CID 129626832
(BVISQZFBLRSESR-XSCWXTNMSA-N)
Structure
- SMILES
- NCCCC[C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)NC(C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N)C)[C@H](O)C)Cc1cnc[nH]1)CC(C)C)CCCCN)(C)C)CC(C)C)CC(C)C)CCCCN)CCC(=O)O)CC(C)C)CC(C)C)CCC(=O)O)CCCNC(=N)N)CCCNC(=N)N)CCCNC(=N)N)CC(C)C)CC(=O)O)CCC(=O)N)[C@H](CC)C)CO)NC(=O)CNC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](C(C)C)NC(=O)[C@@H](N)C)CO)CCC(=O)O)Cc1cnc[nH]1)CCC(=O)N)CC(C)C)CC(C)C)Cc1cnc[nH]1)CC(=O)O)CCCCN
- Molecular Formula:
- C174H300N56O49
- Molecular Weight:
- 3960.590
- Log P:
- 6.6678
- Hydrogen Bond Acceptor:
- 102
- Hydrogen Bond Donor:
- 61
- TPSA:
- 1738.6
- CAS Number(s):
- 247062-33-5
Synonym(s)
1.
CID 129626832
2.
Abaloparatide
External Link(s)
| PubChem Compound | 76943386 129626832 |
| BindingDB | 50246337 |
| CHEMBL | CHEMBL4084894 |
| DrugCentral | 5232 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Headache | FAERS: 684 | US FAERS | |
| 2 | Nausea | FAERS: 559 | US FAERS | |
| 3 | Product dose omission | FAERS: 493 | US FAERS | |
| 4 | Dizziness | FAERS: 429 | US FAERS | |
| 5 | Fatigue | FAERS: 334 | US FAERS | |
| 6 | Palpitations | FAERS: 334 | US FAERS | |
| 7 | Product quality issue | FAERS: 286 | US FAERS | |
| 8 | Wrong technique in product usage process | FAERS: 251 | US FAERS | |
| 9 | Back Pain | FAERS: 214 | US FAERS | |
| 10 | Drug dose omission | FAERS: 189 | US FAERS | |
| 11 | Arthralgia | FAERS: 160 | US FAERS | |
| 12 | Pain | FAERS: 152 | US FAERS | |
| 13 | Bone pain | FAERS: 148 | US FAERS | |
| 14 | Injection site bruising | FAERS: 128 | US FAERS | |
| 15 | Injection site pain | FAERS: 123 | US FAERS | |
| 16 | Adverse event | FAERS: 117 | US FAERS | |
| 17 | Feeling abnormal | FAERS: 116 | US FAERS | |
| 18 | Product storage error | FAERS: 114 | US FAERS | |
| 19 | Needle issue | FAERS: 113 | US FAERS | |
| 20 | Malaise | FAERS: 111 | US FAERS | |
| 21 | Vomiting | FAERS: 111 | US FAERS | |
| 22 | Myalgia | FAERS: 81 | US FAERS | |
| 23 | Asthenia | FAERS: 66 | US FAERS | |
| 24 | Product use issue | FAERS: 61 | US FAERS | |
| 25 | Abdominal discomfort | FAERS: 55 | US FAERS | |
| 26 | Vertigo | FAERS: 50 | US FAERS | |
| 27 | Constipation | FAERS: 49 | US FAERS | |
| 28 | Abdominal Pain | FAERS: 46 | US FAERS | |
| 29 | Alopecia | FAERS: 44 | US FAERS | |
| 30 | Memory impairment | FAERS: 44 | US FAERS | |
| 31 | Injection site erythema | FAERS: 41 | US FAERS | |
| 32 | Chest discomfort | FAERS: 40 | US FAERS | |
| 33 | Anxiety | FAERS: 39 | US FAERS | |
| 34 | Chest Pain | FAERS: 39 | US FAERS | |
| 35 | Tachycardia | FAERS: 39 | US FAERS | |
| 36 | Neck Pain | FAERS: 37 | US FAERS | |
| 37 | Pruritus | FAERS: 36 | US FAERS | |
| 38 | Flushing | FAERS: 35 | US FAERS | |
| 39 | Hypersensitivity | FAERS: 34 | US FAERS | |
| 40 | Tremor | FAERS: 33 | US FAERS | |
| 41 | Musculoskeletal Pain | FAERS: 31 | US FAERS | |
| 42 | Peripheral swelling | FAERS: 29 | US FAERS | |
| 43 | Urinary tract infection | FAERS: 28 | US FAERS | |
| 44 | Injection site pruritus | FAERS: 26 | US FAERS | |
