lanreotide
(DEXPIBGCLCPUHE-UISHROKMSA-N)
Structure
- SMILES
- CC(=O)O.NCCCC[C@@H]1NC(=O)[C@H](NC(=O)[C@H](Cc2ccc(cc2)O)NC(=O)[C@H](CSSC[C@H](NC(=O)[C@@H](NC1=O)C(C)C)C(=O)N[C@H](C(=O)N)[C@H](O)C)NC(=O)[C@@H](Cc1ccc2c(c1)cccc2)N)Cc1c[nH]c2c1cccc2
- Molecular Formula:
- C56H73N11O12S2
- Molecular Weight:
- 1156.380
- Log P:
- 5.4392
- Hydrogen Bond Acceptor:
- 24
- Hydrogen Bond Donor:
- 14
- TPSA:
- 442.98
- CAS Number(s):
- N/A
Synonym(s)
1.
lanreotide
2.
188Re-lanreotide
3.
2-naphthylalanyl-cyclo(cysteinyl-tyrosyl-tryptophyl-lysyl-valyl-cysteinyl)-threoninamide
4.
BIM 23014
5.
BIM 23014C
6.
BIM-23014
7.
DC 13-116
8.
DC-13-116
9.
DC13-116
10.
L-Threoninamide, 3-(2-naphthalenyl)-D-alanyl-L-cysteinyl-L-tyrosyl-D-tryptophyl-L-lysyl-L-valyl-L-cysteinyl-, cyclic (2-7)-disulfide
11.
Nal-cyclo(Cys-Tyr-Trp-Lys-Val-Cys)-Thr-NH2
12.
Nal-cyclo(Cys-Tyr-Trp-Lys-Val-Cys)Thr-NH2
13.
Somatulin
14.
Somatulina
15.
Somatuline
16.
lanreotide acetate
17.
lanreotide-SR
18.
naphthalenyl-cyclo(cysteinyl-tyrosyl-tryptophyl-lysyl-valyl-cysteinyl)threoninamide
19.
naphthyl-cyclo(Cys-Tyr-Trp-Lys-Val-Cys)Thr-NH2
External Link(s)
| MeSH | C060347 |
| PubChem Compound | 6918010 |
| CHEMBL | CHEMBL1201184 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Injection site pain | FAERS: 118 | US FAERS | |
| 2 | Inappropriate schedule of drug administration | FAERS: 95 | US FAERS | |
| 3 | Nausea | FAERS: 60 | US FAERS | |
| 4 | Fatigue | FAERS: 53 | US FAERS | |
| 5 | Injection site mass | FAERS: 47 | US FAERS | |
| 6 | Malaise | FAERS: 47 | US FAERS | |
| 7 | Abdominal Pain | FAERS: 44 | US FAERS | |
| 8 | Headache | FAERS: 43 | US FAERS | |
| 9 | Vomiting | FAERS: 39 | US FAERS | |
| 10 | Flatulence | FAERS: 31 | US FAERS | |
| 11 | Disease Progression | FAERS: 29 | US FAERS | |
| 12 | Drug ineffective | FAERS: 28 | US FAERS | |
| 13 | Pain | FAERS: 26 | US FAERS | |
| 14 | Dizziness | FAERS: 25 | US FAERS | |
| 15 | Asthenia | FAERS: 22 | US FAERS | |
| 16 | Arthralgia | FAERS: 21 | US FAERS | |
| 17 | Incorrect route of drug administration | FAERS: 20 | US FAERS | |
| 18 | Weight decreased | FAERS: 20 | US FAERS | |
| 19 | Alopecia | FAERS: 19 | US FAERS | |
| 20 | Injection site nodule | FAERS: 19 | US FAERS | |
| 21 | Cholelithiasis | FAERS: 18 | US FAERS | |
| 22 | Drug dose omission | FAERS: 18 | US FAERS | |
| 23 | Abdominal discomfort | FAERS: 17 | US FAERS | |
| 24 | Feeling abnormal | FAERS: 17 | US FAERS | |
| 25 | Anxiety | FAERS: 13 | US FAERS | |
| 26 | Blood glucose increased | FAERS: 13 | US FAERS | |
| 27 | Dehydration | FAERS: 13 | US FAERS | |
| 28 | Insulin-like growth factor increased | FAERS: 13 | US FAERS | |
| 29 | Adverse event | FAERS: 12 | US FAERS | |
| 30 | Pneumonia | FAERS: 12 | US FAERS | |
| 31 | Product dose omission | FAERS: 12 | US FAERS | |
| 32 | Flushing | FAERS: 11 | US FAERS | |
| 33 | Back Pain | FAERS: 10 | US FAERS | |
| 34 | Cerebrovascular accident | FAERS: 10 | US FAERS | |
| 35 | Lethargy | FAERS: 10 | US FAERS | |
| 36 | Constipation | FAERS: 9 | US FAERS | |
| 37 | General physical health deterioration | FAERS: 9 | US FAERS | |
| 38 | Injection site pruritus | FAERS: 9 | US FAERS | |
| 39 | Chest Pain | FAERS: 8 | US FAERS | |
| 40 | Intestinal Obstruction | FAERS: 8 | US FAERS | |
| 41 | Wrong technique in product usage process | FAERS: 8 | US FAERS | |
