fluticasone furoate
(XTULMSXFIHGYFS-VLSRWLAYSA-N)
Structure
- SMILES
- FCSC(=O)[C@@]1(OC(=O)c2ccco2)[C@H](C)C[C@@H]2[C@]1(C)C[C@H](O)[C@]1([C@H]2C[C@@H](C2=CC(=O)C=C[C@]12C)F)F
- Type(s)
- Approved
- ATC code(s)
- R01AD12; R03AK10; R03AL08; R03BA09
- Molecular Formula:
- C27H29F3O6S
- Molecular Weight:
- 538.576
- Log P:
- 4.9268
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 1
- TPSA:
- 119.11
- CAS Number(s):
- 397864-44-7; 779352-12-4; 911210-90-7
Synonym(s)
1.
fluticasone furoate
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 346 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 2 | Product quality issue | FAERS: 227 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 3 | Epistaxis | FAERS: 127 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 4 | Wrong technique in device usage process | FAERS: 96 | US FAERS | |
| 5 | Wrong technique in product usage process | FAERS: 91 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 6 | Product use in unapproved indication | FAERS: 89 | US FAERS | |
| 7 | Headache | FAERS: 87 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 8 | Product complaint | FAERS: 69 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 9 | Nasal discomfort | FAERS: 58 | US FAERS | |
| 10 | Drug dose omission | FAERS: 57 | US FAERS | |
| 11 | Dizziness | FAERS: 56 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Anosmia | FAERS: 54 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 13 | Device use error | FAERS: 51 | US FAERS | |
| 14 | Overdose | FAERS: 45 | US FAERS | |
| 15 | Hypersensitivity | FAERS: 41 | US FAERS | |
| 16 | Accidental exposure to product | FAERS: 36 | US FAERS | |
| 17 | Asthma | FAERS: 35 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 18 | Incorrect dose administered | FAERS: 34 | US FAERS | |
| 19 | Dysphonia | FAERS: 33 | US FAERS | |
| 20 | Nausea | FAERS: 33 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 21 | Malaise | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 22 | Oropharyngeal pain | FAERS: 30 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 23 | Inappropriate schedule of drug administration | FAERS: 28 | US FAERS | |
| 24 | Fatigue | FAERS: 25 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 25 | Product use issue | FAERS: 25 | US FAERS | |
| 26 | Ageusia | FAERS: 24 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 27 | Extra dose administered | FAERS: 22 | US FAERS | |
| 28 | Cataract | FAERS: 21 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 29 | Drug ineffective for unapproved indication | FAERS: 21 | US FAERS | |
| 30 | Inappropriate schedule of product administration | FAERS: 21 | US FAERS | |
| 31 | Sinusitis | FAERS: 21 | US FAERS | |
| 32 | Drug effect incomplete | FAERS: 20 | US FAERS | |
| 33 | Product dispensing error | FAERS: 20 | US FAERS | |
| 34 | Therapeutic response unexpected | FAERS: 20 | US FAERS | |
| 35 | Throat irritation | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 36 | Pain | FAERS: 19 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 37 | Anxiety | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 38 | Urticaria | FAERS: 18 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 39 | Chest discomfort | FAERS: 17 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 40 | Drug effective for unapproved indication | FAERS: 17 | US FAERS | |
| 41 | Dysgeusia | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 42 | Sneezing | FAERS: 17 | US FAERS | |
