dorzolamide
(OSRUSFPMRGDLAG-QMGYSKNISA-N)
Structure
- SMILES
- CCN[C@H]1C[C@H](C)S(=O)(=O)c2c1cc(s2)S(=O)(=O)N.Cl
- Molecular Formula:
- C10H17ClN2O4S3
- Molecular Weight:
- 360.901
- Log P:
- 4.6668
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 3
- TPSA:
- 151.33
- CAS Number(s):
- 130693-82-2
Synonym(s)
1.
dorzolamide
2.
4-ethylamino-5,6-dihydro-6-methyl-7,7-dioxide-4H-thieno(2,3-b)thiopyran-2-sulfonamide
3.
5,6-dihydro-4-ethylamino-6-methyl-4H-thieno(2,3-b)thiopyran-2-sulfonamide-7,7-dioxide
4.
Dorzolamide Chibret
5.
L 671152
6.
L-671,152
7.
MK 507
8.
MK-507
9.
Trusopt
10.
dorzolamide hydrochloride
11.
dorzolamide, (trans)-isomer
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Eye irritation | FAERS: 119 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Eye pain | FAERS: 62 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 3 | Drug ineffective | FAERS: 61 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 4 | Product quality issue | FAERS: 54 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 5 | Drug dose omission | FAERS: 38 | US FAERS | |
| 6 | No adverse event | FAERS: 37 | US FAERS | |
| 7 | Dizziness | FAERS: 19 | US FAERS | |
| 8 | Hypersensitivity | FAERS: 19 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 9 | Blindness | FAERS: 18 | US FAERS | |
| 10 | Cataract | FAERS: 18 | US FAERS | |
| 11 | Bradycardia | FAERS: 17 | US FAERS | |
| 12 | Headache | FAERS: 17 | US FAERS | |
| 13 | Visual Impairment | FAERS: 17 | US FAERS | |
| 14 | Burning sensation | FAERS: 15 | US FAERS | |
| 15 | Glaucoma | FAERS: 15 | US FAERS | |
| 16 | Syncope | FAERS: 15 | US FAERS | |
| 17 | Adverse event | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 18 | Dysgeusia | FAERS: 13 | US FAERS | |
| 19 | Erythema | FAERS: 13 | US FAERS | |
| 20 | Incorrect dose administered | FAERS: 12 | US FAERS | |
| 21 | Fatigue | FAERS: 11 | US FAERS | |
| 22 | Overdose | FAERS: 11 | US FAERS | |
| 23 | Product substitution issue | FAERS: 10 | US FAERS | |
| 24 | Pruritus | FAERS: 10 | US FAERS | |
| 25 | Inappropriate schedule of drug administration | FAERS: 9 | US FAERS | |
| 26 | Incorrect product storage | FAERS: 9 | US FAERS | |
| 27 | Product container issue | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Cataract operation | FAERS: 8 | US FAERS | |
| 29 | Eye Infection | FAERS: 8 | US FAERS | |
| 30 | Feeling abnormal | FAERS: 8 | US FAERS | |
| 31 | Foreign body sensation in eyes | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 32 | Hypotension | FAERS: 8 | US FAERS | |
| 33 | Myocardial Infarction | FAERS: 8 | US FAERS | |
| 34 | Photophobia | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 35 | Product dropper issue | FAERS: 8 | US FAERS | |
| 36 | Asthenia | FAERS: 7 | US FAERS | |
| 37 | Eyelid margin crusting | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 38 | Glaucoma surgery | FAERS: 7 | US FAERS | |
| 39 | Nausea | FAERS: 7 | US FAERS | |
| 40 | Pain | FAERS: 7 | US FAERS | |
| 41 | Reaction to preservatives | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 42 | Eye Burns | FAERS: 6 | US FAERS | |
| 43 | Intraocular pressure test abnormal | FAERS: 6 | US FAERS | |
| 44 | Ocular discomfort | FAERS: 6 | US FAERS | |
| 45 | Product packaging quantity issue | FAERS: 6 | US FAERS | |
| 46 | Weight decreased | FAERS: 6 | US FAERS | |
| 47 | Diabetes Mellitus | FAERS: 5 | US FAERS | |
| 48 | Eye allergy | FAERS: 5 | US FAERS | |
| 49 | Hypertensive crisis | FAERS: 5 | US FAERS | |
