INCB018424
(HFNKQEVNSGCOJV-OAHLLOKOSA-N)
Structure
- SMILES
- N#CC[C@@H](n1ncc(c1)c1ncnc2c1cc[nH]2)C1CCCC1
- Type(s)
- Approved
- ATC code(s)
- L01XE18
- Molecular Formula:
- C17H18N6
- Molecular Weight:
- 306.365
- Log P:
- 3.4664
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 1
- TPSA:
- 83.18
- CAS Number(s):
- 941678-49-5
Synonym(s)
1.
INCB018424
2.
INCA24
3.
INCB-018424
4.
ruxolitinib
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Pneumonia | FAERS: 21 | US FAERS | |
| 2 | Thrombocytopenia | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 3 | Gamma-Glutamyltransferase Increased | FAERS: 11 | US FAERS | |
| 4 | Sepsis | FAERS: 11 | US FAERS | |
| 5 | Asthenia | FAERS: 9 | SIDER US FAERS | |
| 6 | Alanine Aminotransferase Increased | FAERS: 8 | SIDER US FAERS | |
| 7 | Pulmonary Embolism | FAERS: 8 | US FAERS | |
| 8 | Splenomegaly | FAERS: 7 Canada Vigilance: 2 | 29200404 | CTD Canada Vigilance US FAERS |
| 9 | General physical health deterioration | FAERS: 6 | US FAERS | |
| 10 | Arthralgia | FAERS: 5 | US FAERS | |
| 11 | Dizziness | FAERS: 5 | SIDER US FAERS | |
| 12 | Fatigue | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 13 | Aspartate Aminotransferase Increased | FAERS: 4 | US FAERS | |
| 14 | Cytopenia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 15 | Pain | FAERS: 4 | US FAERS | |
| 16 | Tracheobronchitis | FAERS: 4 | US FAERS | |
| 17 | White blood cell count decreased | FAERS: 4 | US FAERS | |
| 18 | Acute kidney injury | FAERS: 3 | US FAERS | |
| 19 | Blood glucose increased | FAERS: 3 | US FAERS | |
| 20 | Chest Pain | FAERS: 3 | US FAERS | |
| 21 | Coronary Artery Disease | FAERS: 3 | US FAERS | |
| 22 | Cystitis | FAERS: 3 | US FAERS | |
| 23 | Disease Progression | FAERS: 3 | US FAERS | |
| 24 | Drug ineffective | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 25 | Hypotension | FAERS: 3 | US FAERS | |
| 26 | Immune thrombocytopenic purpura | FAERS: 3 | US FAERS | |
| 27 | Leukocytosis | FAERS: 3 | US FAERS | |
| 28 | Myocardial Infarction | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 29 | Pruritus | FAERS: 3 | SIDER US FAERS | |
| 30 | Respiratory Failure | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 31 | Urinary tract infection | FAERS: 3 | SIDER US FAERS | |
| 32 | Weight decreased | FAERS: 3 | SIDER US FAERS | |
| 33 | Abdominal Pain | FAERS: 2 | US FAERS | |
| 34 | Abscess | FAERS: 2 | US FAERS | |
| 35 | Amylase increased | FAERS: 2 | US FAERS | |
| 36 | Anxiety | FAERS: 2 | US FAERS | |
| 37 | Arthropathy | FAERS: 2 | US FAERS | |
| 38 | Ascites | FAERS: 2 | US FAERS | |
| 39 | Blood creatinine increased | FAERS: 2 | US FAERS | |
| 40 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 41 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 42 | Cholecystitis | FAERS: 2 | US FAERS | |
| 43 | Dermo-hypodermitis | FAERS: 2 | US FAERS | |
| 44 | Epistaxis | FAERS: 2 | SIDER US FAERS | |
| 45 | Erythrophagocytosis | FAERS: 2 | US FAERS | |
| 46 | Headache | FAERS: 2 | SIDER US FAERS | |
| 47 | Hepatitis B | FAERS: 2 | US FAERS | |
| 48 | Hypertensive crisis | FAERS: 2 | US FAERS | |
| 49 | Infection | FAERS: 2 | SIDER US FAERS | |
| 50 | Lipase increased | FAERS: 2 | US FAERS | |
| 51 | Myelofibrosis | FAERS: 2 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 52 | Palpitations | FAERS: 2 | US FAERS | |
