midostaurin
(BMGQWWVMWDBQGC-IIFHNQTCSA-N)
Structure
- SMILES
- CO[C@@H]1[C@@H](C[C@H]2O[C@]1(C)n1c3ccccc3c3c1c1n2c2ccccc2c1c1c3CNC1=O)N(C(=O)c1ccccc1)C
- Type(s)
- Approved; Investigational
- ATC code(s)
- L01XE39
- Molecular Formula:
- C35H30N4O4
- Molecular Weight:
- 570.637
- Log P:
- 6.2356
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 1
- TPSA:
- 77.73
- CAS Number(s):
- 120685-11-2
Synonym(s)
1.
midostaurin
2.
4'-N-benzoyl staurosporine
3.
4'-N-benzoylstaurosporine
4.
CGP 41 251
5.
CGP 41251
6.
CGP-41251
7.
N-((9S,10R,11R,13R)-10-methoxy-9-methyl-1-oxo-2,3,10,11,12,13-hexahydro-9,13-epoxy-1H,9H-diindolo(1,2,3-GH:3',2',1'-lm)pyrrolo(3,4-j)(1,7)benzodiazonin-11-yl)-n-methylbenzamide
8.
PKC 412
9.
PKC-412
10.
PKC412
11.
benzoylstaurosporine
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nausea | FAERS: 77 | US FAERS | |
| 2 | Vomiting | FAERS: 42 | US FAERS | |
| 3 | Malaise | FAERS: 21 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 4 | Neutropenia | FAERS: 18 | US FAERS | |
| 5 | Cytopenia | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 6 | Pneumonia | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Pneumonitis | FAERS: 15 | US FAERS | |
| 8 | Thrombocytopenia | FAERS: 15 | US FAERS | |
| 9 | Drug ineffective | FAERS: 14 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 10 | Abdominal Pain | FAERS: 11 | US FAERS | |
| 11 | Asthenia | FAERS: 10 | US FAERS | |
| 12 | Disease Progression | FAERS: 10 | US FAERS | |
| 13 | Septic Shock | FAERS: 10 | US FAERS | |
| 14 | Colitis | FAERS: 8 | US FAERS | |
| 15 | Febrile Neutropenia | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 16 | No adverse event | FAERS: 8 | US FAERS | |
| 17 | Product use complaint | FAERS: 8 | US FAERS | |
| 18 | Sepsis | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 19 | Fatigue | FAERS: 7 | US FAERS | |
| 20 | Infection | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 21 | Respiratory Failure | FAERS: 6 | US FAERS | |
| 22 | Abdominal discomfort | FAERS: 5 | US FAERS | |
| 23 | Bone pain | FAERS: 5 | US FAERS | |
| 24 | Constipation | FAERS: 5 | US FAERS | |
| 25 | Headache | FAERS: 5 | US FAERS | |
| 26 | Neutropenic colitis | FAERS: 5 | US FAERS | |
| 27 | Pancytopenia | FAERS: 5 | US FAERS | |
| 28 | Amylase increased | FAERS: 4 | US FAERS | |
| 29 | Chest Pain | FAERS: 4 | US FAERS | |
| 30 | Dizziness | FAERS: 4 | US FAERS | |
| 31 | Inappropriate schedule of drug administration | FAERS: 4 | US FAERS | |
| 32 | Malignant neoplasm progression | FAERS: 4 | US FAERS | |
| 33 | Neutrophil count decreased | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 34 | Weight decreased | FAERS: 4 | US FAERS | |
| 35 | White blood cell count decreased | FAERS: 4 | US FAERS | |
| 36 | Alopecia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 37 | Ascites | FAERS: 3 | US FAERS | |
| 38 | Atrial Fibrillation | FAERS: 3 | US FAERS | |
| 39 | Basal cell carcinoma | FAERS: 3 | US FAERS | |
| 40 | Blood albumin decreased | FAERS: 3 | US FAERS | |
| 41 | Cardiac Arrest | FAERS: 3 | US FAERS | |
| 42 | Cerebrovascular accident | FAERS: 3 | US FAERS | |
| 43 | Disease recurrence | FAERS: 3 | US FAERS | |
| 44 | Full blood count decreased | FAERS: 3 | US FAERS | |
| 45 | Incorrect dose administered | FAERS: 3 | US FAERS | |
| 46 | Lipase increased | FAERS: 3 | US FAERS | |
| 47 | Mastocytosis | FAERS: 3 | US FAERS | |
| 48 | Oropharyngeal pain | FAERS: 3 | US FAERS | |
| 49 | Pancreatitis | FAERS: 3 | US FAERS | |
| 50 | Squamous cell carcinoma | FAERS: 3 | US FAERS | |
| 51 | Therapy cessation | FAERS: 3 | US FAERS | |
| 52 | Wrong technique in product usage process | FAERS: 3 | US FAERS | |
| 53 | Amnesia | FAERS: 2 | US FAERS | |
| 54 | Bronchopulmonary Aspergillosis | FAERS: 2 | US FAERS | |
| 55 | Chills | FAERS: 2 | US FAERS | |
