suvorexant
(JYTNQNCOQXFQPK-MRXNPFEDSA-N)
Structure
- SMILES
- Cc1ccc(c(c1)C(=O)N1CCN(CC[C@H]1C)c1oc2c(n1)cc(cc2)Cl)n1nccn1
- Type(s)
- Approved; Investigational
- ATC code(s)
- N05CM19
- Molecular Formula:
- C23H23ClN6O2
- Molecular Weight:
- 450.921
- Log P:
- 4.1142
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 0
- TPSA:
- 80.29
- CAS Number(s):
- 1030377-33-3
Synonym(s)
1.
suvorexant
2.
(4-(5-chloro-1,3-benzoxazol-2-yl)-7-methyl-1,4-diazepan-1-yl)(5-methyl-2-(2H-1,2,3-triazol-2-yl)phenyl)methanone
3.
Belsomra
4.
MK 4305
5.
MK-4305
6.
MK4305
7.
methanone, ((7R)-4-(5-chloro-2-benzoxazolyl)hexahydro-7-methyl-1H-1,4-diazepin-1-yl)(5-methyl-2-(2H-1,2,3-triazol-2-yl)phenyl)-
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 1718 | US FAERS | |
| 2 | Somnolence | FAERS: 353 | SIDER US FAERS | |
| 3 | Headache | FAERS: 262 | SIDER US FAERS | |
| 4 | Feeling abnormal | FAERS: 237 | US FAERS | |
| 5 | Sleep Paralysis | FAERS: 161 | SIDER US FAERS | |
| 6 | Adverse event | FAERS: 150 | US FAERS | |
| 7 | No adverse event | FAERS: 149 | US FAERS | |
| 8 | Dizziness | FAERS: 114 | SIDER US FAERS | |
| 9 | Fatigue | FAERS: 113 | US FAERS | |
| 10 | Nausea | FAERS: 111 | US FAERS | |
| 11 | Anxiety | FAERS: 105 | US FAERS | |
| 12 | Poor quality sleep | FAERS: 103 | US FAERS | |
| 13 | Wrong technique in product usage process | FAERS: 94 | US FAERS | |
| 14 | Drug effect incomplete | FAERS: 92 | US FAERS | |
| 15 | Somnambulism | FAERS: 92 | US FAERS | |
| 16 | Middle insomnia | FAERS: 89 | US FAERS | |
| 17 | Drug dose omission | FAERS: 88 | US FAERS | |
| 18 | Agitation | FAERS: 70 | US FAERS | |
| 19 | Overdose | FAERS: 64 | US FAERS | |
| 20 | Malaise | FAERS: 61 | US FAERS | |
| 21 | Palpitations | FAERS: 49 | US FAERS | |
| 22 | Product quality issue | FAERS: 45 | US FAERS | |
| 23 | Product use issue | FAERS: 41 | US FAERS | |
| 24 | Feeling jittery | FAERS: 37 | US FAERS | |
| 25 | Inappropriate schedule of drug administration | FAERS: 37 | US FAERS | |
| 26 | Amnesia | FAERS: 36 | US FAERS | |
| 27 | Delirium | FAERS: 35 | US FAERS | |
| 28 | Memory impairment | FAERS: 35 | US FAERS | |
| 29 | Vomiting | FAERS: 31 | US FAERS | |
| 30 | Tremor | FAERS: 28 | US FAERS | |
| 31 | Abdominal discomfort | FAERS: 26 | US FAERS | |
| 32 | Cataplexy | FAERS: 26 | SIDER US FAERS | |
| 33 | Restlessness | FAERS: 26 | US FAERS | |
| 34 | Drug effect delayed | FAERS: 25 | US FAERS | |
| 35 | Nervousness | FAERS: 25 | US FAERS | |
| 36 | Pruritus | FAERS: 24 | US FAERS | |
| 37 | Circumstance or information capable of leading to medication error | FAERS: 23 | US FAERS | |
| 38 | Dysgeusia | FAERS: 23 | US FAERS | |
| 39 | Product dose omission | FAERS: 23 | US FAERS | |
| 40 | Night sweats | FAERS: 22 | US FAERS | |
| 41 | Disorientation | FAERS: 21 | US FAERS | |
| 42 | Abnormal sleep-related event | FAERS: 20 | US FAERS | |
| 43 | Pain | FAERS: 20 | US FAERS | |
| 44 | Restless Legs Syndrome | FAERS: 20 | US FAERS | |
| 45 | Initial insomnia | FAERS: 19 | US FAERS | |
| 46 | Product packaging quantity issue | FAERS: 18 | US FAERS | |