| 45 | Tinnitus | FAERS: 24 | US FAERS | |
| 46 | Weight decreased | FAERS: 24 | US FAERS | |
| 47 | Head discomfort | FAERS: 23 | US FAERS | |
| 48 | Hypotension | FAERS: 22 | US FAERS | |
| 49 | Drug ineffective | FAERS: 21 | US FAERS | |
| 50 | Erythema | FAERS: 21 | US FAERS | |
| 51 | Nasopharyngitis | FAERS: 21 | US FAERS | |
| 52 | Visual Impairment | FAERS: 21 | US FAERS | |
| 53 | Chills | FAERS: 20 | US FAERS | |
| 54 | Injection Site Reaction | FAERS: 20 | US FAERS | |
| 55 | Nephrolithiasis | FAERS: 19 | US FAERS | |
| 56 | Influenza | FAERS: 18 | US FAERS | |
| 57 | Dyspepsia | FAERS: 17 | US FAERS | |
| 58 | Joint swelling | FAERS: 17 | US FAERS | |
| 59 | Nervousness | FAERS: 17 | US FAERS | |
| 60 | Somnolence | FAERS: 17 | US FAERS | |
| 61 | Urticaria | FAERS: 17 | US FAERS | |
| 62 | Toothache | FAERS: 16 | US FAERS | |
| 63 | Musculoskeletal stiffness | FAERS: 15 | US FAERS | |
| 64 | Product use complaint | FAERS: 15 | US FAERS | |
| 65 | Sinusitis | FAERS: 15 | US FAERS | |
| 66 | Burning sensation | FAERS: 14 | US FAERS | |
| 67 | Inappropriate schedule of drug administration | FAERS: 14 | US FAERS | |
| 68 | Musculoskeletal discomfort | FAERS: 14 | US FAERS | |
| 69 | No adverse event | FAERS: 14 | US FAERS | |
| 70 | Swelling | FAERS: 14 | US FAERS | |
| 71 | Atrial Fibrillation | FAERS: 13 | US FAERS | |
| 72 | Lethargy | FAERS: 13 | US FAERS | |
| 73 | Therapy cessation | FAERS: 13 | US FAERS | |
| 74 | Blood alkaline phosphatase increased | FAERS: 12 | US FAERS | |
| 75 | Dysgeusia | FAERS: 12 | US FAERS | |
| 76 | Pneumonia | FAERS: 12 | US FAERS | |
| 77 | Cerebrovascular accident | FAERS: 11 | US FAERS | |
| 78 | Expired product administered | FAERS: 11 | US FAERS | |
| 79 | Infection | FAERS: 10 | US FAERS | |
| 80 | Injection site urticaria | FAERS: 10 | US FAERS | |
| 81 | Liquid product physical issue | FAERS: 9 | US FAERS | |
| 82 | Medication Error | FAERS: 9 | US FAERS | |
| 83 | Arthritis | FAERS: 8 | US FAERS | |
| 84 | Arthropathy | FAERS: 8 | US FAERS | |
| 85 | Feeling jittery | FAERS: 8 | US FAERS | |
| 86 | Injury associated with device | FAERS: 8 | US FAERS | |
| 87 | Limb discomfort | FAERS: 8 | US FAERS | |
| 88 | Muscle tightness | FAERS: 8 | US FAERS | |
| 89 | Overdose | FAERS: 8 | US FAERS | |
| 90 | Accidental overdose | FAERS: 7 | US FAERS | |
| 91 | Flatulence | FAERS: 7 | US FAERS | |
| 92 | Loss of personal independence in daily activities | FAERS: 7 | US FAERS | |
| 93 | Multiple allergies | FAERS: 7 | US FAERS | |
| 94 | Oropharyngeal pain | FAERS: 7 | US FAERS | |
| 95 | Retching | FAERS: 7 | US FAERS | |
| 96 | Thirst | FAERS: 7 | US FAERS | |
| 97 | Urine output increased | FAERS: 7 | US FAERS | |
| 98 | Discomfort | FAERS: 6 | US FAERS | |
| 99 | Dry skin | FAERS: 6 | US FAERS | |
| 100 | Ear discomfort | FAERS: 6 | US FAERS | |
| 101 | Eye pain | FAERS: 6 | US FAERS | |
| 102 | Feeling Cold | FAERS: 6 | US FAERS | |
| 103 | Rash erythematous | FAERS: 6 | US FAERS | |
| 104 | Cardiac Flutter | FAERS: 5 | US FAERS | |
| 105 | Disorientation | FAERS: 5 | US FAERS | |
| 106 | Drug administration error | FAERS: 5 | US FAERS | |