| 42 | Blood growth hormone increased | FAERS: 7 | US FAERS | |
| 43 | Injection site bruising | FAERS: 7 | US FAERS | |
| 44 | Terminal state | FAERS: 7 | US FAERS | |
| 45 | Blood glucose decreased | FAERS: 6 | US FAERS | |
| 46 | Bradycardia | FAERS: 6 | US FAERS | |
| 47 | Drug administration error | FAERS: 6 | US FAERS | |
| 48 | Feeling Cold | FAERS: 6 | US FAERS | |
| 49 | Myalgia | FAERS: 6 | US FAERS | |
| 50 | Product use issue | FAERS: 6 | US FAERS | |
| 51 | Pruritus | FAERS: 6 | US FAERS | |
| 52 | Tremor | FAERS: 6 | US FAERS | |
| 53 | Acromegaly | FAERS: 5 | US FAERS | |
| 54 | Cholestasis | FAERS: 5 | US FAERS | |
| 55 | Cytolytic hepatitis | FAERS: 5 | US FAERS | |
| 56 | Drug administered at inappropriate site | FAERS: 5 | US FAERS | |
| 57 | Eructation | FAERS: 5 | US FAERS | |
| 58 | Incorrect drug administration duration | FAERS: 5 | US FAERS | |
| 59 | Injection site erythema | FAERS: 5 | US FAERS | |
| 60 | Malignant neoplasm progression | FAERS: 5 | US FAERS | |
| 61 | Metastasis | FAERS: 5 | US FAERS | |
| 62 | Neck Pain | FAERS: 5 | US FAERS | |
| 63 | Needle issue | FAERS: 5 | US FAERS | |
| 64 | Pancreatitis | FAERS: 5 | US FAERS | |
| 65 | Sinusitis | FAERS: 5 | US FAERS | |
| 66 | Somnolence | FAERS: 5 | US FAERS | |
| 67 | Syncope | FAERS: 5 | US FAERS | |
| 68 | Therapy cessation | FAERS: 5 | US FAERS | |
| 69 | Unevaluable event | FAERS: 5 | US FAERS | |
| 70 | Abscess | FAERS: 4 | US FAERS | |
| 71 | Arthritis | FAERS: 4 | US FAERS | |
| 72 | Blood potassium decreased | FAERS: 4 | US FAERS | |
| 73 | Chills | FAERS: 4 | US FAERS | |
| 74 | Disorientation | FAERS: 4 | US FAERS | |
| 75 | Dyspepsia | FAERS: 4 | US FAERS | |
| 76 | Hypersensitivity | FAERS: 4 | US FAERS | |
| 77 | Ileus | FAERS: 4 | US FAERS | |
| 78 | Incorrect product storage | FAERS: 4 | US FAERS | |
| 79 | Memory impairment | FAERS: 4 | US FAERS | |
| 80 | Musculoskeletal Pain | FAERS: 4 | US FAERS | |
| 81 | Myocardial Infarction | FAERS: 4 | US FAERS | |
| 82 | Overdose | FAERS: 4 | US FAERS | |
| 83 | Pericarditis | FAERS: 4 | US FAERS | |
| 84 | Peripheral swelling | FAERS: 4 | US FAERS | |
| 85 | Post procedural complication | FAERS: 4 | US FAERS | |
| 86 | Urinary tract infection | FAERS: 4 | US FAERS | |
| 87 | Urticaria | FAERS: 4 | US FAERS | |
| 88 | Vertigo | FAERS: 4 | US FAERS | |
| 89 | Alanine Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 90 | Blood glucose fluctuation | FAERS: 3 | US FAERS | |
| 91 | Chest discomfort | FAERS: 3 | US FAERS | |
| 92 | Cholecystitis | FAERS: 3 | US FAERS | |
| 93 | Cold sweat | FAERS: 3 | US FAERS | |
| 94 | Depressed Level of Consciousness | FAERS: 3 | US FAERS | |
| 95 | Diabetes Mellitus | FAERS: 3 | US FAERS | |
| 96 | Discomfort | FAERS: 3 | US FAERS | |
| 97 | Drug ineffective for unapproved indication | FAERS: 3 | US FAERS | |
| 98 | Dyschezia | FAERS: 3 | US FAERS | |
| 99 | Eye pain | FAERS: 3 | US FAERS | |
| 100 | Frustration tolerance decreased | FAERS: 3 | US FAERS | |
| 101 | Hospice Care | FAERS: 3 | US FAERS | |
| 102 | Incorrect storage of drug | FAERS: 3 | US FAERS | |
| 103 | Influenza | FAERS: 3 | US FAERS | |
| 104 | Injection Site Reaction | FAERS: 3 | US FAERS | |
| 105 | Injection site abscess | FAERS: 3 | US FAERS | |
| 106 | Injection site discomfort | FAERS: 3 | US FAERS | |
| 107 | Injection site granuloma | FAERS: 3 | US FAERS | |