| 47 | Incorrect dose administered | FAERS: 17 | US FAERS | |
| 48 | Completed Suicide | FAERS: 16 | US FAERS | |
| 49 | Drug administration error | FAERS: 16 | US FAERS | |
| 50 | Therapeutic response unexpected | FAERS: 16 | US FAERS | |
| 51 | Asthenia | FAERS: 15 | US FAERS | |
| 52 | Hypersomnia | FAERS: 15 | US FAERS | |
| 53 | Intentional product misuse | FAERS: 15 | US FAERS | |
| 54 | Myalgia | FAERS: 15 | US FAERS | |
| 55 | Tinnitus | FAERS: 15 | US FAERS | |
| 56 | Wrong technique in drug usage process | FAERS: 15 | US FAERS | |
| 57 | Urticaria | FAERS: 14 | US FAERS | |
| 58 | Anger | FAERS: 11 | US FAERS | |
| 59 | Cerebrovascular accident | FAERS: 11 | US FAERS | |
| 60 | Depressed mood | FAERS: 11 | US FAERS | |
| 61 | Chest Pain | FAERS: 10 | US FAERS | |
| 62 | Discomfort | FAERS: 10 | US FAERS | |
| 63 | Inability to afford medication | FAERS: 10 | US FAERS | |
| 64 | Lethargy | FAERS: 10 | US FAERS | |
| 65 | Chest discomfort | FAERS: 9 | US FAERS | |
| 66 | Crying | FAERS: 9 | US FAERS | |
| 67 | Head discomfort | FAERS: 9 | US FAERS | |
| 68 | Suicide attempt | FAERS: 9 | US FAERS | |
| 69 | Accidental overdose | FAERS: 8 | US FAERS | |
| 70 | Burning sensation | FAERS: 8 | US FAERS | |
| 71 | Drug prescribing error | FAERS: 8 | US FAERS | |
| 72 | Hypersensitivity | FAERS: 8 | US FAERS | |
| 73 | Nasopharyngitis | FAERS: 8 | US FAERS | |
| 74 | Screaming | FAERS: 8 | US FAERS | |
| 75 | Sleep-related eating disorder | FAERS: 8 | US FAERS | |
| 76 | Sluggishness | FAERS: 8 | US FAERS | |
| 77 | Syncope | FAERS: 8 | US FAERS | |
| 78 | Therapeutic response delayed | FAERS: 8 | US FAERS | |
| 79 | Constipation | FAERS: 7 | US FAERS | |
| 80 | Drug Tolerance | FAERS: 7 | US FAERS | |
| 81 | Extra dose administered | FAERS: 7 | US FAERS | |
| 82 | Influenza | FAERS: 7 | US FAERS | |
| 83 | Narcolepsy | FAERS: 7 | US FAERS | |
| 84 | Tachycardia | FAERS: 7 | US FAERS | |
| 85 | Tachyphrenia | FAERS: 7 | US FAERS | |
| 86 | Therapy non-responder | FAERS: 7 | US FAERS | |
| 87 | Altered state of consciousness | FAERS: 6 | US FAERS | |
| 88 | Depressed Level of Consciousness | FAERS: 6 | US FAERS | |
| 89 | Drug Dependence | FAERS: 6 | US FAERS | |
| 90 | Drug screen positive | FAERS: 6 | US FAERS | |
| 91 | Enuresis | FAERS: 6 | US FAERS | |
| 92 | Incorrect product storage | FAERS: 6 | US FAERS | |
| 93 | Medication Error | FAERS: 6 | US FAERS | |
| 94 | Nocturia | FAERS: 6 | US FAERS | |
| 95 | Prescribed overdose | FAERS: 6 | US FAERS | |
| 96 | Product use in unapproved indication | FAERS: 6 | US FAERS | |
| 97 | Stress | FAERS: 6 | US FAERS | |
| 98 | Vertigo | FAERS: 6 | US FAERS | |
| 99 | Abdominal Pain | FAERS: 5 | US FAERS | |
| 100 | Aphasia | FAERS: 5 | US FAERS | |
| 101 | Bipolar Disorder | FAERS: 5 | US FAERS | |
| 102 | Bradycardia | FAERS: 5 | US FAERS | |
| 103 | Cerebral Infarction | FAERS: 5 | US FAERS | |
| 104 | Cold sweat | FAERS: 5 | US FAERS | |
| 105 | Diplegia | FAERS: 5 | US FAERS | |
| 106 | Drug effect variable | FAERS: 5 | US FAERS | |