| 107 | Dysuria | FAERS: 5 | US FAERS | |
| 108 | Gastric pH decreased | FAERS: 5 | US FAERS | |
| 109 | Hypersomnia | FAERS: 5 | US FAERS | |
| 110 | Incorrect dose administered | FAERS: 5 | US FAERS | |
| 111 | Incorrect route of product administration | FAERS: 5 | US FAERS | |
| 112 | Limb injury | FAERS: 5 | US FAERS | |
| 113 | Myocardial Infarction | FAERS: 5 | US FAERS | |
| 114 | Nocturia | FAERS: 5 | US FAERS | |
| 115 | Onychoclasis | FAERS: 5 | US FAERS | |
| 116 | Poor quality sleep | FAERS: 5 | US FAERS | |
| 117 | Product administered at inappropriate site | FAERS: 5 | US FAERS | |
| 118 | Product complaint | FAERS: 5 | US FAERS | |
| 119 | Product container issue | FAERS: 5 | US FAERS | |
| 120 | Syncope | FAERS: 5 | US FAERS | |
| 121 | Therapeutic response unexpected | FAERS: 5 | US FAERS | |
| 122 | Acne | FAERS: 4 | US FAERS | |
| 123 | Agitation | FAERS: 4 | US FAERS | |
| 124 | Amnesia | FAERS: 4 | US FAERS | |
| 125 | Arthropod bite | FAERS: 4 | US FAERS | |
| 126 | Blood pressure fluctuation | FAERS: 4 | US FAERS | |
| 127 | Bone density decreased | FAERS: 4 | US FAERS | |
| 128 | Cystitis | FAERS: 4 | US FAERS | |
| 129 | Dehydration | FAERS: 4 | US FAERS | |
| 130 | Epistaxis | FAERS: 4 | US FAERS | |
| 131 | Fear of falling | FAERS: 4 | US FAERS | |
| 132 | Fibromyalgia | FAERS: 4 | US FAERS | |
| 133 | Fracture | FAERS: 4 | US FAERS | |
| 134 | Inappropriate schedule of product administration | FAERS: 4 | US FAERS | |
| 135 | Intestinal Obstruction | FAERS: 4 | US FAERS | |
| 136 | Joint injury | FAERS: 4 | US FAERS | |
| 137 | Joint stiffness | FAERS: 4 | US FAERS | |
| 138 | Muscle strain | FAERS: 4 | US FAERS | |
| 139 | Presyncope | FAERS: 4 | US FAERS | |
| 140 | Renal pain | FAERS: 4 | US FAERS | |
| 141 | Sensation of blood flow | FAERS: 4 | US FAERS | |
| 142 | Skin laceration | FAERS: 4 | US FAERS | |
| 143 | Sluggishness | FAERS: 4 | US FAERS | |
| 144 | Stress | FAERS: 4 | US FAERS | |
| 145 | Throat irritation | FAERS: 4 | US FAERS | |
| 146 | Waist circumference increased | FAERS: 4 | US FAERS | |
| 147 | Wrong technique in device usage process | FAERS: 4 | US FAERS | |
| 148 | Accidental underdose | FAERS: 3 | US FAERS | |
| 149 | Ankle Fracture | FAERS: 3 | US FAERS | |
| 150 | Asthma | FAERS: 3 | US FAERS | |
| 151 | Blood glucose decreased | FAERS: 3 | US FAERS | |
| 152 | Blood potassium increased | FAERS: 3 | US FAERS | |
| 153 | Blood urine present | FAERS: 3 | US FAERS | |
| 154 | Cardiac discomfort | FAERS: 3 | US FAERS | |
| 155 | Crying | FAERS: 3 | US FAERS | |
| 156 | Depressed mood | FAERS: 3 | US FAERS | |
| 157 | Device use issue | FAERS: 3 | US FAERS | |
| 158 | Dysphonia | FAERS: 3 | US FAERS | |
| 159 | Eructation | FAERS: 3 | US FAERS | |
| 160 | Growing pains | FAERS: 3 | US FAERS | |
| 161 | Hernia | FAERS: 3 | US FAERS | |
| 162 | Impaired driving ability | FAERS: 3 | US FAERS | |
| 163 | Inflammation | FAERS: 3 | US FAERS | |
| 164 | Injection site discomfort | FAERS: 3 | US FAERS | |
| 165 | Injection site vesicles | FAERS: 3 | US FAERS | |
