Febuxostat
(BQSJTQLCZDPROO-UHFFFAOYSA-N)
Structure
- SMILES
- N#Cc1cc(ccc1OCC(C)C)c1nc(c(s1)C(=O)O)C
- Type(s)
- Approved
- ATC code(s)
- M04AA03
- Molecular Formula:
- C16H16N2O3S
- Molecular Weight:
- 316.375
- Log P:
- 3.7232
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 1
- TPSA:
- 111.45
- CAS Number(s):
- 144060-53-7
Synonym(s)
1.
Febuxostat
2.
2-(3-cyano-4-isobutoxyphenyl)-4-methyl-5-thiazolecarboxylic acid
3.
TEI 6720
4.
TEI-6720
5.
Uloric
6.
6720, TEI
7.
TEI6720
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Gout | FAERS: 189 Canada Vigilance: 3 | 26968635 | CTD SIDER Canada Vigilance US FAERS |
| 2 | Nausea | FAERS: 87 | SIDER US FAERS | |
| 3 | Drug ineffective | FAERS: 78 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 4 | Arthralgia | FAERS: 66 | SIDER US FAERS | |
| 5 | Dizziness | FAERS: 54 | SIDER US FAERS | |
| 6 | Blood creatinine increased | FAERS: 47 | SIDER US FAERS | |
| 7 | Headache | FAERS: 39 | SIDER US FAERS | |
| 8 | Pruritus | FAERS: 38 | SIDER US FAERS | |
| 9 | Myocardial Infarction | FAERS: 30 | SIDER US FAERS | |
| 10 | No adverse event | FAERS: 30 | US FAERS | |
| 11 | Vomiting | FAERS: 30 | SIDER US FAERS | |
| 12 | Urticaria | FAERS: 28 | SIDER US FAERS | |
| 13 | Stevens-Johnson Syndrome | FAERS: 27 | SIDER US FAERS | |
| 14 | Chest Pain | FAERS: 25 | SIDER US FAERS | |
| 15 | Fatigue | FAERS: 25 | SIDER US FAERS | |
| 16 | Abdominal discomfort | FAERS: 24 | SIDER US FAERS | |
| 17 | Myalgia | FAERS: 23 | SIDER US FAERS | |
| 18 | Hypersensitivity | FAERS: 22 | SIDER US FAERS | |
| 19 | Cerebrovascular accident | FAERS: 19 | SIDER US FAERS | |
| 20 | Malaise | FAERS: 19 | US FAERS | |
| 21 | Alanine Aminotransferase Increased | FAERS: 16 | US FAERS | |
| 22 | Erythema | FAERS: 15 | SIDER US FAERS | |
| 23 | Wrong technique in product usage process | FAERS: 15 | US FAERS | |
| 24 | Asthenia | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 25 | Blood creatine phosphokinase increased | FAERS: 14 | US FAERS | |
| 26 | Palpitations | FAERS: 14 | SIDER US FAERS | |
| 27 | Pain | FAERS: 13 | SIDER US FAERS | |
| 28 | Peripheral swelling | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 29 | jaundice | FAERS: 13 | SIDER US FAERS | |
| 30 | Alopecia | FAERS: 11 | SIDER US FAERS | |
| 31 | Aspartate Aminotransferase Increased | FAERS: 11 | US FAERS | |
| 32 | Chromaturia | FAERS: 11 | US FAERS | |
| 33 | Joint swelling | FAERS: 11 | SIDER US FAERS | |
| 34 | Pancreatitis | FAERS: 11 | SIDER US FAERS | |
| 35 | Pneumonia | FAERS: 11 | US FAERS | |
| 36 | Thrombocytopenia | FAERS: 11 | SIDER US FAERS | |
| 37 | Abdominal Pain | FAERS: 10 | SIDER US FAERS | |
| 38 | Rhabdomyolysis | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 39 | Swelling | FAERS: 10 | US FAERS | |
| 40 | Acute kidney injury | FAERS: 9 | US FAERS | |
| 41 | Acute myocardial infarction | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 42 | Chills | FAERS: 9 | US FAERS | |
| 43 | Drug prescribing error | FAERS: 9 | US FAERS | |
| 44 | Nephrolithiasis | FAERS: 9 | SIDER US FAERS | |
| 45 | Somnolence | FAERS: 9 | SIDER US FAERS | |