| 108 | Injection site scar | FAERS: 3 | US FAERS | |
| 109 | Injection site warmth | FAERS: 3 | US FAERS | |
| 110 | Lack of injection site rotation | FAERS: 3 | US FAERS | |
| 111 | Malnutrition | FAERS: 3 | US FAERS | |
| 112 | Nasopharyngitis | FAERS: 3 | US FAERS | |
| 113 | Night sweats | FAERS: 3 | US FAERS | |
| 114 | Nodule | FAERS: 3 | US FAERS | |
| 115 | Pallor | FAERS: 3 | US FAERS | |
| 116 | Palpitations | FAERS: 3 | US FAERS | |
| 117 | Pancytopenia | FAERS: 3 | US FAERS | |
| 118 | Prescribed overdose | FAERS: 3 | US FAERS | |
| 119 | Product quality issue | FAERS: 3 | US FAERS | |
| 120 | Spinal column stenosis | FAERS: 3 | US FAERS | |
| 121 | Therapeutic response unexpected | FAERS: 3 | US FAERS | |
| 122 | Thrombocytopenia | FAERS: 3 | US FAERS | |
| 123 | Abasia | FAERS: 2 | US FAERS | |
| 124 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 125 | Amnesia | FAERS: 2 | US FAERS | |
| 126 | Angioedema | FAERS: 2 | US FAERS | |
| 127 | Ascites | FAERS: 2 | US FAERS | |
| 128 | Aspartate Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 129 | Asthma | FAERS: 2 | US FAERS | |
| 130 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 131 | Bedridden | FAERS: 2 | US FAERS | |
| 132 | Blindness | FAERS: 2 | US FAERS | |
| 133 | Blood alkaline phosphatase increased | FAERS: 2 | US FAERS | |
| 134 | Bone density decreased | FAERS: 2 | US FAERS | |
| 135 | Cholangitis | FAERS: 2 | US FAERS | |
| 136 | Colitis | FAERS: 2 | US FAERS | |
| 137 | Crying | FAERS: 2 | US FAERS | |
| 138 | Cystitis | FAERS: 2 | US FAERS | |
| 139 | Cyst | FAERS: 2 | US FAERS | |
| 140 | Disseminated Intravascular Coagulation | FAERS: 2 | US FAERS | |
| 141 | Dysarthria | FAERS: 2 | US FAERS | |
| 142 | Epistaxis | FAERS: 2 | US FAERS | |
| 143 | Erythema | FAERS: 2 | US FAERS | |
| 144 | Gamma-Glutamyltransferase Increased | FAERS: 2 | US FAERS | |
| 145 | Gastrointestinal Pain | FAERS: 2 | US FAERS | |
| 146 | Gastrointestinal infection | FAERS: 2 | US FAERS | |
| 147 | Granuloma | FAERS: 2 | US FAERS | |
| 148 | Hernia | FAERS: 2 | US FAERS | |
| 149 | Hormone level abnormal | FAERS: 2 | US FAERS | |
| 150 | Hunger | FAERS: 2 | US FAERS | |
| 151 | Hypotension | FAERS: 2 | US FAERS | |
| 152 | Impaired work ability | FAERS: 2 | US FAERS | |
| 153 | Inappropriate schedule of product administration | FAERS: 2 | US FAERS | |
| 154 | Incorrect route of product administration | FAERS: 2 | US FAERS | |
| 155 | Infection | FAERS: 2 | US FAERS | |
| 156 | Inflammation | FAERS: 2 | US FAERS | |
| 157 | Injection site infection | FAERS: 2 | US FAERS | |
| 158 | Injection site necrosis | FAERS: 2 | US FAERS | |
| 159 | Joint stiffness | FAERS: 2 | US FAERS | |
| 160 | Joint swelling | FAERS: 2 | US FAERS | |
| 161 | Laryngitis | FAERS: 2 | US FAERS | |
| 162 | Lymphadenopathy | FAERS: 2 | US FAERS | |
| 163 | Magnesium Deficiency | FAERS: 2 | US FAERS | |
| 164 | Menorrhagia | FAERS: 2 | US FAERS | |
| 165 | Microlithiasis | FAERS: 2 | US FAERS | |
| 166 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 167 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 168 | Nerve injury | FAERS: 2 | US FAERS | |
| 169 | Poor quality sleep | FAERS: 2 | US FAERS | |
| 170 | Presyncope | FAERS: 2 | US FAERS | |
| 171 | Product physical consistency issue | FAERS: 2 | US FAERS | |
