Sotalol
(VIDRYROWYFWGSY-UHFFFAOYSA-N)
Structure
- SMILES
- CC(NCC(c1ccc(cc1)NS(=O)(=O)C)O)C.Cl
- Molecular Formula:
- C12H21ClN2O3S
- Molecular Weight:
- 308.825
- Log P:
- 3.4362
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 4
- TPSA:
- 86.81
- CAS Number(s):
- 959-24-0
Synonym(s)
1.
Sotalol
2.
Darob
3.
MJ-1999
4.
Sotalol Hydrochloride
5.
Sotalol Monohydrochloride
6.
MJ 1999
7.
MJ1999
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Atrial Fibrillation | FAERS: 60 | US FAERS | |
| 2 | Dizziness | FAERS: 38 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 3 | Drug ineffective | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 4 | Fatigue | FAERS: 22 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 5 | Bradycardia | FAERS: 21 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 6 | Palpitations | FAERS: 19 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 7 | Adverse event | FAERS: 16 | US FAERS | |
| 8 | Alopecia | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 9 | No adverse event | FAERS: 16 | US FAERS | |
| 10 | Cardiac Arrest | FAERS: 15 | US FAERS | |
| 11 | Product substitution issue | FAERS: 14 | US FAERS | |
| 12 | Asthenia | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 13 | Pharmaceutical product complaint | FAERS: 11 | US FAERS | |
| 14 | Ventricular Fibrillation | FAERS: 10 | US FAERS | |
| 15 | Chest Pain | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Headache | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | Malaise | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 18 | Medication Error | FAERS: 9 | US FAERS | |
| 19 | Syncope | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 20 | Toxicity to various agents | FAERS: 8 | US FAERS | |
| 21 | Hypotension | FAERS: 7 | US FAERS | |
| 22 | Nausea | FAERS: 7 | US FAERS | |
| 23 | Blood glucose increased | FAERS: 6 | US FAERS | |
| 24 | Drug dispensing error | FAERS: 6 | US FAERS | |
| 25 | Incorrect dose administered | FAERS: 6 | US FAERS | |
| 26 | Supraventricular tachycardia | FAERS: 6 | US FAERS | |
| 27 | Blood creatinine increased | FAERS: 5 | US FAERS | |
| 28 | Completed Suicide | FAERS: 5 | US FAERS | |
| 29 | Pruritus | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 30 | Tachycardia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 31 | Vomiting | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 32 | Abdominal discomfort | FAERS: 4 | US FAERS | |
| 33 | Arthralgia | FAERS: 4 | US FAERS | |
| 34 | Back Pain | FAERS: 4 | US FAERS | |
| 35 | Conjunctivitis | FAERS: 4 | US FAERS | |
| 36 | Drug exposure during pregnancy | FAERS: 4 | US FAERS | |
| 37 | Ejection Fraction Decreased | FAERS: 4 | US FAERS | |
| 38 | Erythema | FAERS: 4 | US FAERS | |
| 39 | Poisoning | FAERS: 4 | US FAERS | |
| 40 | Presyncope | FAERS: 4 | US FAERS | |
| 41 | Product quality issue | FAERS: 4 | US FAERS | |
| 42 | Therapeutic response unexpected with drug substitution | FAERS: 4 | US FAERS | |
| 43 | Visual Impairment | FAERS: 4 | US FAERS | |
| 44 | Abdominal Pain | FAERS: 3 | US FAERS | |
| 45 | Acute Coronary Syndrome | FAERS: 3 | US FAERS | |
| 46 | Autoimmune thrombocytopenia | FAERS: 3 | US FAERS | |
| 47 | Blood potassium decreased | FAERS: 3 | US FAERS | |
| 48 | Brain Death | FAERS: 3 | US FAERS | |
| 49 | Drug ineffective for unapproved indication | FAERS: 3 | US FAERS | |
| 50 | Dysgeusia | FAERS: 3 | US FAERS | |
| 51 | Electromechanical dissociation | FAERS: 3 | US FAERS | |
| 52 | Flatulence | FAERS: 3 | US FAERS | |
| 53 | General physical health deterioration | FAERS: 3 | US FAERS | |
| 54 | Hypoaesthesia facial | FAERS: 3 | US FAERS | |
| 55 | Impaired gastric emptying | FAERS: 3 | US FAERS | |
| 56 | Intercepted drug dispensing error | FAERS: 3 | US FAERS | |
| 57 | Joint swelling | FAERS: 3 | US FAERS | |
| 58 | Lethargy | FAERS: 3 | US FAERS | |