| 166 | Multiple use of single-use product | FAERS: 3 | US FAERS | |
| 167 | Neuralgia | FAERS: 3 | US FAERS | |
| 168 | Night sweats | FAERS: 3 | US FAERS | |
| 169 | Photophobia | FAERS: 3 | US FAERS | |
| 170 | Restless Legs Syndrome | FAERS: 3 | US FAERS | |
| 171 | Restlessness | FAERS: 3 | US FAERS | |
| 172 | Serum procollagen type I N-terminal propeptide decreased | FAERS: 3 | US FAERS | |
| 173 | Skin irritation | FAERS: 3 | US FAERS | |
| 174 | Skin texture abnormal | FAERS: 3 | US FAERS | |
| 175 | Spinal column stenosis | FAERS: 3 | US FAERS | |
| 176 | Stomatitis | FAERS: 3 | US FAERS | |
| 177 | Tachyphrenia | FAERS: 3 | US FAERS | |
| 178 | Thrombosis | FAERS: 3 | US FAERS | |
| 179 | Trismus | FAERS: 3 | US FAERS | |
| 180 | Wheezing | FAERS: 3 | US FAERS | |
| 181 | Accidental exposure to product | FAERS: 2 | US FAERS | |
| 182 | Anger | FAERS: 2 | US FAERS | |
| 183 | Apathy | FAERS: 2 | US FAERS | |
| 184 | Aphasia | FAERS: 2 | US FAERS | |
| 185 | Aphonia | FAERS: 2 | US FAERS | |
| 186 | Back disorder | FAERS: 2 | US FAERS | |
| 187 | Blepharospasm | FAERS: 2 | US FAERS | |
| 188 | Blood cholesterol increased | FAERS: 2 | US FAERS | |
| 189 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 190 | Bowel movement irregularity | FAERS: 2 | US FAERS | |
| 191 | Bronchitis | FAERS: 2 | US FAERS | |
| 192 | Chromatopsia | FAERS: 2 | US FAERS | |
| 193 | Cold sweat | FAERS: 2 | US FAERS | |
| 194 | Deafness | FAERS: 2 | US FAERS | |
| 195 | Delayed sleep phase | FAERS: 2 | US FAERS | |
| 196 | Dyschezia | FAERS: 2 | US FAERS | |
| 197 | Eczema | FAERS: 2 | US FAERS | |
| 198 | Elective procedure | FAERS: 2 | US FAERS | |
| 199 | Emotional disorder | FAERS: 2 | US FAERS | |
| 200 | Emotional distress | FAERS: 2 | US FAERS | |
| 201 | Excessive cerumen production | FAERS: 2 | US FAERS | |
| 202 | Eye irritation | FAERS: 2 | US FAERS | |
| 203 | Food Poisoning | FAERS: 2 | US FAERS | |
| 204 | Food aversion | FAERS: 2 | US FAERS | |
| 205 | Gastric Dilatation | FAERS: 2 | US FAERS | |
| 206 | Glaucoma | FAERS: 2 | US FAERS | |
| 207 | Hemiparesis | FAERS: 2 | US FAERS | |
| 208 | Hip surgery | FAERS: 2 | US FAERS | |
| 209 | Hyperthyroidism | FAERS: 2 | US FAERS | |
| 210 | Hypogeusia | FAERS: 2 | US FAERS | |
| 211 | Impaired quality of life | FAERS: 2 | US FAERS | |
| 212 | Impaired work ability | FAERS: 2 | US FAERS | |
| 213 | Inability to afford medication | FAERS: 2 | US FAERS | |
| 214 | Incision site vesicles | FAERS: 2 | US FAERS | |
| 215 | Incorrect dose administered by device | FAERS: 2 | US FAERS | |
| 216 | Increased upper airway secretion | FAERS: 2 | US FAERS | |
| 217 | Increased viscosity of upper respiratory secretion | FAERS: 2 | US FAERS | |
| 218 | Injection site dryness | FAERS: 2 | US FAERS | |
| 219 | Injection site mass | FAERS: 2 | US FAERS | |
| 220 | Lactose Intolerance | FAERS: 2 | US FAERS | |
| 221 | Laryngitis | FAERS: 2 | US FAERS | |
| 222 | Limb mass | FAERS: 2 | US FAERS | |
| 223 | Medical device removal | FAERS: 2 | US FAERS | |
| 224 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 225 | Nerve injury | FAERS: 2 | US FAERS | |