| 172 | Product storage error | FAERS: 2 | US FAERS | |
| 173 | Quality of life decreased | FAERS: 2 | US FAERS | |
| 174 | Sciatica | FAERS: 2 | US FAERS | |
| 175 | Septic Shock | FAERS: 2 | US FAERS | |
| 176 | Serotonin Syndrome | FAERS: 2 | US FAERS | |
| 177 | Thirst | FAERS: 2 | US FAERS | |
| 178 | Thrombosis | FAERS: 2 | US FAERS | |
| 179 | jaundice | FAERS: 2 | US FAERS | |
| 180 | Abdominal adhesions | FAERS: 1 | US FAERS | |
| 181 | Abdominal mass | FAERS: 1 | US FAERS | |
| 182 | Accidental overdose | FAERS: 1 | US FAERS | |
| 183 | Acral overgrowth | FAERS: 1 | US FAERS | |
| 184 | Administration related reaction | FAERS: 1 | US FAERS | |
| 185 | Ageusia | FAERS: 1 | US FAERS | |
| 186 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 187 | Amylase increased | FAERS: 1 | US FAERS | |
| 188 | Anger | FAERS: 1 | US FAERS | |
| 189 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 190 | Apathy | FAERS: 1 | US FAERS | |
| 191 | Aphagia | FAERS: 1 | US FAERS | |
| 192 | Aphonia | FAERS: 1 | US FAERS | |
| 193 | Arthropathy | FAERS: 1 | US FAERS | |
| 194 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 195 | Biliary Colic | FAERS: 1 | US FAERS | |
| 196 | Biliary Fistula | FAERS: 1 | US FAERS | |
| 197 | Bladder pain | FAERS: 1 | US FAERS | |
| 198 | Blighted ovum | FAERS: 1 | US FAERS | |
| 199 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 200 | Blood cortisol increased | FAERS: 1 | US FAERS | |
| 201 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 202 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 203 | Blood growth hormone abnormal | FAERS: 1 | US FAERS | |
| 204 | Blood growth hormone decreased | FAERS: 1 | US FAERS | |
| 205 | Blood homocysteine increased | FAERS: 1 | US FAERS | |
| 206 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 207 | Blood prolactin increased | FAERS: 1 | US FAERS | |
| 208 | Blood thyroid stimulating hormone decreased | FAERS: 1 | US FAERS | |
| 209 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 210 | Bone density abnormal | FAERS: 1 | US FAERS | |
| 211 | Bone pain | FAERS: 1 | US FAERS | |
| 212 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 213 | Burning sensation | FAERS: 1 | US FAERS | |
| 214 | Cancer Pain | FAERS: 1 | US FAERS | |
| 215 | Carcinoid Heart Disease | FAERS: 1 | US FAERS | |
| 216 | Carcinoid crisis | FAERS: 1 | US FAERS | |
| 217 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 218 | Cellulitis | FAERS: 1 | US FAERS | |
| 219 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 220 | Cytoreductive Surgery | FAERS: 1 | US FAERS | |
| 221 | Dark circles under eyes | FAERS: 1 | US FAERS | |
| 222 | Deafness | FAERS: 1 | US FAERS | |
| 223 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 224 | Depressed mood | FAERS: 1 | US FAERS | |
| 225 | Device difficult to use | FAERS: 1 | US FAERS | |
| 226 | Device malfunction | FAERS: 1 | US FAERS | |
| 227 | Device use error | FAERS: 1 | US FAERS | |
| 228 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 229 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 230 | Diplegia | FAERS: 1 | US FAERS | |
| 231 | Drug Dependence | FAERS: 1 | US FAERS | |
| 232 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 233 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 234 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 235 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 236 | Duodenitis | FAERS: 1 | US FAERS | |
