Insulin
(PBGKTOXHQIOBKM-FHFVDXKLSA-N)
Structure
- SMILES
- NCCCC[C@@H](C(=O)N[C@H](C(=O)O)[C@H](O)C)NC(=O)[C@@H]1CCCN1C(=O)[C@H]([C@H](O)C)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@@H](NC(=O)CNC(=O)[C@@H]1CSSC[C@H](NC(=O)[C@H](Cc2ccc(cc2)O)NC(=O)[C@H](CC(=O)N)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCC(=O)N)NC(=O)[C@H](Cc2ccc(cc2)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H]2CSSC[C@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](C(C)C)NC(=O)[C@H]([C@H](CC)C)NC(=O)CN)CCC(=O)O)CCC(=O)N)C(=O)N[C@@H](CSSC[C@@H](C(=O)NCC(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N1)C(C)C)CC(C)C)Cc1ccc(cc1)O)CC(C)C)C)CCC(=O)O)C(C)C)CC(C)C)Cc1c[nH]cn1)CO)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](C(C)C)NC(=O)[C@H](Cc1ccccc1)N)CC(=O)N)CCC(=O)N)Cc1c[nH]cn1)CC(C)C)C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N2)[C@H](CC)C)CO)[C@H](O)C)C(=O)N[C@H](C(=O)O)CC(=O)N)CCC(=O)O)CCCNC(=N)N)Cc1ccccc1)Cc1ccc(cc1)O
- Molecular Formula:
- C257H383N65O77S6
- Molecular Weight:
- 5807.570
- Log P:
- 5.2078
- Hydrogen Bond Acceptor:
- 146
- Hydrogen Bond Donor:
- 78
- TPSA:
- 2450.87
- CAS Number(s):
- N/A
Synonym(s)
1.
Insulin
2.
Iletin
3.
Insulin A Chain
4.
Insulin B Chain
5.
Insulin, Regular
6.
Novolin
7.
Sodium Insulin
8.
Soluble Insulin
9.
Chain, Insulin B
10.
Insulin, Sodium
11.
Insulin, Soluble
12.
Regular Insulin
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Blood glucose increased | FAERS: 734 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 2 | Incorrect dose administered | FAERS: 229 | US FAERS | |
| 3 | Blood glucose decreased | FAERS: 194 | US FAERS | |
| 4 | Drug ineffective | FAERS: 155 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Visual Impairment | FAERS: 129 | US FAERS | |
| 6 | Drug dose omission | FAERS: 113 | US FAERS | |
| 7 | Malaise | FAERS: 93 | US FAERS | |
| 8 | Injection site pain | FAERS: 86 | US FAERS | |
| 9 | Pharmaceutical product complaint | FAERS: 84 | US FAERS | |
| 10 | Cataract | FAERS: 83 | US FAERS | |
| 11 | Cerebrovascular accident | FAERS: 82 | US FAERS | |
| 12 | Blindness | FAERS: 68 | US FAERS | |
| 13 | Blood glucose abnormal | FAERS: 68 | US FAERS | |
| 14 | Dizziness | FAERS: 61 | US FAERS | |
| 15 | Feeling abnormal | FAERS: 59 | US FAERS | |
| 16 | Myocardial Infarction | FAERS: 58 | US FAERS | |
| 17 | Incorrect product storage | FAERS: 54 | US FAERS | |
| 18 | Blood glucose fluctuation | FAERS: 46 | US FAERS | |
| 19 | Asthenia | FAERS: 45 | US FAERS | |
| 20 | Weight decreased | FAERS: 45 | US FAERS | |
| 21 | Memory impairment | FAERS: 41 | US FAERS | |
| 22 | Wrong technique in product usage process | FAERS: 39 | US FAERS | |
| 23 | Medication Error | FAERS: 38 | US FAERS | |
| 24 | Poor quality drug administered | FAERS: 35 | US FAERS | |
| 25 | Injection site bruising | FAERS: 34 | US FAERS | |
| 26 | Tremor | FAERS: 34 | US FAERS | |
| 27 | Diabetes mellitus inadequate control | FAERS: 32 | US FAERS | |
| 28 | Fatigue | FAERS: 32 | US FAERS | |
| 29 | Nausea | FAERS: 31 | US FAERS | |
| 30 | Vomiting | FAERS: 30 | US FAERS | |
| 31 | Headache | FAERS: 27 | US FAERS | |
| 32 | Pain | FAERS: 27 | US FAERS | |
| 33 | Arthritis | FAERS: 26 | US FAERS | |
| 34 | Drug dispensing error | FAERS: 26 | US FAERS | |
| 35 | Pneumonia | FAERS: 25 | US FAERS | |
| 36 | Diabetic Ketoacidosis | FAERS: 24 | US FAERS | |
| 37 | Pruritus | FAERS: 23 | US FAERS | |
| 38 | Macular degeneration | FAERS: 22 | US FAERS | |
| 39 | Anxiety | FAERS: 21 | US FAERS | |
| 40 | Expired product administered | FAERS: 20 | US FAERS | |
| 41 | Peripheral swelling | FAERS: 19 | US FAERS | |
| 42 | Stress | FAERS: 19 | US FAERS | |
| 43 | Glaucoma | FAERS: 17 | US FAERS | |