| 107 | Dyspepsia | FAERS: 5 | US FAERS | |
| 108 | Dysuria | FAERS: 5 | US FAERS | |
| 109 | Erythema | FAERS: 5 | US FAERS | |
| 110 | Flushing | FAERS: 5 | US FAERS | |
| 111 | Formication | FAERS: 5 | US FAERS | |
| 112 | Hypervigilance | FAERS: 5 | US FAERS | |
| 113 | Impaired driving ability | FAERS: 5 | US FAERS | |
| 114 | Intentional product use issue | FAERS: 5 | US FAERS | |
| 115 | Laceration | FAERS: 5 | US FAERS | |
| 116 | Mental impairment | FAERS: 5 | US FAERS | |
| 117 | Peripheral swelling | FAERS: 5 | US FAERS | |
| 118 | Pneumonia | FAERS: 5 | US FAERS | |
| 119 | Product blister packaging issue | FAERS: 5 | US FAERS | |
| 120 | Arthritis | FAERS: 4 | US FAERS | |
| 121 | Chills | FAERS: 4 | US FAERS | |
| 122 | Drug ineffective for unapproved indication | FAERS: 4 | US FAERS | |
| 123 | Dysarthria | FAERS: 4 | US FAERS | |
| 124 | Euphoric mood | FAERS: 4 | US FAERS | |
| 125 | Expired product administered | FAERS: 4 | US FAERS | |
| 126 | Lip swelling | FAERS: 4 | US FAERS | |
| 127 | Muscle tightness | FAERS: 4 | US FAERS | |
| 128 | Musculoskeletal stiffness | FAERS: 4 | US FAERS | |
| 129 | Myocardial Infarction | FAERS: 4 | US FAERS | |
| 130 | Paradoxical drug reaction | FAERS: 4 | US FAERS | |
| 131 | Paranoia | FAERS: 4 | US FAERS | |
| 132 | Prescription drug used without a prescription | FAERS: 4 | US FAERS | |
| 133 | Product packaging issue | FAERS: 4 | US FAERS | |
| 134 | Product storage error | FAERS: 4 | US FAERS | |
| 135 | Product use complaint | FAERS: 4 | US FAERS | |
| 136 | Quality of life decreased | FAERS: 4 | US FAERS | |
| 137 | Sleep Talking | FAERS: 4 | US FAERS | |
| 138 | Urinary Retention | FAERS: 4 | US FAERS | |
| 139 | Visual Impairment | FAERS: 4 | US FAERS | |
| 140 | Weight decreased | FAERS: 4 | US FAERS | |
| 141 | Abasia | FAERS: 3 | US FAERS | |
| 142 | Alcohol poisoning | FAERS: 3 | US FAERS | |
| 143 | Apparent death | FAERS: 3 | US FAERS | |
| 144 | Arthralgia | FAERS: 3 | US FAERS | |
| 145 | Autoscopy | FAERS: 3 | US FAERS | |
| 146 | Back Pain | FAERS: 3 | US FAERS | |
| 147 | Blood creatine phosphokinase increased | FAERS: 3 | US FAERS | |
| 148 | Blood glucose decreased | FAERS: 3 | US FAERS | |
| 149 | Choking | FAERS: 3 | US FAERS | |
| 150 | Contraindicated product administered | FAERS: 3 | US FAERS | |
| 151 | Emotional disorder | FAERS: 3 | US FAERS | |
| 152 | Eye irritation | FAERS: 3 | US FAERS | |
| 153 | Eye pain | FAERS: 3 | US FAERS | |
| 154 | Flatulence | FAERS: 3 | US FAERS | |
| 155 | Frustration tolerance decreased | FAERS: 3 | US FAERS | |
| 156 | Incorrect route of drug administration | FAERS: 3 | US FAERS | |
| 157 | Laziness | FAERS: 3 | US FAERS | |
| 158 | Limb discomfort | FAERS: 3 | US FAERS | |
| 159 | Limb injury | FAERS: 3 | US FAERS | |
| 160 | Panic Disorder | FAERS: 3 | US FAERS | |
| 161 | Parasomnia | FAERS: 3 | US FAERS | |
| 162 | Patient dissatisfaction with treatment | FAERS: 3 | US FAERS | |
| 163 | Poor quality drug administered | FAERS: 3 | US FAERS | |
| 164 | Product availability issue | FAERS: 3 | US FAERS | |