| 226 | Oral pain | FAERS: 2 | US FAERS | |
| 227 | Pain of skin | FAERS: 2 | US FAERS | |
| 228 | Pancreatitis | FAERS: 2 | US FAERS | |
| 229 | Product administration error | FAERS: 2 | US FAERS | |
| 230 | Product contamination with body fluid | FAERS: 2 | US FAERS | |
| 231 | Product expiration date issue | FAERS: 2 | US FAERS | |
| 232 | Product leakage | FAERS: 2 | US FAERS | |
| 233 | Product physical issue | FAERS: 2 | US FAERS | |
| 234 | Respiratory tract congestion | FAERS: 2 | US FAERS | |
| 235 | Rheumatoid Arthritis | FAERS: 2 | US FAERS | |
| 236 | Rosacea | FAERS: 2 | US FAERS | |
| 237 | Sight disability | FAERS: 2 | US FAERS | |
| 238 | Skin lesion | FAERS: 2 | US FAERS | |
| 239 | Soft tissue mass | FAERS: 2 | US FAERS | |
| 240 | Supraventricular tachycardia | FAERS: 2 | US FAERS | |
| 241 | Syringe issue | FAERS: 2 | US FAERS | |
| 242 | Thoracic vertebral fracture | FAERS: 2 | US FAERS | |
| 243 | Thrombocytopenia | FAERS: 2 | US FAERS | |
| 244 | Tongue pruritus | FAERS: 2 | US FAERS | |
| 245 | Ulcer | FAERS: 2 | US FAERS | |
| 246 | Unevaluable event | FAERS: 2 | US FAERS | |
| 247 | Urine calcium increased | FAERS: 2 | US FAERS | |
| 248 | Walking aid user | FAERS: 2 | US FAERS | |
| 249 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 250 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 251 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 252 | Adnexa uteri pain | FAERS: 1 | US FAERS | |
| 253 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 254 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 255 | Appendicitis | FAERS: 1 | US FAERS | |
| 256 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 257 | Atypical pneumonia | FAERS: 1 | US FAERS | |
| 258 | Aura | FAERS: 1 | US FAERS | |
| 259 | Bedridden | FAERS: 1 | US FAERS | |
| 260 | Bladder pain | FAERS: 1 | US FAERS | |
| 261 | Bladder spasm | FAERS: 1 | US FAERS | |
| 262 | Blepharitis | FAERS: 1 | US FAERS | |
| 263 | Blindness | FAERS: 1 | US FAERS | |
| 264 | Blood blister | FAERS: 1 | US FAERS | |
| 265 | Blood calcium abnormal | FAERS: 1 | US FAERS | |
| 266 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 267 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 268 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 269 | Blood iron abnormal | FAERS: 1 | US FAERS | |
| 270 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 271 | Blood parathyroid hormone abnormal | FAERS: 1 | US FAERS | |
| 272 | Blood parathyroid hormone decreased | FAERS: 1 | US FAERS | |
| 273 | Blood parathyroid hormone increased | FAERS: 1 | US FAERS | |
| 274 | Blood phosphorus increased | FAERS: 1 | US FAERS | |
| 275 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 276 | Blood urea increased | FAERS: 1 | US FAERS | |
| 277 | Bone density abnormal | FAERS: 1 | US FAERS | |
| 278 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 279 | Breast tenderness | FAERS: 1 | US FAERS | |
| 280 | Carotid artery occlusion | FAERS: 1 | US FAERS | |
| 281 | Cataract operation | FAERS: 1 | US FAERS | |