| 237 | Dysgeusia | FAERS: 1 | US FAERS | |
| 238 | Emergency Care | FAERS: 1 | US FAERS | |
| 239 | Emotional distress | FAERS: 1 | US FAERS | |
| 240 | Endocarditis | FAERS: 1 | US FAERS | |
| 241 | Epilepsy | FAERS: 1 | US FAERS | |
| 242 | Excoriation | FAERS: 1 | US FAERS | |
| 243 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 244 | Eye irritation | FAERS: 1 | US FAERS | |
| 245 | Fat necrosis | FAERS: 1 | US FAERS | |
| 246 | Feeding tube complication | FAERS: 1 | US FAERS | |
| 247 | Feeling jittery | FAERS: 1 | US FAERS | |
| 248 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 249 | Gait inability | FAERS: 1 | US FAERS | |
| 250 | Gallbladder pain | FAERS: 1 | US FAERS | |
| 251 | Gastritis | FAERS: 1 | US FAERS | |
| 252 | Gastroenteritis norovirus | FAERS: 1 | US FAERS | |
| 253 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 254 | Gastrointestinal obstruction | FAERS: 1 | US FAERS | |
| 255 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 256 | Gastrointestinal stoma complication | FAERS: 1 | US FAERS | |
| 257 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 258 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 259 | Hepatic artery embolism | FAERS: 1 | US FAERS | |
| 260 | Hepatic cyst infection | FAERS: 1 | US FAERS | |
| 261 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 262 | Hyperlipasaemia | FAERS: 1 | US FAERS | |
| 263 | Hyperparathyroidism | FAERS: 1 | US FAERS | |
| 264 | Hyperplastic cholecystopathy | FAERS: 1 | US FAERS | |
| 265 | Hypersomnia | FAERS: 1 | US FAERS | |
| 266 | Hypersplenism | FAERS: 1 | US FAERS | |
| 267 | Hypokinesia | FAERS: 1 | US FAERS | |
| 268 | Hypophagia | FAERS: 1 | US FAERS | |
| 269 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 270 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 271 | Incorrect product administration duration | FAERS: 1 | US FAERS | |
| 272 | Inflammatory marker increased | FAERS: 1 | US FAERS | |
| 273 | Injection site extravasation | FAERS: 1 | US FAERS | |
| 274 | Injection site inflammation | FAERS: 1 | US FAERS | |
| 275 | Injection site injury | FAERS: 1 | US FAERS | |
| 276 | Injection site urticaria | FAERS: 1 | US FAERS | |
| 277 | Insulin-like growth factor decreased | FAERS: 1 | US FAERS | |
| 278 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 279 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 280 | Intestinal resection | FAERS: 1 | US FAERS | |
| 281 | Leukopenia | FAERS: 1 | US FAERS | |
| 282 | Lip swelling | FAERS: 1 | US FAERS | |
| 283 | Lipase increased | FAERS: 1 | US FAERS | |
| 284 | Liver Abscess | FAERS: 1 | US FAERS | |
| 285 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 286 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 287 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 288 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 289 | Macular degeneration | FAERS: 1 | US FAERS | |
| 290 | Malabsorption | FAERS: 1 | US FAERS | |
| 291 | Male Orgasmic Disorder | FAERS: 1 | US FAERS | |
| 292 | Mastication disorder | FAERS: 1 | US FAERS | |
| 293 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 294 | Meniscus injury | FAERS: 1 | US FAERS | |
| 295 | Metastatic Neoplasm | FAERS: 1 | US FAERS | |
| 296 | Mineral deficiency | FAERS: 1 | US FAERS | |