| 165 | Product supply issue | FAERS: 3 | US FAERS | |
| 166 | Product taste abnormal | FAERS: 3 | US FAERS | |
| 167 | Respiratory Depression | FAERS: 3 | US FAERS | |
| 168 | Sleep sex | FAERS: 3 | US FAERS | |
| 169 | Stupor | FAERS: 3 | US FAERS | |
| 170 | Toxicity to various agents | FAERS: 3 | US FAERS | |
| 171 | Yawning | FAERS: 3 | US FAERS | |
| 172 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 173 | Acute psychosis | FAERS: 2 | US FAERS | |
| 174 | Akathisia | FAERS: 2 | US FAERS | |
| 175 | Alanine Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 176 | Arthropathy | FAERS: 2 | US FAERS | |
| 177 | Back disorder | FAERS: 2 | US FAERS | |
| 178 | Bedridden | FAERS: 2 | US FAERS | |
| 179 | Blood alkaline phosphatase increased | FAERS: 2 | US FAERS | |
| 180 | Bone pain | FAERS: 2 | US FAERS | |
| 181 | Bronchitis | FAERS: 2 | US FAERS | |
| 182 | Cardiac Flutter | FAERS: 2 | US FAERS | |
| 183 | Cerebral disorder | FAERS: 2 | US FAERS | |
| 184 | Dementia | FAERS: 2 | US FAERS | |
| 185 | Dreamy state | FAERS: 2 | US FAERS | |
| 186 | Drug withdrawal syndrome | FAERS: 2 | US FAERS | |
| 187 | Economic problem | FAERS: 2 | US FAERS | |
| 188 | Epistaxis | FAERS: 2 | US FAERS | |
| 189 | Facial paralysis | FAERS: 2 | US FAERS | |
| 190 | Feeling Cold | FAERS: 2 | US FAERS | |
| 191 | Frustration | FAERS: 2 | US FAERS | |
| 192 | Gamma-Glutamyltransferase Increased | FAERS: 2 | US FAERS | |
| 193 | Hemiplegia | FAERS: 2 | US FAERS | |
| 194 | Hyperphagia | FAERS: 2 | US FAERS | |
| 195 | Impaired work ability | FAERS: 2 | US FAERS | |
| 196 | Inappropriate schedule of product administration | FAERS: 2 | US FAERS | |
| 197 | Incoherent | FAERS: 2 | US FAERS | |
| 198 | Incontinence | FAERS: 2 | US FAERS | |
| 199 | Joint Instability | FAERS: 2 | US FAERS | |
| 200 | Malignant neoplasm progression | FAERS: 2 | US FAERS | |
| 201 | Mental status changes | FAERS: 2 | US FAERS | |
| 202 | Mood swings | FAERS: 2 | US FAERS | |
| 203 | Musculoskeletal discomfort | FAERS: 2 | US FAERS | |
| 204 | Myoclonus | FAERS: 2 | US FAERS | |
| 205 | Neurological examination normal | FAERS: 2 | US FAERS | |
| 206 | Obsessive-Compulsive Disorder | FAERS: 2 | US FAERS | |
| 207 | Oropharyngeal discomfort | FAERS: 2 | US FAERS | |
| 208 | Oropharyngeal pain | FAERS: 2 | US FAERS | |
| 209 | Physical product label issue | FAERS: 2 | US FAERS | |
| 210 | Poor quality product administered | FAERS: 2 | US FAERS | |
| 211 | Post-Traumatic Stress Disorder | FAERS: 2 | US FAERS | |
| 212 | Product physical issue | FAERS: 2 | US FAERS | |
| 213 | Product prescribing error | FAERS: 2 | US FAERS | |
| 214 | Product prescribing issue | FAERS: 2 | US FAERS | |
| 215 | Rash erythematous | FAERS: 2 | US FAERS | |
| 216 | Rebound effect | FAERS: 2 | US FAERS | |
| 217 | Schizophrenia | FAERS: 2 | US FAERS | |
| 218 | Spontaneous penile erection | FAERS: 2 | US FAERS | |
| 219 | Stomatitis | FAERS: 2 | US FAERS | |
| 220 | Swelling | FAERS: 2 | US FAERS | |
| 221 | Tension | FAERS: 2 | US FAERS | |