| 44 | Nasopharyngitis | FAERS: 17 | US FAERS | |
| 45 | Cerebral Infarction | FAERS: 16 | US FAERS | |
| 46 | Injury associated with device | FAERS: 16 | US FAERS | |
| 47 | Intentional product misuse | FAERS: 15 | US FAERS | |
| 48 | Accidental underdose | FAERS: 14 | US FAERS | |
| 49 | Arthralgia | FAERS: 14 | US FAERS | |
| 50 | Drug exposure during pregnancy | FAERS: 14 | US FAERS | |
| 51 | Hypersensitivity | FAERS: 14 | US FAERS | |
| 52 | Nervousness | FAERS: 14 | US FAERS | |
| 53 | Visual disturbance | FAERS: 14 | US FAERS | |
| 54 | Cardiac Arrest | FAERS: 13 | US FAERS | |
| 55 | Chest Pain | FAERS: 13 | US FAERS | |
| 56 | Deafness | FAERS: 13 | US FAERS | |
| 57 | Influenza | FAERS: 13 | US FAERS | |
| 58 | Dementia | FAERS: 12 | US FAERS | |
| 59 | Discomfort | FAERS: 12 | US FAERS | |
| 60 | Incorrect drug administration duration | FAERS: 12 | US FAERS | |
| 61 | Product dose omission | FAERS: 12 | US FAERS | |
| 62 | Product storage error | FAERS: 12 | US FAERS | |
| 63 | Diabetic Retinopathy | FAERS: 11 | US FAERS | |
| 64 | Maternal exposure during pregnancy | FAERS: 11 | US FAERS | |
| 65 | Palpitations | FAERS: 11 | US FAERS | |
| 66 | Retinal Detachment | FAERS: 11 | US FAERS | |
| 67 | Somnolence | FAERS: 11 | US FAERS | |
| 68 | Abdominal discomfort | FAERS: 10 | US FAERS | |
| 69 | Back Pain | FAERS: 10 | US FAERS | |
| 70 | Chest discomfort | FAERS: 10 | US FAERS | |
| 71 | Infection | FAERS: 10 | US FAERS | |
| 72 | Limb injury | FAERS: 10 | US FAERS | |
| 73 | Urticaria | FAERS: 10 | US FAERS | |
| 74 | Abasia | FAERS: 9 | US FAERS | |
| 75 | Coronary Artery Disease | FAERS: 9 | US FAERS | |
| 76 | Dehydration | FAERS: 9 | US FAERS | |
| 77 | Product quality issue | FAERS: 9 | US FAERS | |
| 78 | Syncope | FAERS: 9 | US FAERS | |
| 79 | Amnesia | FAERS: 8 | US FAERS | |
| 80 | Burning sensation | FAERS: 8 | US FAERS | |
| 81 | Diabetes Mellitus | FAERS: 8 | US FAERS | |
| 82 | Gangrene | FAERS: 8 | US FAERS | |
| 83 | General physical health deterioration | FAERS: 8 | US FAERS | |
| 84 | Inappropriate schedule of drug administration | FAERS: 8 | US FAERS | |
| 85 | Suicide attempt | FAERS: 8 | US FAERS | |
| 86 | Wrong drug administered | FAERS: 8 | US FAERS | |
| 87 | Accidental exposure to product | FAERS: 7 | US FAERS | |
| 88 | Arthropathy | FAERS: 7 | US FAERS | |
| 89 | Bronchitis | FAERS: 7 | US FAERS | |
| 90 | Erythema | FAERS: 7 | US FAERS | |
| 91 | Injection site erythema | FAERS: 7 | US FAERS | |
| 92 | Injection site mass | FAERS: 7 | US FAERS | |
| 93 | Joint swelling | FAERS: 7 | US FAERS | |
| 94 | Ketoacidosis | FAERS: 7 | US FAERS | |
| 95 | Medical device complication | FAERS: 7 | US FAERS | |
| 96 | Overdose | FAERS: 7 | US FAERS | |
| 97 | Thrombosis | FAERS: 7 | US FAERS | |
| 98 | Wrong technique in drug usage process | FAERS: 7 | US FAERS | |
| 99 | Back disorder | FAERS: 6 | US FAERS | |
| 100 | Carpal Tunnel Syndrome | FAERS: 6 | US FAERS | |
| 101 | Chills | FAERS: 6 | US FAERS | |
| 102 | Disorientation | FAERS: 6 | US FAERS | |
| 103 | Extra dose administered | FAERS: 6 | US FAERS | |
| 104 | Eye laser surgery | FAERS: 6 | US FAERS | |
| 105 | Feeling Cold | FAERS: 6 | US FAERS | |
| 106 | Hunger | FAERS: 6 | US FAERS | |
| 107 | Mental impairment | FAERS: 6 | US FAERS | |
| 108 | Nerve injury | FAERS: 6 | US FAERS | |
| 109 | No adverse event | FAERS: 6 | US FAERS | |
| 110 | Skin Ulcer | FAERS: 6 | US FAERS | |
| 111 | Urinary tract infection | FAERS: 6 | US FAERS | |
| 112 | Alopecia | FAERS: 5 | US FAERS | |
| 113 | Ankle Fracture | FAERS: 5 | US FAERS | |
| 114 | Asthma | FAERS: 5 | US FAERS | |
| 115 | Completed Suicide | FAERS: 5 | US FAERS | |
| 116 | Device Failure | FAERS: 5 | US FAERS | |
| 117 | Diabetic Foot | FAERS: 5 | US FAERS | |