| 59 | Long QT Syndrome | FAERS: 3 | US FAERS | |
| 60 | Mental impairment | FAERS: 3 | US FAERS | |
| 61 | Myocardial Infarction | FAERS: 3 | US FAERS | |
| 62 | Nervousness | FAERS: 3 | US FAERS | |
| 63 | Onychoclasis | FAERS: 3 | US FAERS | |
| 64 | Scleroderma | FAERS: 3 | US FAERS | |
| 65 | Sick Sinus Syndrome | FAERS: 3 | US FAERS | |
| 66 | Sinus bradycardia | FAERS: 3 | US FAERS | |
| 67 | Thrombocytopenia | FAERS: 3 | US FAERS | |
| 68 | Troponin increased | FAERS: 3 | US FAERS | |
| 69 | Weight decreased | FAERS: 3 | US FAERS | |
| 70 | Abasia | FAERS: 2 | US FAERS | |
| 71 | Atrial Flutter | FAERS: 2 | US FAERS | |
| 72 | Atrioventricular Block | FAERS: 2 | US FAERS | |
| 73 | Blindness | FAERS: 2 | US FAERS | |
| 74 | Blood thyroid stimulating hormone increased | FAERS: 2 | US FAERS | |
| 75 | Cardiac Flutter | FAERS: 2 | US FAERS | |
| 76 | Cardioactive drug level increased | FAERS: 2 | US FAERS | |
| 77 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 78 | Chest discomfort | FAERS: 2 | US FAERS | |
| 79 | Creatinine renal clearance decreased | FAERS: 2 | US FAERS | |
| 80 | Deafness | FAERS: 2 | US FAERS | |
| 81 | Depressed Level of Consciousness | FAERS: 2 | US FAERS | |
| 82 | Drug dose omission | FAERS: 2 | US FAERS | |
| 83 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 84 | Drug toxicity | FAERS: 2 | US FAERS | |
| 85 | Dyspepsia | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 86 | Eructation | FAERS: 2 | US FAERS | |
| 87 | Feeling abnormal | FAERS: 2 | US FAERS | |
| 88 | Hepatitis | FAERS: 2 | US FAERS | |
| 89 | Hypersensitivity | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 90 | Hypothermia neonatal | FAERS: 2 | US FAERS | |
| 91 | Joint Range of Motion Decreased | FAERS: 2 | US FAERS | |
| 92 | Lactose Intolerance | FAERS: 2 | US FAERS | |
| 93 | Mydriasis | FAERS: 2 | US FAERS | |
| 94 | Nasal discomfort | FAERS: 2 | US FAERS | |
| 95 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 96 | Neurological examination abnormal | FAERS: 2 | US FAERS | |
| 97 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 98 | Product dispensing error | FAERS: 2 | US FAERS | |
| 99 | Product physical issue | FAERS: 2 | US FAERS | |
| 100 | Product use in unapproved indication | FAERS: 2 | US FAERS | |
| 101 | Reaction to drug excipients | FAERS: 2 | US FAERS | |
| 102 | Retrograde amnesia | FAERS: 2 | US FAERS | |
| 103 | Shock | FAERS: 2 | US FAERS | |
| 104 | Suicide attempt | FAERS: 2 | US FAERS | |
| 105 | Thirst | FAERS: 2 | US FAERS | |
| 106 | Unevaluable event | FAERS: 2 | US FAERS | |
| 107 | Urticaria | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 108 | Ventricular hypertrophy | FAERS: 2 | US FAERS | |
| 109 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 110 | treatment failure | FAERS: 2 | US FAERS | |
| 111 | Abscess | FAERS: 1 | US FAERS | |
| 112 | Accidental exposure | FAERS: 1 | US FAERS | |
| 113 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 114 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 115 | Agitation | FAERS: 1 | US FAERS | |
| 116 | Amyloidosis | FAERS: 1 | US FAERS | |
| 117 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 118 | Anxiety | FAERS: 1 | US FAERS | |
| 119 | Arterial thrombosis | FAERS: 1 | US FAERS | |
| 120 | Asthma | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 121 | Auricular swelling | FAERS: 1 | US FAERS | |
| 122 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 123 | Blood magnesium abnormal | FAERS: 1 | US FAERS | |
| 124 | Blood magnesium increased | FAERS: 1 | US FAERS | |
| 125 | Burning sensation | FAERS: 1 | US FAERS | |
| 126 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 127 | Chromaturia | FAERS: 1 | US FAERS | |
| 128 | Constipation | FAERS: 1 | US FAERS | |
| 129 | Corrective lens user | FAERS: 1 | US FAERS | |
