Bisoprolol
(VHYCDWMUTMEGQY-UHFFFAOYSA-N)
Structure
- SMILES
- OC(COc1ccc(cc1)COCCOC(C)C)CNC(C)C
- Type(s)
- Approved
- ATC code(s)
- C07AB07; C07BB07; C07FB07; C07FX04; C09BX02
- Molecular Formula:
- C18H31NO4
- Molecular Weight:
- 325.443
- Log P:
- 2.7568
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 2
- TPSA:
- 59.95
- CAS Number(s):
- 66722-44-9
Synonym(s)
1.
Bisoprolol
2.
Bisoprolol Fumarate
3.
Bisoprolol Fumarate (1:1) Salt, (+-)-Isomer
4.
Bisoprolol Fumarate (2:1) Salt, (+-)-Isomer
5.
Bisoprolol Hydrochloride
6.
Bisoprolol Methanesulfonate Salt
7.
Bisoprolol, (+-)-Isomer
8.
Bisoprolol, (-)-Isomer
9.
Bisoprolol, Fumarate (1:1) Salt
10.
Bisoprolol, Fumarate (2:1) Salt
11.
CL-297939
12.
Concor
13.
EMD-33512
14.
CL 297939
15.
CL297939
16.
EMD 33512
17.
EMD33512
18.
Fumarate, Bisoprolol
19.
Hydrochloride, Bisoprolol
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Bradycardia | FAERS: 43 Canada Vigilance: 8 | 15662077 19903982 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 2 | Dizziness | FAERS: 39 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 3 | Syncope | FAERS: 29 | SIDER US FAERS | |
| 4 | Atrial Fibrillation | FAERS: 24 Canada Vigilance: 3 | 21129714 | CTD SIDER Canada Vigilance US FAERS |
| 5 | Fatigue | FAERS: 22 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 6 | Feeling abnormal | FAERS: 19 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 7 | Malaise | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 8 | Nausea | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 9 | Palpitations | FAERS: 17 | SIDER US FAERS | |
| 10 | Anxiety | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 11 | Headache | FAERS: 11 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 12 | Hypotension | FAERS: 11 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 13 | Asthenia | FAERS: 10 | 2967187 | CTD SIDER US FAERS |
| 14 | Atrioventricular Block | FAERS: 10 | SIDER US FAERS | |
| 15 | Product substitution issue | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Tachycardia | FAERS: 10 Canada Vigilance: 2 | 2897299 | CTD SIDER Canada Vigilance US FAERS |
| 17 | Urticaria | FAERS: 10 | SIDER US FAERS | |
| 18 | Chest Pain | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 19 | Drug ineffective | FAERS: 9 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 20 | Deafness | FAERS: 7 | OFFSIDES US FAERS | |
| 21 | Lower respiratory tract infection | FAERS: 7 | US FAERS | |
| 22 | Overdose | FAERS: 7 | US FAERS | |
| 23 | Basal cell carcinoma | FAERS: 6 | US FAERS | |
| 24 | Cardiac Arrest | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 25 | Discomfort | FAERS: 6 | SIDER US FAERS | |
| 26 | Feeling Cold | FAERS: 6 | SIDER US FAERS | |
| 27 | Lethargy | FAERS: 6 | US FAERS | |
| 28 | Maternal exposure during pregnancy | FAERS: 6 | US FAERS | |
| 29 | Myalgia | FAERS: 6 | SIDER US FAERS | |
| 30 | Product quality issue | FAERS: 6 | US FAERS | |
| 31 | Sinus bradycardia | FAERS: 6 | US FAERS | |
| 32 | Somnolence | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 33 | nervous system disorder | FAERS: 6 | SIDER US FAERS | |