| 282 | Cheilitis | FAERS: 1 | US FAERS | |
| 283 | Chemotherapy | FAERS: 1 | US FAERS | |
| 284 | Chromaturia | FAERS: 1 | US FAERS | |
| 285 | Cluster Headache | FAERS: 1 | US FAERS | |
| 286 | Colitis | FAERS: 1 | US FAERS | |
| 287 | Creatinine renal clearance increased | FAERS: 1 | US FAERS | |
| 288 | Dental Restoration Failure | FAERS: 1 | US FAERS | |
| 289 | Dental caries | FAERS: 1 | US FAERS | |
| 290 | Device breakage | FAERS: 1 | US FAERS | |
| 291 | Device leakage | FAERS: 1 | US FAERS | |
| 292 | Disability | FAERS: 1 | US FAERS | |
| 293 | Disease Progression | FAERS: 1 | US FAERS | |
| 294 | Diverticular perforation | FAERS: 1 | US FAERS | |
| 295 | Diverticulitis | FAERS: 1 | US FAERS | |
| 296 | Drug administered at inappropriate site | FAERS: 1 | US FAERS | |
| 297 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 298 | Drug dose omission by device | FAERS: 1 | US FAERS | |
| 299 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 300 | Dysarthria | FAERS: 1 | US FAERS | |
| 301 | Dysphemia | FAERS: 1 | US FAERS | |
| 302 | Ear congestion | FAERS: 1 | US FAERS | |
| 303 | Endodontic procedure | FAERS: 1 | US FAERS | |
| 304 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 305 | Epilepsy | FAERS: 1 | US FAERS | |
| 306 | Essential Tremor | FAERS: 1 | US FAERS | |
| 307 | Euphoric mood | FAERS: 1 | US FAERS | |
| 308 | Exfoliative rash | FAERS: 1 | US FAERS | |
| 309 | External ear pain | FAERS: 1 | US FAERS | |
| 310 | Extraocular Muscle Paresis | FAERS: 1 | US FAERS | |
| 311 | Eye Infection | FAERS: 1 | US FAERS | |
| 312 | Eye symptom | FAERS: 1 | US FAERS | |
| 313 | Eyelid rash | FAERS: 1 | US FAERS | |
| 314 | Eyelids pruritus | FAERS: 1 | US FAERS | |
| 315 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 316 | Flank Pain | FAERS: 1 | US FAERS | |
| 317 | Food craving | FAERS: 1 | US FAERS | |
| 318 | Formication | FAERS: 1 | US FAERS | |
| 319 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 320 | Gastritis | FAERS: 1 | US FAERS | |
| 321 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 322 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 323 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 324 | Gastrointestinal ulcer | FAERS: 1 | US FAERS | |
| 325 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 326 | Granuloma Annulare | FAERS: 1 | US FAERS | |
| 327 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 328 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 329 | Hyperparathyroidism | FAERS: 1 | US FAERS | |
| 330 | Hyperventilation | FAERS: 1 | US FAERS | |
| 331 | Hypophagia | FAERS: 1 | US FAERS | |
| 332 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 333 | Idiopathic Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 334 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 335 | Incorrect dose administered by product | FAERS: 1 | US FAERS | |
| 336 | Injection related reaction | FAERS: 1 | US FAERS | |
| 337 | Injection site extravasation | FAERS: 1 | US FAERS | |
| 338 | Injection site hypersensitivity | FAERS: 1 | US FAERS | |
| 339 | Injection site hypertrophy | FAERS: 1 | US FAERS | |
