Telbivudine
(IQFYYKKMVGJFEH-CSMHCCOUSA-N)
Structure
- SMILES
- OC[C@@H]1O[C@@H](C[C@H]1O)n1cc(C)c(=O)[nH]c1=O
- Type(s)
- Approved; Investigational
- ATC code(s)
- J05AF11
- Molecular Formula:
- C10H14N2O5
- Molecular Weight:
- 242.229
- Log P:
- -1.5143
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 3
- TPSA:
- 104.55
- CAS Number(s):
- 3424-98-4; 26879-47-0
Synonym(s)
1.
Telbivudine
2.
1-(2-Deoxy-beta-L-erythropentafuranosyl)-5-methyl-2,4(1H,3H)-pyrimidinedione
3.
Telbivudin
4.
Tyzeka
5.
beta-L-2'-Deoxythymidine
6.
beta L 2' Deoxythymidine
External Link(s)
| MeSH | D000077712 |
| PubChem Compound | 159269 |
| BindingDB | 50088372 |
| ChEBI | 63624 |
| CHEMBL | CHEMBL374731 |
| DrugBank | DB01265 |
| DrugCentral | 4220 |
| KEGG | dr:D06675 |
| Therapeutic Target Database | D0CL9S |
| ZINC | 2159 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Blood creatine phosphokinase increased | FAERS: 151 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Myalgia | FAERS: 79 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Drug exposure during pregnancy | FAERS: 59 | US FAERS | |
| 4 | Fatigue | FAERS: 58 Canada Vigilance: 1 | 18201580 | CTD Canada Vigilance US FAERS |
| 5 | Rhabdomyolysis | FAERS: 55 | US FAERS | |
| 6 | Nausea | FAERS: 54 | US FAERS | |
| 7 | Vomiting | FAERS: 53 | US FAERS | |
| 8 | Asthenia | FAERS: 52 | US FAERS | |
| 9 | Myoglobin blood increased | FAERS: 52 | US FAERS | |
| 10 | Maternal exposure during pregnancy | FAERS: 37 | US FAERS | |
| 11 | Myopathy | FAERS: 32 | US FAERS | |
| 12 | Blood lactate dehydrogenase increased | FAERS: 30 | US FAERS | |
| 13 | Blood creatine phosphokinase MB increased | FAERS: 28 | US FAERS | |
| 14 | Aspartate Aminotransferase Increased | FAERS: 26 | US FAERS | |
| 15 | Hepatitis B | FAERS: 22 | 15388423 16152756 18816503 | CTD US FAERS |
| 16 | Alanine Aminotransferase Increased | FAERS: 20 | US FAERS | |
| 17 | Abdominal Pain | FAERS: 19 | 18201580 | CTD US FAERS |
| 18 | Abdominal discomfort | FAERS: 19 | US FAERS | |
| 19 | Hepatitis B DNA increased | FAERS: 19 | US FAERS | |
| 20 | Metabolic acidosis | FAERS: 19 | US FAERS | |
| 21 | Pain | FAERS: 19 | US FAERS | |
| 22 | Palpitations | FAERS: 19 | US FAERS | |
| 23 | Chest discomfort | FAERS: 18 | US FAERS | |
| 24 | Gastritis | FAERS: 17 | US FAERS | |
| 25 | Ascites | FAERS: 13 | US FAERS | |
| 26 | Shock | FAERS: 13 | US FAERS | |
| 27 | Drug resistance | FAERS: 12 | US FAERS | |
| 28 | jaundice | FAERS: 12 | 20610938 | CTD US FAERS |
| 29 | Arthralgia | FAERS: 11 | US FAERS | |
| 30 | Dizziness | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 31 | Hepatitis | FAERS: 11 | 20610938 | CTD US FAERS |
| 32 | Weight decreased | FAERS: 11 | US FAERS | |
| 33 | Blood pH decreased | FAERS: 10 | US FAERS | |
| 34 | Malaise | FAERS: 10 | US FAERS | |
| 35 | Electrolyte imbalance | FAERS: 9 | US FAERS | |
| 36 | Musculoskeletal stiffness | FAERS: 9 | US FAERS | |
| 37 | Oliguria | FAERS: 9 | US FAERS | |
| 38 | Polymyositis | FAERS: 9 | US FAERS | |
| 39 | Polyneuropathy | FAERS: 9 | US FAERS | |
| 40 | Acidosis | FAERS: 8 | US FAERS | |
| 41 | Anuria | FAERS: 8 | US FAERS | |