| 34 | Amnesia | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 35 | Angina Pectoris | FAERS: 5 | 2439788 2967185 | CTD US FAERS |
| 36 | Angioedema | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 37 | Arthralgia | FAERS: 5 | SIDER US FAERS | |
| 38 | Erythema | FAERS: 5 | SIDER US FAERS | |
| 39 | Presyncope | FAERS: 5 | US FAERS | |
| 40 | Stress | FAERS: 5 | US FAERS | |
| 41 | Suicide attempt | FAERS: 5 | US FAERS | |
| 42 | Trifascicular block | FAERS: 5 | US FAERS | |
| 43 | Asthma | FAERS: 4 | SIDER US FAERS | |
| 44 | Autonomic nervous system imbalance | FAERS: 4 | US FAERS | |
| 45 | Limb discomfort | FAERS: 4 | US FAERS | |
| 46 | Lymphoma | FAERS: 4 | US FAERS | |
| 47 | Nephrolithiasis | FAERS: 4 | US FAERS | |
| 48 | Ocular discomfort | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 49 | Sepsis | FAERS: 4 | US FAERS | |
| 50 | Skin tightness | FAERS: 4 | US FAERS | |
| 51 | Toxicity to various agents | FAERS: 4 | SIDER US FAERS | |
| 52 | Urinary Incontinence | FAERS: 4 | US FAERS | |
| 53 | Vitiligo | FAERS: 4 | US FAERS | |
| 54 | Wrong patient received medication | FAERS: 4 | US FAERS | |
| 55 | Abdominal Pain | FAERS: 3 | 2967187 | CTD SIDER US FAERS |
| 56 | Accidental overdose | FAERS: 3 | US FAERS | |
| 57 | Acute psychosis | FAERS: 3 | US FAERS | |
| 58 | Alopecia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 59 | Choking | FAERS: 3 | US FAERS | |
| 60 | Disorientation | FAERS: 3 | SIDER US FAERS | |
| 61 | General physical health deterioration | FAERS: 3 | OFFSIDES US FAERS | |
| 62 | Live Birth | FAERS: 3 | US FAERS | |
| 63 | Liver Abscess | FAERS: 3 | US FAERS | |
| 64 | Metastatic Neoplasm | FAERS: 3 | OFFSIDES US FAERS | |
| 65 | Monoparesis | FAERS: 3 | US FAERS | |
| 66 | Pain | FAERS: 3 | SIDER US FAERS | |
| 67 | Pneumonia | FAERS: 3 | SIDER US FAERS | |
| 68 | Poisoning | FAERS: 3 | US FAERS | |
| 69 | Skin Ulcer | FAERS: 3 | US FAERS | |
| 70 | Therapy non-responder | FAERS: 3 | US FAERS | |
| 71 | Tinnitus | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 72 | Ventricular failure | FAERS: 3 | US FAERS | |
| 73 | Visual Impairment | FAERS: 3 | SIDER US FAERS | |
| 74 | Vomiting | FAERS: 3 | SIDER US FAERS | |
| 75 | Accidental exposure to product | FAERS: 2 | US FAERS | |
| 76 | Acute kidney injury | FAERS: 2 | 15662077 | CTD US FAERS |
| 77 | Aphasia | FAERS: 2 | SIDER US FAERS | |
| 78 | Atrial tachycardia | FAERS: 2 | US FAERS | |
| 79 | Back Pain | FAERS: 2 | SIDER US FAERS | |
| 80 | Cardiac Flutter | FAERS: 2 | US FAERS | |
| 81 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 82 | Contraindicated product prescribed | FAERS: 2 | US FAERS | |
| 83 | Dehydration | FAERS: 2 | US FAERS | |
| 84 | Depressed Level of Consciousness | FAERS: 2 | OFFSIDES US FAERS | |
| 85 | Drug administration error | FAERS: 2 | US FAERS | |
| 86 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 87 | Drug withdrawal syndrome | FAERS: 2 | US FAERS | |
| 88 | Erysipelas | FAERS: 2 | OFFSIDES US FAERS | |
