bosutinib
(UBPYILGKFZZVDX-UHFFFAOYSA-N)
Structure
- SMILES
- COc1cc2c(cc1OCCCN1CCN(CC1)C)ncc(c2Nc1cc(OC)c(cc1Cl)Cl)C#N
- Type(s)
- Approved
- ATC code(s)
- L01XE14
- Molecular Formula:
- C26H29Cl2N5O3
- Molecular Weight:
- 530.446
- Log P:
- 5.1392
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 1
- TPSA:
- 82.88
- CAS Number(s):
- 380843-75-4; 1391063-17-4
Synonym(s)
1.
bosutinib
2.
SKI-606
3.
SKI606
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nausea | FAERS: 384 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 2 | Fatigue | FAERS: 229 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 3 | Vomiting | FAERS: 185 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 4 | Headache | FAERS: 112 | SIDER US FAERS | |
| 5 | Malaise | FAERS: 91 | SIDER US FAERS | |
| 6 | Abdominal Pain | FAERS: 71 | SIDER US FAERS | |
| 7 | Dizziness | FAERS: 65 | SIDER US FAERS | |
| 8 | Pain | FAERS: 65 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 9 | Constipation | FAERS: 62 | US FAERS | |
| 10 | Arthralgia | FAERS: 61 | SIDER US FAERS | |
| 11 | Disease Progression | FAERS: 57 | US FAERS | |
| 12 | Abdominal discomfort | FAERS: 55 | SIDER US FAERS | |
| 13 | Asthenia | FAERS: 55 | SIDER US FAERS | |
| 14 | Pneumonia | FAERS: 53 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 15 | Weight decreased | FAERS: 49 | US FAERS | |
| 16 | Pruritus | FAERS: 44 | SIDER US FAERS | |
| 17 | Dehydration | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 18 | Myalgia | FAERS: 32 | SIDER US FAERS | |
| 19 | White blood cell count decreased | FAERS: 29 | US FAERS | |
| 20 | Chest Pain | FAERS: 28 | SIDER US FAERS | |
| 21 | Drug dose omission | FAERS: 28 | US FAERS | |
| 22 | Dyspepsia | FAERS: 27 | US FAERS | |
| 23 | Bone pain | FAERS: 26 | US FAERS | |
| 24 | Feeling abnormal | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 25 | Peripheral swelling | FAERS: 25 | US FAERS | |
| 26 | Dysgeusia | FAERS: 24 | SIDER US FAERS | |
| 27 | Flatulence | FAERS: 22 | US FAERS | |
| 28 | Nasopharyngitis | FAERS: 22 | SIDER US FAERS | |
| 29 | Back Pain | FAERS: 21 | SIDER US FAERS | |
| 30 | Cerebrovascular accident | FAERS: 20 | US FAERS | |
| 31 | Intentional product misuse | FAERS: 20 | US FAERS | |
| 32 | Blood creatinine increased | FAERS: 19 | SIDER US FAERS | |
| 33 | Product use issue | FAERS: 19 | US FAERS | |
| 34 | Thrombocytopenia | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 35 | Alanine Aminotransferase Increased | FAERS: 18 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 36 | Hypersensitivity | FAERS: 17 | US FAERS | |
| 37 | Influenza | FAERS: 17 | SIDER US FAERS | |
| 38 | Dry skin | FAERS: 16 | US FAERS | |
| 39 | Infection | FAERS: 16 | SIDER US FAERS | |
| 40 | Memory impairment | FAERS: 16 | US FAERS | |
| 41 | Pericardial effusion | FAERS: 15 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 42 | Product use in unapproved indication | FAERS: 15 | US FAERS | |
| 43 | Atrial Fibrillation | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 44 | Chills | FAERS: 14 | US FAERS | |
| 45 | Product dose omission | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 46 | Alopecia | FAERS: 13 | US FAERS | |
| 47 | Anxiety | FAERS: 13 | US FAERS | |
| 48 | Sinusitis | FAERS: 13 | US FAERS | |
| 49 | Urticaria | FAERS: 13 | SIDER US FAERS | |
| 50 | Somnolence | FAERS: 12 | US FAERS | |