| 42 | Blood urea increased | FAERS: 8 | US FAERS | |
| 43 | Deafness | FAERS: 8 | US FAERS | |
| 44 | Musculoskeletal Pain | FAERS: 8 | US FAERS | |
| 45 | Tinnitus | FAERS: 8 | US FAERS | |
| 46 | Troponin increased | FAERS: 8 | US FAERS | |
| 47 | Blood creatinine increased | FAERS: 7 | US FAERS | |
| 48 | General physical health deterioration | FAERS: 7 | US FAERS | |
| 49 | Headache | FAERS: 7 | 18201580 | CTD US FAERS |
| 50 | Hepatic Encephalopathy | FAERS: 7 | US FAERS | |
| 51 | Infantile apnoeic attack | FAERS: 7 | US FAERS | |
| 52 | Myositis | FAERS: 7 | US FAERS | |
| 53 | Nerve injury | FAERS: 7 | US FAERS | |
| 54 | Rales | FAERS: 7 | US FAERS | |
| 55 | Sinus Tachycardia | FAERS: 7 | US FAERS | |
| 56 | Somnolence | FAERS: 7 | US FAERS | |
| 57 | Viral load increased | FAERS: 7 | US FAERS | |
| 58 | Abdominal rebound tenderness | FAERS: 6 | US FAERS | |
| 59 | Abdominal tenderness | FAERS: 6 | US FAERS | |
| 60 | Drug exposure via breast milk | FAERS: 6 | US FAERS | |
| 61 | Drug ineffective | FAERS: 6 | US FAERS | |
| 62 | Hepatitis B surface antigen positive | FAERS: 6 | US FAERS | |
| 63 | Hyporeflexia | FAERS: 6 | US FAERS | |
| 64 | PCO2 decreased | FAERS: 6 | US FAERS | |
| 65 | Pancreatitis | FAERS: 6 | US FAERS | |
| 66 | Aldolase abnormal | FAERS: 5 | US FAERS | |
| 67 | Alpha hydroxybutyrate dehydrogenase increased | FAERS: 5 | US FAERS | |
| 68 | Anxiety | FAERS: 5 | US FAERS | |
| 69 | Base excess increased | FAERS: 5 | US FAERS | |
| 70 | Blood urine present | FAERS: 5 | US FAERS | |
| 71 | Chest Pain | FAERS: 5 | US FAERS | |
| 72 | Distributive shock | FAERS: 5 | US FAERS | |
| 73 | Dysgeusia | FAERS: 5 | US FAERS | |
| 74 | Hypophagia | FAERS: 5 | US FAERS | |
| 75 | Limb discomfort | FAERS: 5 | US FAERS | |
| 76 | Muscular Dystrophy | FAERS: 5 | US FAERS | |
| 77 | Amniotic fluid volume decreased | FAERS: 4 | US FAERS | |
| 78 | Asterixis | FAERS: 4 | US FAERS | |
| 79 | Blood glucose increased | FAERS: 4 | US FAERS | |
| 80 | Cyanosis | FAERS: 4 | US FAERS | |
| 81 | Escherichia sepsis | FAERS: 4 | US FAERS | |
| 82 | Hypotension | FAERS: 4 | US FAERS | |
| 83 | Mechanical ventilation | FAERS: 4 | US FAERS | |
| 84 | Nasopharyngitis | FAERS: 4 | 18201580 | CTD US FAERS |
| 85 | Nephritis | FAERS: 4 | US FAERS | |
| 86 | Neuralgia | FAERS: 4 | US FAERS | |
| 87 | Ocular icterus | FAERS: 4 | US FAERS | |
| 88 | Respiratory Failure | FAERS: 4 | US FAERS | |
| 89 | Respiratory distress | FAERS: 4 | US FAERS | |
| 90 | Restlessness | FAERS: 4 | US FAERS | |
| 91 | Rheumatoid factor increased | FAERS: 4 | US FAERS | |
| 92 | Tachycardia | FAERS: 4 | US FAERS | |
| 93 | muscle injury | FAERS: 4 | US FAERS | |
| 94 | Acute respiratory failure | FAERS: 3 | US FAERS | |
| 95 | Allergic cough | FAERS: 3 | US FAERS | |
| 96 | Arteriosclerosis | FAERS: 3 | US FAERS | |
| 97 | Asthma | FAERS: 3 | US FAERS | |
| 98 | Axonal neuropathy | FAERS: 3 | US FAERS | |
| 99 | Back Pain | FAERS: 3 | US FAERS | |
| 100 | Blood gases abnormal | FAERS: 3 | US FAERS | |
| 101 | Cerebral cyst | FAERS: 3 | US FAERS | |
| 102 | Choking sensation | FAERS: 3 | US FAERS | |