| 46 | Anxiety | FAERS: 8 | SIDER US FAERS | |
| 47 | Dysuria | FAERS: 8 | US FAERS | |
| 48 | Feeling abnormal | FAERS: 8 | SIDER US FAERS | |
| 49 | Constipation | FAERS: 7 | SIDER US FAERS | |
| 50 | Creatinine renal clearance decreased | FAERS: 7 | US FAERS | |
| 51 | Dysgeusia | FAERS: 7 | SIDER US FAERS | |
| 52 | Overdose | FAERS: 7 | US FAERS | |
| 53 | Sepsis | FAERS: 7 | US FAERS | |
| 54 | White blood cell count decreased | FAERS: 7 | US FAERS | |
| 55 | Adverse event | FAERS: 6 | US FAERS | |
| 56 | Blood potassium increased | FAERS: 6 | SIDER US FAERS | |
| 57 | Blood triglycerides increased | FAERS: 6 | SIDER US FAERS | |
| 58 | Gamma-Glutamyltransferase Increased | FAERS: 6 | US FAERS | |
| 59 | Nasopharyngitis | FAERS: 6 | US FAERS | |
| 60 | Oropharyngeal pain | FAERS: 6 | US FAERS | |
| 61 | Tremor | FAERS: 6 | SIDER US FAERS | |
| 62 | Visual Impairment | FAERS: 6 | US FAERS | |
| 63 | Atrial Fibrillation | FAERS: 5 | SIDER US FAERS | |
| 64 | Blood glucose increased | FAERS: 5 | SIDER US FAERS | |
| 65 | Blood urea increased | FAERS: 5 | SIDER US FAERS | |
| 66 | Blood uric acid abnormal | FAERS: 5 | US FAERS | |
| 67 | Blood uric acid decreased | FAERS: 5 | US FAERS | |
| 68 | Dehydration | FAERS: 5 | SIDER US FAERS | |
| 69 | General physical health deterioration | FAERS: 5 | US FAERS | |
| 70 | Tinnitus | FAERS: 5 | SIDER US FAERS | |
| 71 | Blood potassium decreased | FAERS: 4 | US FAERS | |
| 72 | Burning sensation | FAERS: 4 | US FAERS | |
| 73 | Chest discomfort | FAERS: 4 | SIDER US FAERS | |
| 74 | Deep Vein Thrombosis | FAERS: 4 | US FAERS | |
| 75 | Erectile dysfunction | FAERS: 4 | SIDER US FAERS | |
| 76 | Inflammation | FAERS: 4 | 26036690 | CTD US FAERS |
| 77 | Lip swelling | FAERS: 4 | US FAERS | |
| 78 | Musculoskeletal Pain | FAERS: 4 | SIDER US FAERS | |
| 79 | Neck Pain | FAERS: 4 | US FAERS | |
| 80 | Nervousness | FAERS: 4 | SIDER US FAERS | |
| 81 | Pancytopenia | FAERS: 4 | SIDER US FAERS | |
| 82 | Prescribed overdose | FAERS: 4 | US FAERS | |
| 83 | Psoriasis | FAERS: 4 | US FAERS | |
| 84 | Pulmonary Embolism | FAERS: 4 | US FAERS | |
| 85 | Skin reaction | FAERS: 4 | US FAERS | |
| 86 | Tachycardia | FAERS: 4 | SIDER US FAERS | |
| 87 | Urinary Retention | FAERS: 4 | US FAERS | |
| 88 | Amnesia | FAERS: 3 | US FAERS | |
| 89 | Back Pain | FAERS: 3 | US FAERS | |
| 90 | Blood lactate dehydrogenase increased | FAERS: 3 | SIDER US FAERS | |
| 91 | Bone pain | FAERS: 3 | US FAERS | |
| 92 | Cardiac Arrest | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 93 | Cellulitis | FAERS: 3 | US FAERS | |
| 94 | Dyspepsia | FAERS: 3 | SIDER US FAERS | |
| 95 | Epistaxis | FAERS: 3 | SIDER US FAERS | |
| 96 | Hemiparesis | FAERS: 3 | SIDER US FAERS | |
| 97 | Hypertensive crisis | FAERS: 3 | US FAERS | |
| 98 | Joint stiffness | FAERS: 3 | SIDER US FAERS | |
| 99 | Lymphoma | FAERS: 3 | US FAERS | |
| 100 | Night sweats | FAERS: 3 | US FAERS | |
| 101 | Pericardial effusion | FAERS: 3 | US FAERS | |
| 102 | Presyncope | FAERS: 3 | US FAERS | |
| 103 | Respiratory Failure | FAERS: 3 | US FAERS | |
| 104 | Skin lesion | FAERS: 3 | SIDER US FAERS | |
