Metoprolol
(RGHAZVBIOOEVQX-UHFFFAOYSA-N)
Structure
- SMILES
- OC(=O)CCC(=O)O.COCCc1ccc(cc1)OCC(CNC(C)C)O.COCCc1ccc(cc1)OCC(CNC(C)C)O
- Molecular Formula:
- C34H56N2O10
- Molecular Weight:
- 652.816
- Log P:
- 3.9440
- Hydrogen Bond Acceptor:
- 12
- Hydrogen Bond Donor:
- 6
- TPSA:
- 176.04
- CAS Number(s):
- 98418-47-4
Synonym(s)
1.
Metoprolol
2.
Beloc-Duriles
3.
Betaloc
4.
Betaloc-Astra
5.
Betalok
6.
CGP-2175
7.
H 93-26
8.
Lopressor
9.
Metoprolol CR-XL
10.
Metoprolol Succinate
11.
Metoprolol Tartrate
12.
Seloken
13.
Spesicor
14.
Spesikor
15.
Toprol
16.
Toprol-XL
17.
Beloc Duriles
18.
Betaloc Astra
19.
CGP 2175
20.
CGP2175
21.
H 93 26
22.
H 9326
23.
Metoprolol CR XL
24.
Toprol XL
External Link(s)
| MeSH | D008790 |
| PubChem Compound | 62937 |
| ChEBI | 6905 |
| CHEMBL | CHEMBL2356097 |
| KEGG | dr:D00635 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 171 | US FAERS | |
| 2 | Malaise | FAERS: 129 | US FAERS | |
| 3 | Dizziness | FAERS: 103 | US FAERS | |
| 4 | Product substitution issue | FAERS: 93 | US FAERS | |
| 5 | Palpitations | FAERS: 92 | US FAERS | |
| 6 | Headache | FAERS: 91 | US FAERS | |
| 7 | Product quality issue | FAERS: 83 | US FAERS | |
| 8 | Drug dose omission | FAERS: 75 | US FAERS | |
| 9 | Feeling abnormal | FAERS: 64 | US FAERS | |
| 10 | Fatigue | FAERS: 54 | US FAERS | |
| 11 | Nausea | FAERS: 50 | US FAERS | |
| 12 | Anxiety | FAERS: 44 | US FAERS | |
| 13 | Adverse event | FAERS: 40 | US FAERS | |
| 14 | Bradycardia | FAERS: 37 | US FAERS | |
| 15 | Hypotension | FAERS: 36 | US FAERS | |
| 16 | Chest Pain | FAERS: 35 | US FAERS | |
| 17 | Blood pressure inadequately controlled | FAERS: 33 | US FAERS | |
| 18 | Asthenia | FAERS: 32 | US FAERS | |
| 19 | Chest discomfort | FAERS: 29 | US FAERS | |
| 20 | Therapeutic response unexpected with drug substitution | FAERS: 29 | US FAERS | |
| 21 | Hypersensitivity | FAERS: 28 | US FAERS | |
| 22 | Myocardial Infarction | FAERS: 28 | US FAERS | |
| 23 | Atrial Fibrillation | FAERS: 25 | US FAERS | |
| 24 | Pruritus | FAERS: 25 | US FAERS | |
| 25 | Alopecia | FAERS: 24 | US FAERS | |
| 26 | Intentional drug misuse | FAERS: 24 | US FAERS | |
| 27 | Inappropriate schedule of drug administration | FAERS: 23 | US FAERS | |
| 28 | Tachycardia | FAERS: 23 | US FAERS | |
| 29 | Blood pressure fluctuation | FAERS: 22 | US FAERS | |
| 30 | Cerebrovascular accident | FAERS: 22 | US FAERS | |
| 31 | Pain | FAERS: 22 | US FAERS | |
| 32 | Intentional product misuse | FAERS: 20 | US FAERS | |
| 33 | Tremor | FAERS: 20 | US FAERS | |
| 34 | Visual Impairment | FAERS: 20 | US FAERS | |
| 35 | Pharmaceutical product complaint | FAERS: 19 | US FAERS | |
| 36 | Syncope | FAERS: 18 | US FAERS | |
| 37 | Toxicity to various agents | FAERS: 18 | US FAERS | |
| 38 | Unevaluable event | FAERS: 18 | US FAERS | |
| 39 | Somnolence | FAERS: 17 | US FAERS | |
| 40 | Abdominal discomfort | FAERS: 16 | US FAERS | |
| 41 | Diabetes Mellitus | FAERS: 16 | US FAERS | |
| 42 | Product use issue | FAERS: 16 | US FAERS | |
| 43 | Asthma | FAERS: 15 | US FAERS | |
| 44 | Tinnitus | FAERS: 14 | US FAERS | |
| 45 | Activities of daily living impaired | FAERS: 13 | US FAERS | |
| 46 | Dyspepsia | FAERS: 13 | US FAERS | |
| 47 | Inappropriate schedule of product administration | FAERS: 13 | US FAERS | |
| 48 | Nasopharyngitis | FAERS: 13 | US FAERS | |
| 49 | Nervousness | FAERS: 13 | US FAERS | |
| 50 | Stress | FAERS: 13 | US FAERS | |
