Nebivolol
(KOHIRBRYDXPAMZ-YHBROIRLSA-N)
Structure
- SMILES
- O[C@@H]([C@@H]1CCc2c(O1)ccc(c2)F)CNC[C@H]([C@H]1CCc2c(O1)ccc(c2)F)O
- Molecular Formula:
- C22H25F2NO4
- Molecular Weight:
- 405.435
- Log P:
- 2.7545
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 3
- TPSA:
- 70.95
- CAS Number(s):
- 118457-14-0; 118457-15-1
Synonym(s)
1.
Nebivolol
2.
Alpha,Alpha'-(Iminobis(Methylene))bis(6-Fluoro-3,4-dihydro)-2H-1-benzopyran-2-methanol
3.
Bystolic
4.
Lobivon
5.
Nebilet
6.
Nebivolol Hydrochloride
7.
R 67555
8.
R-67555
9.
Silostar
10.
67555, R
11.
Hydrochloride, Nebivolol
12.
R67555
External Link(s)
| MeSH | D000068577 |
| PubChem Compound | 189562 |
| ChEBI | 64021 |
| CHEMBL | CHEMBL3526436 |
| ZINC | 3951631 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Fatigue | FAERS: 71 | US FAERS | |
| 2 | Dizziness | FAERS: 60 | US FAERS | |
| 3 | Bradycardia | FAERS: 48 | US FAERS | |
| 4 | Headache | FAERS: 45 | US FAERS | |
| 5 | Drug ineffective | FAERS: 31 | US FAERS | |
| 6 | Alopecia | FAERS: 29 | US FAERS | |
| 7 | Nausea | FAERS: 29 | US FAERS | |
| 8 | Chest Pain | FAERS: 24 | US FAERS | |
| 9 | Wrong technique in product usage process | FAERS: 24 | US FAERS | |
| 10 | Palpitations | FAERS: 22 | US FAERS | |
| 11 | Feeling abnormal | FAERS: 21 | US FAERS | |
| 12 | Pruritus | FAERS: 19 | US FAERS | |
| 13 | Hypersensitivity | FAERS: 16 | US FAERS | |
| 14 | Malaise | FAERS: 16 | US FAERS | |
| 15 | Hypotension | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Intentional product misuse | FAERS: 14 | US FAERS | |
| 17 | Urticaria | FAERS: 13 | US FAERS | |
| 18 | Arthralgia | FAERS: 12 | US FAERS | |
| 19 | Unevaluable event | FAERS: 12 | US FAERS | |
| 20 | Abdominal Pain | FAERS: 11 | US FAERS | |
| 21 | Pain | FAERS: 11 | US FAERS | |
| 22 | Drug dose omission | FAERS: 10 | US FAERS | |
| 23 | Dyspepsia | FAERS: 10 | US FAERS | |
| 24 | Asthenia | FAERS: 9 | US FAERS | |
| 25 | Erectile dysfunction | FAERS: 9 | US FAERS | |
| 26 | Visual Impairment | FAERS: 9 | US FAERS | |
| 27 | Abdominal discomfort | FAERS: 8 | US FAERS | |
| 28 | Anxiety | FAERS: 8 | US FAERS | |
| 29 | Cerebrovascular accident | FAERS: 8 | US FAERS | |
| 30 | Chest discomfort | FAERS: 8 | US FAERS | |
| 31 | Flatulence | FAERS: 8 | US FAERS | |
| 32 | Peripheral swelling | FAERS: 8 | US FAERS | |
| 33 | Somnolence | FAERS: 8 | US FAERS | |
| 34 | Tremor | FAERS: 8 | US FAERS | |
| 35 | Joint swelling | FAERS: 7 | US FAERS | |
| 36 | Memory impairment | FAERS: 7 | US FAERS | |
| 37 | Myalgia | FAERS: 7 | US FAERS | |
| 38 | Syncope | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 39 | Angioedema | FAERS: 6 | US FAERS | |
| 40 | Atrial Fibrillation | FAERS: 6 | US FAERS | |
| 41 | Atrioventricular Block | FAERS: 6 | US FAERS | |
| 42 | Blood pressure fluctuation | FAERS: 6 | US FAERS | |
| 43 | Constipation | FAERS: 6 | US FAERS | |
| 44 | Expired product administered | FAERS: 6 | US FAERS | |
| 45 | Flushing | FAERS: 6 | US FAERS | |
| 46 | Tinnitus | FAERS: 6 | US FAERS | |
| 47 | Vomiting | FAERS: 6 | US FAERS | |
| 48 | Weight decreased | FAERS: 6 | US FAERS | |
| 49 | Asthma | FAERS: 5 | US FAERS | |
| 50 | Back Pain | FAERS: 5 | US FAERS | |
| 51 | Blood glucose increased | FAERS: 5 | US FAERS | |
| 52 | Bronchospasm | FAERS: 5 | US FAERS | |
| 53 | Dysgeusia | FAERS: 5 | US FAERS | |
| 54 | Inappropriate schedule of drug administration | FAERS: 5 | US FAERS | |
| 55 | Lethargy | FAERS: 5 | US FAERS | |
| 56 | Musculoskeletal Pain | FAERS: 5 | US FAERS | |
| 57 | Myocardial Infarction | FAERS: 5 | US FAERS | |
| 58 | Neck Pain | FAERS: 5 | US FAERS | |