| 43 | Vomiting | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 44 | Back Pain | FAERS: 16 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 45 | Drug administration error | FAERS: 16 | US FAERS | |
| 46 | Eye pain | FAERS: 16 | US FAERS | |
| 47 | Erythema | FAERS: 15 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 48 | Product dose omission | FAERS: 15 | US FAERS | |
| 49 | Asthenia | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 50 | Drug administered to patient of inappropriate age | FAERS: 14 | US FAERS | |
| 51 | Feeling abnormal | FAERS: 14 | US FAERS | |
| 52 | Glaucoma | FAERS: 14 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 53 | Palpitations | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 54 | Medication Error | FAERS: 13 | US FAERS | |
| 55 | Pharmaceutical product complaint | FAERS: 13 | US FAERS | |
| 56 | Pneumonia | FAERS: 13 | US FAERS | |
| 57 | Product package associated injury | FAERS: 13 | US FAERS | |
| 58 | Pruritus | FAERS: 13 | US FAERS | |
| 59 | Rhinalgia | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 60 | Somnolence | FAERS: 13 | US FAERS | |
| 61 | Adverse event | FAERS: 12 | US FAERS | |
| 62 | Expired product administered | FAERS: 12 | US FAERS | |
| 63 | Eye irritation | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 64 | Nasopharyngitis | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 65 | Sinus headache | FAERS: 12 | US FAERS | |
| 66 | Wheezing | FAERS: 12 | US FAERS | |
| 67 | Burning sensation | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 68 | Ear discomfort | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 69 | Intentional product misuse | FAERS: 10 | US FAERS | |
| 70 | Prescribed overdose | FAERS: 10 | US FAERS | |
| 71 | Product storage error | FAERS: 10 | US FAERS | |
| 72 | Visual Impairment | FAERS: 10 | US FAERS | |
| 73 | Accidental overdose | FAERS: 9 | US FAERS | |
| 74 | Circumstance or information capable of leading to medication error | FAERS: 9 | US FAERS | |
| 75 | Incorrect product administration duration | FAERS: 9 | US FAERS | |
| 76 | Laceration | FAERS: 9 | US FAERS | |
| 77 | Tinnitus | FAERS: 9 | US FAERS | |
| 78 | Bronchitis | FAERS: 8 | US FAERS | |
| 79 | Incorrect drug administration duration | FAERS: 8 | US FAERS | |
| 80 | Nasal inflammation | FAERS: 8 | US FAERS | |
| 81 | Angioedema | FAERS: 7 | US FAERS | |
| 82 | Chest Pain | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 83 | Choking | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 84 | Drug prescribing error | FAERS: 7 | US FAERS | |
| 85 | Feeling jittery | FAERS: 7 | US FAERS | |
| 86 | Oropharyngeal discomfort | FAERS: 7 | US FAERS | |
| 87 | Product container issue | FAERS: 7 | US FAERS | |
| 88 | Productive Cough | FAERS: 7 | US FAERS | |
| 89 | Upper-airway cough syndrome | FAERS: 7 | US FAERS | |
| 90 | Abdominal discomfort | FAERS: 6 | US FAERS | |
| 91 | Arthralgia | FAERS: 6 | US FAERS | |
| 92 | Blood cortisol decreased | FAERS: 6 | US FAERS | |
| 93 | Contraindicated product administered | FAERS: 6 | US FAERS | |
| 94 | Infection | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 95 | Lip swelling | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 96 | Myalgia | FAERS: 6 | US FAERS | |
| 97 | Oral candidiasis | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 98 | Vertigo | FAERS: 6 | US FAERS | |
| 99 | Abdominal Pain | FAERS: 5 | US FAERS | |
| 100 | Flushing | FAERS: 5 | US FAERS | |
| 101 | Growth retardation | FAERS: 5 | US FAERS | |
| 102 | Influenza | FAERS: 5 | US FAERS | |