| 89 | Heat Stroke | FAERS: 2 | US FAERS | |
| 90 | Lacrimation decreased | FAERS: 2 | US FAERS | |
| 91 | Lung hyperinflation | FAERS: 2 | US FAERS | |
| 92 | No adverse event | FAERS: 2 | US FAERS | |
| 93 | Polyhydramnios | FAERS: 2 | US FAERS | |
| 94 | Polyuria | FAERS: 2 | SIDER US FAERS | |
| 95 | Precancerous skin lesion | FAERS: 2 | US FAERS | |
| 96 | Pulmonary Hypertension | FAERS: 2 | OFFSIDES US FAERS | |
| 97 | Reaction to drug excipients | FAERS: 2 | US FAERS | |
| 98 | Sinus Tachycardia | FAERS: 2 | US FAERS | |
| 99 | Stupor | FAERS: 2 | US FAERS | |
| 100 | Ventricular arrhythmia | FAERS: 2 | US FAERS | |
| 101 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 102 | Agitation | FAERS: 1 | SIDER US FAERS | |
| 103 | Apathy | FAERS: 1 | US FAERS | |
| 104 | Aphonia | FAERS: 1 | US FAERS | |
| 105 | Asphyxia | FAERS: 1 | OFFSIDES US FAERS | |
| 106 | Bifascicular block | FAERS: 1 | US FAERS | |
| 107 | Bipolar I disorder | FAERS: 1 | US FAERS | |
| 108 | Blood creatine phosphokinase MB increased | FAERS: 1 | US FAERS | |
| 109 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 110 | Carcinoma in situ of skin | FAERS: 1 | US FAERS | |
| 111 | Charles Bonnet Syndrome | FAERS: 1 | US FAERS | |
| 112 | Chest discomfort | FAERS: 1 | US FAERS | |
| 113 | Chromatopsia | FAERS: 1 | US FAERS | |
| 114 | Chronotropic incompetence | FAERS: 1 | US FAERS | |
| 115 | Coma scale abnormal | FAERS: 1 | US FAERS | |
| 116 | Contraindicated drug prescribed | FAERS: 1 | US FAERS | |
| 117 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 118 | Drug Dependence | FAERS: 1 | US FAERS | |
| 119 | Drug abuse | FAERS: 1 | US FAERS | |
| 120 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 121 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 122 | Dry skin | FAERS: 1 | OFFSIDES US FAERS | |
| 123 | Dysgeusia | FAERS: 1 | SIDER US FAERS | |
| 124 | Dyspepsia | FAERS: 1 | SIDER US FAERS | |
| 125 | Dysphasia | FAERS: 1 | US FAERS | |
| 126 | Dysphonia | FAERS: 1 | US FAERS | |
| 127 | Dysuria | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 128 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 129 | Eye Burns | FAERS: 1 | US FAERS | |
| 130 | Eye irritation | FAERS: 1 | US FAERS | |
| 131 | Eye pain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 132 | Fluid overload | FAERS: 1 | OFFSIDES US FAERS | |
| 133 | Flushing | FAERS: 1 | SIDER US FAERS | |
| 134 | Foreign body sensation in eyes | FAERS: 1 | US FAERS | |
| 135 | Glossitis | FAERS: 1 | US FAERS | |
| 136 | Hypersensitivity | FAERS: 1 | SIDER US FAERS | |
| 137 | Hypospadias | FAERS: 1 | US FAERS | |
| 138 | Incontinence | FAERS: 1 | US FAERS | |
| 139 | Incorrect dose administered | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 140 | Leukocytosis | FAERS: 1 | US FAERS | |
| 141 | Leukopenia | FAERS: 1 | US FAERS | |
| 142 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 143 | Medication Error | FAERS: 1 | US FAERS | |
| 144 | Mental impairment | FAERS: 1 | US FAERS | |
| 145 | Mental status changes | FAERS: 1 | US FAERS | |