| 118 | Dry skin | FAERS: 5 | US FAERS | |
| 119 | Dyspepsia | FAERS: 5 | US FAERS | |
| 120 | Dysphonia | FAERS: 5 | US FAERS | |
| 121 | Frustration | FAERS: 5 | US FAERS | |
| 122 | Gout | FAERS: 5 | US FAERS | |
| 123 | Hypotension | FAERS: 5 | US FAERS | |
| 124 | Injection site abscess | FAERS: 5 | US FAERS | |
| 125 | Injection site injury | FAERS: 5 | US FAERS | |
| 126 | Injection site nodule | FAERS: 5 | US FAERS | |
| 127 | Insulin Resistance | FAERS: 5 | US FAERS | |
| 128 | Joint injury | FAERS: 5 | US FAERS | |
| 129 | Laceration | FAERS: 5 | US FAERS | |
| 130 | Lethargy | FAERS: 5 | US FAERS | |
| 131 | Limb discomfort | FAERS: 5 | US FAERS | |
| 132 | Multiple Sclerosis | FAERS: 5 | US FAERS | |
| 133 | Myalgia | FAERS: 5 | US FAERS | |
| 134 | Obesity | FAERS: 5 | US FAERS | |
| 135 | Pancreatitis | FAERS: 5 | US FAERS | |
| 136 | Post procedural complication | FAERS: 5 | US FAERS | |
| 137 | Procedural complication | FAERS: 5 | US FAERS | |
| 138 | Product tampering | FAERS: 5 | US FAERS | |
| 139 | Thirst | FAERS: 5 | US FAERS | |
| 140 | Throat irritation | FAERS: 5 | US FAERS | |
| 141 | Unevaluable event | FAERS: 5 | US FAERS | |
| 142 | Acidosis | FAERS: 4 | US FAERS | |
| 143 | Altered state of consciousness | FAERS: 4 | US FAERS | |
| 144 | Anger | FAERS: 4 | US FAERS | |
| 145 | Angina Pectoris | FAERS: 4 | US FAERS | |
| 146 | Angioedema | FAERS: 4 | US FAERS | |
| 147 | Arteriosclerosis | FAERS: 4 | US FAERS | |
| 148 | Blood cholesterol increased | FAERS: 4 | US FAERS | |
| 149 | Cholecystitis | FAERS: 4 | US FAERS | |
| 150 | Cold sweat | FAERS: 4 | US FAERS | |
| 151 | Constipation | FAERS: 4 | US FAERS | |
| 152 | Depressed Level of Consciousness | FAERS: 4 | US FAERS | |
| 153 | Flushing | FAERS: 4 | US FAERS | |
| 154 | Gastroenteritis | FAERS: 4 | US FAERS | |
| 155 | Hemiparesis | FAERS: 4 | US FAERS | |
| 156 | Hernia | FAERS: 4 | US FAERS | |
| 157 | Incorrect dose administered by device | FAERS: 4 | US FAERS | |
| 158 | Injection Site Reaction | FAERS: 4 | US FAERS | |
| 159 | Injection site discomfort | FAERS: 4 | US FAERS | |
| 160 | Intercepted product selection error | FAERS: 4 | US FAERS | |
| 161 | Intervertebral disc disorder | FAERS: 4 | US FAERS | |
| 162 | Intestinal Obstruction | FAERS: 4 | US FAERS | |
| 163 | Musculoskeletal stiffness | FAERS: 4 | US FAERS | |
| 164 | Nephrolithiasis | FAERS: 4 | US FAERS | |
| 165 | Neuropathy | FAERS: 4 | US FAERS | |
| 166 | Overweight | FAERS: 4 | US FAERS | |
| 167 | Pallor | FAERS: 4 | US FAERS | |
| 168 | Polyuria | FAERS: 4 | US FAERS | |
| 169 | Poor peripheral circulation | FAERS: 4 | US FAERS | |
| 170 | Retinal scar | FAERS: 4 | US FAERS | |
| 171 | Screaming | FAERS: 4 | US FAERS | |
| 172 | Sinusitis | FAERS: 4 | US FAERS | |
| 173 | Spinal column stenosis | FAERS: 4 | US FAERS | |
| 174 | Swelling | FAERS: 4 | US FAERS | |
| 175 | Ulcer | FAERS: 4 | US FAERS | |
| 176 | Agitation | FAERS: 3 | US FAERS | |
| 177 | Arthropod bite | FAERS: 3 | US FAERS | |
| 178 | Bedridden | FAERS: 3 | US FAERS | |
| 179 | Blood potassium decreased | FAERS: 3 | US FAERS | |
| 180 | Bronchospasm | FAERS: 3 | US FAERS | |
| 181 | Cataract operation | FAERS: 3 | US FAERS | |
| 182 | Cellulitis | FAERS: 3 | US FAERS | |
| 183 | Circumstance or information capable of leading to medication error | FAERS: 3 | US FAERS | |
| 184 | Cyanosis | FAERS: 3 | US FAERS | |
| 185 | Cystitis | FAERS: 3 | US FAERS | |
| 186 | Device leakage | FAERS: 3 | US FAERS | |
| 187 | Device malfunction | FAERS: 3 | US FAERS | |
| 188 | Drug prescribing error | FAERS: 3 | US FAERS | |
| 189 | Dysgeusia | FAERS: 3 | US FAERS | |
| 190 | Emotional distress | FAERS: 3 | US FAERS | |