| 51 | Angina Pectoris | FAERS: 12 | US FAERS | |
| 52 | Completed Suicide | FAERS: 12 | US FAERS | |
| 53 | Memory impairment | FAERS: 12 | US FAERS | |
| 54 | Vomiting | FAERS: 12 | US FAERS | |
| 55 | Wrong technique in product usage process | FAERS: 12 | US FAERS | |
| 56 | Abdominal Pain | FAERS: 11 | US FAERS | |
| 57 | Arthralgia | FAERS: 11 | US FAERS | |
| 58 | Pneumonia | FAERS: 11 | US FAERS | |
| 59 | Drug ineffective for unapproved indication | FAERS: 10 | US FAERS | |
| 60 | Overdose | FAERS: 10 | US FAERS | |
| 61 | Constipation | FAERS: 9 | US FAERS | |
| 62 | Drug dispensing error | FAERS: 9 | US FAERS | |
| 63 | Flatulence | FAERS: 9 | US FAERS | |
| 64 | Medication Error | FAERS: 9 | US FAERS | |
| 65 | Suicide attempt | FAERS: 9 | US FAERS | |
| 66 | Swelling | FAERS: 9 | US FAERS | |
| 67 | Weight decreased | FAERS: 9 | US FAERS | |
| 68 | Discomfort | FAERS: 8 | US FAERS | |
| 69 | Disorientation | FAERS: 8 | US FAERS | |
| 70 | Dysgeusia | FAERS: 8 | US FAERS | |
| 71 | Joint swelling | FAERS: 8 | US FAERS | |
| 72 | Urticaria | FAERS: 8 | US FAERS | |
| 73 | Burning sensation | FAERS: 7 | US FAERS | |
| 74 | Cardiac Flutter | FAERS: 7 | US FAERS | |
| 75 | Erythema | FAERS: 7 | US FAERS | |
| 76 | Feeling Cold | FAERS: 7 | US FAERS | |
| 77 | Incorrect dose administered | FAERS: 7 | US FAERS | |
| 78 | Musculoskeletal stiffness | FAERS: 7 | US FAERS | |
| 79 | Oropharyngeal pain | FAERS: 7 | US FAERS | |
| 80 | Wheezing | FAERS: 7 | US FAERS | |
| 81 | Angioedema | FAERS: 6 | US FAERS | |
| 82 | Arthritis | FAERS: 6 | US FAERS | |
| 83 | Atrioventricular Block | FAERS: 6 | US FAERS | |
| 84 | Back Pain | FAERS: 6 | US FAERS | |
| 85 | Bronchitis | FAERS: 6 | US FAERS | |
| 86 | Cardiac Arrest | FAERS: 6 | US FAERS | |
| 87 | Chills | FAERS: 6 | US FAERS | |
| 88 | Lethargy | FAERS: 6 | US FAERS | |
| 89 | Medication residue | FAERS: 6 | US FAERS | |
| 90 | Peripheral swelling | FAERS: 6 | US FAERS | |
| 91 | Psoriasis | FAERS: 6 | US FAERS | |
| 92 | Reaction to drug excipients | FAERS: 6 | US FAERS | |
| 93 | Supraventricular tachycardia | FAERS: 6 | US FAERS | |
| 94 | Vertigo | FAERS: 6 | US FAERS | |
| 95 | Amnesia | FAERS: 5 | US FAERS | |
| 96 | Blood cholesterol increased | FAERS: 5 | US FAERS | |
| 97 | Circumstance or information capable of leading to medication error | FAERS: 5 | US FAERS | |
| 98 | Drug effect incomplete | FAERS: 5 | US FAERS | |
| 99 | Dysphonia | FAERS: 5 | US FAERS | |
| 100 | Epistaxis | FAERS: 5 | US FAERS | |
| 101 | Eructation | FAERS: 5 | US FAERS | |
| 102 | Impaired work ability | FAERS: 5 | US FAERS | |
| 103 | Myalgia | FAERS: 5 | US FAERS | |
| 104 | Presyncope | FAERS: 5 | US FAERS | |
| 105 | Product dose omission | FAERS: 5 | US FAERS | |
| 106 | Sinus bradycardia | FAERS: 5 | US FAERS | |
| 107 | Urinary tract infection | FAERS: 5 | US FAERS | |
| 108 | Ventricular arrhythmia | FAERS: 5 | US FAERS | |
| 109 | Wrong drug administered | FAERS: 5 | US FAERS | |
| 110 | Wrong technique in drug usage process | FAERS: 5 | US FAERS | |
| 111 | Abasia | FAERS: 4 | US FAERS | |
| 112 | Bronchospasm | FAERS: 4 | US FAERS | |
| 113 | Cardiotoxicity | FAERS: 4 | US FAERS | |
| 114 | Cataract | FAERS: 4 | US FAERS | |
| 115 | Cold sweat | FAERS: 4 | US FAERS | |
| 116 | Deafness | FAERS: 4 | US FAERS | |
| 117 | Dementia | FAERS: 4 | US FAERS | |
| 118 | Depressed mood | FAERS: 4 | US FAERS | |
| 119 | Diplopia | FAERS: 4 | US FAERS | |