| 51 | Therapy cessation | FAERS: 12 | US FAERS | |
| 52 | Gastric ulcer | FAERS: 11 | US FAERS | |
| 53 | Joint swelling | FAERS: 11 | US FAERS | |
| 54 | Myocardial Infarction | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 55 | Pancreatitis | FAERS: 11 | US FAERS | |
| 56 | Sneezing | FAERS: 11 | US FAERS | |
| 57 | Lip swelling | FAERS: 10 | US FAERS | |
| 58 | Aspartate Aminotransferase Increased | FAERS: 9 | SIDER US FAERS | |
| 59 | Blood glucose increased | FAERS: 9 | US FAERS | |
| 60 | Cytopenia | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 61 | Dysphonia | FAERS: 9 | US FAERS | |
| 62 | Hypotension | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 63 | Acne | FAERS: 8 | SIDER US FAERS | |
| 64 | Chest discomfort | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 65 | Epistaxis | FAERS: 8 | US FAERS | |
| 66 | Hepatotoxicity | FAERS: 8 | SIDER US FAERS | |
| 67 | No adverse event | FAERS: 8 | US FAERS | |
| 68 | Oropharyngeal pain | FAERS: 8 | US FAERS | |
| 69 | Transaminases increased | FAERS: 8 | US FAERS | |
| 70 | Angina Pectoris | FAERS: 7 | US FAERS | |
| 71 | Blindness | FAERS: 7 | US FAERS | |
| 72 | Blood iron decreased | FAERS: 7 | US FAERS | |
| 73 | Bronchitis | FAERS: 7 | SIDER US FAERS | |
| 74 | Cellulitis | FAERS: 7 | US FAERS | |
| 75 | Cholelithiasis | FAERS: 7 | US FAERS | |
| 76 | Gait inability | FAERS: 7 | US FAERS | |
| 77 | Loss of personal independence in daily activities | FAERS: 7 | US FAERS | |
| 78 | Neutropenia | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 79 | Pancytopenia | FAERS: 7 | SIDER US FAERS | |
| 80 | Respiratory Failure | FAERS: 7 | SIDER US FAERS | |
| 81 | Ulcer | FAERS: 7 | US FAERS | |
| 82 | Urinary tract infection | FAERS: 7 | US FAERS | |
| 83 | Vertigo | FAERS: 7 | US FAERS | |
| 84 | Angioedema | FAERS: 6 | US FAERS | |
| 85 | Blood count abnormal | FAERS: 6 | US FAERS | |
| 86 | Blood pressure fluctuation | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 87 | Burning sensation | FAERS: 6 | US FAERS | |
| 88 | Disease recurrence | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 89 | Erythema | FAERS: 6 | US FAERS | |
| 90 | Gout | FAERS: 6 | US FAERS | |
| 91 | Rash erythematous | FAERS: 6 | US FAERS | |
| 92 | Sciatica | FAERS: 6 | US FAERS | |
| 93 | Swelling | FAERS: 6 | US FAERS | |
| 94 | Toxicity to various agents | FAERS: 6 | US FAERS | |
| 95 | Visual Impairment | FAERS: 6 | US FAERS | |
| 96 | Acute kidney injury | FAERS: 5 | US FAERS | |
| 97 | Ageusia | FAERS: 5 | US FAERS | |
| 98 | Asthma | FAERS: 5 | US FAERS | |
| 99 | Cerebral Infarction | FAERS: 5 | US FAERS | |
| 100 | Deafness | FAERS: 5 | US FAERS | |
| 101 | Diabetes Mellitus | FAERS: 5 | US FAERS | |
| 102 | Dysuria | FAERS: 5 | US FAERS | |
| 103 | Feeling Cold | FAERS: 5 | US FAERS | |
| 104 | Full blood count decreased | FAERS: 5 | US FAERS | |
| 105 | General physical health deterioration | FAERS: 5 | US FAERS | |
| 106 | Pain of skin | FAERS: 5 | US FAERS | |
| 107 | Poor quality sleep | FAERS: 5 | US FAERS | |
| 108 | Rheumatoid Arthritis | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 109 | Skin Wrinkling | FAERS: 5 | US FAERS | |
| 110 | Throat irritation | FAERS: 5 | US FAERS | |
| 111 | White blood cell count abnormal | FAERS: 5 | US FAERS | |
| 112 | Acute myocardial infarction | FAERS: 4 | US FAERS | |