| 56 | Concomitant disease aggravated | FAERS: 2 | US FAERS | |
| 57 | Concomitant disease progression | FAERS: 2 | US FAERS | |
| 58 | Disease complication | FAERS: 2 | US FAERS | |
| 59 | Drug level increased | FAERS: 2 | US FAERS | |
| 60 | Drug withdrawal syndrome | FAERS: 2 | US FAERS | |
| 61 | Dysphonia | FAERS: 2 | US FAERS | |
| 62 | Full blood count abnormal | FAERS: 2 | US FAERS | |
| 63 | Gastrointestinal Pain | FAERS: 2 | US FAERS | |
| 64 | Hepatotoxicity | FAERS: 2 | US FAERS | |
| 65 | Hypersensitivity | FAERS: 2 | US FAERS | |
| 66 | Hypotension | FAERS: 2 | US FAERS | |
| 67 | Hypoxia | FAERS: 2 | US FAERS | |
| 68 | Large intestine perforation | FAERS: 2 | US FAERS | |
| 69 | Leukopenia | FAERS: 2 | US FAERS | |
| 70 | Memory impairment | FAERS: 2 | US FAERS | |
| 71 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 72 | Pain | FAERS: 2 | US FAERS | |
| 73 | Pericarditis | FAERS: 2 | US FAERS | |
| 74 | Product use in unapproved indication | FAERS: 2 | US FAERS | |
| 75 | Pruritus | FAERS: 2 | US FAERS | |
| 76 | Stress | FAERS: 2 | US FAERS | |
| 77 | Swelling | FAERS: 2 | US FAERS | |
| 78 | jaundice | FAERS: 2 | US FAERS | |
| 79 | Abdominal mass | FAERS: 1 | US FAERS | |
| 80 | Acidosis | FAERS: 1 | US FAERS | |
| 81 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 82 | Ageusia | FAERS: 1 | US FAERS | |
| 83 | Agranulocytosis | FAERS: 1 | US FAERS | |
| 84 | Akinesia | FAERS: 1 | US FAERS | |
| 85 | Angioedema | FAERS: 1 | US FAERS | |
| 86 | Anuria | FAERS: 1 | US FAERS | |
| 87 | Apathy | FAERS: 1 | US FAERS | |
| 88 | Atypical pneumonia | FAERS: 1 | US FAERS | |
| 89 | Bilirubin conjugated increased | FAERS: 1 | US FAERS | |
| 90 | Blast cell count increased | FAERS: 1 | US FAERS | |
| 91 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 92 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 93 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 94 | Blood urea increased | FAERS: 1 | US FAERS | |
| 95 | Bone marrow infiltration | FAERS: 1 | US FAERS | |
| 96 | Bone marrow myelogram abnormal | FAERS: 1 | US FAERS | |
| 97 | Cardiac cirrhosis | FAERS: 1 | US FAERS | |
| 98 | Cardiac dysfunction | FAERS: 1 | US FAERS | |
| 99 | Cellulitis | FAERS: 1 | US FAERS | |
| 100 | Cholecystitis | FAERS: 1 | US FAERS | |
| 101 | Cholestasis | FAERS: 1 | US FAERS | |
| 102 | Clostridium colitis | FAERS: 1 | US FAERS | |
| 103 | Colon adenoma | FAERS: 1 | US FAERS | |
| 104 | Delirium | FAERS: 1 | US FAERS | |
| 105 | Dementia | FAERS: 1 | US FAERS | |
| 106 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 107 | Depressed mood | FAERS: 1 | US FAERS | |
| 108 | Device related infection | FAERS: 1 | US FAERS | |
| 109 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 110 | Diffuse Large B-Cell Lymphoma | FAERS: 1 | US FAERS | |
| 111 | Discomfort | FAERS: 1 | US FAERS | |
| 112 | Disorientation | FAERS: 1 | US FAERS | |
| 113 | Drooling | FAERS: 1 | US FAERS | |
| 114 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 115 | Drug resistance | FAERS: 1 | US FAERS | |
| 116 | Dysgeusia | FAERS: 1 | US FAERS | |
| 117 | Dysgraphia | FAERS: 1 | US FAERS | |
| 118 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 119 | Embolic stroke | FAERS: 1 | US FAERS | |
| 120 | Enterobacter sepsis | FAERS: 1 | US FAERS | |
| 121 | Enterococcal infection | FAERS: 1 | US FAERS | |
| 122 | Enterocolitis | FAERS: 1 | US FAERS | |
| 123 | Epilepsy | FAERS: 1 | US FAERS | |
| 124 | Epistaxis | FAERS: 1 | US FAERS | |
| 125 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 126 | Flatulence | FAERS: 1 | US FAERS | |
| 127 | Flushing | FAERS: 1 | US FAERS | |
| 128 | Full blood count increased | FAERS: 1 | US FAERS | |
| 129 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 130 | Gastritis | FAERS: 1 | US FAERS | |
