Vilazodone Hydrochloride
(RPZBRGFNBNQSOP-UHFFFAOYSA-N)
Structure
- SMILES
- N#Cc1ccc2c(c1)c(CCCCN1CCN(CC1)c1ccc3c(c1)cc(o3)C(=O)N)c[nH]2.Cl
- Molecular Formula:
- C26H28ClN5O2
- Molecular Weight:
- 477.986
- Log P:
- 5.5348
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 3
- TPSA:
- 102.29
- CAS Number(s):
- 163521-08-2
Synonym(s)
1.
Vilazodone Hydrochloride
2.
2-benzofurancarboxamide, 5-(4-(4-(5-cyano-1H-indol-3-yl)butyl)-1-piperazinyl)-, hydrochloride (1:1)
3.
5-(4-(4-(5-cyano-3-indolyl)butyl)-1-piperazinyl)benzofuran-2-carboxamide
4.
EMB-68843
5.
EMD 68843
6.
Viibryd
7.
Vilazodone
8.
Vilazodone HCl
9.
68843, EMD
10.
EMB 68843
11.
EMB68843
12.
HCl, Vilazodone
13.
Hydrochloride, Vilazodone
External Link(s)
| MeSH | D000069503 |
| PubChem Compound | 6918313 |
| ChEBI | 70705 |
| CHEMBL | CHEMBL1615374 |
| KEGG | dr:D09699 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nausea | FAERS: 187 | US FAERS | |
| 2 | Headache | FAERS: 128 | US FAERS | |
| 3 | Anxiety | FAERS: 121 | US FAERS | |
| 4 | Dizziness | FAERS: 111 | US FAERS | |
| 5 | Drug ineffective | FAERS: 93 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 6 | Feeling abnormal | FAERS: 85 | US FAERS | |
| 7 | Agitation | FAERS: 60 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 8 | Tremor | FAERS: 60 | US FAERS | |
| 9 | Vomiting | FAERS: 49 | US FAERS | |
| 10 | Fatigue | FAERS: 46 | US FAERS | |
| 11 | Palpitations | FAERS: 43 | US FAERS | |
| 12 | Pruritus | FAERS: 42 | US FAERS | |
| 13 | Somnolence | FAERS: 40 | US FAERS | |
| 14 | Crying | FAERS: 39 | US FAERS | |
| 15 | Serotonin Syndrome | FAERS: 36 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Drug dose omission | FAERS: 34 | US FAERS | |
| 17 | Anger | FAERS: 33 | US FAERS | |
| 18 | Wrong technique in product usage process | FAERS: 32 | US FAERS | |
| 19 | Alopecia | FAERS: 30 | US FAERS | |
| 20 | Abdominal discomfort | FAERS: 29 | US FAERS | |
| 21 | Completed Suicide | FAERS: 28 | US FAERS | |
| 22 | Intentional product misuse | FAERS: 28 | US FAERS | |
| 23 | Malaise | FAERS: 27 | US FAERS | |
| 24 | Suicide attempt | FAERS: 27 | US FAERS | |
| 25 | Sleep Paralysis | FAERS: 26 | US FAERS | |
| 26 | Feeling jittery | FAERS: 23 | US FAERS | |
| 27 | Tinnitus | FAERS: 21 | US FAERS | |
| 28 | Unevaluable event | FAERS: 21 | US FAERS | |
| 29 | Arthralgia | FAERS: 20 | US FAERS | |
| 30 | Asthenia | FAERS: 20 | US FAERS | |
| 31 | Sexual Dysfunction | FAERS: 19 | US FAERS | |
| 32 | Pain | FAERS: 18 | US FAERS | |
| 33 | Paranoia | FAERS: 18 | US FAERS | |
| 34 | Amnesia | FAERS: 17 | US FAERS | |
| 35 | Lethargy | FAERS: 16 | US FAERS | |
| 36 | Myalgia | FAERS: 16 | US FAERS | |
| 37 | Nervousness | FAERS: 16 | US FAERS | |
| 38 | Restlessness | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 39 | Restless Legs Syndrome | FAERS: 14 | US FAERS | |
| 40 | Memory impairment | FAERS: 13 | US FAERS | |
| 41 | Abdominal Pain | FAERS: 12 | US FAERS | |
| 42 | Musculoskeletal stiffness | FAERS: 12 | US FAERS | |
| 43 | Night sweats | FAERS: 12 | US FAERS | |
| 44 | Product dose omission | FAERS: 12 | US FAERS | |
| 45 | Blood glucose increased | FAERS: 11 | US FAERS | |
| 46 | Incorrect dose administered | FAERS: 11 | US FAERS | |
| 47 | Syncope | FAERS: 11 | US FAERS | |
| 48 | Constipation | FAERS: 10 | US FAERS | |