| 113 | Amnesia | FAERS: 4 | US FAERS | |
| 114 | Arthropathy | FAERS: 4 | US FAERS | |
| 115 | Blood urine present | FAERS: 4 | US FAERS | |
| 116 | Body temperature fluctuation | FAERS: 4 | US FAERS | |
| 117 | Cardiac Tamponade | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 118 | Chromaturia | FAERS: 4 | US FAERS | |
| 119 | Clostridium difficile infection | FAERS: 4 | US FAERS | |
| 120 | Discomfort | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 121 | Diverticulitis | FAERS: 4 | US FAERS | |
| 122 | Drug ineffective | FAERS: 4 | US FAERS | |
| 123 | Electrolyte imbalance | FAERS: 4 | US FAERS | |
| 124 | Expired product administered | FAERS: 4 | US FAERS | |
| 125 | Eye pain | FAERS: 4 | US FAERS | |
| 126 | Fluid overload | FAERS: 4 | US FAERS | |
| 127 | Fracture | FAERS: 4 | US FAERS | |
| 128 | Gastroenteritis | FAERS: 4 | US FAERS | |
| 129 | Gastrointestinal infection | FAERS: 4 | US FAERS | |
| 130 | Haematotoxicity | FAERS: 4 | US FAERS | |
| 131 | Head discomfort | FAERS: 4 | US FAERS | |
| 132 | Intentional product use issue | FAERS: 4 | US FAERS | |
| 133 | Intervertebral disc disorder | FAERS: 4 | US FAERS | |
| 134 | Lethargy | FAERS: 4 | US FAERS | |
| 135 | Lipase increased | FAERS: 4 | SIDER US FAERS | |
| 136 | Muscle tightness | FAERS: 4 | US FAERS | |
| 137 | Musculoskeletal Pain | FAERS: 4 | US FAERS | |
| 138 | Neck Pain | FAERS: 4 | US FAERS | |
| 139 | Paranasal sinus hypersecretion | FAERS: 4 | US FAERS | |
| 140 | Pericarditis | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 141 | Photophobia | FAERS: 4 | US FAERS | |
| 142 | Pneumonitis | FAERS: 4 | US FAERS | |
| 143 | Productive Cough | FAERS: 4 | US FAERS | |
| 144 | Protein total increased | FAERS: 4 | US FAERS | |
| 145 | Pulmonary Hypertension | FAERS: 4 | SIDER US FAERS | |
| 146 | Red cell distribution width decreased | FAERS: 4 | US FAERS | |
| 147 | Renal pain | FAERS: 4 | US FAERS | |
| 148 | Sepsis | FAERS: 4 | US FAERS | |
| 149 | Snoring | FAERS: 4 | US FAERS | |
| 150 | Stomatitis | FAERS: 4 | US FAERS | |
| 151 | Altered state of consciousness | FAERS: 3 | US FAERS | |
| 152 | Amylase increased | FAERS: 3 | SIDER US FAERS | |
| 153 | Arthritis | FAERS: 3 | US FAERS | |
| 154 | Blood potassium decreased | FAERS: 3 | US FAERS | |
| 155 | Chylothorax | FAERS: 3 | US FAERS | |
| 156 | Cytogenetic analysis abnormal | FAERS: 3 | US FAERS | |
| 157 | Erectile dysfunction | FAERS: 3 | US FAERS | |
| 158 | Eructation | FAERS: 3 | US FAERS | |
| 159 | Flushing | FAERS: 3 | US FAERS | |
| 160 | Gamma-Glutamyltransferase Increased | FAERS: 3 | SIDER US FAERS | |
| 161 | Hypersomnia | FAERS: 3 | US FAERS | |
| 162 | Leukocytosis | FAERS: 3 | US FAERS | |
| 163 | Limb discomfort | FAERS: 3 | US FAERS | |
| 164 | Lung consolidation | FAERS: 3 | US FAERS | |
| 165 | Musculoskeletal stiffness | FAERS: 3 | US FAERS | |
| 166 | Night sweats | FAERS: 3 | US FAERS | |
| 167 | Nocturia | FAERS: 3 | US FAERS | |
| 168 | Nodule | FAERS: 3 | US FAERS | |
| 169 | Occult blood positive | FAERS: 3 | US FAERS | |
| 170 | Oral pain | FAERS: 3 | US FAERS | |
| 171 | Palpitations | FAERS: 3 | US FAERS | |
| 172 | Product size issue | FAERS: 3 | US FAERS | |
| 173 | Pulmonary Embolism | FAERS: 3 | US FAERS | |
| 174 | Skin lesion | FAERS: 3 | US FAERS | |
| 175 | Thrombosis | FAERS: 3 | US FAERS | |
| 176 | Wrong technique in product usage process | FAERS: 3 | US FAERS | |