| 222 | Therapeutic product effect incomplete | FAERS: 2 | US FAERS | |
| 223 | Therapy cessation | FAERS: 2 | US FAERS | |
| 224 | Thirst | FAERS: 2 | US FAERS | |
| 225 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 226 | nervous system disorder | FAERS: 2 | SIDER US FAERS | |
| 227 | treatment failure | FAERS: 2 | US FAERS | |
| 228 | Acne | FAERS: 1 | US FAERS | |
| 229 | Agranulocytosis | FAERS: 1 | US FAERS | |
| 230 | Alcohol abuse | FAERS: 1 | US FAERS | |
| 231 | Alcohol interaction | FAERS: 1 | US FAERS | |
| 232 | Alcohol withdrawal syndrome | FAERS: 1 | US FAERS | |
| 233 | Alopecia | FAERS: 1 | US FAERS | |
| 234 | Amnestic Disorder | FAERS: 1 | US FAERS | |
| 235 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 236 | Angioedema | FAERS: 1 | US FAERS | |
| 237 | Anorgasmia | FAERS: 1 | US FAERS | |
| 238 | Antidepressant therapy | FAERS: 1 | US FAERS | |
| 239 | Asphyxia | FAERS: 1 | US FAERS | |
| 240 | Asthenopia | FAERS: 1 | US FAERS | |
| 241 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 242 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 243 | Bipolar I disorder | FAERS: 1 | US FAERS | |
| 244 | Bladder dysfunction | FAERS: 1 | US FAERS | |
| 245 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 246 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 247 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 248 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 249 | Breast Feeding | FAERS: 1 | US FAERS | |
| 250 | Breast tenderness | FAERS: 1 | US FAERS | |
| 251 | Breathing-related sleep disorder | FAERS: 1 | US FAERS | |
| 252 | Bruxism | FAERS: 1 | US FAERS | |
| 253 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 254 | Choking sensation | FAERS: 1 | US FAERS | |
| 255 | Cholecystitis infective | FAERS: 1 | US FAERS | |
| 256 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 257 | Contraindicated drug administered | FAERS: 1 | US FAERS | |
| 258 | Contrast media reaction | FAERS: 1 | US FAERS | |
| 259 | Counterfeit drug administered | FAERS: 1 | US FAERS | |
| 260 | Deafness | FAERS: 1 | US FAERS | |
| 261 | Dehydration | FAERS: 1 | US FAERS | |
| 262 | Dissociation | FAERS: 1 | US FAERS | |
| 263 | Dissociative disorder | FAERS: 1 | US FAERS | |
| 264 | Drooling | FAERS: 1 | US FAERS | |
| 265 | Drug effective for unapproved indication | FAERS: 1 | US FAERS | |
| 266 | Drug level increased | FAERS: 1 | US FAERS | |
| 267 | Drug resistance | FAERS: 1 | US FAERS | |
| 268 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 269 | Drug-disease interaction | FAERS: 1 | US FAERS | |
| 270 | Dry skin | FAERS: 1 | US FAERS | |
| 271 | Dysgraphia | FAERS: 1 | US FAERS | |
| 272 | Dysphemia | FAERS: 1 | US FAERS | |
| 273 | Dysphonia | FAERS: 1 | US FAERS | |
| 274 | Ear discomfort | FAERS: 1 | US FAERS | |
| 275 | Encephalitis | FAERS: 1 | US FAERS | |
| 276 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 277 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 278 | Erection increased | FAERS: 1 | US FAERS | |
| 279 | Essential Hypertension | FAERS: 1 | US FAERS | |