| 103 | Peripheral swelling | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 104 | Product cleaning inadequate | FAERS: 5 | US FAERS | |
| 105 | Product label confusion | FAERS: 5 | US FAERS | |
| 106 | Swelling | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 107 | Weight decreased | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 108 | Aphonia | FAERS: 4 | US FAERS | |
| 109 | Bronchospasm | FAERS: 4 | US FAERS | |
| 110 | Cataract operation | FAERS: 4 | US FAERS | |
| 111 | Diplopia | FAERS: 4 | US FAERS | |
| 112 | Encephalitis | FAERS: 4 | US FAERS | |
| 113 | Head discomfort | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 114 | Inability to afford medication | FAERS: 4 | US FAERS | |
| 115 | Increased upper airway secretion | FAERS: 4 | US FAERS | |
| 116 | Nasal mucosal disorder | FAERS: 4 | US FAERS | |
| 117 | Nasal pruritus | FAERS: 4 | US FAERS | |
| 118 | Nervousness | FAERS: 4 | US FAERS | |
| 119 | Ocular discomfort | FAERS: 4 | US FAERS | |
| 120 | Paranasal sinus discomfort | FAERS: 4 | US FAERS | |
| 121 | Rhinitis | FAERS: 4 | US FAERS | |
| 122 | Syncope | FAERS: 4 | US FAERS | |
| 123 | Acne | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 124 | Agitation | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 125 | Aneurysm | FAERS: 3 | US FAERS | |
| 126 | Angina Pectoris | FAERS: 3 | US FAERS | |
| 127 | Auricular swelling | FAERS: 3 | US FAERS | |
| 128 | Blood glucose increased | FAERS: 3 | US FAERS | |
| 129 | Cellulitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 130 | Constipation | FAERS: 3 | US FAERS | |
| 131 | Crying | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 132 | Depressed Level of Consciousness | FAERS: 3 | US FAERS | |
| 133 | Device malfunction | FAERS: 3 | US FAERS | |
| 134 | Discomfort | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 135 | Drug dispensing error | FAERS: 3 | US FAERS | |
| 136 | Drug exposure during pregnancy | FAERS: 3 | US FAERS | |
| 137 | Emergency care examination | FAERS: 3 | US FAERS | |
| 138 | Facial Pain | FAERS: 3 | US FAERS | |
| 139 | Incorrect route of product administration | FAERS: 3 | US FAERS | |
| 140 | Inflammation | FAERS: 3 | US FAERS | |
| 141 | Intercepted drug administration error | FAERS: 3 | US FAERS | |
| 142 | Intercepted medication error | FAERS: 3 | US FAERS | |
| 143 | Laryngitis | FAERS: 3 | US FAERS | |
| 144 | Lymphadenopathy | FAERS: 3 | US FAERS | |
| 145 | Myocardial Infarction | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 146 | Oral pain | FAERS: 3 | US FAERS | |
| 147 | Oropharyngeal swelling | FAERS: 3 | US FAERS | |
| 148 | Pharyngitis | FAERS: 3 | US FAERS | |
| 149 | Photophobia | FAERS: 3 | US FAERS | |
| 150 | Pleurisy | FAERS: 3 | US FAERS | |
| 151 | Product prescribing issue | FAERS: 3 | US FAERS | |
| 152 | Rash erythematous | FAERS: 3 | US FAERS | |
| 153 | Rebound effect | FAERS: 3 | US FAERS | |
| 154 | Retching | FAERS: 3 | US FAERS | |
| 155 | Scab | FAERS: 3 | US FAERS | |
| 156 | Secretion discharge | FAERS: 3 | US FAERS | |
| 157 | Tachycardia | FAERS: 3 | US FAERS | |
| 158 | Therapeutic procedure | FAERS: 3 | US FAERS | |
| 159 | Thrombosis | FAERS: 3 | US FAERS | |
| 160 | Tremor | FAERS: 3 | US FAERS | |
| 161 | Visual disturbance | FAERS: 3 | US FAERS | |
| 162 | Accidental exposure to product packaging | FAERS: 2 | US FAERS | |
| 163 | Accidental exposure | FAERS: 2 | US FAERS | |
| 164 | Alopecia | FAERS: 2 | US FAERS | |
| 165 | Amnesia | FAERS: 2 | US FAERS | |
| 166 | Anaphylactic shock | FAERS: 2 | US FAERS | |