| 49 | Disorientation | FAERS: 10 | US FAERS | |
| 50 | Drug withdrawal syndrome | FAERS: 10 | US FAERS | |
| 51 | Flatulence | FAERS: 10 | US FAERS | |
| 52 | Adverse event | FAERS: 9 | US FAERS | |
| 53 | Dyspepsia | FAERS: 9 | US FAERS | |
| 54 | Expired product administered | FAERS: 9 | US FAERS | |
| 55 | Product prescribing error | FAERS: 9 | US FAERS | |
| 56 | Screaming | FAERS: 9 | US FAERS | |
| 57 | Therapeutic response unexpected | FAERS: 9 | US FAERS | |
| 58 | Accidental overdose | FAERS: 8 | US FAERS | |
| 59 | Chest discomfort | FAERS: 8 | US FAERS | |
| 60 | Depressed mood | FAERS: 8 | US FAERS | |
| 61 | Emotional disorder | FAERS: 8 | US FAERS | |
| 62 | Erectile dysfunction | FAERS: 8 | US FAERS | |
| 63 | Hypersensitivity | FAERS: 8 | US FAERS | |
| 64 | Medication Error | FAERS: 8 | US FAERS | |
| 65 | Mood swings | FAERS: 8 | US FAERS | |
| 66 | Tachyphrenia | FAERS: 8 | US FAERS | |
| 67 | Weight decreased | FAERS: 8 | US FAERS | |
| 68 | Accidental exposure to product | FAERS: 7 | US FAERS | |
| 69 | Bruxism | FAERS: 7 | US FAERS | |
| 70 | Joint swelling | FAERS: 7 | US FAERS | |
| 71 | Muscle tightness | FAERS: 7 | US FAERS | |
| 72 | Stress | FAERS: 7 | US FAERS | |
| 73 | Tachycardia | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 74 | Urticaria | FAERS: 7 | US FAERS | |
| 75 | Vertigo | FAERS: 7 | US FAERS | |
| 76 | Chest Pain | FAERS: 6 | US FAERS | |
| 77 | Dysgeusia | FAERS: 6 | US FAERS | |
| 78 | Hostility | FAERS: 6 | US FAERS | |
| 79 | Hypomania | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 80 | Middle insomnia | FAERS: 6 | US FAERS | |
| 81 | Pancreatitis | FAERS: 6 | US FAERS | |
| 82 | Violence-related symptom | FAERS: 6 | US FAERS | |
| 83 | Visual Impairment | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 84 | Ageusia | FAERS: 5 | US FAERS | |
| 85 | Anorgasmia | FAERS: 5 | US FAERS | |
| 86 | Cerebrovascular accident | FAERS: 5 | US FAERS | |
| 87 | Dehydration | FAERS: 5 | US FAERS | |
| 88 | Drug ineffective for unapproved indication | FAERS: 5 | US FAERS | |
| 89 | Flushing | FAERS: 5 | US FAERS | |
| 90 | Inappropriate schedule of drug administration | FAERS: 5 | US FAERS | |
| 91 | Intentional self-injury | FAERS: 5 | US FAERS | |
| 92 | Lymphadenopathy | FAERS: 5 | US FAERS | |
| 93 | Mental impairment | FAERS: 5 | US FAERS | |
| 94 | Mental status changes | FAERS: 5 | US FAERS | |
| 95 | Myocardial Infarction | FAERS: 5 | US FAERS | |
| 96 | Overdose | FAERS: 5 | US FAERS | |
| 97 | Personality Change | FAERS: 5 | US FAERS | |
| 98 | Product use issue | FAERS: 5 | US FAERS | |
| 99 | nervous system disorder | FAERS: 5 | US FAERS | |
| 100 | Hallucinations, mixed | FAERS: 4 | US FAERS | |
| 101 | Hypotension | FAERS: 4 | US FAERS | |
| 102 | Initial insomnia | FAERS: 4 | US FAERS | |
| 103 | Intentional dose omission | FAERS: 4 | US FAERS | |
| 104 | Prescribed overdose | FAERS: 4 | US FAERS | |
| 105 | Accidental exposure to product by child | FAERS: 3 | US FAERS | |
| 106 | Acne | FAERS: 3 | US FAERS | |
| 107 | Activities of daily living impaired | FAERS: 3 | US FAERS | |
| 108 | Anaphylactic shock | FAERS: 3 | US FAERS | |
| 109 | Angioedema | FAERS: 3 | US FAERS | |
| 110 | Blood cholesterol increased | FAERS: 3 | US FAERS | |
| 111 | Blood triglycerides increased | FAERS: 3 | US FAERS | |