| 59 | Nervousness | FAERS: 5 | US FAERS | |
| 60 | Nocturia | FAERS: 5 | US FAERS | |
| 61 | Swelling | FAERS: 5 | US FAERS | |
| 62 | Agitation | FAERS: 4 | US FAERS | |
| 63 | Bronchitis | FAERS: 4 | US FAERS | |
| 64 | Erythema | FAERS: 4 | US FAERS | |
| 65 | Feeling jittery | FAERS: 4 | US FAERS | |
| 66 | Malignant Hypertension | FAERS: 4 | US FAERS | |
| 67 | Musculoskeletal stiffness | FAERS: 4 | US FAERS | |
| 68 | Pneumonia | FAERS: 4 | US FAERS | |
| 69 | Therapeutic response unexpected | FAERS: 4 | US FAERS | |
| 70 | Vertigo | FAERS: 4 | US FAERS | |
| 71 | Accidental exposure to product by child | FAERS: 3 | US FAERS | |
| 72 | Adverse event | FAERS: 3 | US FAERS | |
| 73 | Blood pressure inadequately controlled | FAERS: 3 | US FAERS | |
| 74 | Blood triglycerides increased | FAERS: 3 | US FAERS | |
| 75 | Cardiac Arrest | FAERS: 3 | US FAERS | |
| 76 | Chromaturia | FAERS: 3 | US FAERS | |
| 77 | Discomfort | FAERS: 3 | US FAERS | |
| 78 | Drug dispensing error | FAERS: 3 | US FAERS | |
| 79 | Drug prescribing error | FAERS: 3 | US FAERS | |
| 80 | Feeling Cold | FAERS: 3 | US FAERS | |
| 81 | Gastrointestinal Pain | FAERS: 3 | US FAERS | |
| 82 | Head discomfort | FAERS: 3 | US FAERS | |
| 83 | Incorrect dose administered | FAERS: 3 | US FAERS | |
| 84 | Joint injury | FAERS: 3 | US FAERS | |
| 85 | No adverse event | FAERS: 3 | US FAERS | |
| 86 | Oropharyngeal pain | FAERS: 3 | US FAERS | |
| 87 | Polymyositis | FAERS: 3 | US FAERS | |
| 88 | Product dose omission | FAERS: 3 | US FAERS | |
| 89 | Product storage error | FAERS: 3 | US FAERS | |
| 90 | Rash erythematous | FAERS: 3 | US FAERS | |
| 91 | Suicide attempt | FAERS: 3 | US FAERS | |
| 92 | Tachycardia | FAERS: 3 | US FAERS | |
| 93 | Throat irritation | FAERS: 3 | US FAERS | |
| 94 | Thrombocytopenia | FAERS: 3 | US FAERS | |
| 95 | Wheezing | FAERS: 3 | US FAERS | |
| 96 | jaundice | FAERS: 3 | US FAERS | |
| 97 | Accidental overdose | FAERS: 2 | US FAERS | |
| 98 | Acute kidney injury | FAERS: 2 | US FAERS | |
| 99 | Amnesia | FAERS: 2 | US FAERS | |
| 100 | Anger | FAERS: 2 | US FAERS | |
| 101 | Angina Pectoris | FAERS: 2 | US FAERS | |
| 102 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 103 | Blood urine present | FAERS: 2 | US FAERS | |
| 104 | Cardiac Flutter | FAERS: 2 | US FAERS | |
| 105 | Chills | FAERS: 2 | US FAERS | |
| 106 | Choking | FAERS: 2 | US FAERS | |
| 107 | Cold sweat | FAERS: 2 | US FAERS | |
| 108 | Deafness | FAERS: 2 | US FAERS | |
| 109 | Dehydration | FAERS: 2 | US FAERS | |
| 110 | Dysphonia | FAERS: 2 | US FAERS | |
| 111 | Dysuria | FAERS: 2 | US FAERS | |
| 112 | Ear congestion | FAERS: 2 | US FAERS | |
| 113 | Epistaxis | FAERS: 2 | US FAERS | |
| 114 | Facial Pain | FAERS: 2 | US FAERS | |
| 115 | Failure of child resistant mechanism for pharmaceutical product | FAERS: 2 | US FAERS | |
| 116 | Hemiparesis | FAERS: 2 | US FAERS | |
| 117 | Impaired gastric emptying | FAERS: 2 | US FAERS | |
| 118 | Impaired work ability | FAERS: 2 | US FAERS | |
| 119 | Lactose Intolerance | FAERS: 2 | US FAERS | |
| 120 | Limb discomfort | FAERS: 2 | US FAERS | |
| 121 | Low density lipoprotein increased | FAERS: 2 | US FAERS | |
| 122 | Lung Injury | FAERS: 2 | US FAERS | |
| 123 | Lupus-like syndrome | FAERS: 2 | US FAERS | |
| 124 | Malnutrition | FAERS: 2 | US FAERS | |
| 125 | Mental impairment | FAERS: 2 | US FAERS | |
| 126 | Middle insomnia | FAERS: 2 | US FAERS | |
| 127 | Muscle tightness | FAERS: 2 | US FAERS | |
| 128 | Night sweats | FAERS: 2 | US FAERS | |
| 129 | Overdose | FAERS: 2 | US FAERS | |