| 146 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 147 | Myocarditis | FAERS: 1 | US FAERS | |
| 148 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 149 | Neuritis | FAERS: 1 | US FAERS | |
| 150 | Neutropenia | FAERS: 1 | US FAERS | |
| 151 | Panniculitis | FAERS: 1 | US FAERS | |
| 152 | Paradoxical drug reaction | FAERS: 1 | US FAERS | |
| 153 | Patent ductus arteriosus | FAERS: 1 | US FAERS | |
| 154 | Pericardial effusion | FAERS: 1 | OFFSIDES US FAERS | |
| 155 | Personality Change | FAERS: 1 | US FAERS | |
| 156 | Pregnancy | FAERS: 1 | US FAERS | |
| 157 | Product packaging issue | FAERS: 1 | US FAERS | |
| 158 | Product use in unapproved indication | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 159 | Pruritus | FAERS: 1 | SIDER US FAERS | |
| 160 | Sarcoidosis | FAERS: 1 | US FAERS | |
| 161 | Sluggishness | FAERS: 1 | US FAERS | |
| 162 | Sneezing | FAERS: 1 | US FAERS | |
| 163 | Sopor | FAERS: 1 | US FAERS | |
| 164 | Spinal column injury | FAERS: 1 | US FAERS | |
| 165 | Stasis dermatitis | FAERS: 1 | US FAERS | |
| 166 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 167 | Throat irritation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 168 | Thrombocytopenia | FAERS: 1 | SIDER US FAERS | |
| 169 | Tremor | FAERS: 1 | SIDER US FAERS | |
| 170 | Troponin I increased | FAERS: 1 | US FAERS | |
| 171 | Vagus Nerve Disorder | FAERS: 1 | US FAERS | |
| 172 | Ventricular Fibrillation | FAERS: 1 | SIDER US FAERS | |
| 173 | Ventricular hypokinesia | FAERS: 1 | US FAERS | |
| 174 | Vertigo | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 175 | Abnormal vision | SIDER | ||
| 176 | Ache | SIDER | ||
| 177 | Acute Coronary Syndrome | OFFSIDES SIDER | ||
| 178 | Ageusia | SIDER | ||
| 179 | Agranulocytosis | SIDER | ||
| 180 | Alanine Aminotransferase Increased | OFFSIDES | ||
| 181 | Alveolitis | OFFSIDES | ||
| 182 | Anaphylactic shock | Canada Vigilance: 1 | Canada Vigilance | |
| 183 | Angioplasty | OFFSIDES | ||
| 184 | Anosmia | SIDER | ||
| 185 | Anticonvulsant drug level increased | OFFSIDES | ||
| 186 | Aphthous Stomatitis | OFFSIDES | ||
| 187 | Application site vesicles | OFFSIDES | ||
| 188 | Arterial thrombosis | SIDER | ||
| 189 | Arthropathy | OFFSIDES SIDER | ||
| 190 | Atrial thrombosis | OFFSIDES | ||
| 191 | Bedridden | OFFSIDES | ||
| 192 | Biliary cirrhosis | OFFSIDES | ||
| 193 | Bilirubin conjugated abnormal | OFFSIDES | ||
| 194 | Bladder pain | SIDER | ||
| 195 | Blindness | Canada Vigilance: 1 | Canada Vigilance | |
| 196 | Blood creatine phosphokinase increased | OFFSIDES | ||
| 197 | Blood sodium | OFFSIDES | ||
| 198 | Blood triglycerides increased | SIDER | ||
| 199 | Blood urea increased | OFFSIDES | ||
| 200 | Bone pain | OFFSIDES | ||
| 201 | Bronchitis | SIDER | ||
| 202 | Bronchoalveolar lavage abnormal | OFFSIDES | ||
| 203 | Bronchospasm | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 204 | Cardiomyopathies | 10410811 | CTD | |
| 205 | Catatonia | SIDER | ||
| 206 | Choking sensation | OFFSIDES | ||