| 280 | Exaggerated startle response | FAERS: 1 | US FAERS | |
| 281 | Eyelids pruritus | FAERS: 1 | US FAERS | |
| 282 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 283 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 284 | Food craving | FAERS: 1 | US FAERS | |
| 285 | Fracture | FAERS: 1 | US FAERS | |
| 286 | Frontotemporal dementia | FAERS: 1 | US FAERS | |
| 287 | Gastric Fistula | FAERS: 1 | US FAERS | |
| 288 | Gastritis | FAERS: 1 | US FAERS | |
| 289 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 290 | Gastrointestinal candidiasis | FAERS: 1 | US FAERS | |
| 291 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 292 | Gastrostomy | FAERS: 1 | US FAERS | |
| 293 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 294 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 295 | Genital infection fungal | FAERS: 1 | US FAERS | |
| 296 | Hemiparesis | FAERS: 1 | US FAERS | |
| 297 | Hernia | FAERS: 1 | US FAERS | |
| 298 | Hyperventilation | FAERS: 1 | US FAERS | |
| 299 | Hypotension | FAERS: 1 | US FAERS | |
| 300 | Impaired self-care | FAERS: 1 | US FAERS | |
| 301 | Impatience | FAERS: 1 | US FAERS | |
| 302 | Insurance issue | FAERS: 1 | US FAERS | |
| 303 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 304 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 305 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 306 | Intracranial Hypotension | FAERS: 1 | US FAERS | |
| 307 | Irregular sleep phase | FAERS: 1 | US FAERS | |
| 308 | Joint stiffness | FAERS: 1 | US FAERS | |
| 309 | Joint swelling | FAERS: 1 | US FAERS | |
| 310 | Lack of spontaneous speech | FAERS: 1 | US FAERS | |
| 311 | Laryngitis | FAERS: 1 | US FAERS | |
| 312 | Loss of dreaming | FAERS: 1 | US FAERS | |
| 313 | Manufacturing production issue | FAERS: 1 | US FAERS | |
| 314 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 315 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 316 | Moaning | FAERS: 1 | US FAERS | |
| 317 | Monoplegia | FAERS: 1 | US FAERS | |
| 318 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 319 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 320 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 321 | Mydriasis | FAERS: 1 | US FAERS | |
| 322 | Neuroleptic Malignant Syndrome | FAERS: 1 | US FAERS | |
| 323 | Obesity | FAERS: 1 | US FAERS | |
| 324 | Oliguria | FAERS: 1 | US FAERS | |
| 325 | Packaging design issue | FAERS: 1 | US FAERS | |
| 326 | Pallor | FAERS: 1 | US FAERS | |
| 327 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 328 | Personality Change | FAERS: 1 | US FAERS | |
| 329 | Pertussis | FAERS: 1 | US FAERS | |
| 330 | Pharyngitis | FAERS: 1 | US FAERS | |
| 331 | Phobia of driving | FAERS: 1 | US FAERS | |
| 332 | Physical assault | FAERS: 1 | US FAERS | |
| 333 | Pituitary enlargement | FAERS: 1 | US FAERS | |
| 334 | Polydipsia | FAERS: 1 | US FAERS | |
| 335 | Polyuria | FAERS: 1 | US FAERS | |
| 336 | Postrenal failure | FAERS: 1 | US FAERS | |
| 337 | Prescribed underdose | FAERS: 1 | US FAERS | |
| 338 | Priapism | FAERS: 1 | US FAERS | |