| 191 | Expired drug administered | FAERS: 3 | US FAERS | |
| 192 | Eye pain | FAERS: 3 | US FAERS | |
| 193 | Hypersomnia | FAERS: 3 | US FAERS | |
| 194 | Hypophagia | FAERS: 3 | US FAERS | |
| 195 | Incorrect product administration duration | FAERS: 3 | US FAERS | |
| 196 | Incorrect product formulation administered | FAERS: 3 | US FAERS | |
| 197 | Inflammation | FAERS: 3 | US FAERS | |
| 198 | Injection site pruritus | FAERS: 3 | US FAERS | |
| 199 | Injection site vesicles | FAERS: 3 | US FAERS | |
| 200 | Intentional product use issue | FAERS: 3 | US FAERS | |
| 201 | Intercepted drug dispensing error | FAERS: 3 | US FAERS | |
| 202 | Myopia | FAERS: 3 | US FAERS | |
| 203 | Needle issue | FAERS: 3 | US FAERS | |
| 204 | Oropharyngeal pain | FAERS: 3 | US FAERS | |
| 205 | Polydipsia | FAERS: 3 | US FAERS | |
| 206 | Post procedural infection | FAERS: 3 | US FAERS | |
| 207 | Product container issue | FAERS: 3 | US FAERS | |
| 208 | Product physical issue | FAERS: 3 | US FAERS | |
| 209 | Productive Cough | FAERS: 3 | US FAERS | |
| 210 | Protein urine present | FAERS: 3 | US FAERS | |
| 211 | Psoriasis | FAERS: 3 | US FAERS | |
| 212 | Renal pain | FAERS: 3 | US FAERS | |
| 213 | Schizophrenia | FAERS: 3 | US FAERS | |
| 214 | Therapeutic response delayed | FAERS: 3 | US FAERS | |
| 215 | Vascular bypass graft | FAERS: 3 | US FAERS | |
| 216 | Ventricular Fibrillation | FAERS: 3 | US FAERS | |
| 217 | Ventricular Flutter | FAERS: 3 | US FAERS | |
| 218 | Vertigo | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 219 | Walking aid user | FAERS: 3 | US FAERS | |
| 220 | nervous system disorder | FAERS: 3 | US FAERS | |
| 221 | Abdominal Pain | FAERS: 2 | US FAERS | |
| 222 | Abscess | FAERS: 2 | US FAERS | |
| 223 | Accidental overdose | FAERS: 2 | US FAERS | |
| 224 | Acne | FAERS: 2 | US FAERS | |
| 225 | Acute Coronary Syndrome | FAERS: 2 | US FAERS | |
| 226 | Adverse event | FAERS: 2 | US FAERS | |
| 227 | Amputation | FAERS: 2 | US FAERS | |
| 228 | Anaphylactic shock | FAERS: 2 | US FAERS | |
| 229 | Aphasia | FAERS: 2 | US FAERS | |
| 230 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 231 | Autoimmune hepatitis | FAERS: 2 | US FAERS | |
| 232 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 233 | Blood triglycerides increased | FAERS: 2 | US FAERS | |
| 234 | Cardiomegaly | FAERS: 2 | US FAERS | |
| 235 | Carotid artery occlusion | FAERS: 2 | US FAERS | |
| 236 | Chemotherapy | FAERS: 2 | US FAERS | |
| 237 | Choking | FAERS: 2 | US FAERS | |
| 238 | Cholelithiasis | FAERS: 2 | US FAERS | |
| 239 | Crying | FAERS: 2 | US FAERS | |
| 240 | Delirium | FAERS: 2 | US FAERS | |
| 241 | Depressed mood | FAERS: 2 | US FAERS | |
| 242 | Device breakage | FAERS: 2 | US FAERS | |
| 243 | Diabetic ulcer | FAERS: 2 | US FAERS | |
| 244 | Diplopia | FAERS: 2 | US FAERS | |
| 245 | Disease recurrence | FAERS: 2 | US FAERS | |
| 246 | Drug Dependence | FAERS: 2 | US FAERS | |
| 247 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 248 | Dysarthria | FAERS: 2 | US FAERS | |
| 249 | Dysgraphia | FAERS: 2 | US FAERS | |
| 250 | Dysuria | FAERS: 2 | US FAERS | |
| 251 | Electrolyte imbalance | FAERS: 2 | US FAERS | |
| 252 | Emotional disorder | FAERS: 2 | US FAERS | |
| 253 | Enzyme abnormality | FAERS: 2 | US FAERS | |
| 254 | Excoriation | FAERS: 2 | US FAERS | |
| 255 | Exposure via direct contact | FAERS: 2 | US FAERS | |
| 256 | Eye Infection | FAERS: 2 | US FAERS | |
| 257 | Eye irritation | FAERS: 2 | US FAERS | |
| 258 | Feeling jittery | FAERS: 2 | US FAERS | |
| 259 | Fibromyalgia | FAERS: 2 | US FAERS | |
| 260 | Flatulence | FAERS: 2 | US FAERS | |
| 261 | Food Allergy | FAERS: 2 | US FAERS | |
| 262 | Gastritis | FAERS: 2 | US FAERS | |