| 130 | Crying | FAERS: 1 | US FAERS | |
| 131 | Dehydration | FAERS: 1 | US FAERS | |
| 132 | Dementia | FAERS: 1 | US FAERS | |
| 133 | Device related infection | FAERS: 1 | US FAERS | |
| 134 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 135 | Diplopia | FAERS: 1 | US FAERS | |
| 136 | Disease recurrence | FAERS: 1 | US FAERS | |
| 137 | Drug label confusion | FAERS: 1 | US FAERS | |
| 138 | Electrocardiogram ST segment abnormal | FAERS: 1 | US FAERS | |
| 139 | Endocarditis | FAERS: 1 | US FAERS | |
| 140 | Exposure via ingestion | FAERS: 1 | US FAERS | |
| 141 | Feeling Cold | FAERS: 1 | US FAERS | |
| 142 | Flushing | FAERS: 1 | US FAERS | |
| 143 | Formication | FAERS: 1 | US FAERS | |
| 144 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 145 | Hemiparesis | FAERS: 1 | US FAERS | |
| 146 | Hypersomnia | FAERS: 1 | US FAERS | |
| 147 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 148 | Hypotrichosis | FAERS: 1 | US FAERS | |
| 149 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 150 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 151 | Incoherent | FAERS: 1 | US FAERS | |
| 152 | Incorrect storage of drug | FAERS: 1 | US FAERS | |
| 153 | Infertility | FAERS: 1 | US FAERS | |
| 154 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 155 | Left atrial dilatation | FAERS: 1 | US FAERS | |
| 156 | Lymphocyte count increased | FAERS: 1 | US FAERS | |
| 157 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 158 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 159 | Memory impairment | FAERS: 1 | US FAERS | |
| 160 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 161 | Neonatal disorder | FAERS: 1 | US FAERS | |
| 162 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 163 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 164 | Oligohydramnios | FAERS: 1 | US FAERS | |
| 165 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 166 | Overdose | FAERS: 1 | US FAERS | |
| 167 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 168 | Personality Change | FAERS: 1 | US FAERS | |
| 169 | Pneumonia | FAERS: 1 | US FAERS | |
| 170 | Pre-Eclampsia | FAERS: 1 | US FAERS | |
| 171 | Presbyopia | FAERS: 1 | US FAERS | |
| 172 | Product availability issue | FAERS: 1 | US FAERS | |
| 173 | Product commingling | FAERS: 1 | US FAERS | |
| 174 | Product friable | FAERS: 1 | US FAERS | |
| 175 | Product shape issue | FAERS: 1 | US FAERS | |
| 176 | Product size issue | FAERS: 1 | US FAERS | |
| 177 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 178 | Psoriasis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 179 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 180 | Renal Colic | FAERS: 1 | US FAERS | |
| 181 | Renal pain | FAERS: 1 | US FAERS | |
| 182 | Renal tubular necrosis | FAERS: 1 | US FAERS | |
| 183 | Retroperitoneal fibrosis | FAERS: 1 | US FAERS | |
| 184 | Sinusitis | FAERS: 1 | US FAERS | |
| 185 | Skin Papilloma | FAERS: 1 | US FAERS | |
| 186 | Somnolence | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 187 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 188 | Stress | FAERS: 1 | US FAERS | |
| 189 | Sudden Cardiac Death | FAERS: 1 | US FAERS | |
| 190 | Sudden onset of sleep | FAERS: 1 | US FAERS | |
| 191 | Therapy cessation | FAERS: 1 | US FAERS | |
| 192 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 193 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 194 | Upper airway obstruction | FAERS: 1 | US FAERS | |
| 195 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 196 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 197 | Ventricular arrhythmia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 198 | Vertigo | Canada Vigilance: 1 | Canada Vigilance | |
| 199 | Wheezing | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120269
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.