FAERS: 1 | US FAERS | |
| 273 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 274 | Neuralgia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 275 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 276 | No adverse event | FAERS: 1 | US FAERS | |
| 277 | Obesity | FAERS: 1 | US FAERS | |
| 278 | Oculomucocutaneous syndrome | FAERS: 1 | US FAERS | |
| 279 | Optic Nerve Hypoplasia | FAERS: 1 | US FAERS | |
| 280 | Osteomalacia | FAERS: 1 | US FAERS | |
| 281 | Osteoporosis | FAERS: 1 | US FAERS | |
| 282 | Pancreatic Pseudocyst | FAERS: 1 | US FAERS | |
| 283 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 284 | Parakeratosis | FAERS: 1 | US FAERS | |
| 285 | Parotitis | FAERS: 1 | US FAERS | |
| 286 | Patent ductus arteriosus | FAERS: 1 | US FAERS | |
| 287 | Pelvic venous thrombosis | FAERS: 1 | US FAERS | |
| 288 | Penile swelling | FAERS: 1 | US FAERS | |
| 289 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 290 | Pericarditis lupus | FAERS: 1 | US FAERS | |
| 291 | Pericarditis | FAERS: 1 | US FAERS | |
| 292 | Perivascular dermatitis | FAERS: 1 | US FAERS | |
| 293 | Pharmaceutical product counterfeit | FAERS: 1 | US FAERS | |
| 294 | Pityriasis Rosea | FAERS: 1 | US FAERS | |
| 295 | Pleurisy | FAERS: 1 | US FAERS | |
| 296 | Polymyalgia Rheumatica | FAERS: 1 | US FAERS | |
| 297 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 298 | Pre-Eclampsia | FAERS: 1 | US FAERS | |
| 299 | Product complaint | FAERS: 1 | US FAERS | |
| 300 | Product formulation issue | FAERS: 1 | US FAERS | |
| 301 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 302 | Protein urine present | FAERS: 1 | US FAERS | |
| 303 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 304 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 305 | Quadriplegia | FAERS: 1 | US FAERS | |
| 306 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 307 | Rash papulosquamous | FAERS: 1 | US FAERS | |
| 308 | Renal dysplasia | FAERS: 1 | US FAERS | |
| 309 | Renal pain | FAERS: 1 | US FAERS | |
| 310 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 311 | Retching | FAERS: 1 | US FAERS | |
| 312 | Rhabdomyolysis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 313 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 314 | Scab | FAERS: 1 | US FAERS | |
| 315 | Schizoaffective Disorder | FAERS: 1 | US FAERS | |
| 316 | Sepsis | FAERS: 1 | US FAERS | |
| 317 | Septo-Optic Dysplasia | FAERS: 1 | US FAERS | |
| 318 | Shock | FAERS: 1 | US FAERS | |
| 319 | Similar reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 320 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 321 | Sinusitis | FAERS: 1 | US FAERS | |
| 322 | Skin nodule | FAERS: 1 | US FAERS | |
| 323 | Sleep study abnormal | FAERS: 1 | US FAERS | |
| 324 | Snoring | FAERS: 1 | US FAERS | |
| 325 | Soft tissue inflammation | FAERS: 1 | US FAERS | |
| 326 | Starvation | FAERS: 1 | US FAERS | |
| 327 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 328 | Strabismus | FAERS: 1 | US FAERS | |
| 329 | Stress | FAERS: 1 | US FAERS | |
| 330 | Stupor | FAERS: 1 | US FAERS | |
| 331 | Thirst | FAERS: 1 | US FAERS | |
| 332 | Thrombotic stroke | FAERS: 1 | US FAERS | |
| 333 | Tongue biting | FAERS: 1 | US FAERS | |
| 334 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 335 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 336 | Transcription medication error | FAERS: 1 | US FAERS | |
| 337 | Troponin increased | FAERS: 1 | US FAERS | |
| 338 | Tuberculosis | FAERS: 1 | US FAERS | |
| 339 | Unequal Limb Length | FAERS: 1 | US FAERS | |
| 340 | Upper respiratory tract inflammation | FAERS: 1 | US FAERS | |
| 341 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 342 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 343 | Urine output increased | FAERS: 1 | US FAERS | |
| 344 | Vanishing bile duct syndrome | FAERS: 1 | US FAERS | |
| 345 | Venous Insufficiency | FAERS: 1 | US FAERS | |
| 346 | Viral myocarditis | FAERS: 1 | US FAERS | |
| 347 | Visual acuity reduced transiently | FAERS: 1 | US FAERS | |
| 348 | Visual disturbance | FAERS: 1 | US FAERS | |
| 349 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 350 | jaundice | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 351 | Acute kidney injury | Canada Vigilance: 1 | Canada Vigilance | |
| 352 | Amylase increased | Canada Vigilance: 1 | Canada Vigilance | |
| 353 | Anosmia | Canada Vigilance: 1 | Canada Vigilance | |
| 354 | Ataxia | Canada Vigilance: 1 | Canada Vigilance | |
| 355 | Dry skin | Canada Vigilance: 1 | Canada Vigilance | |
| 356 | Epigastric discomfort | Canada Vigilance: 1 | Canada Vigilance | |
| 357 | Erythema Multiforme | Canada Vigilance: 2 | Canada Vigilance | |
| 358 | Petechiae | Canada Vigilance: 1 | Canada Vigilance | |
| 359 | Pharyngeal swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 360 | Purpura | Canada Vigilance: 2 | Canada Vigilance | |
| 361 | Visual Impairment | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.