| 120 | Drug prescribing error | FAERS: 4 | US FAERS | |
| 121 | Feeling jittery | FAERS: 4 | US FAERS | |
| 122 | Flushing | FAERS: 4 | US FAERS | |
| 123 | Gout | FAERS: 4 | US FAERS | |
| 124 | Influenza | FAERS: 4 | US FAERS | |
| 125 | Lip swelling | FAERS: 4 | US FAERS | |
| 126 | Macular degeneration | FAERS: 4 | US FAERS | |
| 127 | Musculoskeletal Pain | FAERS: 4 | US FAERS | |
| 128 | Product solubility abnormal | FAERS: 4 | US FAERS | |
| 129 | Product taste abnormal | FAERS: 4 | US FAERS | |
| 130 | Sinus Tachycardia | FAERS: 4 | US FAERS | |
| 131 | Therapeutic response unexpected | FAERS: 4 | US FAERS | |
| 132 | Ageusia | FAERS: 3 | US FAERS | |
| 133 | Anger | FAERS: 3 | US FAERS | |
| 134 | Aphonia | FAERS: 3 | US FAERS | |
| 135 | Blindness | FAERS: 3 | US FAERS | |
| 136 | Cardiac discomfort | FAERS: 3 | US FAERS | |
| 137 | Choking | FAERS: 3 | US FAERS | |
| 138 | Coronary Artery Disease | FAERS: 3 | US FAERS | |
| 139 | Dehydration | FAERS: 3 | US FAERS | |
| 140 | Drug administration error | FAERS: 3 | US FAERS | |
| 141 | Ear discomfort | FAERS: 3 | US FAERS | |
| 142 | Eye pain | FAERS: 3 | US FAERS | |
| 143 | Glaucoma | FAERS: 3 | US FAERS | |
| 144 | Head discomfort | FAERS: 3 | US FAERS | |
| 145 | Hyperthyroidism | FAERS: 3 | US FAERS | |
| 146 | Limb discomfort | FAERS: 3 | US FAERS | |
| 147 | Medication residue present | FAERS: 3 | US FAERS | |
| 148 | Multiple allergies | FAERS: 3 | US FAERS | |
| 149 | Neonatal tachycardia | FAERS: 3 | US FAERS | |
| 150 | Night sweats | FAERS: 3 | US FAERS | |
| 151 | No adverse event | FAERS: 3 | US FAERS | |
| 152 | Pallor | FAERS: 3 | US FAERS | |
| 153 | Poor quality sleep | FAERS: 3 | US FAERS | |
| 154 | Product formulation issue | FAERS: 3 | US FAERS | |
| 155 | Retching | FAERS: 3 | US FAERS | |
| 156 | Skin Ulcer | FAERS: 3 | US FAERS | |
| 157 | Sleep disorder due to general medical condition, insomnia type | FAERS: 3 | US FAERS | |
| 158 | Thirst | FAERS: 3 | US FAERS | |
| 159 | Throat irritation | FAERS: 3 | US FAERS | |
| 160 | Thrombosis | FAERS: 3 | US FAERS | |
| 161 | Agitation | FAERS: 2 | US FAERS | |
| 162 | Allergic reaction to excipient | FAERS: 2 | US FAERS | |
| 163 | Alveolitis | FAERS: 2 | US FAERS | |
| 164 | Aneurysm | FAERS: 2 | US FAERS | |
| 165 | Aortic Aneurysm | FAERS: 2 | US FAERS | |
| 166 | Apathy | FAERS: 2 | US FAERS | |
| 167 | Aphagia | FAERS: 2 | US FAERS | |
| 168 | Apparent death | FAERS: 2 | US FAERS | |
| 169 | Arthropathy | FAERS: 2 | US FAERS | |
| 170 | Asphyxia | FAERS: 2 | US FAERS | |
| 171 | Atrial tachycardia | FAERS: 2 | US FAERS | |
| 172 | Back disorder | FAERS: 2 | US FAERS | |
| 173 | Bladder pain | FAERS: 2 | US FAERS | |
| 174 | Blood glucose decreased | FAERS: 2 | US FAERS | |
| 175 | Bone pain | FAERS: 2 | US FAERS | |
| 176 | Bowel movement irregularity | FAERS: 2 | US FAERS | |
| 177 | Counterfeit drug administered | FAERS: 2 | US FAERS | |
| 178 | Cystitis | FAERS: 2 | US FAERS | |
| 179 | Depressed Level of Consciousness | FAERS: 2 | US FAERS | |
| 180 | Disease recurrence | FAERS: 2 | US FAERS | |
| 181 | Diverticulitis | FAERS: 2 | US FAERS | |
| 182 | Drug level fluctuating | FAERS: 2 | US FAERS | |
| 183 | Dry skin | FAERS: 2 | US FAERS | |
| 184 | Dysuria | FAERS: 2 | US FAERS | |
| 185 | Erectile dysfunction | FAERS: 2 | US FAERS | |
| 186 | Escherichia infection | FAERS: 2 | US FAERS | |
| 187 | Fibromyalgia | FAERS: 2 | US FAERS | |