| 105 | Syncope | FAERS: 3 | US FAERS | |
| 106 | Therapy cessation | FAERS: 3 | US FAERS | |
| 107 | Unresponsive to stimuli | FAERS: 3 | US FAERS | |
| 108 | Urinary Incontinence | FAERS: 3 | US FAERS | |
| 109 | Urinary tract infection | FAERS: 3 | US FAERS | |
| 110 | Vasculitis | FAERS: 3 | US FAERS | |
| 111 | Weight decreased | FAERS: 3 | SIDER US FAERS | |
| 112 | Altered state of consciousness | FAERS: 2 | US FAERS | |
| 113 | Anaphylactic shock | FAERS: 2 | SIDER US FAERS | |
| 114 | Angioedema | FAERS: 2 | SIDER US FAERS | |
| 115 | Aphasia | FAERS: 2 | US FAERS | |
| 116 | Arthritis | FAERS: 2 | SIDER US FAERS | |
| 117 | Bedridden | FAERS: 2 | US FAERS | |
| 118 | Blood cholesterol increased | FAERS: 2 | US FAERS | |
| 119 | Blood creatinine abnormal | FAERS: 2 | US FAERS | |
| 120 | Blood urine present | FAERS: 2 | US FAERS | |
| 121 | Cold sweat | FAERS: 2 | US FAERS | |
| 122 | Coronary Artery Disease | FAERS: 2 | US FAERS | |
| 123 | Cyst | FAERS: 2 | US FAERS | |
| 124 | Dementia | FAERS: 2 | US FAERS | |
| 125 | Disorientation | FAERS: 2 | US FAERS | |
| 126 | Diverticulitis | FAERS: 2 | US FAERS | |
| 127 | Dysarthria | FAERS: 2 | US FAERS | |
| 128 | Exfoliative rash | FAERS: 2 | SIDER US FAERS | |
| 129 | Eye pain | FAERS: 2 | US FAERS | |
| 130 | Feeling Cold | FAERS: 2 | US FAERS | |
| 131 | Fluid overload | FAERS: 2 | US FAERS | |
| 132 | Flushing | FAERS: 2 | SIDER US FAERS | |
| 133 | Gangrene | FAERS: 2 | US FAERS | |
| 134 | Hepatitis | FAERS: 2 | SIDER US FAERS | |
| 135 | Hepatomegaly | FAERS: 2 | SIDER US FAERS | |
| 136 | Hypotension | FAERS: 2 | SIDER US FAERS | |
| 137 | Infection | FAERS: 2 | SIDER US FAERS | |
| 138 | Lethargy | FAERS: 2 | SIDER US FAERS | |
| 139 | Leukopenia | FAERS: 2 | SIDER US FAERS | |
| 140 | Musculoskeletal stiffness | FAERS: 2 | SIDER US FAERS | |
| 141 | Myopathy | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 142 | Myositis | FAERS: 2 | US FAERS | |
| 143 | Neutropenia | FAERS: 2 | SIDER US FAERS | |
| 144 | Oliguria | FAERS: 2 | US FAERS | |
| 145 | Oropharyngeal blistering | FAERS: 2 | US FAERS | |
| 146 | Pancreatic Insufficiency | FAERS: 2 | US FAERS | |
| 147 | Polymyalgia Rheumatica | FAERS: 2 | US FAERS | |
| 148 | Product use issue | FAERS: 2 | US FAERS | |
| 149 | Proteinuria | FAERS: 2 | SIDER US FAERS | |
| 150 | Rash erythematous | FAERS: 2 | SIDER US FAERS | |
| 151 | Renal Colic | FAERS: 2 | US FAERS | |
| 152 | Skin Erosion | FAERS: 2 | US FAERS | |
| 153 | Skin Ulcer | FAERS: 2 | US FAERS | |
| 154 | Skin irritation | FAERS: 2 | US FAERS | |
| 155 | Stomatitis | FAERS: 2 | SIDER US FAERS | |
| 156 | Thirst | FAERS: 2 | SIDER US FAERS | |
| 157 | Throat irritation | FAERS: 2 | SIDER US FAERS | |
| 158 | Transaminases increased | FAERS: 2 | US FAERS | |
| 159 | Troponin increased | FAERS: 2 | US FAERS | |
| 160 | Urine flow decreased | FAERS: 2 | US FAERS | |
| 161 | VIIth nerve paralysis | FAERS: 2 | US FAERS | |
| 162 | Wheezing | FAERS: 2 | US FAERS | |
| 163 | treatment failure | FAERS: 2 | US FAERS | |
| 164 | Abasia | FAERS: 1 | US FAERS | |
| 165 | Abdominal mass | FAERS: 1 | US FAERS | |