| 53 | Pneumothorax | FAERS: 2 | US FAERS | |
| 54 | Primary Myelofibrosis | FAERS: 2 | US FAERS | |
| 55 | Pyoderma Gangrenosum | FAERS: 2 | US FAERS | |
| 56 | Respiratory tract infection viral | FAERS: 2 | US FAERS | |
| 57 | Retinal Detachment | FAERS: 2 | US FAERS | |
| 58 | Septic Shock | FAERS: 2 | US FAERS | |
| 59 | Splenic Rupture | FAERS: 2 | US FAERS | |
| 60 | Syncope | FAERS: 2 | US FAERS | |
| 61 | Therapy change | FAERS: 2 | US FAERS | |
| 62 | Uveitis | FAERS: 2 | US FAERS | |
| 63 | Visual Impairment | FAERS: 2 | US FAERS | |
| 64 | Vomiting | FAERS: 2 | US FAERS | |
| 65 | Abasia | FAERS: 1 | US FAERS | |
| 66 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 67 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 68 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 69 | Adrenal cyst | FAERS: 1 | US FAERS | |
| 70 | Appendicitis | FAERS: 1 | US FAERS | |
| 71 | Aspergillus test positive | FAERS: 1 | US FAERS | |
| 72 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 73 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 74 | Back Pain | FAERS: 1 | US FAERS | |
| 75 | Basal cell carcinoma | FAERS: 1 | US FAERS | |
| 76 | Blast cell count increased | FAERS: 1 | US FAERS | |
| 77 | Blast cells present | FAERS: 1 | US FAERS | |
| 78 | Blastomycosis | FAERS: 1 | US FAERS | |
| 79 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 80 | Bone marrow transplant rejection | FAERS: 1 | US FAERS | |
| 81 | Brain Abscess | FAERS: 1 | US FAERS | |
| 82 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 83 | Cardiac Tamponade | FAERS: 1 | US FAERS | |
| 84 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 85 | Cataract | FAERS: 1 | US FAERS | |
| 86 | Cellulitis | FAERS: 1 | US FAERS | |
| 87 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 88 | Chronic gastritis | FAERS: 1 | US FAERS | |
| 89 | Constipation | FAERS: 1 | US FAERS | |
| 90 | Dehydration | FAERS: 1 | US FAERS | |
| 91 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 92 | Depressed mood | FAERS: 1 | US FAERS | |
| 93 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 94 | Disease recurrence | FAERS: 1 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 95 | Diverticular perforation | FAERS: 1 | US FAERS | |
| 96 | Diverticulitis | FAERS: 1 | US FAERS | |
| 97 | Diverticulum | FAERS: 1 | US FAERS | |
| 98 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 99 | Duodenitis | FAERS: 1 | US FAERS | |
| 100 | Embolic stroke | FAERS: 1 | US FAERS | |
| 101 | Endocarditis | FAERS: 1 | US FAERS | |
| 102 | Enterocolitis | FAERS: 1 | US FAERS | |
| 103 | Erythema Nodosum | FAERS: 1 | US FAERS | |
| 104 | Escherichia infection | FAERS: 1 | US FAERS | |
| 105 | Escherichia urinary tract infection | FAERS: 1 | US FAERS | |
| 106 | Facial paralysis | FAERS: 1 | US FAERS | |
| 107 | Gout | FAERS: 1 | US FAERS | |
| 108 | Hepatitis B DNA assay positive | FAERS: 1 | US FAERS | |
| 109 | Hepatitis | FAERS: 1 | US FAERS | |
| 110 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 111 | Hepatorenal Syndrome | FAERS: 1 | US FAERS | |
| 112 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 113 | Histiocytosis haematophagic | FAERS: 1 | US FAERS | |
| 114 | Histoplasmosis | FAERS: 1 | US FAERS | |
| 115 | Hospice Care | FAERS: 1 | US FAERS | |
| 116 | Hypoxia | FAERS: 1 | US FAERS | |