| 207 | Cholelithotomy | OFFSIDES | ||
| 208 | Chronic left ventricular failure | OFFSIDES | ||
| 209 | Concomitant disease aggravated | OFFSIDES | ||
| 210 | Concomitant disease progression | OFFSIDES | ||
| 211 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 212 | Conjunctivitis | SIDER | ||
| 213 | Constipation | SIDER | ||
| 214 | Corneal abscess | OFFSIDES | ||
| 215 | Cystitis | SIDER | ||
| 216 | Deafness Neurosensory | OFFSIDES | ||
| 217 | Dermatitis | SIDER | ||
| 218 | Diarrhea | 15662077 | CTD OFFSIDES | |
| 219 | Disturbance in sexual arousal | SIDER | ||
| 220 | Drowsiness | SIDER | ||
| 221 | Dyspnea | 2967187 | CTD | |
| 222 | Ear and labyrinth disorders | SIDER | ||
| 223 | Eczema | SIDER | ||
| 224 | Ejection Fraction Decreased | OFFSIDES | ||
| 225 | Embolism | OFFSIDES SIDER | ||
| 226 | Empyema | OFFSIDES | ||
| 227 | Enuresis | OFFSIDES | ||
| 228 | Epigastric pain not food-related | SIDER | ||
| 229 | Epistaxis | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 230 | Erectile dysfunction | SIDER | ||
| 231 | Extremity necrosis | OFFSIDES | ||
| 232 | Flatulence | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 233 | Fracture | SIDER | ||
| 234 | Frustration tolerance decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 235 | Gangrene | OFFSIDES | ||
| 236 | Gastritis | SIDER | ||
| 237 | Gastroduodenitis | OFFSIDES | ||
| 238 | Gastrointestinal Pain | SIDER | ||
| 239 | Gout | OFFSIDES SIDER | ||
| 240 | Granulocyte count decreased | OFFSIDES | ||
| 241 | Heart failure | 11336626 11835035 18528751 | CTD | |
| 242 | Heparin-induced thrombocytopenia | OFFSIDES | ||
| 243 | Hepatitis | OFFSIDES SIDER | ||
| 244 | Hepatomegaly | SIDER | ||
| 245 | Hormone level abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 246 | Hypokalemia | 8098220 12795776 | CTD | |
| 247 | Hypoxia | OFFSIDES | ||
| 248 | Ileal ulcer | OFFSIDES | ||
| 249 | Immunosuppressant drug level | OFFSIDES | ||
| 250 | Incorrect drug administration duration | OFFSIDES | ||
| 251 | Infection | SIDER | ||
| 252 | Intermittent Claudication | SIDER | ||
| 253 | Intestinal Fistula | OFFSIDES | ||
| 254 | Intestinal Perforation | OFFSIDES | ||
| 255 | Intestinal mucosal hypertrophy | OFFSIDES | ||
| 256 | Iritis | OFFSIDES | ||
| 257 | Ischemia | 2967185 | CTD | |
| 258 | Joint swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 259 | Kidney Failure | OFFSIDES | ||
| 260 | Klebsiella sepsis | OFFSIDES | ||
| 261 | Lacrimation abnormal NOS | SIDER | ||
| 262 | Laryngospasm | SIDER | ||
| 263 | Leukoaraiosis | OFFSIDES | ||
| 264 | Lividity | OFFSIDES | ||
| 265 | Long QT Syndrome | 14579055 | CTD | |
| 266 | Loose tooth | OFFSIDES | ||
| 267 | Lung Abscess | OFFSIDES | ||
| 268 | Meningioma | OFFSIDES | ||
| 269 | Migraine Disorders | 19708964 | CTD | |
| 270 | Mood swings | SIDER | ||
| 271 | Multiple drug overdose intentional | OFFSIDES | ||
| 272 | Muscle fibrosis | OFFSIDES | ||
| 273 | Musculoskeletal discomfort | SIDER | ||
| 274 | Myocardial Infarction | 21697605 | CTD SIDER | |
| 275 | Myopericarditis | OFFSIDES | ||