| 103 | Choking | FAERS: 3 | US FAERS | |
| 104 | Cholestasis | FAERS: 3 | US FAERS | |
| 105 | Chromaturia | FAERS: 3 | US FAERS | |
| 106 | Claustrophobia | FAERS: 3 | US FAERS | |
| 107 | Completed Suicide | FAERS: 3 | US FAERS | |
| 108 | Delirium | FAERS: 3 | US FAERS | |
| 109 | Ecchymosis | FAERS: 3 | US FAERS | |
| 110 | Ectopic Pregnancy | FAERS: 3 | US FAERS | |
| 111 | Electromyogram abnormal | FAERS: 3 | US FAERS | |
| 112 | Erectile dysfunction | FAERS: 3 | US FAERS | |
| 113 | Exposure during breast feeding | FAERS: 3 | US FAERS | |
| 114 | Feeling abnormal | FAERS: 3 | US FAERS | |
| 115 | Feeling of body temperature change | FAERS: 3 | US FAERS | |
| 116 | Gamma-Glutamyltransferase Increased | FAERS: 3 | US FAERS | |
| 117 | Hyperreflexia | FAERS: 3 | US FAERS | |
| 118 | Infection | FAERS: 3 | US FAERS | |
| 119 | Lumbar radiculopathy | FAERS: 3 | US FAERS | |
| 120 | Muscle Fatigue | FAERS: 3 | US FAERS | |
| 121 | Myocardial necrosis marker increased | FAERS: 3 | US FAERS | |
| 122 | Myocarditis | FAERS: 3 | US FAERS | |
| 123 | Nephrolithiasis | FAERS: 3 | US FAERS | |
| 124 | Neuritis | FAERS: 3 | US FAERS | |
| 125 | Neurosensory hypoacusis | FAERS: 3 | US FAERS | |
| 126 | Peripheral arterial occlusive disease | FAERS: 3 | US FAERS | |
| 127 | Peritonitis | FAERS: 3 | US FAERS | |
| 128 | Pneumonia | FAERS: 3 | US FAERS | |
| 129 | Poikilocytosis | FAERS: 3 | US FAERS | |
| 130 | Poor quality sleep | FAERS: 3 | US FAERS | |
| 131 | Proteinuria | FAERS: 3 | US FAERS | |
| 132 | Pruritus | FAERS: 3 | US FAERS | |
| 133 | Toothache | FAERS: 3 | US FAERS | |
| 134 | Transaminases increased | FAERS: 3 | US FAERS | |
| 135 | Urine ketone body present | FAERS: 3 | US FAERS | |
| 136 | Ventricular internal diameter abnormal | FAERS: 3 | US FAERS | |
| 137 | Vital functions abnormal | FAERS: 3 | US FAERS | |
| 138 | effusion | FAERS: 3 | US FAERS | |
| 139 | Acoustic stimulation tests abnormal | FAERS: 2 | US FAERS | |
| 140 | Ageusia | FAERS: 2 | US FAERS | |
| 141 | Alopecia | FAERS: 2 | US FAERS | |
| 142 | Appendicitis | FAERS: 2 | US FAERS | |
| 143 | Arthritis | FAERS: 2 | US FAERS | |
| 144 | Blood creatine phosphokinase | FAERS: 2 | US FAERS | |
| 145 | Blood creatinine abnormal | FAERS: 2 | US FAERS | |
| 146 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 147 | Blood triglycerides increased | FAERS: 2 | US FAERS | |
| 148 | Blood urea abnormal | FAERS: 2 | US FAERS | |
| 149 | Bullous lung disease | FAERS: 2 | US FAERS | |
| 150 | Cardiac discomfort | FAERS: 2 | US FAERS | |
| 151 | Cardiac enzymes increased | FAERS: 2 | US FAERS | |
| 152 | Cardiomegaly | FAERS: 2 | US FAERS | |
| 153 | Cholecystitis | FAERS: 2 | US FAERS | |
| 154 | Cholelithiasis | FAERS: 2 | US FAERS | |
| 155 | Cold sweat | FAERS: 2 | US FAERS | |
| 156 | Decreased immune responsiveness | FAERS: 2 | US FAERS | |
| 157 | Dehydration | FAERS: 2 | US FAERS | |
| 158 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 159 | Diastolic dysfunction | FAERS: 2 | US FAERS | |
| 160 | Dysphonia | FAERS: 2 | US FAERS | |
| 161 | Eosinophilia | FAERS: 2 | US FAERS | |