| 340 | Injection site inflammation | FAERS: 1 | US FAERS | |
| 341 | Injection site irritation | FAERS: 1 | US FAERS | |
| 342 | Injection site nodule | FAERS: 1 | US FAERS | |
| 343 | Injection site scab | FAERS: 1 | US FAERS | |
| 344 | Insurance issue | FAERS: 1 | US FAERS | |
| 345 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 346 | Intervertebral disc disorder | FAERS: 1 | US FAERS | |
| 347 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 348 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 349 | Laceration | FAERS: 1 | US FAERS | |
| 350 | Lack of spontaneous speech | FAERS: 1 | US FAERS | |
| 351 | Limb operation | FAERS: 1 | US FAERS | |
| 352 | Lip swelling | FAERS: 1 | US FAERS | |
| 353 | Loose tooth | FAERS: 1 | US FAERS | |
| 354 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 355 | Lower respiratory tract congestion | FAERS: 1 | US FAERS | |
| 356 | Lupus-like syndrome | FAERS: 1 | US FAERS | |
| 357 | Lymphocyte count abnormal | FAERS: 1 | US FAERS | |
| 358 | Macule | FAERS: 1 | US FAERS | |
| 359 | Malabsorption | FAERS: 1 | US FAERS | |
| 360 | Mandibular mass | FAERS: 1 | US FAERS | |
| 361 | Medical device site joint infection | FAERS: 1 | US FAERS | |
| 362 | Mental impairment | FAERS: 1 | US FAERS | |
| 363 | Middle insomnia | FAERS: 1 | US FAERS | |
| 364 | Motion Sickness | FAERS: 1 | US FAERS | |
| 365 | Mouth swelling | FAERS: 1 | US FAERS | |
| 366 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 367 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 368 | Narcolepsy | FAERS: 1 | US FAERS | |
| 369 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 370 | Nodule | FAERS: 1 | US FAERS | |
| 371 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 372 | Off label use of device | FAERS: 1 | US FAERS | |
| 373 | Onychomycosis | FAERS: 1 | US FAERS | |
| 374 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 375 | Orthostatic hypertension | FAERS: 1 | US FAERS | |
| 376 | Osteitis Deformans | FAERS: 1 | US FAERS | |
| 377 | Osteomalacia | FAERS: 1 | US FAERS | |
| 378 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 379 | Palmar erythema | FAERS: 1 | US FAERS | |
| 380 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 381 | Pelvic Floor Muscle Weakness | FAERS: 1 | US FAERS | |
| 382 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 383 | Pelvic discomfort | FAERS: 1 | US FAERS | |
| 384 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 385 | Peripheral arterial occlusive disease | FAERS: 1 | US FAERS | |
| 386 | Plantar erythema | FAERS: 1 | US FAERS | |
| 387 | Polymyalgia Rheumatica | FAERS: 1 | US FAERS | |
| 388 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 389 | Portal Hypertension | FAERS: 1 | US FAERS | |
| 390 | Post procedural complication | FAERS: 1 | US FAERS | |
| 391 | Post-traumatic pain | FAERS: 1 | US FAERS | |
| 392 | Postoperative wound complication | FAERS: 1 | US FAERS | |
| 393 | Procedural shock | FAERS: 1 | US FAERS | |
| 394 | Procollagen type I C-terminal propeptide increased | FAERS: 1 | US FAERS | |