| 188 | Gastritis | FAERS: 2 | US FAERS | |
| 189 | General physical health deterioration | FAERS: 2 | US FAERS | |
| 190 | Gluten sensitivity | FAERS: 2 | US FAERS | |
| 191 | Hunger | FAERS: 2 | US FAERS | |
| 192 | Hypertensive crisis | FAERS: 2 | US FAERS | |
| 193 | Initial insomnia | FAERS: 2 | US FAERS | |
| 194 | Intentional dose omission | FAERS: 2 | US FAERS | |
| 195 | Intentional product use issue | FAERS: 2 | US FAERS | |
| 196 | Intercepted drug dispensing error | FAERS: 2 | US FAERS | |
| 197 | Lactose Intolerance | FAERS: 2 | US FAERS | |
| 198 | Laryngitis | FAERS: 2 | US FAERS | |
| 199 | Limb injury | FAERS: 2 | US FAERS | |
| 200 | Lower respiratory tract infection | FAERS: 2 | US FAERS | |
| 201 | Mental impairment | FAERS: 2 | US FAERS | |
| 202 | Mental status changes | FAERS: 2 | US FAERS | |
| 203 | Middle insomnia | FAERS: 2 | US FAERS | |
| 204 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 205 | Overweight | FAERS: 2 | US FAERS | |
| 206 | Pancreatic carcinoma | FAERS: 2 | US FAERS | |
| 207 | Peripheral arterial occlusive disease | FAERS: 2 | US FAERS | |
| 208 | Photophobia | FAERS: 2 | US FAERS | |
| 209 | Product dispensing error | FAERS: 2 | US FAERS | |
| 210 | Product use complaint | FAERS: 2 | US FAERS | |
| 211 | Product use in unapproved indication | FAERS: 2 | US FAERS | |
| 212 | Productive Cough | FAERS: 2 | US FAERS | |
| 213 | Respiratory Depression | FAERS: 2 | US FAERS | |
| 214 | Restlessness | FAERS: 2 | US FAERS | |
| 215 | Sepsis | FAERS: 2 | US FAERS | |
| 216 | Sick Sinus Syndrome | FAERS: 2 | US FAERS | |
| 217 | Single functional kidney | FAERS: 2 | US FAERS | |
| 218 | Sinusitis | FAERS: 2 | US FAERS | |
| 219 | Sluggishness | FAERS: 2 | US FAERS | |
| 220 | Somnambulism | FAERS: 2 | US FAERS | |
| 221 | Tension | FAERS: 2 | US FAERS | |
| 222 | Therapy non-responder | FAERS: 2 | US FAERS | |
| 223 | jaundice | FAERS: 2 | US FAERS | |
| 224 | Accidental drug intake by child | FAERS: 1 | US FAERS | |
| 225 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 226 | Acidosis | FAERS: 1 | US FAERS | |
| 227 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 228 | Alcohol problem | FAERS: 1 | US FAERS | |
| 229 | Allergy to chemicals | FAERS: 1 | US FAERS | |
| 230 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 231 | Anhedonia | FAERS: 1 | US FAERS | |
| 232 | Anorexia | FAERS: 1 | US FAERS | |
| 233 | Anosmia | FAERS: 1 | US FAERS | |
| 234 | Aphasia | FAERS: 1 | US FAERS | |
| 235 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 236 | Arthropod bite | FAERS: 1 | US FAERS | |
| 237 | Arthropod sting | FAERS: 1 | US FAERS | |
| 238 | Ataxia | FAERS: 1 | US FAERS | |
| 239 | Atypical pneumonia | FAERS: 1 | US FAERS | |
| 240 | Autonomic nervous system imbalance | FAERS: 1 | US FAERS | |
| 241 | Bedridden | FAERS: 1 | US FAERS | |
| 242 | Bilirubinuria | FAERS: 1 | US FAERS | |
| 243 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 244 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 245 | Blood creatine phosphokinase MB increased | FAERS: 1 | US FAERS | |
| 246 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 247 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 248 | Blood insulin decreased | FAERS: 1 | US FAERS | |
| 249 | Blood pressure difference of extremities | FAERS: 1 | US FAERS | |
| 250 | Blood pressure immeasurable | FAERS: 1 | US FAERS | |