| 263 | Grip strength decreased | FAERS: 2 | US FAERS | |
| 264 | Head discomfort | FAERS: 2 | US FAERS | |
| 265 | Hepatic cancer metastatic | FAERS: 2 | US FAERS | |
| 266 | Hepatitis C | FAERS: 2 | US FAERS | |
| 267 | Hyperkeratosis | FAERS: 2 | US FAERS | |
| 268 | Hypokinesia | FAERS: 2 | US FAERS | |
| 269 | Impaired gastric emptying | FAERS: 2 | US FAERS | |
| 270 | Impatience | FAERS: 2 | US FAERS | |
| 271 | Incorrect drug dosage form administered | FAERS: 2 | US FAERS | |
| 272 | Incorrect storage of drug | FAERS: 2 | US FAERS | |
| 273 | Injection site scar | FAERS: 2 | US FAERS | |
| 274 | Injection site urticaria | FAERS: 2 | US FAERS | |
| 275 | Latex allergy | FAERS: 2 | US FAERS | |
| 276 | Low density lipoprotein increased | FAERS: 2 | US FAERS | |
| 277 | Mastectomy | FAERS: 2 | US FAERS | |
| 278 | Monoplegia | FAERS: 2 | US FAERS | |
| 279 | Multiple Myeloma | FAERS: 2 | US FAERS | |
| 280 | Muscle tightness | FAERS: 2 | US FAERS | |
| 281 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 282 | Nocturia | FAERS: 2 | US FAERS | |
| 283 | Ocular discomfort | FAERS: 2 | US FAERS | |
| 284 | Osteoporosis | FAERS: 2 | US FAERS | |
| 285 | Oxygen supplementation | FAERS: 2 | US FAERS | |
| 286 | Pancreatic carcinoma | FAERS: 2 | US FAERS | |
| 287 | Pericardial effusion | FAERS: 2 | US FAERS | |
| 288 | Postoperative infection | FAERS: 2 | US FAERS | |
| 289 | Pre-Eclampsia | FAERS: 2 | US FAERS | |
| 290 | Presyncope | FAERS: 2 | US FAERS | |
| 291 | Product counterfeit | FAERS: 2 | US FAERS | |
| 292 | Product dispensing error | FAERS: 2 | US FAERS | |
| 293 | Product label issue | FAERS: 2 | US FAERS | |
| 294 | Product packaging quantity issue | FAERS: 2 | US FAERS | |
| 295 | Psychiatric evaluation | FAERS: 2 | US FAERS | |
| 296 | Purulence | FAERS: 2 | US FAERS | |
| 297 | Reaction to preservatives | FAERS: 2 | US FAERS | |
| 298 | Respiratory Failure | FAERS: 2 | US FAERS | |
| 299 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 300 | Rheumatoid Arthritis | FAERS: 2 | US FAERS | |
| 301 | Senile dementia | FAERS: 2 | US FAERS | |
| 302 | Shock | FAERS: 2 | US FAERS | |
| 303 | Skin irritation | FAERS: 2 | US FAERS | |
| 304 | Sleep disorder due to a general medical condition | FAERS: 2 | US FAERS | |
| 305 | Spinal fusion surgery | FAERS: 2 | US FAERS | |
| 306 | Stomatitis | FAERS: 2 | US FAERS | |
| 307 | Tonic clonic movements | FAERS: 2 | US FAERS | |
| 308 | Tooth Infection | FAERS: 2 | US FAERS | |
| 309 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 310 | Urinary Incontinence | FAERS: 2 | US FAERS | |
| 311 | Urine output increased | FAERS: 2 | US FAERS | |
| 312 | Vitreous floaters | FAERS: 2 | US FAERS | |
| 313 | Wheezing | FAERS: 2 | US FAERS | |
| 314 | Wrong patient received medication | FAERS: 2 | US FAERS | |
| 315 | Abdominal adhesions | FAERS: 1 | US FAERS | |
| 316 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 317 | Abnormal weight gain | FAERS: 1 | US FAERS | |
| 318 | Accidental exposure | FAERS: 1 | US FAERS | |
| 319 | Acoustic Neuroma | FAERS: 1 | US FAERS | |
| 320 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 321 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 322 | Alcohol rehabilitation | FAERS: 1 | US FAERS | |
| 323 | Aneurysm | FAERS: 1 | US FAERS | |
| 324 | Anti-insulin antibody increased | FAERS: 1 | US FAERS | |
| 325 | Anti-insulin antibody positive | FAERS: 1 | US FAERS | |
| 326 | Antisocial Personality Disorder | FAERS: 1 | US FAERS | |
| 327 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 328 | Apparent death | FAERS: 1 | US FAERS | |
| 329 | Appendicitis | FAERS: 1 | US FAERS | |
| 330 | Arterial Injury | FAERS: 1 | US FAERS | |
| 331 | Arteriosclerotic retinopathy | FAERS: 1 | US FAERS | |