| 339 | Product container issue | FAERS: 1 | US FAERS | |
| 340 | Product dispensing issue | FAERS: 1 | US FAERS | |
| 341 | Product distribution issue | FAERS: 1 | US FAERS | |
| 342 | Product dosage form confusion | FAERS: 1 | US FAERS | |
| 343 | Product formulation issue | FAERS: 1 | US FAERS | |
| 344 | Product label confusion | FAERS: 1 | US FAERS | |
| 345 | Product label issue | FAERS: 1 | US FAERS | |
| 346 | Product outer packaging issue | FAERS: 1 | US FAERS | |
| 347 | Product quality control issue | FAERS: 1 | US FAERS | |
| 348 | Product selection error | FAERS: 1 | US FAERS | |
| 349 | Product shape issue | FAERS: 1 | US FAERS | |
| 350 | Product size issue | FAERS: 1 | US FAERS | |
| 351 | Product tampering | FAERS: 1 | US FAERS | |
| 352 | Pruritus allergic | FAERS: 1 | US FAERS | |
| 353 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 354 | Psychomotor skills impaired | FAERS: 1 | US FAERS | |
| 355 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 356 | Purpura | FAERS: 1 | US FAERS | |
| 357 | Renal tubular disorder | FAERS: 1 | US FAERS | |
| 358 | Respiratory distress | FAERS: 1 | US FAERS | |
| 359 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 360 | Sedation complication | FAERS: 1 | US FAERS | |
| 361 | Sinus headache | FAERS: 1 | US FAERS | |
| 362 | Sinusitis | FAERS: 1 | US FAERS | |
| 363 | Sleep disorder due to general medical condition, insomnia type | FAERS: 1 | US FAERS | |
| 364 | Snoring | FAERS: 1 | US FAERS | |
| 365 | Sudden death | FAERS: 1 | US FAERS | |
| 366 | Sudden onset of sleep | FAERS: 1 | US FAERS | |
| 367 | Suicide threat | FAERS: 1 | US FAERS | |
| 368 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 369 | Taciturnity | FAERS: 1 | US FAERS | |
| 370 | Tension Headache | FAERS: 1 | US FAERS | |
| 371 | Therapeutic product effect decreased | FAERS: 1 | US FAERS | |
| 372 | Therapy change | FAERS: 1 | US FAERS | |
| 373 | Thermal burn | FAERS: 1 | US FAERS | |
| 374 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 375 | Tongue pruritus | FAERS: 1 | US FAERS | |
| 376 | Tooth Ankylosis | FAERS: 1 | US FAERS | |
| 377 | Toothache | FAERS: 1 | US FAERS | |
| 378 | Trichotillomania | FAERS: 1 | US FAERS | |
| 379 | Tuberculosis | FAERS: 1 | US FAERS | |
| 380 | Unevaluable event | FAERS: 1 | US FAERS | |
| 381 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 382 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 383 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 384 | Violence-related symptom | FAERS: 1 | US FAERS | |
| 385 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 386 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 387 | Waxy flexibility | FAERS: 1 | US FAERS | |
| 388 | Wrong schedule | FAERS: 1 | US FAERS | |
| 389 | furuncle | FAERS: 1 | US FAERS | |
| 390 | prostatitis | FAERS: 1 | US FAERS | |
| 391 | skin abrasion | FAERS: 1 | US FAERS | |
| 392 | Blood cholesterol increased | SIDER | ||
| 393 | Infection | SIDER | ||
| 394 | Infestation | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.