| 251 | Blood sodium abnormal | FAERS: 1 | US FAERS | |
| 252 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 253 | Blood sodium increased | FAERS: 1 | US FAERS | |
| 254 | Blood testosterone decreased | FAERS: 1 | US FAERS | |
| 255 | Brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 256 | Breakthrough Pain | FAERS: 1 | US FAERS | |
| 257 | Bruxism | FAERS: 1 | US FAERS | |
| 258 | Carotid aneurysm rupture | FAERS: 1 | US FAERS | |
| 259 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 260 | Cellulitis | FAERS: 1 | US FAERS | |
| 261 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 262 | Chemotherapy | FAERS: 1 | US FAERS | |
| 263 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 264 | Coma scale abnormal | FAERS: 1 | US FAERS | |
| 265 | Crying | FAERS: 1 | US FAERS | |
| 266 | Cyanosis | FAERS: 1 | US FAERS | |
| 267 | Decorticate posture | FAERS: 1 | US FAERS | |
| 268 | Delirium | FAERS: 1 | US FAERS | |
| 269 | Dermatitis Herpetiformis | FAERS: 1 | US FAERS | |
| 270 | Device dislocation | FAERS: 1 | US FAERS | |
| 271 | Device related infection | FAERS: 1 | US FAERS | |
| 272 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 273 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 274 | Drug abuse | FAERS: 1 | US FAERS | |
| 275 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 276 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 277 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 278 | Drug toxicity | FAERS: 1 | US FAERS | |
| 279 | Dysarthria | FAERS: 1 | US FAERS | |
| 280 | Ear congestion | FAERS: 1 | US FAERS | |
| 281 | Eczema | FAERS: 1 | US FAERS | |
| 282 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 283 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 284 | Electromyogram abnormal | FAERS: 1 | US FAERS | |
| 285 | Embolic stroke | FAERS: 1 | US FAERS | |
| 286 | Encephalitis | FAERS: 1 | US FAERS | |
| 287 | Endometriosis | FAERS: 1 | US FAERS | |
| 288 | Eosinophilic granulomatosis with polyangiitis | FAERS: 1 | US FAERS | |
| 289 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 290 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 291 | Erythropsia | FAERS: 1 | US FAERS | |
| 292 | Excessive eye blinking | FAERS: 1 | US FAERS | |
| 293 | Exfoliative rash | FAERS: 1 | US FAERS | |
| 294 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 295 | External ear pain | FAERS: 1 | US FAERS | |
| 296 | Extra dose administered | FAERS: 1 | US FAERS | |
| 297 | Eye symptom | FAERS: 1 | US FAERS | |
| 298 | Eyelid skin dryness | FAERS: 1 | US FAERS | |
| 299 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 300 | Femoral artery occlusion | FAERS: 1 | US FAERS | |
| 301 | Food Allergy | FAERS: 1 | US FAERS | |
| 302 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 303 | Gastrointestinal hypomotility | FAERS: 1 | US FAERS | |
| 304 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 305 | Hemiparesis | FAERS: 1 | US FAERS | |
| 306 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 307 | Hernia | FAERS: 1 | US FAERS | |
| 308 | Hypersomnia | FAERS: 1 | US FAERS | |
| 309 | Hypogeusia | FAERS: 1 | US FAERS | |
| 310 | Hypokinesia | FAERS: 1 | US FAERS | |
| 311 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 312 | Hypoventilation | FAERS: 1 | US FAERS | |
| 313 | Hysterectomy | FAERS: 1 | US FAERS | |
| 314 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 315 | Incontinence | FAERS: 1 | US FAERS | |