| 167 | Anaphylactoid Reaction | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 168 | Angle Closure Glaucoma | FAERS: 2 | US FAERS | |
| 169 | Asphyxia | FAERS: 2 | US FAERS | |
| 170 | Atrial Fibrillation | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 171 | Blepharospasm | FAERS: 2 | US FAERS | |
| 172 | Blood glucose decreased | FAERS: 2 | US FAERS | |
| 173 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 174 | Chills | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 175 | Decreased immune responsiveness | FAERS: 2 | US FAERS | |
| 176 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 177 | Diabetes mellitus inadequate control | FAERS: 2 | US FAERS | |
| 178 | Disease recurrence | FAERS: 2 | US FAERS | |
| 179 | Drug Dependence | FAERS: 2 | US FAERS | |
| 180 | Dysentery | FAERS: 2 | US FAERS | |
| 181 | Emotional distress | FAERS: 2 | US FAERS | |
| 182 | Eyelid irritation | FAERS: 2 | US FAERS | |
| 183 | Flank Pain | FAERS: 2 | US FAERS | |
| 184 | Flatulence | FAERS: 2 | US FAERS | |
| 185 | Foreign body aspiration | FAERS: 2 | US FAERS | |
| 186 | Hyperinsulinism | FAERS: 2 | US FAERS | |
| 187 | Hypersomnia | FAERS: 2 | US FAERS | |
| 188 | Hypertensive crisis | FAERS: 2 | US FAERS | |
| 189 | Hypoaesthesia facial | FAERS: 2 | US FAERS | |
| 190 | Hypotension | FAERS: 2 | US FAERS | |
| 191 | Immobile | FAERS: 2 | US FAERS | |
| 192 | Incorrect product storage | FAERS: 2 | US FAERS | |
| 193 | Intentional product use issue | FAERS: 2 | US FAERS | |
| 194 | Intercepted drug dispensing error | FAERS: 2 | US FAERS | |
| 195 | Intercepted drug prescribing error | FAERS: 2 | US FAERS | |
| 196 | Joint swelling | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 197 | Limb injury | FAERS: 2 | US FAERS | |
| 198 | Metamorphopsia | FAERS: 2 | US FAERS | |
| 199 | Molluscum Contagiosum | FAERS: 2 | US FAERS | |
| 200 | Multiple allergies | FAERS: 2 | US FAERS | |
| 201 | Muscle tightness | FAERS: 2 | US FAERS | |
| 202 | Musculoskeletal discomfort | FAERS: 2 | US FAERS | |
| 203 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 204 | Myopia | FAERS: 2 | US FAERS | |
| 205 | Neutropenia | FAERS: 2 | US FAERS | |
| 206 | Nonspecific reaction | FAERS: 2 | US FAERS | |
| 207 | Oral fungal infection | FAERS: 2 | US FAERS | |
| 208 | Ovarian enlargement | FAERS: 2 | US FAERS | |
| 209 | Poisoning | FAERS: 2 | US FAERS | |
| 210 | Poor quality sleep | FAERS: 2 | US FAERS | |
| 211 | Product administered at inappropriate site | FAERS: 2 | US FAERS | |
| 212 | Product packaging issue | FAERS: 2 | US FAERS | |
| 213 | Respiratory tract irritation | FAERS: 2 | US FAERS | |
| 214 | Rosacea | FAERS: 2 | US FAERS | |
| 215 | Sinus operation | FAERS: 2 | US FAERS | |
| 216 | Sinus pain | FAERS: 2 | US FAERS | |
| 217 | Stomatitis | FAERS: 2 | US FAERS | |
| 218 | Therapeutic product effect incomplete | FAERS: 2 | US FAERS | |
| 219 | Therapeutic response changed | FAERS: 2 | US FAERS | |
| 220 | Ultrasound scan abnormal | FAERS: 2 | US FAERS | |
| 221 | Vitreous floaters | FAERS: 2 | US FAERS | |
| 222 | Vulvovaginal mycotic infection | FAERS: 2 | US FAERS | |
| 223 | Abasia | FAERS: 1 | US FAERS | |
| 224 | Abscess | FAERS: 1 | US FAERS | |
| 225 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 226 | Adenoidal disorder | FAERS: 1 | US FAERS | |
| 227 | Adrenal mass | FAERS: 1 | US FAERS | |
| 228 | Anger | FAERS: 1 | US FAERS | |
| 229 | Anticoagulation drug level above therapeutic | FAERS: 1 | US FAERS | |
| 230 | Application site erosion | FAERS: 1 | US FAERS | |