| 130 | Product physical issue | FAERS: 2 | US FAERS | |
| 131 | Product prescribing error | FAERS: 2 | US FAERS | |
| 132 | Product quality issue | FAERS: 2 | US FAERS | |
| 133 | Psoriasis | FAERS: 2 | US FAERS | |
| 134 | Sexual Dysfunction | FAERS: 2 | US FAERS | |
| 135 | Skin reaction | FAERS: 2 | US FAERS | |
| 136 | Sluggishness | FAERS: 2 | US FAERS | |
| 137 | Stevens-Johnson Syndrome | FAERS: 2 | US FAERS | |
| 138 | Trichorrhexis | FAERS: 2 | US FAERS | |
| 139 | Abasia | FAERS: 1 | US FAERS | |
| 140 | Accidental exposure | FAERS: 1 | US FAERS | |
| 141 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 142 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 143 | Alcohol Intolerance | FAERS: 1 | US FAERS | |
| 144 | Anorexia | FAERS: 1 | US FAERS | |
| 145 | Anticonvulsant drug level increased | FAERS: 1 | US FAERS | |
| 146 | Apathy | FAERS: 1 | US FAERS | |
| 147 | Aphagia | FAERS: 1 | US FAERS | |
| 148 | Arthritis | FAERS: 1 | US FAERS | |
| 149 | Arthropathy | FAERS: 1 | US FAERS | |
| 150 | Ascites | FAERS: 1 | US FAERS | |
| 151 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 152 | Asthenopia | FAERS: 1 | US FAERS | |
| 153 | Bedridden | FAERS: 1 | US FAERS | |
| 154 | Biopsy small intestine abnormal | FAERS: 1 | US FAERS | |
| 155 | Blepharospasm | FAERS: 1 | US FAERS | |
| 156 | Blindness | FAERS: 1 | US FAERS | |
| 157 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 158 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 159 | Blood cortisol decreased | FAERS: 1 | US FAERS | |
| 160 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 161 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 162 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 163 | Blood triglycerides | FAERS: 1 | US FAERS | |
| 164 | Blood urea increased | FAERS: 1 | US FAERS | |
| 165 | Blue Toe Syndrome | FAERS: 1 | US FAERS | |
| 166 | Burning sensation | FAERS: 1 | US FAERS | |
| 167 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 168 | Cholestasis | FAERS: 1 | US FAERS | |
| 169 | Cholestatic liver injury | FAERS: 1 | US FAERS | |
| 170 | Completed Suicide | FAERS: 1 | US FAERS | |
| 171 | Crying | FAERS: 1 | US FAERS | |
| 172 | Dementia | FAERS: 1 | US FAERS | |
| 173 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 174 | Device malfunction | FAERS: 1 | US FAERS | |
| 175 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 176 | Diastolic dysfunction | FAERS: 1 | US FAERS | |
| 177 | Disorientation | FAERS: 1 | US FAERS | |
| 178 | Dissociation | FAERS: 1 | US FAERS | |
| 179 | Diverticulitis | FAERS: 1 | US FAERS | |
| 180 | Drug administration error | FAERS: 1 | US FAERS | |
| 181 | Dry skin | FAERS: 1 | US FAERS | |
| 182 | Ear discomfort | FAERS: 1 | US FAERS | |
| 183 | Eating disorder symptom | FAERS: 1 | US FAERS | |
| 184 | Economic problem | FAERS: 1 | US FAERS | |
| 185 | Emotional distress | FAERS: 1 | US FAERS | |
| 186 | Erection increased | FAERS: 1 | US FAERS | |
| 187 | Eructation | FAERS: 1 | US FAERS | |
| 188 | Exophthalmos | FAERS: 1 | US FAERS | |
| 189 | Extra dose administered | FAERS: 1 | US FAERS | |
| 190 | Gait inability | FAERS: 1 | US FAERS | |
| 191 | Gout | FAERS: 1 | US FAERS | |
| 192 | Hepatic necrosis | FAERS: 1 | US FAERS | |
| 193 | Hepatitis A | FAERS: 1 | US FAERS | |
| 194 | Hepatitis | FAERS: 1 | US FAERS | |
| 195 | Hostility | FAERS: 1 | US FAERS | |
| 196 | Hypersomnia | FAERS: 1 | US FAERS | |
| 197 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 198 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 199 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 200 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 201 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 202 | Intercepted product storage error | FAERS: 1 | US FAERS | |