| 131 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 132 | Gastrointestinal perforation | FAERS: 1 | US FAERS | |
| 133 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 134 | Head discomfort | FAERS: 1 | US FAERS | |
| 135 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 136 | Hyperlipasaemia | FAERS: 1 | US FAERS | |
| 137 | Hyperpyrexia | FAERS: 1 | US FAERS | |
| 138 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 139 | Hypophagia | FAERS: 1 | US FAERS | |
| 140 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 141 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 142 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 143 | Intussusception | FAERS: 1 | US FAERS | |
| 144 | Invasive Lobular Breast Carcinoma | FAERS: 1 | US FAERS | |
| 145 | Laceration | FAERS: 1 | US FAERS | |
| 146 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 147 | Left atrial dilatation | FAERS: 1 | US FAERS | |
| 148 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 149 | Malnutrition | FAERS: 1 | US FAERS | |
| 150 | Meningitis | FAERS: 1 | US FAERS | |
| 151 | Mental status changes | FAERS: 1 | US FAERS | |
| 152 | Micrococcal sepsis | FAERS: 1 | US FAERS | |
| 153 | Mucosal pain | FAERS: 1 | US FAERS | |
| 154 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 155 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 156 | Mycobacterium tuberculosis complex test positive | FAERS: 1 | US FAERS | |
| 157 | Myocarditis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 158 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 159 | Neutropenic sepsis | FAERS: 1 | US FAERS | |
| 160 | Night sweats | FAERS: 1 | US FAERS | |
| 161 | Nystagmus | FAERS: 1 | US FAERS | |
| 162 | Papule | FAERS: 1 | US FAERS | |
| 163 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 164 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 165 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 166 | Product administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 167 | Product outer packaging issue | FAERS: 1 | US FAERS | |
| 168 | Productive Cough | FAERS: 1 | US FAERS | |
| 169 | Pseudomonal sepsis | FAERS: 1 | US FAERS | |
| 170 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 171 | Pulmonary arterial pressure increased | FAERS: 1 | US FAERS | |
| 172 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 173 | Respiratory distress | FAERS: 1 | US FAERS | |
| 174 | Respiratory tract infection fungal | FAERS: 1 | US FAERS | |
| 175 | Right atrial dilatation | FAERS: 1 | US FAERS | |
| 176 | Somatic symptom disorder | FAERS: 1 | US FAERS | |
| 177 | Splenic Infarction | FAERS: 1 | US FAERS | |
| 178 | Splenic abscess | FAERS: 1 | US FAERS | |
| 179 | Squamous cell carcinoma of skin | FAERS: 1 | US FAERS | |
| 180 | Stenotrophomonas infection | FAERS: 1 | US FAERS | |
| 181 | Stomatitis | FAERS: 1 | US FAERS | |
| 182 | Tachycardia | FAERS: 1 | US FAERS | |
| 183 | Therapy non-responder | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 184 | Therapy partial responder | FAERS: 1 | US FAERS | |
| 185 | Thyroid hormones increased | FAERS: 1 | US FAERS | |
| 186 | Tooth Infection | FAERS: 1 | US FAERS | |
| 187 | Transaminases increased | FAERS: 1 | US FAERS | |
| 188 | Tremor | FAERS: 1 | US FAERS | |
| 189 | Tryptase increased | FAERS: 1 | US FAERS | |
| 190 | Unevaluable event | FAERS: 1 | US FAERS | |
| 191 | Urticaria | FAERS: 1 | US FAERS | |
| 192 | Ventricular hypokinesia | FAERS: 1 | US FAERS | |
| 193 | Vertigo | FAERS: 1 | US FAERS | |
| 194 | keratoacanthoma | FAERS: 1 | US FAERS | |
| 195 | Fibrosarcoma | Canada Vigilance: 1 | Canada Vigilance | |
| 196 | Mastocytosis, Systemic | 17420286 | CTD | |
| 197 | Therapeutic product effect incomplete | Canada Vigilance: 1 | Canada Vigilance | |
| 198 | treatment failure | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.