| 316 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 317 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 318 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 319 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 320 | Inflammation | FAERS: 1 | US FAERS | |
| 321 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 322 | Intercepted drug prescribing error | FAERS: 1 | US FAERS | |
| 323 | Intermittent Claudication | FAERS: 1 | US FAERS | |
| 324 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 325 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 326 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 327 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 328 | Laceration | FAERS: 1 | US FAERS | |
| 329 | Left ventricular end-diastolic pressure increased | FAERS: 1 | US FAERS | |
| 330 | Leriche Syndrome | FAERS: 1 | US FAERS | |
| 331 | Ligament rupture | FAERS: 1 | US FAERS | |
| 332 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 333 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 334 | Mastectomy | FAERS: 1 | US FAERS | |
| 335 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 336 | Menopause | FAERS: 1 | US FAERS | |
| 337 | Monoplegia | FAERS: 1 | US FAERS | |
| 338 | Mood swings | FAERS: 1 | US FAERS | |
| 339 | Mouth swelling | FAERS: 1 | US FAERS | |
| 340 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 341 | Muscle Spasticity | FAERS: 1 | US FAERS | |
| 342 | Muscle tightness | FAERS: 1 | US FAERS | |
| 343 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 344 | Neonatal disorder | FAERS: 1 | US FAERS | |
| 345 | Nerve injury | FAERS: 1 | US FAERS | |
| 346 | Neuropsychiatric syndrome | FAERS: 1 | US FAERS | |
| 347 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 348 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 349 | Ocular icterus | FAERS: 1 | US FAERS | |
| 350 | Organic brain syndrome | FAERS: 1 | US FAERS | |
| 351 | Oropharyngeal plaque | FAERS: 1 | US FAERS | |
| 352 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 353 | Osteopenia | FAERS: 1 | US FAERS | |
| 354 | Otitis Externa | FAERS: 1 | US FAERS | |
| 355 | Pacemaker generated rhythm | FAERS: 1 | US FAERS | |
| 356 | Pain of skin | FAERS: 1 | US FAERS | |
| 357 | Pancreatitis | FAERS: 1 | US FAERS | |
| 358 | Pancytopenia | FAERS: 1 | US FAERS | |
| 359 | Paranoia | FAERS: 1 | US FAERS | |
| 360 | Peripheral artery stenosis | FAERS: 1 | US FAERS | |
| 361 | Peripheral venous disease | FAERS: 1 | US FAERS | |
| 362 | Physical assault | FAERS: 1 | US FAERS | |
| 363 | Pneumonitis | FAERS: 1 | US FAERS | |
| 364 | Pneumothorax | FAERS: 1 | US FAERS | |
| 365 | Polyuria | FAERS: 1 | US FAERS | |
| 366 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 367 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 368 | Pre-existing condition improved | FAERS: 1 | US FAERS | |
| 369 | Procedural complication | FAERS: 1 | US FAERS | |
| 370 | Product coating issue | FAERS: 1 | US FAERS | |
| 371 | Product container issue | FAERS: 1 | US FAERS | |
| 372 | Product counterfeit | FAERS: 1 | US FAERS | |
| 373 | Product label issue | FAERS: 1 | US FAERS | |
| 374 | Product lot number issue | FAERS: 1 | US FAERS | |
| 375 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 376 | Product packaging issue | FAERS: 1 | US FAERS | |
| 377 | Product physical issue | FAERS: 1 | US FAERS | |
| 378 | Product prescribing error | FAERS: 1 | US FAERS | |