| 166 | Acarodermatitis | FAERS: 1 | US FAERS | |
| 167 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 168 | Accidental overdose | FAERS: 1 | US FAERS | |
| 169 | Acute Coronary Syndrome | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 170 | Ageusia | FAERS: 1 | US FAERS | |
| 171 | Agranulocytosis | FAERS: 1 | US FAERS | |
| 172 | Alcohol interaction | FAERS: 1 | US FAERS | |
| 173 | Alopecia Areata | FAERS: 1 | US FAERS | |
| 174 | Amaurosis Fugax | FAERS: 1 | US FAERS | |
| 175 | Amylase increased | FAERS: 1 | SIDER US FAERS | |
| 176 | Amyotrophic Lateral Sclerosis | FAERS: 1 | US FAERS | |
| 177 | Angina Pectoris | FAERS: 1 | SIDER US FAERS | |
| 178 | Angiocardiogram | FAERS: 1 | US FAERS | |
| 179 | Anuria | FAERS: 1 | US FAERS | |
| 180 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 181 | Aortic embolus | FAERS: 1 | US FAERS | |
| 182 | Arthropathy | FAERS: 1 | US FAERS | |
| 183 | Astigmatism | FAERS: 1 | US FAERS | |
| 184 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 185 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 186 | Bladder pain | FAERS: 1 | US FAERS | |
| 187 | Blood alkaline phosphatase increased | FAERS: 1 | SIDER US FAERS | |
| 188 | Blood cholinesterase decreased | FAERS: 1 | US FAERS | |
| 189 | Blood creatinine decreased | FAERS: 1 | US FAERS | |
| 190 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 191 | Blood potassium | FAERS: 1 | US FAERS | |
| 192 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 193 | Bone marrow myelogram abnormal | FAERS: 1 | US FAERS | |
| 194 | Borderline glaucoma | FAERS: 1 | US FAERS | |
| 195 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 196 | Bradycardia | FAERS: 1 | US FAERS | |
| 197 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 198 | Breast tenderness | FAERS: 1 | US FAERS | |
| 199 | Bronchitis | FAERS: 1 | SIDER US FAERS | |
| 200 | Bronchospasm | FAERS: 1 | US FAERS | |
| 201 | Cardiac discomfort | FAERS: 1 | US FAERS | |
| 202 | Cardiac dysfunction | FAERS: 1 | US FAERS | |
| 203 | Cerebellar infarction | FAERS: 1 | US FAERS | |
| 204 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 205 | Cholelithiasis | FAERS: 1 | SIDER US FAERS | |
| 206 | Cholestasis | FAERS: 1 | US FAERS | |
| 207 | Completed Suicide | FAERS: 1 | US FAERS | |
| 208 | Concomitant disease aggravated | FAERS: 1 | US FAERS | |
| 209 | Congenital cystic kidney disease | FAERS: 1 | US FAERS | |
| 210 | Crying | FAERS: 1 | US FAERS | |
| 211 | Cytolytic hepatitis | FAERS: 1 | US FAERS | |
| 212 | Deafness | FAERS: 1 | SIDER US FAERS | |
| 213 | Deformity | FAERS: 1 | US FAERS | |
| 214 | Delirium | FAERS: 1 | US FAERS | |
| 215 | Depression suicidal | FAERS: 1 | US FAERS | |
| 216 | Dermatitis acneiform | FAERS: 1 | US FAERS | |
| 217 | Device malfunction | FAERS: 1 | US FAERS | |
| 218 | Diabetes Mellitus | FAERS: 1 | SIDER US FAERS | |
| 219 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 220 | Diabetic metabolic decompensation | FAERS: 1 | US FAERS | |
| 221 | Diplegia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 222 | Discomfort | FAERS: 1 | SIDER US FAERS | |