| 332 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 333 | Atypical pneumonia | FAERS: 1 | US FAERS | |
| 334 | Aura | FAERS: 1 | US FAERS | |
| 335 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 336 | Bipolar I disorder | FAERS: 1 | US FAERS | |
| 337 | Blood blister | FAERS: 1 | US FAERS | |
| 338 | Blood potassium abnormal | FAERS: 1 | US FAERS | |
| 339 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 340 | Blood testosterone decreased | FAERS: 1 | US FAERS | |
| 341 | Blood urea abnormal | FAERS: 1 | US FAERS | |
| 342 | Body temperature fluctuation | FAERS: 1 | US FAERS | |
| 343 | Bone density decreased | FAERS: 1 | US FAERS | |
| 344 | Bradycardia | FAERS: 1 | US FAERS | |
| 345 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 346 | Brain Hypoxia | FAERS: 1 | US FAERS | |
| 347 | Breast infection | FAERS: 1 | US FAERS | |
| 348 | Carcinoma | FAERS: 1 | US FAERS | |
| 349 | Cardiovascular insufficiency | FAERS: 1 | US FAERS | |
| 350 | Cataract operation complication | FAERS: 1 | US FAERS | |
| 351 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 352 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 353 | Cerebral congestion | FAERS: 1 | US FAERS | |
| 354 | Cervix carcinoma | FAERS: 1 | US FAERS | |
| 355 | Choking sensation | FAERS: 1 | US FAERS | |
| 356 | Clostridium colitis | FAERS: 1 | US FAERS | |
| 357 | Counterfeit drug administered | FAERS: 1 | US FAERS | |
| 358 | Counterfeit product administered | FAERS: 1 | US FAERS | |
| 359 | Cyst | FAERS: 1 | US FAERS | |
| 360 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 361 | Dental caries | FAERS: 1 | US FAERS | |
| 362 | Dependence | FAERS: 1 | US FAERS | |
| 363 | Device dislocation | FAERS: 1 | US FAERS | |
| 364 | Device occlusion | FAERS: 1 | US FAERS | |
| 365 | Device related infection | FAERS: 1 | US FAERS | |
| 366 | Device use error | FAERS: 1 | US FAERS | |
| 367 | Diabetic Nephropathy | FAERS: 1 | US FAERS | |
| 368 | Diabetic glaucoma | FAERS: 1 | US FAERS | |
| 369 | Dissociation | FAERS: 1 | US FAERS | |
| 370 | Drug resistance | FAERS: 1 | US FAERS | |
| 371 | Drug screen positive | FAERS: 1 | US FAERS | |
| 372 | Ear discomfort | FAERS: 1 | US FAERS | |
| 373 | Eczema | FAERS: 1 | US FAERS | |
| 374 | Enuresis | FAERS: 1 | US FAERS | |
| 375 | Epilepsy | FAERS: 1 | US FAERS | |
| 376 | Epistaxis | FAERS: 1 | US FAERS | |
| 377 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 378 | Escherichia infection | FAERS: 1 | US FAERS | |
| 379 | Essential Tremor | FAERS: 1 | US FAERS | |
| 380 | Expired device used | FAERS: 1 | US FAERS | |
| 381 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 382 | Extremity necrosis | FAERS: 1 | US FAERS | |
| 383 | Eye excision | FAERS: 1 | US FAERS | |
| 384 | Eye laser scar | FAERS: 1 | US FAERS | |
| 385 | Eye operation complication | FAERS: 1 | US FAERS | |
| 386 | Eye ulcer | FAERS: 1 | US FAERS | |
| 387 | Eyelid irritation | FAERS: 1 | US FAERS | |
| 388 | Eyelid margin crusting | FAERS: 1 | US FAERS | |
| 389 | Facial paralysis | FAERS: 1 | US FAERS | |
| 390 | Fluid imbalance | FAERS: 1 | US FAERS | |
| 391 | Food Poisoning | FAERS: 1 | US FAERS | |
| 392 | Food craving | FAERS: 1 | US FAERS | |
| 393 | Foreign body trauma | FAERS: 1 | US FAERS | |
| 394 | Gait inability | FAERS: 1 | US FAERS | |
| 395 | Gastric Bypass | FAERS: 1 | US FAERS | |
| 396 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 397 | Gastrointestinal obstruction | FAERS: 1 | US FAERS | |
| 398 | Haematotoxicity | FAERS: 1 | US FAERS | |
| 399 | Hemiplegia | FAERS: 1 | US FAERS | |
| 400 | Hoarseness | FAERS: 1 | US FAERS | |
| 401 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 402 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 403 | Hypoventilation | FAERS: 1 | US FAERS | |