| 231 | Application site pain | FAERS: 1 | US FAERS | |
| 232 | Artificial crown procedure | FAERS: 1 | US FAERS | |
| 233 | Atrophic vulvovaginitis | FAERS: 1 | US FAERS | |
| 234 | Back disorder | FAERS: 1 | US FAERS | |
| 235 | Bacterial rhinitis | FAERS: 1 | US FAERS | |
| 236 | Blindness | FAERS: 1 | US FAERS | |
| 237 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 238 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 239 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 240 | Bone pain | FAERS: 1 | US FAERS | |
| 241 | Borderline glaucoma | FAERS: 1 | US FAERS | |
| 242 | Borrelia test positive | FAERS: 1 | US FAERS | |
| 243 | Brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 244 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 245 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 246 | Catheter placement | FAERS: 1 | US FAERS | |
| 247 | Cheilitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 248 | Chemotherapy | FAERS: 1 | US FAERS | |
| 249 | Choking sensation | FAERS: 1 | US FAERS | |
| 250 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 251 | Circumstance or information capable of leading to device use error | FAERS: 1 | US FAERS | |
| 252 | Complication associated with device | FAERS: 1 | US FAERS | |
| 253 | Compression fracture | FAERS: 1 | US FAERS | |
| 254 | Concomitant disease aggravated | FAERS: 1 | US FAERS | |
| 255 | Cyst | FAERS: 1 | US FAERS | |
| 256 | Dacryostenosis acquired | FAERS: 1 | US FAERS | |
| 257 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 258 | Dehydration | FAERS: 1 | US FAERS | |
| 259 | Dental caries | FAERS: 1 | US FAERS | |
| 260 | Dependence | FAERS: 1 | US FAERS | |
| 261 | Depressed mood | FAERS: 1 | US FAERS | |
| 262 | Dermatitis | FAERS: 1 | US FAERS | |
| 263 | Disorientation | FAERS: 1 | US FAERS | |
| 264 | Drooling | FAERS: 1 | US FAERS | |
| 265 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 266 | Drug effect variable | FAERS: 1 | US FAERS | |
| 267 | Drug screen positive | FAERS: 1 | US FAERS | |
| 268 | Drug toxicity | FAERS: 1 | US FAERS | |
| 269 | Dyspepsia | FAERS: 1 | US FAERS | |
| 270 | Electrocardiogram | FAERS: 1 | US FAERS | |
| 271 | Elevated mood | FAERS: 1 | US FAERS | |
| 272 | Emergency Care | FAERS: 1 | US FAERS | |
| 273 | Emotional disorder | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 274 | Endodontic procedure | FAERS: 1 | US FAERS | |
| 275 | Environmental Exposure | FAERS: 1 | US FAERS | |
| 276 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 277 | Erection increased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 278 | Eructation | FAERS: 1 | US FAERS | |
| 279 | Erythema Multiforme | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 280 | Euphoric mood | FAERS: 1 | US FAERS | |
| 281 | Eye Infection | FAERS: 1 | US FAERS | |
| 282 | Eye inflammation | FAERS: 1 | US FAERS | |
| 283 | Eyelid pain | FAERS: 1 | US FAERS | |
| 284 | Eyelids pruritus | FAERS: 1 | US FAERS | |
| 285 | Facial Paresis | FAERS: 1 | US FAERS | |
| 286 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 287 | Fluid overload | FAERS: 1 | US FAERS | |
| 288 | Food Allergy | FAERS: 1 | US FAERS | |
| 289 | Foreign body in respiratory tract | FAERS: 1 | US FAERS | |
| 290 | Frustration tolerance decreased | FAERS: 1 | US FAERS | |
| 291 | Fungal rhinitis | FAERS: 1 | US FAERS | |
| 292 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 293 | Gastrointestinal candidiasis | FAERS: 1 | US FAERS | |
| 294 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 295 | Glossitis | FAERS: 1 | US FAERS | |