| 112 | Cerebral disorder | FAERS: 3 | US FAERS | |
| 113 | Chills | FAERS: 3 | US FAERS | |
| 114 | Cold sweat | FAERS: 3 | US FAERS | |
| 115 | Drug administration error | FAERS: 3 | US FAERS | |
| 116 | Drug screen positive | FAERS: 3 | US FAERS | |
| 117 | Dysarthria | FAERS: 3 | US FAERS | |
| 118 | Dystonia | FAERS: 3 | US FAERS | |
| 119 | Emotional distress | FAERS: 3 | US FAERS | |
| 120 | Epistaxis | FAERS: 3 | US FAERS | |
| 121 | Euphoric mood | FAERS: 3 | US FAERS | |
| 122 | Eye pain | FAERS: 3 | US FAERS | |
| 123 | Head discomfort | FAERS: 3 | US FAERS | |
| 124 | Impaired work ability | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 125 | Joint stiffness | FAERS: 3 | US FAERS | |
| 126 | Lip swelling | FAERS: 3 | US FAERS | |
| 127 | No adverse event | FAERS: 3 | US FAERS | |
| 128 | Obsessive thoughts | FAERS: 3 | US FAERS | |
| 129 | Ocular discomfort | FAERS: 3 | US FAERS | |
| 130 | Photophobia | FAERS: 3 | US FAERS | |
| 131 | Priapism | FAERS: 3 | US FAERS | |
| 132 | Shock | FAERS: 3 | US FAERS | |
| 133 | Toxicity to various agents | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 134 | Urinary Retention | FAERS: 3 | US FAERS | |
| 135 | Urinary hesitation | FAERS: 3 | US FAERS | |
| 136 | Altered state of consciousness | FAERS: 2 | US FAERS | |
| 137 | Anosmia | FAERS: 2 | US FAERS | |
| 138 | Apathy | FAERS: 2 | US FAERS | |
| 139 | Aphasia | FAERS: 2 | US FAERS | |
| 140 | Asthenopia | FAERS: 2 | US FAERS | |
| 141 | Back Pain | FAERS: 2 | US FAERS | |
| 142 | Bladder discomfort | FAERS: 2 | US FAERS | |
| 143 | Blood creatinine increased | FAERS: 2 | US FAERS | |
| 144 | Blood glucose decreased | FAERS: 2 | US FAERS | |
| 145 | Bronchial Hyperreactivity | FAERS: 2 | US FAERS | |
| 146 | Bronchitis | FAERS: 2 | US FAERS | |
| 147 | Burning sensation | FAERS: 2 | US FAERS | |
| 148 | Clumsiness | FAERS: 2 | US FAERS | |
| 149 | Deafness | FAERS: 2 | US FAERS | |
| 150 | Delirium | FAERS: 2 | US FAERS | |
| 151 | Dependence | FAERS: 2 | US FAERS | |
| 152 | Depressed Level of Consciousness | FAERS: 2 | US FAERS | |
| 153 | Diabetes mellitus inadequate control | FAERS: 2 | US FAERS | |
| 154 | Diabetic Ketoacidosis | FAERS: 2 | US FAERS | |
| 155 | Disease recurrence | FAERS: 2 | US FAERS | |
| 156 | Dissociation | FAERS: 2 | US FAERS | |
| 157 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 158 | Drug screen false positive | FAERS: 2 | US FAERS | |
| 159 | Drug titration error | FAERS: 2 | US FAERS | |
| 160 | Dysphonia | FAERS: 2 | US FAERS | |
| 161 | Dysuria | FAERS: 2 | US FAERS | |
| 162 | Economic problem | FAERS: 2 | US FAERS | |
| 163 | Eructation | FAERS: 2 | US FAERS | |
| 164 | Erythema | FAERS: 2 | US FAERS | |
| 165 | Extremity contracture | FAERS: 2 | US FAERS | |
| 166 | Food craving | FAERS: 2 | US FAERS | |
| 167 | Formication | FAERS: 2 | US FAERS | |
| 168 | Gastrointestinal sounds abnormal | FAERS: 2 | US FAERS | |
| 169 | Homicide | FAERS: 2 | US FAERS | |
| 170 | Hypersomnia | FAERS: 2 | US FAERS | |
| 171 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 172 | Incontinence | FAERS: 2 | US FAERS | |
| 173 | Maternal exposure during breast feeding | FAERS: 2 | US FAERS | |
| 174 | Menorrhagia | FAERS: 2 | US FAERS | |
| 175 | Multiple drug overdose | FAERS: 2 | US FAERS | |