| 162 | Exposure via father | FAERS: 2 | US FAERS | |
| 163 | Gastrointestinal sounds abnormal | FAERS: 2 | US FAERS | |
| 164 | Gene Mutation | FAERS: 2 | US FAERS | |
| 165 | Head circumference abnormal | FAERS: 2 | US FAERS | |
| 166 | Hepatitis B DNA assay positive | FAERS: 2 | US FAERS | |
| 167 | Hepatorenal Syndrome | FAERS: 2 | US FAERS | |
| 168 | Hypogeusia | FAERS: 2 | US FAERS | |
| 169 | Intentional drug misuse | FAERS: 2 | US FAERS | |
| 170 | Irregular breathing | FAERS: 2 | US FAERS | |
| 171 | Left atrial dilatation | FAERS: 2 | US FAERS | |
| 172 | Lipase increased | FAERS: 2 | US FAERS | |
| 173 | Lipoma | FAERS: 2 | US FAERS | |
| 174 | Low birth weight baby | FAERS: 2 | US FAERS | |
| 175 | Malignant neoplasm progression | FAERS: 2 | US FAERS | |
| 176 | Mitochondrial toxicity | FAERS: 2 | US FAERS | |
| 177 | Musculoskeletal discomfort | FAERS: 2 | US FAERS | |
| 178 | Pallor | FAERS: 2 | US FAERS | |
| 179 | Perinatal HBV infection | FAERS: 2 | US FAERS | |
| 180 | Portal Hypertension | FAERS: 2 | US FAERS | |
| 181 | Pre-Eclampsia | FAERS: 2 | US FAERS | |
| 182 | Protein urine present | FAERS: 2 | US FAERS | |
| 183 | Radiculitis | FAERS: 2 | US FAERS | |
| 184 | Sepsis | FAERS: 2 | US FAERS | |
| 185 | Splenectomy | FAERS: 2 | US FAERS | |
| 186 | Splenomegaly | FAERS: 2 | US FAERS | |
| 187 | Stillbirth | FAERS: 2 | US FAERS | |
| 188 | Suicide attempt | FAERS: 2 | US FAERS | |
| 189 | Syphilis | FAERS: 2 | US FAERS | |
| 190 | Thyroid Neoplasm | FAERS: 2 | US FAERS | |
| 191 | Toxicity to various agents | FAERS: 2 | US FAERS | |
| 192 | Tuberculosis | FAERS: 2 | US FAERS | |
| 193 | Ultrasound liver abnormal | FAERS: 2 | US FAERS | |
| 194 | Victim of homicide | FAERS: 2 | US FAERS | |
| 195 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 196 | Wound Complication | FAERS: 2 | US FAERS | |
| 197 | treatment failure | FAERS: 2 | US FAERS | |
| 198 | Abasia | FAERS: 1 | US FAERS | |
| 199 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 200 | Anal sphincter atony | FAERS: 1 | US FAERS | |
| 201 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 202 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 203 | Anorexia | FAERS: 1 | US FAERS | |
| 204 | Anti-HBe antibody positive | FAERS: 1 | US FAERS | |
| 205 | Aphagia | FAERS: 1 | US FAERS | |
| 206 | Aphasia | FAERS: 1 | US FAERS | |
| 207 | Apolipoprotein B increased | FAERS: 1 | US FAERS | |
| 208 | Arthropathy | FAERS: 1 | US FAERS | |
| 209 | Bilirubin conjugated increased | FAERS: 1 | US FAERS | |
| 210 | Biopsy muscle abnormal | FAERS: 1 | US FAERS | |
| 211 | Blindness | FAERS: 1 | US FAERS | |
| 212 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 213 | Blood bilirubin unconjugated increased | FAERS: 1 | US FAERS | |
| 214 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 215 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 216 | Blood creatine phosphokinase MB | FAERS: 1 | US FAERS | |
| 217 | Blood creatine phosphokinase decreased | FAERS: 1 | US FAERS | |
| 218 | Blood creatinine decreased | FAERS: 1 | US FAERS | |
| 219 | Blood immunoglobulin G abnormal | FAERS: 1 | US FAERS | |