| 296 | Hordeolum | FAERS: 1 | US FAERS | |
| 297 | Hyperventilation | FAERS: 1 | US FAERS | |
| 298 | Hypogeusia | FAERS: 1 | US FAERS | |
| 299 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 300 | Immunosuppression | FAERS: 1 | US FAERS | |
| 301 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 302 | Impaired work ability | FAERS: 1 | US FAERS | |
| 303 | Increased bronchial secretion | FAERS: 1 | US FAERS | |
| 304 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 305 | Increased viscosity of bronchial secretion | FAERS: 1 | US FAERS | |
| 306 | Increased viscosity of upper respiratory secretion | FAERS: 1 | US FAERS | |
| 307 | Induration | FAERS: 1 | US FAERS | |
| 308 | Intentional device misuse | FAERS: 1 | US FAERS | |
| 309 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 310 | Intercepted product prescribing error | FAERS: 1 | US FAERS | |
| 311 | Intercepted product storage error | FAERS: 1 | US FAERS | |
| 312 | Keratoconjunctivitis Sicca | FAERS: 1 | US FAERS | |
| 313 | Keratosis pilaris | FAERS: 1 | US FAERS | |
| 314 | Lactose Intolerance | FAERS: 1 | US FAERS | |
| 315 | Laryngospasm | FAERS: 1 | US FAERS | |
| 316 | Lethargy | FAERS: 1 | US FAERS | |
| 317 | Leukocytosis | FAERS: 1 | US FAERS | |
| 318 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 319 | Living in residential institution | FAERS: 1 | US FAERS | |
| 320 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 321 | Mastication disorder | FAERS: 1 | US FAERS | |
| 322 | Medication residue | FAERS: 1 | US FAERS | |
| 323 | Middle insomnia | FAERS: 1 | US FAERS | |
| 324 | Mood swings | FAERS: 1 | US FAERS | |
| 325 | Mouth swelling | FAERS: 1 | US FAERS | |
| 326 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 327 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 328 | Mydriasis | FAERS: 1 | US FAERS | |
| 329 | Myopathy | FAERS: 1 | US FAERS | |
| 330 | Nasal mucosa atrophy | FAERS: 1 | US FAERS | |
| 331 | Nasal mucosal erosion | FAERS: 1 | US FAERS | |
| 332 | Nasal mucosal ulcer | FAERS: 1 | US FAERS | |
| 333 | Nasal turbinate abnormality | FAERS: 1 | US FAERS | |
| 334 | Negativism | FAERS: 1 | US FAERS | |
| 335 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 336 | Neuralgia | FAERS: 1 | US FAERS | |
| 337 | No adverse event | FAERS: 1 | US FAERS | |
| 338 | No adverse reaction | FAERS: 1 | US FAERS | |
| 339 | Ocular Hypertension | FAERS: 1 | US FAERS | |
| 340 | Olfactory Nerve Disorder | FAERS: 1 | US FAERS | |
| 341 | Onychalgia | FAERS: 1 | US FAERS | |
| 342 | Onychoclasis | FAERS: 1 | US FAERS | |
| 343 | Optic Atrophy | FAERS: 1 | US FAERS | |
| 344 | Optic Neuritis | FAERS: 1 | US FAERS | |
| 345 | Oral mucosal erythema | FAERS: 1 | US FAERS | |
| 346 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 347 | Osteopenia | FAERS: 1 | US FAERS | |
| 348 | Otitis Media | FAERS: 1 | US FAERS | |
| 349 | Pain of skin | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 350 | Palatal swelling | FAERS: 1 | US FAERS | |
| 351 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 352 | Parasomnia | FAERS: 1 | US FAERS | |
| 353 | Performance status decreased | FAERS: 1 | US FAERS | |
| 354 | Personality Change | FAERS: 1 | US FAERS | |
| 355 | Petechiae | FAERS: 1 | US FAERS | |
| 356 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 357 | Pharyngolaryngeal abscess | FAERS: 1 | US FAERS | |
| 358 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 359 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 360 | Prescribed underdose | FAERS: 1 | US FAERS | |