| 203 | Intestinal villi atrophy | FAERS: 1 | US FAERS | |
| 204 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 205 | Labile blood pressure | FAERS: 1 | US FAERS | |
| 206 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 207 | Lip swelling | FAERS: 1 | US FAERS | |
| 208 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 209 | Macular degeneration | FAERS: 1 | US FAERS | |
| 210 | Mallory-Weiss Syndrome | FAERS: 1 | US FAERS | |
| 211 | Medication Error | FAERS: 1 | US FAERS | |
| 212 | Metastases to adrenals | FAERS: 1 | US FAERS | |
| 213 | Micturition frequency decreased | FAERS: 1 | US FAERS | |
| 214 | Mouth swelling | FAERS: 1 | US FAERS | |
| 215 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 216 | Nodule | FAERS: 1 | US FAERS | |
| 217 | Noninfective gingivitis | FAERS: 1 | US FAERS | |
| 218 | Onychoclasis | FAERS: 1 | US FAERS | |
| 219 | Onycholysis | FAERS: 1 | US FAERS | |
| 220 | Onychomycosis | FAERS: 1 | US FAERS | |
| 221 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 222 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 223 | Oral mucosal erythema | FAERS: 1 | US FAERS | |
| 224 | Oral pain | FAERS: 1 | US FAERS | |
| 225 | Overweight | FAERS: 1 | US FAERS | |
| 226 | Performance status decreased | FAERS: 1 | US FAERS | |
| 227 | Pericarditis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 228 | Personality Change | FAERS: 1 | US FAERS | |
| 229 | Pleurisy | FAERS: 1 | US FAERS | |
| 230 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 231 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 232 | Portal Hypertension | FAERS: 1 | US FAERS | |
| 233 | Post procedural complication | FAERS: 1 | US FAERS | |
| 234 | Pregnancy | FAERS: 1 | US FAERS | |
| 235 | Presyncope | FAERS: 1 | US FAERS | |
| 236 | Priapism | FAERS: 1 | US FAERS | |
| 237 | Product dispensing error | FAERS: 1 | US FAERS | |
| 238 | Product label issue | FAERS: 1 | US FAERS | |
| 239 | Product packaging confusion | FAERS: 1 | US FAERS | |
| 240 | Product packaging issue | FAERS: 1 | US FAERS | |
| 241 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 242 | Product substitution issue | FAERS: 1 | US FAERS | |
| 243 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 244 | Product use issue | FAERS: 1 | US FAERS | |
| 245 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 246 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 247 | Retching | FAERS: 1 | US FAERS | |
| 248 | Retinal Artery Occlusion | FAERS: 1 | US FAERS | |
| 249 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 250 | Scleroderma | FAERS: 1 | US FAERS | |
| 251 | Sick Sinus Syndrome | FAERS: 1 | US FAERS | |
| 252 | Somnambulism | FAERS: 1 | US FAERS | |
| 253 | Stomatitis | FAERS: 1 | US FAERS | |
| 254 | Stress | FAERS: 1 | US FAERS | |
| 255 | Sunburn | FAERS: 1 | US FAERS | |
| 256 | Tension | FAERS: 1 | US FAERS | |
| 257 | Therapy regimen changed | FAERS: 1 | US FAERS | |
| 258 | Thrombosis | FAERS: 1 | US FAERS | |
| 259 | Tongue blistering | FAERS: 1 | US FAERS | |
| 260 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 261 | Tongue erythema | FAERS: 1 | US FAERS | |
| 262 | Toothache | FAERS: 1 | US FAERS | |
| 263 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 264 | Urinary Retention | FAERS: 1 | US FAERS | |
| 265 | Withdrawal hypertension | FAERS: 1 | US FAERS | |
| 266 | nervous system disorder | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.