| 177 | Abasia | FAERS: 2 | US FAERS | |
| 178 | Accidental overdose | FAERS: 2 | US FAERS | |
| 179 | Anger | FAERS: 2 | US FAERS | |
| 180 | Anosmia | FAERS: 2 | US FAERS | |
| 181 | Apathy | FAERS: 2 | US FAERS | |
| 182 | Appendicitis | FAERS: 2 | US FAERS | |
| 183 | Atelectasis | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 184 | Autoimmune thyroiditis | FAERS: 2 | US FAERS | |
| 185 | Blood creatine phosphokinase increased | FAERS: 2 | SIDER US FAERS | |
| 186 | Blood magnesium abnormal | FAERS: 2 | US FAERS | |
| 187 | Blood phosphorus abnormal | FAERS: 2 | US FAERS | |
| 188 | Blood sodium decreased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 189 | Bradycardia | FAERS: 2 | US FAERS | |
| 190 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 191 | Cataract | FAERS: 2 | US FAERS | |
| 192 | Cholecystitis | FAERS: 2 | US FAERS | |
| 193 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 194 | Clostridium difficile colitis | FAERS: 2 | US FAERS | |
| 195 | Depressed mood | FAERS: 2 | US FAERS | |
| 196 | Drug administration error | FAERS: 2 | US FAERS | |
| 197 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 198 | Ear discomfort | FAERS: 2 | US FAERS | |
| 199 | Ejection Fraction Decreased | FAERS: 2 | US FAERS | |
| 200 | Eosinophilia | FAERS: 2 | US FAERS | |
| 201 | Epigastric discomfort | FAERS: 2 | US FAERS | |
| 202 | Erythema Nodosum | FAERS: 2 | US FAERS | |
| 203 | Hypophagia | FAERS: 2 | US FAERS | |
| 204 | Hypoxia | FAERS: 2 | US FAERS | |
| 205 | Impaired gastric emptying | FAERS: 2 | US FAERS | |
| 206 | Inappropriate schedule of drug administration | FAERS: 2 | US FAERS | |
| 207 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 208 | Keratitis | FAERS: 2 | US FAERS | |
| 209 | Labyrinthitis | FAERS: 2 | US FAERS | |
| 210 | Leukoderma | FAERS: 2 | US FAERS | |
| 211 | Leukopenia | FAERS: 2 | SIDER US FAERS | |
| 212 | Limb injury | FAERS: 2 | US FAERS | |
| 213 | MYELODYSPLASTIC SYNDROME | FAERS: 2 | US FAERS | |
| 214 | Marasmus | FAERS: 2 | US FAERS | |
| 215 | Mental impairment | FAERS: 2 | US FAERS | |
| 216 | Neutrophil count decreased | FAERS: 2 | US FAERS | |
| 217 | Pallor | FAERS: 2 | US FAERS | |
| 218 | Pancreatic enzymes increased | FAERS: 2 | US FAERS | |
| 219 | Peripheral arterial occlusive disease | FAERS: 2 | US FAERS | |
| 220 | Pharyngitis | FAERS: 2 | US FAERS | |
| 221 | Pulmonary arterial hypertension | FAERS: 2 | US FAERS | |
| 222 | Scab | FAERS: 2 | US FAERS | |
| 223 | Screaming | FAERS: 2 | US FAERS | |
| 224 | Splenomegaly | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 225 | Stevens-Johnson Syndrome | FAERS: 2 | US FAERS | |
| 226 | Stress | FAERS: 2 | US FAERS | |
| 227 | Tension Headache | FAERS: 2 | US FAERS | |
| 228 | Toothache | FAERS: 2 | US FAERS | |
| 229 | furuncle | FAERS: 2 | US FAERS | |
| 230 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 231 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 232 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 233 | Adrenal mass | FAERS: 1 | US FAERS | |
| 234 | Agitation | FAERS: 1 | US FAERS | |
| 235 | Alkalosis | FAERS: 1 | US FAERS | |
| 236 | Allergic sinusitis | FAERS: 1 | US FAERS | |
| 237 | Aphagia | FAERS: 1 | US FAERS | |
| 238 | Aphonia | FAERS: 1 | US FAERS | |
| 239 | Apparent death | FAERS: 1 | US FAERS | |