| 117 | Ileus | FAERS: 1 | US FAERS | |
| 118 | Infection in an immunocompromised host | FAERS: 1 | US FAERS | |
| 119 | Joint injury | FAERS: 1 | US FAERS | |
| 120 | Leukopenia | FAERS: 1 | US FAERS | |
| 121 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 122 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 123 | Lymph Node Tuberculosis | FAERS: 1 | US FAERS | |
| 124 | Mallory-Weiss Syndrome | FAERS: 1 | US FAERS | |
| 125 | Meningitis | FAERS: 1 | US FAERS | |
| 126 | Mental status changes | FAERS: 1 | US FAERS | |
| 127 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 128 | Metastatic bronchial carcinoma | FAERS: 1 | US FAERS | |
| 129 | Mitral Valve Stenosis | FAERS: 1 | US FAERS | |
| 130 | Necrosis | FAERS: 1 | US FAERS | |
| 131 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 132 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 133 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 134 | Pancytopenia | FAERS: 1 | SIDER US FAERS | |
| 135 | Pathological fracture | FAERS: 1 | US FAERS | |
| 136 | Pelvic venous thrombosis | FAERS: 1 | US FAERS | |
| 137 | Peritonitis | FAERS: 1 | US FAERS | |
| 138 | Platelet count abnormal | FAERS: 1 | US FAERS | |
| 139 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 140 | Portal Hypertension | FAERS: 1 | US FAERS | |
| 141 | Product use in unapproved indication | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 142 | Product use issue | FAERS: 1 | US FAERS | |
| 143 | Productive Cough | FAERS: 1 | US FAERS | |
| 144 | Prurigo | FAERS: 1 | US FAERS | |
| 145 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 146 | Retinal Vein Occlusion | FAERS: 1 | US FAERS | |
| 147 | Septic embolus | FAERS: 1 | US FAERS | |
| 148 | Sinusitis | FAERS: 1 | US FAERS | |
| 149 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 150 | Splenic Infarction | FAERS: 1 | US FAERS | |
| 151 | Splenitis | FAERS: 1 | US FAERS | |
| 152 | Squamous cell carcinoma of skin | FAERS: 1 | US FAERS | |
| 153 | Staphylococcus test positive | FAERS: 1 | US FAERS | |
| 154 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 155 | Systemic mycosis | FAERS: 1 | US FAERS | |
| 156 | Therapy cessation | FAERS: 1 | US FAERS | |
| 157 | Toxoplasma serology positive | FAERS: 1 | US FAERS | |
| 158 | Toxoplasmosis | FAERS: 1 | US FAERS | |
| 159 | Urticaria | FAERS: 1 | US FAERS | |
| 160 | Viral labyrinthitis | FAERS: 1 | US FAERS | |
| 161 | Vitreous Detachment | FAERS: 1 | US FAERS | |
| 162 | Blood and lymphatic system disorders | SIDER | ||
| 163 | Bone pain | SIDER | ||
| 164 | Carbon dioxide increased | Canada Vigilance: 1 | Canada Vigilance | |
| 165 | Chemical and Drug Induced Liver Injury | 24973641 | CTD | |
| 166 | Flatulence | SIDER | ||
| 167 | Infestation | SIDER | ||
| 168 | Malnutrition | SIDER | ||
| 169 | Myalgia | Canada Vigilance: 1 | Canada Vigilance | |
| 170 | Myelosuppression | SIDER | ||
| 171 | Neutropenia | SIDER | ||
| 172 | Night sweats | SIDER | ||
| 173 | Plasmacytoma | SIDER | ||
| 174 | Psoriasis | 24883332 | CTD | |
| 175 | Rebound effect | Canada Vigilance: 1 | Canada Vigilance | |
| 176 | Respiratory arrest | Canada Vigilance: 1 | Canada Vigilance | |
| 177 | Squamous cell carcinoma | Canada Vigilance: 1 | Canada Vigilance | |
| 178 | Tuberculosis | SIDER | ||
| 179 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.