| 223 | Disease recurrence | FAERS: 1 | US FAERS | |
| 224 | Drug dose omission | FAERS: 1 | US FAERS | |
| 225 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 226 | Duodenal ulcer perforation | FAERS: 1 | US FAERS | |
| 227 | Dysphonia | FAERS: 1 | US FAERS | |
| 228 | Dystonia | FAERS: 1 | US FAERS | |
| 229 | Economic problem | FAERS: 1 | US FAERS | |
| 230 | Eczema | FAERS: 1 | SIDER US FAERS | |
| 231 | Emotional distress | FAERS: 1 | US FAERS | |
| 232 | Encephalitis | FAERS: 1 | US FAERS | |
| 233 | Enteritis | FAERS: 1 | US FAERS | |
| 234 | Eosinophilia | FAERS: 1 | SIDER US FAERS | |
| 235 | Erection increased | FAERS: 1 | US FAERS | |
| 236 | Erythema Multiforme | FAERS: 1 | SIDER US FAERS | |
| 237 | Expired product administered | FAERS: 1 | US FAERS | |
| 238 | Extremity contracture | FAERS: 1 | US FAERS | |
| 239 | Eye irritation | FAERS: 1 | SIDER US FAERS | |
| 240 | Facial paralysis | FAERS: 1 | US FAERS | |
| 241 | Febrile Neutropenia | FAERS: 1 | US FAERS | |
| 242 | Flank Pain | FAERS: 1 | US FAERS | |
| 243 | Fracture | FAERS: 1 | US FAERS | |
| 244 | Gastrointestinal Pain | FAERS: 1 | SIDER US FAERS | |
| 245 | Gastrointestinal hypomotility | FAERS: 1 | US FAERS | |
| 246 | Gastrointestinal ulcer | FAERS: 1 | US FAERS | |
| 247 | Genital rash | FAERS: 1 | US FAERS | |
| 248 | Glaucoma | FAERS: 1 | US FAERS | |
| 249 | Glomerulonephritis | FAERS: 1 | US FAERS | |
| 250 | Head discomfort | FAERS: 1 | US FAERS | |
| 251 | Hepatic necrosis | FAERS: 1 | US FAERS | |
| 252 | Hepatitis A positive | FAERS: 1 | US FAERS | |
| 253 | Histiocytosis haematophagic | FAERS: 1 | US FAERS | |
| 254 | Hospice Care | FAERS: 1 | US FAERS | |
| 255 | Hyperpyrexia | FAERS: 1 | US FAERS | |
| 256 | Hypertensive emergency | FAERS: 1 | US FAERS | |
| 257 | Hypokinesia | FAERS: 1 | US FAERS | |
| 258 | Hyposideraemia | FAERS: 1 | US FAERS | |
| 259 | Hypoventilation | FAERS: 1 | US FAERS | |
| 260 | Hysterectomy | FAERS: 1 | US FAERS | |
| 261 | Ileus | FAERS: 1 | US FAERS | |
| 262 | Illiteracy | FAERS: 1 | US FAERS | |
| 263 | Immune thrombocytopenic purpura | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 264 | Impaired work ability | FAERS: 1 | US FAERS | |
| 265 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 266 | Incontinence | FAERS: 1 | SIDER US FAERS | |
| 267 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 268 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 269 | Inhibitory drug interaction | FAERS: 1 | US FAERS | |
| 270 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 271 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 272 | Intestinal infarction | FAERS: 1 | US FAERS | |
| 273 | Lactose Intolerance | FAERS: 1 | US FAERS | |
| 274 | Large intestinal polypectomy | FAERS: 1 | US FAERS | |
| 275 | Laryngitis | FAERS: 1 | US FAERS | |
| 276 | Libido disorder | FAERS: 1 | US FAERS | |
| 277 | Limb discomfort | FAERS: 1 | US FAERS | |
| 278 | Lipase increased | FAERS: 1 | US FAERS | |
| 279 | Lymphocyte stimulation test negative | FAERS: 1 | US FAERS | |
| 280 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 281 | Memory impairment | FAERS: 1 | US FAERS | |