| 361 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 362 | Presyncope | FAERS: 1 | US FAERS | |
| 363 | Product administration error | FAERS: 1 | US FAERS | |
| 364 | Product appearance confusion | FAERS: 1 | US FAERS | |
| 365 | Product communication issue | FAERS: 1 | US FAERS | |
| 366 | Product contamination physical | FAERS: 1 | US FAERS | |
| 367 | Product prescribing error | FAERS: 1 | US FAERS | |
| 368 | Product substitution issue | FAERS: 1 | US FAERS | |
| 369 | Product supply issue | FAERS: 1 | US FAERS | |
| 370 | Pseudomonas bronchitis | FAERS: 1 | US FAERS | |
| 371 | Pulmonary Valve Stenosis | FAERS: 1 | US FAERS | |
| 372 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 373 | Pulmonary pain | FAERS: 1 | US FAERS | |
| 374 | Purulence | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 375 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 376 | Reaction to preservatives | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 377 | Rehabilitation therapy | FAERS: 1 | US FAERS | |
| 378 | Respiratory distress | FAERS: 1 | US FAERS | |
| 379 | Respiratory tract infection viral | FAERS: 1 | US FAERS | |
| 380 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 381 | Retinoschisis | FAERS: 1 | US FAERS | |
| 382 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 383 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 384 | Saliva analysis abnormal | FAERS: 1 | US FAERS | |
| 385 | Scotoma | FAERS: 1 | US FAERS | |
| 386 | Skin irritation | FAERS: 1 | US FAERS | |
| 387 | Skin laceration | FAERS: 1 | US FAERS | |
| 388 | Skin lesion | FAERS: 1 | US FAERS | |
| 389 | Skin reaction | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 390 | Small cell lung cancer extensive stage | FAERS: 1 | US FAERS | |
| 391 | Somnambulism | FAERS: 1 | US FAERS | |
| 392 | Stem cell transplant | FAERS: 1 | US FAERS | |
| 393 | Stress | FAERS: 1 | US FAERS | |
| 394 | Sudden death | FAERS: 1 | US FAERS | |
| 395 | Swelling of eyelid | FAERS: 1 | US FAERS | |
| 396 | Tendon discomfort | FAERS: 1 | US FAERS | |
| 397 | Therapeutic product effect decreased | FAERS: 1 | US FAERS | |
| 398 | Thirst | FAERS: 1 | US FAERS | |
| 399 | Throat cancer | FAERS: 1 | US FAERS | |
| 400 | Throat clearing | FAERS: 1 | US FAERS | |
| 401 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 402 | Tongue blistering | FAERS: 1 | US FAERS | |
| 403 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 404 | Tooth repair | FAERS: 1 | US FAERS | |
| 405 | Transcription medication error | FAERS: 1 | US FAERS | |
| 406 | Transmission of an infectious agent via a medicinal product | FAERS: 1 | US FAERS | |
| 407 | Tympanic Membrane Perforation | FAERS: 1 | US FAERS | |
| 408 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 409 | Urinary Retention | FAERS: 1 | US FAERS | |
| 410 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 411 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 412 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 413 | Vitreous Detachment | FAERS: 1 | US FAERS | |
| 414 | Waist circumference increased | FAERS: 1 | US FAERS | |
| 415 | cancer surgery | FAERS: 1 | US FAERS | |
| 416 | furuncle | FAERS: 1 | US FAERS | |
| 417 | jaundice | FAERS: 1 | US FAERS | |
| 418 | Product impurity | Canada Vigilance: 1 | Canada Vigilance | |
| 419 | Product lot number issue | Canada Vigilance: 1 | Canada Vigilance | |
| 420 | Purulent discharge | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.