| 220 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 221 | Blood urea nitrogen/creatinine ratio increased | FAERS: 1 | US FAERS | |
| 222 | Bradycardia | FAERS: 1 | US FAERS | |
| 223 | Brain scan abnormal | FAERS: 1 | US FAERS | |
| 224 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 225 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 226 | Cerebellar infarction | FAERS: 1 | US FAERS | |
| 227 | Cerebral Palsy | FAERS: 1 | US FAERS | |
| 228 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 229 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 230 | Chronic gastritis | FAERS: 1 | US FAERS | |
| 231 | Cleft Palate | FAERS: 1 | US FAERS | |
| 232 | Concomitant disease aggravated | FAERS: 1 | US FAERS | |
| 233 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 234 | Crying | FAERS: 1 | US FAERS | |
| 235 | Discomfort | FAERS: 1 | US FAERS | |
| 236 | Disease Progression | FAERS: 1 | US FAERS | |
| 237 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 238 | Dyspepsia | FAERS: 1 | US FAERS | |
| 239 | Echocardiogram abnormal | FAERS: 1 | US FAERS | |
| 240 | Eczema | FAERS: 1 | US FAERS | |
| 241 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 242 | Enzyme abnormality | FAERS: 1 | US FAERS | |
| 243 | Eructation | FAERS: 1 | US FAERS | |
| 244 | Erythema | FAERS: 1 | US FAERS | |
| 245 | Eye pain | FAERS: 1 | US FAERS | |
| 246 | Fibrinolysis | FAERS: 1 | US FAERS | |
| 247 | Flatulence | FAERS: 1 | US FAERS | |
| 248 | Frustration | FAERS: 1 | US FAERS | |
| 249 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 250 | Gingival erythema | FAERS: 1 | US FAERS | |
| 251 | Glomerulonephritis | FAERS: 1 | US FAERS | |
| 252 | Glossitis | FAERS: 1 | US FAERS | |
| 253 | Hemiparesis | FAERS: 1 | US FAERS | |
| 254 | Hepatic Infection | FAERS: 1 | US FAERS | |
| 255 | Hepatitis B e antigen positive | FAERS: 1 | US FAERS | |
| 256 | Hepatitis C | FAERS: 1 | US FAERS | |
| 257 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 258 | Hyperemesis Gravidarum | FAERS: 1 | US FAERS | |
| 259 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 260 | Hypersplenism | FAERS: 1 | US FAERS | |
| 261 | Hyporesponsive to stimuli | FAERS: 1 | US FAERS | |
| 262 | Hypoxia | FAERS: 1 | US FAERS | |
| 263 | Inflammation | FAERS: 1 | US FAERS | |
| 264 | Influenza A virus test positive | FAERS: 1 | US FAERS | |
| 265 | Influenza | FAERS: 1 | US FAERS | |
| 266 | Lethargy | FAERS: 1 | US FAERS | |
| 267 | Leukopenia | FAERS: 1 | US FAERS | |
| 268 | Liver carcinoma ruptured | FAERS: 1 | US FAERS | |
| 269 | Liver transplant rejection | FAERS: 1 | US FAERS | |
| 270 | Low set ears | FAERS: 1 | US FAERS | |
| 271 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 272 | Marasmus | FAERS: 1 | US FAERS | |
| 273 | Maternal death during childbirth | FAERS: 1 | US FAERS | |
| 274 | Measles | FAERS: 1 | US FAERS | |
| 275 | Mental impairment | FAERS: 1 | US FAERS | |
| 276 | Mental status changes | FAERS: 1 | US FAERS | |
| 277 | Mitochondrial enzyme deficiency | FAERS: 1 | US FAERS | |
| 278 | Multi-organ disorder | FAERS: 1 | US FAERS | |