| 282 | Meningitis | FAERS: 1 | US FAERS | |
| 283 | Meniscus injury | FAERS: 1 | US FAERS | |
| 284 | Mental status changes | FAERS: 1 | US FAERS | |
| 285 | Mouth swelling | FAERS: 1 | US FAERS | |
| 286 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 287 | Muscle tightness | FAERS: 1 | SIDER US FAERS | |
| 288 | Myofascial spasm | FAERS: 1 | US FAERS | |
| 289 | Myoglobin blood increased | FAERS: 1 | US FAERS | |
| 290 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 291 | Nephritis | FAERS: 1 | US FAERS | |
| 292 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 293 | Neuromuscular pain | FAERS: 1 | US FAERS | |
| 294 | Neutrophil count decreased | FAERS: 1 | SIDER US FAERS | |
| 295 | Nipple pain | FAERS: 1 | US FAERS | |
| 296 | Nodule | FAERS: 1 | US FAERS | |
| 297 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 298 | Opiates positive | FAERS: 1 | US FAERS | |
| 299 | Optic Neuritis | FAERS: 1 | US FAERS | |
| 300 | Pain of skin | FAERS: 1 | US FAERS | |
| 301 | Pallor | FAERS: 1 | US FAERS | |
| 302 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 303 | Paranoia | FAERS: 1 | US FAERS | |
| 304 | Parotidectomy | FAERS: 1 | US FAERS | |
| 305 | Perianal erythema | FAERS: 1 | US FAERS | |
| 306 | Peripheral arterial occlusive disease | FAERS: 1 | US FAERS | |
| 307 | Piloerection | FAERS: 1 | US FAERS | |
| 308 | Poisoning | FAERS: 1 | US FAERS | |
| 309 | Polydipsia | FAERS: 1 | US FAERS | |
| 310 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 311 | Polyuria | FAERS: 1 | US FAERS | |
| 312 | Porphyrins urine increased | FAERS: 1 | US FAERS | |
| 313 | Portal Vein Thrombosis | FAERS: 1 | US FAERS | |
| 314 | Post procedural myocardial infarction | FAERS: 1 | US FAERS | |
| 315 | Pregnancy | FAERS: 1 | US FAERS | |
| 316 | Product appearance confusion | FAERS: 1 | US FAERS | |
| 317 | Product dispensing error | FAERS: 1 | US FAERS | |
| 318 | Product physical issue | FAERS: 1 | US FAERS | |
| 319 | Product quality issue | FAERS: 1 | US FAERS | |
| 320 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 321 | Purpura | FAERS: 1 | SIDER US FAERS | |
| 322 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 323 | Renal pain | FAERS: 1 | US FAERS | |
| 324 | Respiratory distress | FAERS: 1 | US FAERS | |
| 325 | Respiratory tract congestion | FAERS: 1 | SIDER US FAERS | |
| 326 | Retinal Artery Occlusion | FAERS: 1 | US FAERS | |
| 327 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 328 | Rosacea | FAERS: 1 | US FAERS | |
| 329 | Scab | FAERS: 1 | US FAERS | |
| 330 | Sinusitis | FAERS: 1 | US FAERS | |
| 331 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 332 | Skin tightness | FAERS: 1 | US FAERS | |
| 333 | Splenic Rupture | FAERS: 1 | US FAERS | |
| 334 | Staring | FAERS: 1 | US FAERS | |
| 335 | Stress | FAERS: 1 | US FAERS | |
| 336 | Sudden death | FAERS: 1 | US FAERS | |
| 337 | Suture related complication | FAERS: 1 | US FAERS | |
| 338 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 339 | Thrombophlebitis | FAERS: 1 | US FAERS | |
| 340 | Thrombosis | FAERS: 1 | US FAERS | |