| 50 | Liquid product physical issue | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 51 | Malaise | FAERS: 5 | US FAERS | |
| 52 | Product use issue | FAERS: 5 | US FAERS | |
| 53 | treatment failure | FAERS: 5 | US FAERS | |
| 54 | Abdominal Pain | FAERS: 4 | US FAERS | |
| 55 | Accidental exposure to product | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 56 | Anxiety | FAERS: 4 | US FAERS | |
| 57 | Asthma | FAERS: 4 | US FAERS | |
| 58 | Blepharitis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 59 | Cerebrovascular accident | FAERS: 4 | US FAERS | |
| 60 | Chest discomfort | FAERS: 4 | US FAERS | |
| 61 | Contraindicated product administered | FAERS: 4 | US FAERS | |
| 62 | Epistaxis | FAERS: 4 | US FAERS | |
| 63 | Eyelid irritation | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 64 | Medication Error | FAERS: 4 | US FAERS | |
| 65 | Respiratory Failure | FAERS: 4 | US FAERS | |
| 66 | Screaming | FAERS: 4 | US FAERS | |
| 67 | Tachycardia | FAERS: 4 | US FAERS | |
| 68 | Toxic Epidermal Necrolysis | FAERS: 4 | US FAERS | |
| 69 | Vomiting | FAERS: 4 | US FAERS | |
| 70 | Alopecia | FAERS: 3 | US FAERS | |
| 71 | Anosmia | FAERS: 3 | US FAERS | |
| 72 | Application site irritation | FAERS: 3 | US FAERS | |
| 73 | Arthralgia | FAERS: 3 | US FAERS | |
| 74 | Atrial Fibrillation | FAERS: 3 | US FAERS | |
| 75 | Bronchospasm | FAERS: 3 | US FAERS | |
| 76 | Cholelithiasis | FAERS: 3 | US FAERS | |
| 77 | Corneal lesion | FAERS: 3 | US FAERS | |
| 78 | Deafness | FAERS: 3 | US FAERS | |
| 79 | Dengue Fever | FAERS: 3 | US FAERS | |
| 80 | Dry skin | FAERS: 3 | US FAERS | |
| 81 | Eczema | FAERS: 3 | US FAERS | |
| 82 | Expired drug administered | FAERS: 3 | US FAERS | |
| 83 | Eyelids pruritus | FAERS: 3 | US FAERS | |
| 84 | Hepatitis | FAERS: 3 | US FAERS | |
| 85 | Incorrect storage of drug | FAERS: 3 | US FAERS | |
| 86 | Keratitis | FAERS: 3 | US FAERS | |
| 87 | Macular degeneration | FAERS: 3 | US FAERS | |
| 88 | Medication residue present | FAERS: 3 | US FAERS | |
| 89 | Memory impairment | FAERS: 3 | US FAERS | |
| 90 | Myasthenia Gravis | FAERS: 3 | US FAERS | |
| 91 | Myopia | FAERS: 3 | US FAERS | |
| 92 | Pneumonia | FAERS: 3 | US FAERS | |
| 93 | Product availability issue | FAERS: 3 | US FAERS | |
| 94 | Product physical consistency issue | FAERS: 3 | US FAERS | |
| 95 | Product physical issue | FAERS: 3 | US FAERS | |
| 96 | Punctate keratitis | FAERS: 3 | US FAERS | |
| 97 | Retinal Detachment | FAERS: 3 | US FAERS | |
| 98 | Skin irritation | FAERS: 3 | US FAERS | |
| 99 | Superficial injury of eye | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 100 | Therapeutic response unexpected | FAERS: 3 | US FAERS | |
| 101 | Throat irritation | FAERS: 3 | US FAERS | |
| 102 | Urinary tract infection | FAERS: 3 | US FAERS | |
| 103 | Vertigo | FAERS: 3 | US FAERS | |
| 104 | Wrong technique in drug usage process | FAERS: 3 | US FAERS | |
| 105 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 106 | Amnesia | FAERS: 2 | US FAERS | |
| 107 | Angina Pectoris | FAERS: 2 | US FAERS | |
| 108 | Application site erythema | FAERS: 2 | US FAERS | |
| 109 | Back Pain | FAERS: 2 | US FAERS | |
| 110 | Back disorder | FAERS: 2 | US FAERS | |
| 111 | Blepharospasm | FAERS: 2 | US FAERS | |
| 112 | Cardiovascular insufficiency | FAERS: 2 | US FAERS | |
| 113 | Chest Pain | FAERS: 2 | US FAERS | |
| 114 | Chills | FAERS: 2 | US FAERS | |
| 115 | Chromaturia | FAERS: 2 | US FAERS | |