| 276 | Neck Pain | SIDER | ||
| 277 | Necrolysis epidermal | SIDER | ||
| 278 | Nephrotic Syndrome | OFFSIDES | ||
| 279 | Neuralgia | SIDER | ||
| 280 | Non-cardiac chest pain | OFFSIDES | ||
| 281 | Numbness of limbs | SIDER | ||
| 282 | Optic Disc Edema | OFFSIDES | ||
| 283 | Optic Neuropathy | OFFSIDES | ||
| 284 | Oropharyngeal discomfort | SIDER | ||
| 285 | Oropharyngeal pain | SIDER | ||
| 286 | Orthopnea | OFFSIDES | ||
| 287 | Osteolysis | OFFSIDES | ||
| 288 | Pallor | OFFSIDES | ||
| 289 | Paresis | SIDER | ||
| 290 | Peptic Ulcer | SIDER | ||
| 291 | Peripheral Vascular Diseases | 2967187 | CTD | |
| 292 | Peripheral swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 293 | Peritonitis | OFFSIDES | ||
| 294 | Pharyngitis | SIDER | ||
| 295 | Pneumocystis jiroveci pneumonia | OFFSIDES | ||
| 296 | Polymyalgia Rheumatica | OFFSIDES | ||
| 297 | Postoperative Complications | 21129714 | CTD | |
| 298 | Postural Orthostatic Tachycardia Syndrome | 11198485 | CTD | |
| 299 | Psoriasis | SIDER | ||
| 300 | Purpura | SIDER | ||
| 301 | Quadriplegia | 15313766 | CTD | |
| 302 | Rales | OFFSIDES | ||
| 303 | Rash erythematous | Canada Vigilance: 1 | Canada Vigilance | |
| 304 | Raynaud-like disorder | SIDER | ||
| 305 | Renal Colic | SIDER | ||
| 306 | Respiratory Failure | OFFSIDES SIDER | ||
| 307 | Respiratory Insufficiency | SIDER | ||
| 308 | Respiratory distress | SIDER | ||
| 309 | Reticulocytosis | OFFSIDES | ||
| 310 | Retinal Artery Occlusion | OFFSIDES | ||
| 311 | Retinal pigment epithelial tear | OFFSIDES | ||
| 312 | Rhabdomyolysis | OFFSIDES | ||
| 313 | Rhinitis | SIDER | ||
| 314 | Ruptured cerebral aneurysm | OFFSIDES | ||
| 315 | Scleroderma | SIDER | ||
| 316 | Scotoma | OFFSIDES | ||
| 317 | Septic Shock | OFFSIDES | ||
| 318 | Serum triglycerides increased | SIDER | ||
| 319 | Shock | SIDER | ||
| 320 | Sinusitis | SIDER | ||
| 321 | Skin irritation | SIDER | ||
| 322 | Sleep Wake Disorders | 10527042 | CTD | |
| 323 | Spondylolysis | OFFSIDES | ||
| 324 | Stevens-Johnson Syndrome | OFFSIDES | ||
| 325 | Stillbirth | SIDER | ||
| 326 | Stridor | SIDER | ||
| 327 | Sweating | SIDER | ||
| 328 | Temperature intolerance | Canada Vigilance: 1 | Canada Vigilance | |
| 329 | Therapeutic product effect decreased | Canada Vigilance: 2 | Canada Vigilance | |
| 330 | Thrombocytopenic purpura | SIDER | ||
| 331 | Torsades de Pointes | 14579055 | CTD | |
| 332 | Toxic Epidermal Necrolysis | SIDER | ||
| 333 | Transaminases increased | OFFSIDES | ||
| 334 | Upper respiratory tract inflammation | OFFSIDES | ||
| 335 | Urinary tract infection | SIDER | ||
| 336 | Urination Disorders | 16225113 | CTD | |
| 337 | Urine output increased | SIDER | ||
| 338 | Vascular purpura | SIDER | ||
| 339 | Vasculitis | SIDER | ||
| 340 | Venous thrombosis limb | OFFSIDES | ||
| 341 | Ventricular Dysfunction | 21273767 | CTD | |
| 342 | Ventricular Remodeling | 20668454 | CTD | |
| 343 | Visual disturbance | SIDER | ||
| 344 | overdose effect | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.