| 341 | Thyroiditis | FAERS: 1 | US FAERS | |
| 342 | Toxic Epidermal Necrolysis | FAERS: 1 | SIDER US FAERS | |
| 343 | Ulcer | FAERS: 1 | US FAERS | |
| 344 | Unevaluable event | FAERS: 1 | US FAERS | |
| 345 | Urine output increased | FAERS: 1 | SIDER US FAERS | |
| 346 | Vasculitic rash | FAERS: 1 | US FAERS | |
| 347 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 348 | Vertigo | FAERS: 1 | SIDER US FAERS | |
| 349 | Walking aid user | FAERS: 1 | US FAERS | |
| 350 | nervous system disorder | FAERS: 1 | SIDER US FAERS | |
| 351 | Agitation | SIDER | ||
| 352 | Anorexia | SIDER | ||
| 353 | Blood and lymphatic system disorders | SIDER | ||
| 354 | Blood creatine increased | SIDER | ||
| 355 | Blood sodium increased | SIDER | ||
| 356 | Blood thyroid stimulating hormone increased | SIDER | ||
| 357 | Bursitis | SIDER | ||
| 358 | Cardiac Flutter | SIDER | ||
| 359 | Cardiotoxicity | 26036690 | CTD | |
| 360 | Cardiovascular Diseases | 21449597 | CTD | |
| 361 | Cholecystitis | SIDER | ||
| 362 | Coagulation test abnormal | SIDER | ||
| 363 | Creatine increased | SIDER | ||
| 364 | Creatinine increased | SIDER | ||
| 365 | Dermatitis | SIDER | ||
| 366 | Disturbance in sexual arousal | SIDER | ||
| 367 | Ear and labyrinth disorders | SIDER | ||
| 368 | Ecchymosis | SIDER | ||
| 369 | Edema, Cardiac | 26036690 | CTD | |
| 370 | Electrocardiogram abnormal | SIDER | ||
| 371 | Electroencephalogram abnormal | SIDER | ||
| 372 | Endomyocardial Fibrosis | 26036690 | CTD | |
| 373 | Flatulence | SIDER | ||
| 374 | Gastric pH decreased | SIDER | ||
| 375 | Gastritis | SIDER | ||
| 376 | Gastrointestinal discomfort | SIDER | ||
| 377 | Glucose increased | SIDER | ||
| 378 | Gout flare | SIDER | ||
| 379 | Guillain-Barre Syndrome | SIDER | ||
| 380 | Haptoglobin increased | Canada Vigilance: 1 | Canada Vigilance | |
| 381 | Hyperchlorhydria | SIDER | ||
| 382 | Infestation | SIDER | ||
| 383 | Influenza-like symptoms | SIDER | ||
| 384 | Lactic dehydrogenase activity increased | SIDER | ||
| 385 | Leukocytosis | SIDER | ||
| 386 | Lymphocyte count decreased | SIDER | ||
| 387 | Malnutrition | SIDER | ||
| 388 | Mechanical urticaria | SIDER | ||
| 389 | Mental Retardation | SIDER | ||
| 390 | Musculoskeletal discomfort | SIDER | ||
| 391 | Paranasal sinus hypersecretion | SIDER | ||
| 392 | Peptic Ulcer | SIDER | ||
| 393 | Personality Change | SIDER | ||
| 394 | Petechiae | SIDER | ||
| 395 | Potassium increased | SIDER | ||
| 396 | Protein urine present | SIDER | ||
| 397 | Prurigo | SIDER | ||
| 398 | Rash follicular | SIDER | ||
| 399 | Shock | SIDER | ||
| 400 | Sinus bradycardia | SIDER | ||
| 401 | Sneezing | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 402 | Sodium high | SIDER | ||
| 403 | Splenomegaly | SIDER | ||
| 404 | Stiffness | SIDER | ||
| 405 | Tension | SIDER | ||
| 406 | Therapeutic product effect decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 407 | Traumatic liver injury | SIDER | ||
| 408 | Urinary tract obstruction | Canada Vigilance: 1 | Canada Vigilance | |
| 409 | Vascular purpura | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.