| 116 | Circumstance or information capable of leading to medication error | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 117 | Conjunctivitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 118 | Corneal decompensation | FAERS: 2 | US FAERS | |
| 119 | Corneal degeneration | FAERS: 2 | US FAERS | |
| 120 | Corneal dystrophy | FAERS: 2 | US FAERS | |
| 121 | Depressed mood | FAERS: 2 | US FAERS | |
| 122 | Diplopia | FAERS: 2 | US FAERS | |
| 123 | Discomfort | FAERS: 2 | US FAERS | |
| 124 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 125 | Economic problem | FAERS: 2 | US FAERS | |
| 126 | Ectropion | FAERS: 2 | US FAERS | |
| 127 | Erectile dysfunction | FAERS: 2 | US FAERS | |
| 128 | Excoriation | FAERS: 2 | US FAERS | |
| 129 | Exophthalmos | FAERS: 2 | US FAERS | |
| 130 | Expired product administered | FAERS: 2 | US FAERS | |
| 131 | Eye inflammation | FAERS: 2 | US FAERS | |
| 132 | Eyelid pain | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 133 | Eyelid skin dryness | FAERS: 2 | US FAERS | |
| 134 | Gamma-Glutamyltransferase Increased | FAERS: 2 | US FAERS | |
| 135 | Hernia | FAERS: 2 | US FAERS | |
| 136 | Hypokinesia | FAERS: 2 | US FAERS | |
| 137 | Incorrect dose administered by device | FAERS: 2 | US FAERS | |
| 138 | Injection Site Reaction | FAERS: 2 | US FAERS | |
| 139 | Keratoconjunctivitis Sicca | FAERS: 2 | US FAERS | |
| 140 | Metabolic acidosis | FAERS: 2 | US FAERS | |
| 141 | Nasal discomfort | FAERS: 2 | US FAERS | |
| 142 | Nervousness | FAERS: 2 | US FAERS | |
| 143 | Nocturia | FAERS: 2 | US FAERS | |
| 144 | Ocular vascular disorder | FAERS: 2 | US FAERS | |
| 145 | Optic Neuropathy | FAERS: 2 | US FAERS | |
| 146 | Oral mucosal exfoliation | FAERS: 2 | US FAERS | |
| 147 | Oropharyngeal pain | FAERS: 2 | US FAERS | |
| 148 | Palpitations | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 149 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 150 | Polyneuropathy | FAERS: 2 | US FAERS | |
| 151 | Product deposit | FAERS: 2 | US FAERS | |
| 152 | Product gel formation | FAERS: 2 | US FAERS | |
| 153 | Product lot number issue | FAERS: 2 | US FAERS | |
| 154 | Product storage error | FAERS: 2 | US FAERS | |
| 155 | Product use in unapproved indication | FAERS: 2 | US FAERS | |
| 156 | Productive Cough | FAERS: 2 | US FAERS | |
| 157 | Renal pain | FAERS: 2 | US FAERS | |
| 158 | Rheumatoid Arthritis | FAERS: 2 | US FAERS | |
| 159 | Scab | FAERS: 2 | US FAERS | |
| 160 | Sciatica | FAERS: 2 | US FAERS | |
| 161 | Shock | FAERS: 2 | US FAERS | |
| 162 | Somnolence | FAERS: 2 | US FAERS | |
| 163 | Status Asthmaticus | FAERS: 2 | US FAERS | |
| 164 | Stevens-Johnson Syndrome | FAERS: 2 | US FAERS | |
| 165 | Supraventricular tachycardia | FAERS: 2 | US FAERS | |
| 166 | Thyroid Neoplasm | FAERS: 2 | US FAERS | |
| 167 | Tinnitus | FAERS: 2 | US FAERS | |
| 168 | Visual acuity tests abnormal | FAERS: 2 | US FAERS | |
| 169 | Vitrectomy | FAERS: 2 | US FAERS | |
| 170 | Vitreous opacities | FAERS: 2 | US FAERS | |
| 171 | Wrong technique in product usage process | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 172 | Accelerated Idioventricular Rhythm | FAERS: 1 | US FAERS | |
| 173 | Accidental overdose | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 174 | Accidental underdose | FAERS: 1 | US FAERS | |
| 175 | Acidosis | FAERS: 1 | US FAERS | |
| 176 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 177 | Anger | FAERS: 1 | US FAERS | |
| 178 | Angioedema | FAERS: 1 | US FAERS | |
| 179 | Angle Closure Glaucoma | FAERS: 1 | US FAERS | |