| 395 | Product administration interrupted | FAERS: 1 | US FAERS | |
| 396 | Product contamination | FAERS: 1 | US FAERS | |
| 397 | Product distribution issue | FAERS: 1 | US FAERS | |
| 398 | Product intolerance | FAERS: 1 | US FAERS | |
| 399 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 400 | Protein total abnormal | FAERS: 1 | US FAERS | |
| 401 | Protein total decreased | FAERS: 1 | US FAERS | |
| 402 | Proteinuria | FAERS: 1 | US FAERS | |
| 403 | Psoriasis | FAERS: 1 | US FAERS | |
| 404 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 405 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 406 | Purpura | FAERS: 1 | US FAERS | |
| 407 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 408 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 409 | Radiation associated pain | FAERS: 1 | US FAERS | |
| 410 | Reflux gastritis | FAERS: 1 | US FAERS | |
| 411 | Renal cyst | FAERS: 1 | US FAERS | |
| 412 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 413 | Respiratory distress | FAERS: 1 | US FAERS | |
| 414 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 415 | Sarcoidosis | FAERS: 1 | US FAERS | |
| 416 | Scab | FAERS: 1 | US FAERS | |
| 417 | Sciatica | FAERS: 1 | US FAERS | |
| 418 | Secretion discharge | FAERS: 1 | US FAERS | |
| 419 | Self-induced vomiting | FAERS: 1 | US FAERS | |
| 420 | Sepsis | FAERS: 1 | US FAERS | |
| 421 | Seroma | FAERS: 1 | US FAERS | |
| 422 | Serum procollagen type I N-terminal propeptide increased | FAERS: 1 | US FAERS | |
| 423 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 424 | Sinus headache | FAERS: 1 | US FAERS | |
| 425 | Skeletal injury | FAERS: 1 | US FAERS | |
| 426 | Skin Induration | FAERS: 1 | US FAERS | |
| 427 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 428 | Skin tightness | FAERS: 1 | US FAERS | |
| 429 | Sleep Talking | FAERS: 1 | US FAERS | |
| 430 | Sneezing | FAERS: 1 | US FAERS | |
| 431 | Spinal fusion surgery | FAERS: 1 | US FAERS | |
| 432 | Spinal rod insertion | FAERS: 1 | US FAERS | |
| 433 | Spinal rod removal | FAERS: 1 | US FAERS | |
| 434 | Squamous cell carcinoma of lung | FAERS: 1 | US FAERS | |
| 435 | Synovial Cyst | FAERS: 1 | US FAERS | |
| 436 | Terminal state | FAERS: 1 | US FAERS | |
| 437 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 438 | Tongue movement disturbance | FAERS: 1 | US FAERS | |
| 439 | Tongue spasm | FAERS: 1 | US FAERS | |
| 440 | Tooth Infection | FAERS: 1 | US FAERS | |
| 441 | Tooth repair | FAERS: 1 | US FAERS | |
| 442 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 443 | Tracheostomy malfunction | FAERS: 1 | US FAERS | |
| 444 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 445 | Urinary Retention | FAERS: 1 | US FAERS | |
| 446 | Vascular pain | FAERS: 1 | US FAERS | |
| 447 | Vertebroplasty | FAERS: 1 | US FAERS | |
| 448 | Vocal cord cyst | FAERS: 1 | US FAERS | |
| 449 | Wrong product stored | FAERS: 1 | US FAERS | |
| 450 | kyphosis | FAERS: 1 | US FAERS | |
| 451 | muscle injury | FAERS: 1 | US FAERS | |
| 452 | nervous system disorder | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.