| 240 | Arteritis | FAERS: 1 | US FAERS | |
| 241 | Back disorder | FAERS: 1 | US FAERS | |
| 242 | Benign Neoplasm | FAERS: 1 | US FAERS | |
| 243 | Bladder Neoplasm | FAERS: 1 | US FAERS | |
| 244 | Bladder candidiasis | FAERS: 1 | US FAERS | |
| 245 | Blister rupture | FAERS: 1 | US FAERS | |
| 246 | Blood blister | FAERS: 1 | US FAERS | |
| 247 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 248 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 249 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 250 | Blood urea increased | FAERS: 1 | US FAERS | |
| 251 | Bone infarction | FAERS: 1 | US FAERS | |
| 252 | Bone marrow reticulin fibrosis | FAERS: 1 | US FAERS | |
| 253 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 254 | Brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 255 | Bronchopulmonary Aspergillosis | FAERS: 1 | US FAERS | |
| 256 | Capillary Leak Syndrome | FAERS: 1 | US FAERS | |
| 257 | Cardiac dysfunction | FAERS: 1 | US FAERS | |
| 258 | Cardiomegaly | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 259 | Cardiotoxicity | FAERS: 1 | US FAERS | |
| 260 | Cell Death | FAERS: 1 | US FAERS | |
| 261 | Cervix carcinoma | FAERS: 1 | US FAERS | |
| 262 | Colitis | FAERS: 1 | US FAERS | |
| 263 | Completed Suicide | FAERS: 1 | US FAERS | |
| 264 | Complications of transplant surgery | FAERS: 1 | US FAERS | |
| 265 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 266 | Creatinine renal clearance increased | FAERS: 1 | US FAERS | |
| 267 | Cutis Laxa | FAERS: 1 | US FAERS | |
| 268 | Cyst | FAERS: 1 | US FAERS | |
| 269 | Cytokine storm | FAERS: 1 | US FAERS | |
| 270 | Dental caries | FAERS: 1 | US FAERS | |
| 271 | Dermatitis acneiform | FAERS: 1 | US FAERS | |
| 272 | Dermatitis | FAERS: 1 | SIDER US FAERS | |
| 273 | Device related infection | FAERS: 1 | US FAERS | |
| 274 | Diplopia | FAERS: 1 | US FAERS | |
| 275 | Disease complication | FAERS: 1 | US FAERS | |
| 276 | Disorientation | FAERS: 1 | US FAERS | |
| 277 | Distributive shock | FAERS: 1 | US FAERS | |
| 278 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 279 | Drug resistance | FAERS: 1 | US FAERS | |
| 280 | Dumping Syndrome | FAERS: 1 | US FAERS | |
| 281 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 282 | Dysentery | FAERS: 1 | US FAERS | |
| 283 | Eczema | FAERS: 1 | US FAERS | |
| 284 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 285 | Enteritis | FAERS: 1 | US FAERS | |
| 286 | Enterocolitis viral | FAERS: 1 | US FAERS | |
| 287 | Epilepsy | FAERS: 1 | US FAERS | |
| 288 | Erosive Duodenitis | FAERS: 1 | US FAERS | |
| 289 | Eschar | FAERS: 1 | US FAERS | |
| 290 | Exposure via partner | FAERS: 1 | US FAERS | |
| 291 | Extremity necrosis | FAERS: 1 | US FAERS | |
| 292 | Eye irritation | FAERS: 1 | US FAERS | |
| 293 | Facial Pain | FAERS: 1 | US FAERS | |
| 294 | Febrile Neutropenia | FAERS: 1 | SIDER US FAERS | |
| 295 | Full blood count abnormal | FAERS: 1 | US FAERS | |
| 296 | Full blood count increased | FAERS: 1 | US FAERS | |
| 297 | Gastric infection | FAERS: 1 | US FAERS | |
| 298 | Gastritis | FAERS: 1 | SIDER US FAERS | |
| 299 | Gastrointestinal Pain | FAERS: 1 | SIDER US FAERS | |
| 300 | Gastrointestinal hypermotility | FAERS: 1 | US FAERS | |
| 301 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 302 | Gastrointestinal toxicity | FAERS: 1 | SIDER US FAERS | |