| 180 | Application site pain | FAERS: 1 | US FAERS | |
| 181 | Arthritis | FAERS: 1 | US FAERS | |
| 182 | Asphyxia | FAERS: 1 | US FAERS | |
| 183 | Asthenopia | FAERS: 1 | US FAERS | |
| 184 | Astigmatism | FAERS: 1 | US FAERS | |
| 185 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 186 | Basal cell carcinoma | FAERS: 1 | US FAERS | |
| 187 | Blood Pressure | FAERS: 1 | US FAERS | |
| 188 | Blood cholesterol | FAERS: 1 | US FAERS | |
| 189 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 190 | Blood urine present | FAERS: 1 | US FAERS | |
| 191 | Bone marrow depression | FAERS: 1 | US FAERS | |
| 192 | Bronchitis | FAERS: 1 | US FAERS | |
| 193 | Cardiac valve fibroelastoma | FAERS: 1 | US FAERS | |
| 194 | Caustic injury | FAERS: 1 | US FAERS | |
| 195 | Cavernous Sinus Thrombosis | FAERS: 1 | US FAERS | |
| 196 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 197 | Chemical burn of skin | FAERS: 1 | US FAERS | |
| 198 | Chemical burns of eye | FAERS: 1 | US FAERS | |
| 199 | Choroidal Detachment | FAERS: 1 | US FAERS | |
| 200 | Chromatopsia | FAERS: 1 | US FAERS | |
| 201 | Conjunctival abrasion | FAERS: 1 | US FAERS | |
| 202 | Constipation | FAERS: 1 | US FAERS | |
| 203 | Contact lens intolerance | FAERS: 1 | US FAERS | |
| 204 | Corneal Opacity | FAERS: 1 | US FAERS | |
| 205 | Corneal Perforation | FAERS: 1 | US FAERS | |
| 206 | Corneal erosion | FAERS: 1 | US FAERS | |
| 207 | Creutzfeldt-Jakob disease | FAERS: 1 | US FAERS | |
| 208 | Crying | FAERS: 1 | US FAERS | |
| 209 | Cyanopsia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 210 | Dementia | FAERS: 1 | US FAERS | |
| 211 | Device difficult to use | FAERS: 1 | US FAERS | |
| 212 | Diet refusal | FAERS: 1 | US FAERS | |
| 213 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 214 | Drug administration error | FAERS: 1 | US FAERS | |
| 215 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 216 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 217 | Dysmetropsia | FAERS: 1 | US FAERS | |
| 218 | Dyspepsia | FAERS: 1 | US FAERS | |
| 219 | Dysphonia | FAERS: 1 | US FAERS | |
| 220 | Dysuria | FAERS: 1 | US FAERS | |
| 221 | Emotional disorder | FAERS: 1 | US FAERS | |
| 222 | Emotional distress | FAERS: 1 | US FAERS | |
| 223 | Endophthalmitis | FAERS: 1 | US FAERS | |
| 224 | Erysipelas | FAERS: 1 | US FAERS | |
| 225 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 226 | Eschar | FAERS: 1 | US FAERS | |
| 227 | Excitability | FAERS: 1 | US FAERS | |
| 228 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 229 | Eye laser surgery | FAERS: 1 | US FAERS | |
| 230 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 231 | Growth of eyelashes | FAERS: 1 | US FAERS | |
| 232 | Head discomfort | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 233 | Hemiparesis | FAERS: 1 | US FAERS | |
| 234 | Hoarseness | FAERS: 1 | US FAERS | |
| 235 | Hypercapnia | FAERS: 1 | US FAERS | |
| 236 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 237 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 238 | Hypometabolism | FAERS: 1 | US FAERS | |
| 239 | Hypopigmentation of eyelid | FAERS: 1 | US FAERS | |
| 240 | Hypoxia | FAERS: 1 | US FAERS | |
| 241 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 242 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 243 | Inflammation | FAERS: 1 | US FAERS | |
| 244 | Instillation site erythema | FAERS: 1 | US FAERS | |
| 245 | Instillation site pain | FAERS: 1 | US FAERS | |