| 176 | Musculoskeletal Pain | FAERS: 2 | US FAERS | |
| 177 | Mydriasis | FAERS: 2 | US FAERS | |
| 178 | Obsessive-Compulsive Disorder | FAERS: 2 | US FAERS | |
| 179 | Obsessive-compulsive symptom | FAERS: 2 | US FAERS | |
| 180 | Oropharyngeal pain | FAERS: 2 | US FAERS | |
| 181 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 182 | Petechiae | FAERS: 2 | US FAERS | |
| 183 | Poor quality sleep | FAERS: 2 | US FAERS | |
| 184 | Product formulation issue | FAERS: 2 | US FAERS | |
| 185 | Product substitution issue | FAERS: 2 | US FAERS | |
| 186 | Psoriasis | FAERS: 2 | US FAERS | |
| 187 | Retching | FAERS: 2 | US FAERS | |
| 188 | Sneezing | FAERS: 2 | US FAERS | |
| 189 | Somnambulism | FAERS: 2 | US FAERS | |
| 190 | Strabismus | FAERS: 2 | US FAERS | |
| 191 | Therapy cessation | FAERS: 2 | US FAERS | |
| 192 | VIIth nerve paralysis | FAERS: 2 | US FAERS | |
| 193 | Vulvovaginal mycotic infection | FAERS: 2 | US FAERS | |
| 194 | jaundice | FAERS: 2 | US FAERS | |
| 195 | Abasia | FAERS: 1 | US FAERS | |
| 196 | Abnormal weight gain | FAERS: 1 | US FAERS | |
| 197 | Accidental exposure | FAERS: 1 | US FAERS | |
| 198 | Akathisia | FAERS: 1 | US FAERS | |
| 199 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 200 | Amphetamines positive | FAERS: 1 | US FAERS | |
| 201 | Anal sphincter atony | FAERS: 1 | US FAERS | |
| 202 | Angle Closure Glaucoma | FAERS: 1 | US FAERS | |
| 203 | Apparent life threatening event | FAERS: 1 | US FAERS | |
| 204 | Arthritis | FAERS: 1 | US FAERS | |
| 205 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 206 | Asphyxia | FAERS: 1 | US FAERS | |
| 207 | Asthma | FAERS: 1 | US FAERS | |
| 208 | Aura | FAERS: 1 | US FAERS | |
| 209 | Autoscopy | FAERS: 1 | US FAERS | |
| 210 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 211 | Blepharospasm | FAERS: 1 | US FAERS | |
| 212 | Blindness | FAERS: 1 | US FAERS | |
| 213 | Blood Pressure | FAERS: 1 | US FAERS | |
| 214 | Blood alkaline phosphatase abnormal | FAERS: 1 | US FAERS | |
| 215 | Blood bilirubin abnormal | FAERS: 1 | US FAERS | |
| 216 | Blood calcium abnormal | FAERS: 1 | US FAERS | |
| 217 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 218 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 219 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 220 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 221 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 222 | Bone pain | FAERS: 1 | US FAERS | |
| 223 | Breast tenderness | FAERS: 1 | US FAERS | |
| 224 | Bronchospasm | FAERS: 1 | US FAERS | |
| 225 | Cardiac discomfort | FAERS: 1 | US FAERS | |
| 226 | Change in sustained attention | FAERS: 1 | US FAERS | |
| 227 | Choking sensation | FAERS: 1 | US FAERS | |
| 228 | Chromatopsia | FAERS: 1 | US FAERS | |
| 229 | Chronic disease | FAERS: 1 | US FAERS | |
| 230 | Colitis | FAERS: 1 | US FAERS | |
| 231 | Compulsive cheek biting | FAERS: 1 | US FAERS | |
| 232 | Confabulation | FAERS: 1 | US FAERS | |
| 233 | Contact lens intolerance | FAERS: 1 | US FAERS | |
| 234 | Cystitis | FAERS: 1 | US FAERS | |
| 235 | Cyst | FAERS: 1 | US FAERS | |
| 236 | Dementia | FAERS: 1 | US FAERS | |
| 237 | Dental discomfort | FAERS: 1 | US FAERS | |
| 238 | Discomfort | FAERS: 1 | US FAERS | |
| 239 | Discontinued product administered | FAERS: 1 | US FAERS | |