| 297 | Mood swings | FAERS: 1 | US FAERS | |
| 298 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 299 | Muscle abscess | FAERS: 1 | US FAERS | |
| 300 | Muscle strain | FAERS: 1 | US FAERS | |
| 301 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 302 | Nervous system neoplasm surgery | FAERS: 1 | US FAERS | |
| 303 | Nervousness | FAERS: 1 | US FAERS | |
| 304 | Neutropenia | FAERS: 1 | US FAERS | |
| 305 | Obstruction | FAERS: 1 | US FAERS | |
| 306 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 307 | Osteodystrophy | FAERS: 1 | US FAERS | |
| 308 | Osteoporosis | FAERS: 1 | US FAERS | |
| 309 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 310 | Paraplegia | FAERS: 1 | US FAERS | |
| 311 | Petechiae | FAERS: 1 | US FAERS | |
| 312 | Pharyngitis | FAERS: 1 | US FAERS | |
| 313 | Platelet count abnormal | FAERS: 1 | US FAERS | |
| 314 | Pneumatosis intestinalis | FAERS: 1 | US FAERS | |
| 315 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 316 | Post procedural bile leak | FAERS: 1 | US FAERS | |
| 317 | Pregnancy | FAERS: 1 | US FAERS | |
| 318 | Product administered at inappropriate site | FAERS: 1 | US FAERS | |
| 319 | Product deposit | FAERS: 1 | US FAERS | |
| 320 | Product leakage | FAERS: 1 | US FAERS | |
| 321 | Product physical issue | FAERS: 1 | US FAERS | |
| 322 | Productive Cough | FAERS: 1 | US FAERS | |
| 323 | Rectal tenesmus | FAERS: 1 | US FAERS | |
| 324 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 325 | Restlessness | FAERS: 1 | US FAERS | |
| 326 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 327 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 328 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 329 | Scab | FAERS: 1 | US FAERS | |
| 330 | Sinus headache | FAERS: 1 | US FAERS | |
| 331 | Skeletal injury | FAERS: 1 | US FAERS | |
| 332 | Skin hypertrophy | FAERS: 1 | US FAERS | |
| 333 | Skin irritation | FAERS: 1 | US FAERS | |
| 334 | Spinal fusion surgery | FAERS: 1 | US FAERS | |
| 335 | Splenomegaly | FAERS: 1 | US FAERS | |
| 336 | Steatohepatitis | FAERS: 1 | US FAERS | |
| 337 | Subcutaneous drug absorption impaired | FAERS: 1 | US FAERS | |
| 338 | Subileus | FAERS: 1 | US FAERS | |
| 339 | Swelling | FAERS: 1 | US FAERS | |
| 340 | Symptom recurrence | FAERS: 1 | US FAERS | |
| 341 | Tachycardia | FAERS: 1 | US FAERS | |
| 342 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 343 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 344 | Thyroidectomy | FAERS: 1 | US FAERS | |
| 345 | Tinnitus | FAERS: 1 | US FAERS | |
| 346 | Toothache | FAERS: 1 | US FAERS | |
| 347 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 348 | Transaminases increased | FAERS: 1 | US FAERS | |
| 349 | Trismus | FAERS: 1 | US FAERS | |
| 350 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 351 | Urine output increased | FAERS: 1 | US FAERS | |
| 352 | Very low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 353 | Vital functions abnormal | FAERS: 1 | US FAERS | |
| 354 | Vitamin A Deficiency | FAERS: 1 | US FAERS | |
| 355 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 356 | Vitamin K Deficiency | FAERS: 1 | US FAERS | |
| 357 | Vitreous degeneration | FAERS: 1 | US FAERS | |
| 358 | Wheezing | FAERS: 1 | US FAERS | |
| 359 | muscle injury | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.