| 303 | Glaucoma | FAERS: 1 | US FAERS | |
| 304 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 305 | Hordeolum | FAERS: 1 | US FAERS | |
| 306 | Humidity intolerance | FAERS: 1 | US FAERS | |
| 307 | Hypercreatininaemia | FAERS: 1 | US FAERS | |
| 308 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 309 | Hypokinesia | FAERS: 1 | US FAERS | |
| 310 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 311 | Ileus | FAERS: 1 | US FAERS | |
| 312 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 313 | Incontinence | FAERS: 1 | US FAERS | |
| 314 | Infarction | FAERS: 1 | US FAERS | |
| 315 | Infectious colitis | FAERS: 1 | US FAERS | |
| 316 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 317 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 318 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 319 | Invasive Ductal Breast Carcinoma | FAERS: 1 | US FAERS | |
| 320 | Iron deficiency | FAERS: 1 | US FAERS | |
| 321 | Joint stiffness | FAERS: 1 | US FAERS | |
| 322 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 323 | Laryngitis | FAERS: 1 | US FAERS | |
| 324 | Lip Infection | FAERS: 1 | US FAERS | |
| 325 | Loose tooth | FAERS: 1 | US FAERS | |
| 326 | Lower respiratory tract infection | FAERS: 1 | SIDER US FAERS | |
| 327 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 328 | Lymphoma | FAERS: 1 | US FAERS | |
| 329 | Mastoiditis | FAERS: 1 | US FAERS | |
| 330 | Mental status changes | FAERS: 1 | US FAERS | |
| 331 | Mood swings | FAERS: 1 | US FAERS | |
| 332 | Mouth swelling | FAERS: 1 | US FAERS | |
| 333 | Multiple sclerosis relapse | FAERS: 1 | US FAERS | |
| 334 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 335 | Musculoskeletal discomfort | FAERS: 1 | SIDER US FAERS | |
| 336 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 337 | Myocardial necrosis marker increased | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 338 | Myocarditis | FAERS: 1 | US FAERS | |
| 339 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 340 | Nervousness | FAERS: 1 | US FAERS | |
| 341 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 342 | Oropharyngeal candidiasis | FAERS: 1 | US FAERS | |
| 343 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 344 | Overdose | FAERS: 1 | US FAERS | |
| 345 | Overweight | FAERS: 1 | US FAERS | |
| 346 | Palmar erythema | FAERS: 1 | US FAERS | |
| 347 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 348 | Parakeratosis | FAERS: 1 | US FAERS | |
| 349 | Parotitis | FAERS: 1 | US FAERS | |
| 350 | Penile blister | FAERS: 1 | US FAERS | |
| 351 | Peripheral artery stenosis | FAERS: 1 | US FAERS | |
| 352 | Petechiae | FAERS: 1 | US FAERS | |
| 353 | Physical deconditioning | FAERS: 1 | US FAERS | |
| 354 | Pleurisy | FAERS: 1 | US FAERS | |
| 355 | Pleuropericarditis | FAERS: 1 | US FAERS | |
| 356 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 357 | Poor quality product administered | FAERS: 1 | US FAERS | |
| 358 | Posterior reversible encephalopathy syndrome | FAERS: 1 | US FAERS | |
| 359 | Primary Myelofibrosis | FAERS: 1 | US FAERS | |
| 360 | Product administration error | FAERS: 1 | US FAERS | |
| 361 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 362 | Product physical issue | FAERS: 1 | US FAERS | |
| 363 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 364 | Product used for unknown indication | FAERS: 1 | US FAERS | |