| 246 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 247 | Intraocular pressure fluctuation | FAERS: 1 | US FAERS | |
| 248 | Iritis | FAERS: 1 | US FAERS | |
| 249 | Joint swelling | FAERS: 1 | US FAERS | |
| 250 | Lacrimal duct procedure | FAERS: 1 | US FAERS | |
| 251 | Laryngeal discomfort | FAERS: 1 | US FAERS | |
| 252 | Lip swelling | FAERS: 1 | US FAERS | |
| 253 | Loss of visual contrast sensitivity | FAERS: 1 | US FAERS | |
| 254 | Macular fibrosis | FAERS: 1 | US FAERS | |
| 255 | Malignant glaucoma | FAERS: 1 | US FAERS | |
| 256 | Maternal exposure timing unspecified | FAERS: 1 | US FAERS | |
| 257 | Medication residue | FAERS: 1 | US FAERS | |
| 258 | Metamorphopsia | FAERS: 1 | US FAERS | |
| 259 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 260 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 261 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 262 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 263 | Orthostatic hypertension | FAERS: 1 | US FAERS | |
| 264 | Osteoporosis | FAERS: 1 | US FAERS | |
| 265 | Paradoxical drug reaction | FAERS: 1 | US FAERS | |
| 266 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 267 | Pharyngeal swelling | FAERS: 1 | US FAERS | |
| 268 | Pharyngitis | FAERS: 1 | US FAERS | |
| 269 | Poisoning | FAERS: 1 | US FAERS | |
| 270 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 271 | Priapism | FAERS: 1 | US FAERS | |
| 272 | Product closure issue | FAERS: 1 | US FAERS | |
| 273 | Product complaint | FAERS: 1 | US FAERS | |
| 274 | Product container seal issue | FAERS: 1 | US FAERS | |
| 275 | Product contamination | FAERS: 1 | US FAERS | |
| 276 | Product contamination microbial | FAERS: 1 | US FAERS | |
| 277 | Product leakage | FAERS: 1 | US FAERS | |
| 278 | Product package associated injury | FAERS: 1 | US FAERS | |
| 279 | Product packaging issue | FAERS: 1 | US FAERS | |
| 280 | Product tampering | FAERS: 1 | US FAERS | |
| 281 | Product use complaint | FAERS: 1 | US FAERS | |
| 282 | Pulmonary pain | FAERS: 1 | US FAERS | |
| 283 | Retinal Degeneration | FAERS: 1 | US FAERS | |
| 284 | Rhinitis | FAERS: 1 | US FAERS | |
| 285 | Ruptured cerebral aneurysm | FAERS: 1 | US FAERS | |
| 286 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 287 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 288 | Sinusitis | FAERS: 1 | US FAERS | |
| 289 | Skeletal injury | FAERS: 1 | US FAERS | |
| 290 | Sneezing | FAERS: 1 | US FAERS | |
| 291 | Swelling of eyelid | FAERS: 1 | US FAERS | |
| 292 | Swelling | FAERS: 1 | US FAERS | |
| 293 | Symblepharon | FAERS: 1 | US FAERS | |
| 294 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 295 | Thrombosis | FAERS: 1 | US FAERS | |
| 296 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 297 | Urinary Retention | FAERS: 1 | US FAERS | |
| 298 | Urticaria | FAERS: 1 | US FAERS | |
| 299 | Uveitis | FAERS: 1 | US FAERS | |
| 300 | Vascular purpura | FAERS: 1 | US FAERS | |
| 301 | Vasculitis | FAERS: 1 | US FAERS | |
| 302 | Visual brightness | FAERS: 1 | US FAERS | |
| 303 | Vitreous Detachment | FAERS: 1 | US FAERS | |
| 304 | Wheezing | FAERS: 1 | US FAERS | |
| 305 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 306 | Xanthopsia | FAERS: 1 | US FAERS | |
| 307 | Ear discomfort | Canada Vigilance: 1 | Canada Vigilance | |
| 308 | Infection | Canada Vigilance: 1 | Canada Vigilance | |
| 309 | Open globe injury | Canada Vigilance: 1 | Canada Vigilance | |
| 310 | Product packaging difficult to open | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.