| 240 | Dissociative Amnesia | FAERS: 1 | US FAERS | |
| 241 | Dissociative disorder | FAERS: 1 | US FAERS | |
| 242 | Dreamy state | FAERS: 1 | US FAERS | |
| 243 | Drug Dependence | FAERS: 1 | US FAERS | |
| 244 | Drug abuser | FAERS: 1 | US FAERS | |
| 245 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 246 | Drug dose titration not performed | FAERS: 1 | US FAERS | |
| 247 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 248 | Duodenitis | FAERS: 1 | US FAERS | |
| 249 | Dysgraphia | FAERS: 1 | US FAERS | |
| 250 | Dysphemia | FAERS: 1 | US FAERS | |
| 251 | Ear discomfort | FAERS: 1 | US FAERS | |
| 252 | Eczema | FAERS: 1 | US FAERS | |
| 253 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 254 | Enuresis | FAERS: 1 | US FAERS | |
| 255 | Episcleritis | FAERS: 1 | US FAERS | |
| 256 | Excessive sexual fantasies | FAERS: 1 | US FAERS | |
| 257 | Eye Infection | FAERS: 1 | US FAERS | |
| 258 | Eye irritation | FAERS: 1 | US FAERS | |
| 259 | Failure of child resistant mechanism for pharmaceutical product | FAERS: 1 | US FAERS | |
| 260 | Feeling Cold | FAERS: 1 | US FAERS | |
| 261 | Frustration | FAERS: 1 | US FAERS | |
| 262 | Gastric Bypass | FAERS: 1 | US FAERS | |
| 263 | Gastritis | FAERS: 1 | US FAERS | |
| 264 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 265 | Head Banging | FAERS: 1 | US FAERS | |
| 266 | Hunger | FAERS: 1 | US FAERS | |
| 267 | Hyperacusis | FAERS: 1 | US FAERS | |
| 268 | Hyperreflexia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 269 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 270 | Hyperventilation | FAERS: 1 | US FAERS | |
| 271 | Hypervigilance | FAERS: 1 | US FAERS | |
| 272 | Hypokinesia | FAERS: 1 | US FAERS | |
| 273 | Hypophagia | FAERS: 1 | US FAERS | |
| 274 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 275 | Impatience | FAERS: 1 | US FAERS | |
| 276 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 277 | Incoherent | FAERS: 1 | US FAERS | |
| 278 | Incorrect product administration duration | FAERS: 1 | US FAERS | |
| 279 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 280 | Infection | FAERS: 1 | US FAERS | |
| 281 | Infertility | FAERS: 1 | US FAERS | |
| 282 | Inflammatory pain | FAERS: 1 | US FAERS | |
| 283 | Influenza | FAERS: 1 | US FAERS | |
| 284 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 285 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 286 | Intercepted product prescribing error | FAERS: 1 | US FAERS | |
| 287 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 288 | Joint injury | FAERS: 1 | US FAERS | |
| 289 | Laceration | FAERS: 1 | US FAERS | |
| 290 | Lactose Intolerance | FAERS: 1 | US FAERS | |
| 291 | Loss of dreaming | FAERS: 1 | US FAERS | |
| 292 | Mastitis | FAERS: 1 | US FAERS | |
| 293 | Mechanical urticaria | FAERS: 1 | US FAERS | |
| 294 | Merycism | FAERS: 1 | US FAERS | |
| 295 | Morbid thoughts | FAERS: 1 | US FAERS | |
| 296 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 297 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 298 | Myoclonus | FAERS: 1 | US FAERS | |
| 299 | Nasal pruritus | FAERS: 1 | US FAERS | |
| 300 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 301 | Neck Pain | FAERS: 1 | US FAERS | |
| 302 | Negative thoughts | FAERS: 1 | US FAERS | |