| 365 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 366 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 367 | Respiratory distress | FAERS: 1 | US FAERS | |
| 368 | Respiratory syncytial virus test positive | FAERS: 1 | US FAERS | |
| 369 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 370 | Restlessness | FAERS: 1 | US FAERS | |
| 371 | Retching | FAERS: 1 | US FAERS | |
| 372 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 373 | Rhinalgia | FAERS: 1 | US FAERS | |
| 374 | Rhinitis | FAERS: 1 | US FAERS | |
| 375 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 376 | Sarcoidosis | FAERS: 1 | US FAERS | |
| 377 | Sensitivity to weather change | FAERS: 1 | US FAERS | |
| 378 | Severe invasive streptococcal infection | FAERS: 1 | US FAERS | |
| 379 | Shock | FAERS: 1 | US FAERS | |
| 380 | Silent myocardial infarction | FAERS: 1 | US FAERS | |
| 381 | Skin Papilloma | FAERS: 1 | US FAERS | |
| 382 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 383 | Skin reaction | FAERS: 1 | US FAERS | |
| 384 | Skin toxicity | FAERS: 1 | US FAERS | |
| 385 | Solar dermatitis | FAERS: 1 | US FAERS | |
| 386 | Spinal Stenosis | FAERS: 1 | US FAERS | |
| 387 | Subcutaneous Abscess | FAERS: 1 | US FAERS | |
| 388 | Sudden death | FAERS: 1 | US FAERS | |
| 389 | Syncope | FAERS: 1 | US FAERS | |
| 390 | Tachycardia | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 391 | Temporal Arteritis | FAERS: 1 | US FAERS | |
| 392 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 393 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 394 | Therapy change | FAERS: 1 | US FAERS | |
| 395 | Thrombocytosis | FAERS: 1 | US FAERS | |
| 396 | Tinea cruris | FAERS: 1 | US FAERS | |
| 397 | Tinnitus | FAERS: 1 | SIDER US FAERS | |
| 398 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 399 | Transcription medication error | FAERS: 1 | US FAERS | |
| 400 | Tremor | FAERS: 1 | US FAERS | |
| 401 | Troponin increased | FAERS: 1 | US FAERS | |
| 402 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 403 | Urinary Retention | FAERS: 1 | US FAERS | |
| 404 | Urinary Tract Pain | FAERS: 1 | US FAERS | |
| 405 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 406 | Uveitis | FAERS: 1 | US FAERS | |
| 407 | Vascular pain | FAERS: 1 | US FAERS | |
| 408 | Viral upper respiratory tract infection | FAERS: 1 | SIDER US FAERS | |
| 409 | Vulvovaginal pain | FAERS: 1 | US FAERS | |
| 410 | West Nile virus test positive | FAERS: 1 | US FAERS | |
| 411 | Abdominal tenderness | SIDER | ||
| 412 | Agranulocytosis | SIDER | ||
| 413 | Anaphylactic shock | SIDER | ||
| 414 | Atypical pneumonia | SIDER | ||
| 415 | Blood amylase increased | SIDER | ||
| 416 | Blood and lymphatic system disorders | SIDER | ||
| 417 | Bronchopneumonia | SIDER | ||
| 418 | Cytolytic hepatitis | SIDER | ||
| 419 | Ear and labyrinth disorders | SIDER | ||
| 420 | Erythema Multiforme | SIDER | ||
| 421 | Exfoliative rash | SIDER | ||
| 422 | Hepatitis | SIDER | ||
| 423 | Infestation | SIDER | ||
| 424 | Lobar Pneumonia | SIDER | ||
| 425 | Long QT Syndrome | SIDER | ||
| 426 | Malnutrition | SIDER | ||
| 427 | Myelosuppression | SIDER | ||
| 428 | Prurigo | SIDER | ||
| 429 | Respiratory tract infection viral | SIDER | ||
| 430 | Traumatic liver injury | SIDER | ||
| 431 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.