| 404 | Hypoxia | FAERS: 1 | US FAERS | |
| 405 | Hysterectomy | FAERS: 1 | US FAERS | |
| 406 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 407 | Illogical thinking | FAERS: 1 | US FAERS | |
| 408 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 409 | Implantable defibrillator insertion | FAERS: 1 | US FAERS | |
| 410 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 411 | Incoherent | FAERS: 1 | US FAERS | |
| 412 | Incontinence | FAERS: 1 | US FAERS | |
| 413 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 414 | Incorrect product dosage form administered | FAERS: 1 | US FAERS | |
| 415 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 416 | Induration | FAERS: 1 | US FAERS | |
| 417 | Infective spondylitis | FAERS: 1 | US FAERS | |
| 418 | Injection site burning | FAERS: 1 | US FAERS | |
| 419 | Injection site extravasation | FAERS: 1 | US FAERS | |
| 420 | Injection site hypersensitivity | FAERS: 1 | US FAERS | |
| 421 | Injection site hypertrophy | FAERS: 1 | US FAERS | |
| 422 | Injection site inflammation | FAERS: 1 | US FAERS | |
| 423 | Injection site irritation | FAERS: 1 | US FAERS | |
| 424 | Injection site laceration | FAERS: 1 | US FAERS | |
| 425 | Injection site pustule | FAERS: 1 | US FAERS | |
| 426 | Injection site scab | FAERS: 1 | US FAERS | |
| 427 | Injection site warmth | FAERS: 1 | US FAERS | |
| 428 | Insulin C-peptide decreased | FAERS: 1 | US FAERS | |
| 429 | Insulin autoimmune syndrome | FAERS: 1 | US FAERS | |
| 430 | Intellectual Disability | FAERS: 1 | US FAERS | |
| 431 | Intentional device misuse | FAERS: 1 | US FAERS | |
| 432 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 433 | Intercepted drug administration error | FAERS: 1 | US FAERS | |
| 434 | Intervertebral disc injury | FAERS: 1 | US FAERS | |
| 435 | Intestinal resection | FAERS: 1 | US FAERS | |
| 436 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 437 | Laryngitis | FAERS: 1 | US FAERS | |
| 438 | Lens dislocation | FAERS: 1 | US FAERS | |
| 439 | Ligament rupture | FAERS: 1 | US FAERS | |
| 440 | Liquid product physical issue | FAERS: 1 | US FAERS | |
| 441 | Loose tooth | FAERS: 1 | US FAERS | |
| 442 | Lung Abscess | FAERS: 1 | US FAERS | |
| 443 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 444 | Lymphocyte stimulation test positive | FAERS: 1 | US FAERS | |
| 445 | Malabsorption from injection site | FAERS: 1 | US FAERS | |
| 446 | Markedly reduced dietary intake | FAERS: 1 | US FAERS | |
| 447 | Mastication disorder | FAERS: 1 | US FAERS | |
| 448 | Mental status changes | FAERS: 1 | US FAERS | |
| 449 | Monoparesis | FAERS: 1 | US FAERS | |
| 450 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 451 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 452 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 453 | Mycobacterium chelonei infection | FAERS: 1 | US FAERS | |
| 454 | Mydriasis | FAERS: 1 | US FAERS | |
| 455 | Neck Pain | FAERS: 1 | US FAERS | |
| 456 | Neonatal respiratory failure | FAERS: 1 | US FAERS | |
| 457 | Neuralgia | FAERS: 1 | US FAERS | |
| 458 | Night sweats | FAERS: 1 | US FAERS | |
| 459 | No adverse effect | FAERS: 1 | US FAERS | |
| 460 | Obsessive-Compulsive Disorder | FAERS: 1 | US FAERS | |
| 461 | Onychoclasis | FAERS: 1 | US FAERS | |
| 462 | Open wound | FAERS: 1 | US FAERS | |
| 463 | Optic disc vascular disorder | FAERS: 1 | US FAERS | |
| 464 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 465 | Pancreatic Neoplasm | FAERS: 1 | US FAERS | |
| 466 | Papule | FAERS: 1 | US FAERS | |
| 467 | Paranasal sinus hypersecretion | FAERS: 1 | US FAERS | |
| 468 | Paraplegia | FAERS: 1 | US FAERS | |