| 379 | Product residue present | FAERS: 1 | US FAERS | |
| 380 | Product shape issue | FAERS: 1 | US FAERS | |
| 381 | Product size issue | FAERS: 1 | US FAERS | |
| 382 | Product storage error | FAERS: 1 | US FAERS | |
| 383 | Product supply issue | FAERS: 1 | US FAERS | |
| 384 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 385 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 386 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 387 | Renal abscess | FAERS: 1 | US FAERS | |
| 388 | Renal cyst | FAERS: 1 | US FAERS | |
| 389 | Renal pain | FAERS: 1 | US FAERS | |
| 390 | Respiratory Paralysis | FAERS: 1 | US FAERS | |
| 391 | Respiratory distress | FAERS: 1 | US FAERS | |
| 392 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 393 | Retinal Degeneration | FAERS: 1 | US FAERS | |
| 394 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 395 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 396 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 397 | Sarcoidosis | FAERS: 1 | US FAERS | |
| 398 | Screaming | FAERS: 1 | US FAERS | |
| 399 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 400 | Shoulder Pain | FAERS: 1 | US FAERS | |
| 401 | Sinus headache | FAERS: 1 | US FAERS | |
| 402 | Skin laceration | FAERS: 1 | US FAERS | |
| 403 | Skin reaction | FAERS: 1 | US FAERS | |
| 404 | Sleep disorder due to a general medical condition | FAERS: 1 | US FAERS | |
| 405 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 406 | Sunburn | FAERS: 1 | US FAERS | |
| 407 | Symptom recurrence | FAERS: 1 | US FAERS | |
| 408 | Tablet issue | FAERS: 1 | US FAERS | |
| 409 | Tablet physical issue | FAERS: 1 | US FAERS | |
| 410 | Terminal state | FAERS: 1 | US FAERS | |
| 411 | Therapeutic agent-diagnostic test interaction | FAERS: 1 | US FAERS | |
| 412 | Therapeutic product contamination | FAERS: 1 | US FAERS | |
| 413 | Therapeutic product effect decreased | FAERS: 1 | US FAERS | |
| 414 | Therapeutic product effective for unapproved indication | FAERS: 1 | US FAERS | |
| 415 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 416 | Therapy cessation | FAERS: 1 | US FAERS | |
| 417 | Therapy change | FAERS: 1 | US FAERS | |
| 418 | Therapy regimen changed | FAERS: 1 | US FAERS | |
| 419 | Thermal burn | FAERS: 1 | US FAERS | |
| 420 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 421 | Toothache | FAERS: 1 | US FAERS | |
| 422 | Transcription medication error | FAERS: 1 | US FAERS | |
| 423 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 424 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 425 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 426 | Uterine spasm | FAERS: 1 | US FAERS | |
| 427 | Vascular stenosis | FAERS: 1 | US FAERS | |
| 428 | Vascular stent occlusion | FAERS: 1 | US FAERS | |
| 429 | Venous Insufficiency | FAERS: 1 | US FAERS | |
| 430 | Visual disturbance | FAERS: 1 | US FAERS | |
| 431 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 432 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 433 | Vulvovaginal dryness | FAERS: 1 | US FAERS | |
| 434 | Vulvovaginal pruritus | FAERS: 1 | US FAERS | |
| 435 | Withdrawal hypertension | FAERS: 1 | US FAERS | |
| 436 | Wrong product administered | FAERS: 1 | US FAERS | |
| 437 | heart rate | FAERS: 1 | US FAERS | |
| 438 | kyphosis | FAERS: 1 | US FAERS | |
| 439 | nervous system disorder | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.