| 279 | Muscle necrosis | FAERS: 1 | US FAERS | |
| 280 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 281 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 282 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 283 | Myoglobinuria | FAERS: 1 | US FAERS | |
| 284 | Nerve root injury | FAERS: 1 | US FAERS | |
| 285 | Obesity | FAERS: 1 | US FAERS | |
| 286 | PO2 increased | FAERS: 1 | US FAERS | |
| 287 | Pain of skin | FAERS: 1 | US FAERS | |
| 288 | Pancytopenia | FAERS: 1 | US FAERS | |
| 289 | Petechiae | FAERS: 1 | US FAERS | |
| 290 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 291 | Poisoning | FAERS: 1 | US FAERS | |
| 292 | Post procedural complication | FAERS: 1 | US FAERS | |
| 293 | Pregnancy of partner | FAERS: 1 | US FAERS | |
| 294 | Pregnancy test negative | FAERS: 1 | US FAERS | |
| 295 | Pregnancy | FAERS: 1 | US FAERS | |
| 296 | Productive Cough | FAERS: 1 | US FAERS | |
| 297 | Protein total increased | FAERS: 1 | US FAERS | |
| 298 | Pulmonary Valve Stenosis | FAERS: 1 | US FAERS | |
| 299 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 300 | Radiculopathy | FAERS: 1 | US FAERS | |
| 301 | Rebound effect | FAERS: 1 | US FAERS | |
| 302 | Regurgitation | FAERS: 1 | US FAERS | |
| 303 | Renal tubular disorder | FAERS: 1 | US FAERS | |
| 304 | Retroperitoneal lymphadenopathy | FAERS: 1 | US FAERS | |
| 305 | Septic Shock | FAERS: 1 | US FAERS | |
| 306 | Sperm count abnormal | FAERS: 1 | US FAERS | |
| 307 | Spermatozoa abnormal | FAERS: 1 | US FAERS | |
| 308 | Spermatozoa morphology abnormal | FAERS: 1 | US FAERS | |
| 309 | Spermatozoa progressive motility abnormal | FAERS: 1 | US FAERS | |
| 310 | Spondylitis | FAERS: 1 | US FAERS | |
| 311 | Sputum retention | FAERS: 1 | US FAERS | |
| 312 | Stem cell transplant | FAERS: 1 | US FAERS | |
| 313 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 314 | Supportive care | FAERS: 1 | US FAERS | |
| 315 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 316 | Syncope | FAERS: 1 | US FAERS | |
| 317 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 318 | Throat irritation | FAERS: 1 | US FAERS | |
| 319 | Thyroidectomy | FAERS: 1 | US FAERS | |
| 320 | Transaminases abnormal | FAERS: 1 | US FAERS | |
| 321 | Trendelenburg's symptom | FAERS: 1 | US FAERS | |
| 322 | Troponin I increased | FAERS: 1 | US FAERS | |
| 323 | Troponin T increased | FAERS: 1 | US FAERS | |
| 324 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 325 | Urine bilirubin increased | FAERS: 1 | US FAERS | |
| 326 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 327 | Vasculitis | FAERS: 1 | US FAERS | |
| 328 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 329 | Vertigo | FAERS: 1 | US FAERS | |
| 330 | Viral mutation identified | FAERS: 1 | US FAERS | |
| 331 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 332 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 333 | Xeroderma | FAERS: 1 | US FAERS | |
| 334 | nervous system disorder | FAERS: 1 | US FAERS | |
| 335 | Hepatitis B, Chronic | CTD | ||
| 336 | Respiratory Tract Infections | 18201580 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.