| 469 | Phlebitis | FAERS: 1 | US FAERS | |
| 470 | Piloerection | FAERS: 1 | US FAERS | |
| 471 | Poisoning | FAERS: 1 | US FAERS | |
| 472 | Poliomyelitis | FAERS: 1 | US FAERS | |
| 473 | Polymyalgia Rheumatica | FAERS: 1 | US FAERS | |
| 474 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 475 | Post-traumatic pain | FAERS: 1 | US FAERS | |
| 476 | Postoperative adhesion | FAERS: 1 | US FAERS | |
| 477 | Pregnancy | FAERS: 1 | US FAERS | |
| 478 | Procedural vomiting | FAERS: 1 | US FAERS | |
| 479 | Product contamination microbial | FAERS: 1 | US FAERS | |
| 480 | Product contamination with body fluid | FAERS: 1 | US FAERS | |
| 481 | Proteinuria | FAERS: 1 | US FAERS | |
| 482 | Puerperal pyrexia | FAERS: 1 | US FAERS | |
| 483 | Pulmonary function test decreased | FAERS: 1 | US FAERS | |
| 484 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 485 | Purulent discharge | FAERS: 1 | US FAERS | |
| 486 | Quadruple vessel bypass graft | FAERS: 1 | US FAERS | |
| 487 | Renal abscess | FAERS: 1 | US FAERS | |
| 488 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 489 | Restlessness | FAERS: 1 | US FAERS | |
| 490 | Retching | FAERS: 1 | US FAERS | |
| 491 | Scab | FAERS: 1 | US FAERS | |
| 492 | Sciatica | FAERS: 1 | US FAERS | |
| 493 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 494 | Sepsis | FAERS: 1 | US FAERS | |
| 495 | Septic Shock | FAERS: 1 | US FAERS | |
| 496 | Shunt infection | FAERS: 1 | US FAERS | |
| 497 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 498 | Skin Papilloma | FAERS: 1 | US FAERS | |
| 499 | Skin graft infection | FAERS: 1 | US FAERS | |
| 500 | Skin lesion | FAERS: 1 | US FAERS | |
| 501 | Slow response to stimuli | FAERS: 1 | US FAERS | |
| 502 | Slow speech | FAERS: 1 | US FAERS | |
| 503 | Sluggishness | FAERS: 1 | US FAERS | |
| 504 | Sneezing | FAERS: 1 | US FAERS | |
| 505 | Spina Bifida | FAERS: 1 | US FAERS | |
| 506 | Splenomegaly | FAERS: 1 | US FAERS | |
| 507 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 508 | Staring | FAERS: 1 | US FAERS | |
| 509 | Starvation | FAERS: 1 | US FAERS | |
| 510 | Stillbirth | FAERS: 1 | US FAERS | |
| 511 | Subcutaneous Abscess | FAERS: 1 | US FAERS | |
| 512 | Sudden death | FAERS: 1 | US FAERS | |
| 513 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 514 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 515 | Synovial Cyst | FAERS: 1 | US FAERS | |
| 516 | Terminal state | FAERS: 1 | US FAERS | |
| 517 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 518 | Throat cancer | FAERS: 1 | US FAERS | |
| 519 | Thrombotic stroke | FAERS: 1 | US FAERS | |
| 520 | Tinnitus | FAERS: 1 | US FAERS | |
| 521 | Transient psychosis | FAERS: 1 | US FAERS | |
| 522 | Transitional cell carcinoma urethra | FAERS: 1 | US FAERS | |
| 523 | Transplant | FAERS: 1 | US FAERS | |
| 524 | Triple vessel bypass graft | FAERS: 1 | US FAERS | |
| 525 | Tympanic Membrane Perforation | FAERS: 1 | US FAERS | |
| 526 | Urinary bladder polyp | FAERS: 1 | US FAERS | |
| 527 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 528 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 529 | Vascular rupture | FAERS: 1 | US FAERS | |
| 530 | Vessel perforation | FAERS: 1 | US FAERS | |
| 531 | Vitrectomy | FAERS: 1 | US FAERS | |
| 532 | Wheelchair user | FAERS: 1 | US FAERS | |
| 533 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 534 | Wound infection staphylococcal | FAERS: 1 | US FAERS | |
| 535 | Wrong patient received product | FAERS: 1 | US FAERS | |
| 536 | Wrong product administered | FAERS: 1 | US FAERS | |
| 537 | angiogram | FAERS: 1 | US FAERS | |
| 538 | furuncle | FAERS: 1 | US FAERS | |
| 539 | jaundice | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.