| 303 | Neuralgia | FAERS: 1 | US FAERS | |
| 304 | Neuroleptic Malignant Syndrome | FAERS: 1 | US FAERS | |
| 305 | Nocturia | FAERS: 1 | US FAERS | |
| 306 | Ocular icterus | FAERS: 1 | US FAERS | |
| 307 | Onychoclasis | FAERS: 1 | US FAERS | |
| 308 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 309 | Ovarian enlargement | FAERS: 1 | US FAERS | |
| 310 | Pallor | FAERS: 1 | US FAERS | |
| 311 | Pancreatic Pseudocyst | FAERS: 1 | US FAERS | |
| 312 | Panic Disorder | FAERS: 1 | US FAERS | |
| 313 | Parasomnia | FAERS: 1 | US FAERS | |
| 314 | Parkinsonian rest tremor | FAERS: 1 | US FAERS | |
| 315 | Penile size reduced | FAERS: 1 | US FAERS | |
| 316 | Physical assault | FAERS: 1 | US FAERS | |
| 317 | Polyarthritis | FAERS: 1 | US FAERS | |
| 318 | Pre-existing condition improved | FAERS: 1 | US FAERS | |
| 319 | Premature Ejaculation | FAERS: 1 | US FAERS | |
| 320 | Presyncope | FAERS: 1 | US FAERS | |
| 321 | Procedural complication | FAERS: 1 | US FAERS | |
| 322 | Product dispensing error | FAERS: 1 | US FAERS | |
| 323 | Product lot number issue | FAERS: 1 | US FAERS | |
| 324 | Product physical issue | FAERS: 1 | US FAERS | |
| 325 | Product quality issue | FAERS: 1 | US FAERS | |
| 326 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 327 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 328 | Rash erythematous | FAERS: 1 | US FAERS | |
| 329 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 330 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 331 | Scab | FAERS: 1 | US FAERS | |
| 332 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 333 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 334 | Sinusitis | FAERS: 1 | US FAERS | |
| 335 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 336 | Skin texture abnormal | FAERS: 1 | US FAERS | |
| 337 | Sleep Talking | FAERS: 1 | US FAERS | |
| 338 | Slow speech | FAERS: 1 | US FAERS | |
| 339 | Sluggishness | FAERS: 1 | US FAERS | |
| 340 | Splenic vein thrombosis | FAERS: 1 | US FAERS | |
| 341 | Splenomegaly | FAERS: 1 | US FAERS | |
| 342 | Spontaneous penile erection | FAERS: 1 | US FAERS | |
| 343 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 344 | Stomatitis | FAERS: 1 | US FAERS | |
| 345 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 346 | Tardive Dyskinesia | FAERS: 1 | US FAERS | |
| 347 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 348 | Tension Headache | FAERS: 1 | US FAERS | |
| 349 | Theft | FAERS: 1 | US FAERS | |
| 350 | Therapeutic product effect decreased | FAERS: 1 | US FAERS | |
| 351 | Therapeutic product effective for unapproved indication | FAERS: 1 | US FAERS | |
| 352 | Thrombosis | FAERS: 1 | US FAERS | |
| 353 | Toothache | FAERS: 1 | US FAERS | |
| 354 | Toxicologic test abnormal | FAERS: 1 | US FAERS | |
| 355 | Ulcer | FAERS: 1 | US FAERS | |
| 356 | Unemployment | FAERS: 1 | US FAERS | |
| 357 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 358 | Vasodilation procedure | FAERS: 1 | US FAERS | |
| 359 | Vitreous Detachment | FAERS: 1 | US FAERS | |
| 360 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 361 | Vulvovaginal dryness | FAERS: 1 | US FAERS | |
| 362 | Wolff-Parkinson-White Syndrome | FAERS: 1 | US FAERS | |
| 363 | pH urine increased | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.