trametinib
(LIRYPHYGHXZJBZ-UHFFFAOYSA-N)
Structure
- SMILES
- CC(=O)Nc1cccc(c1)n1c(=O)n(C2CC2)c(=O)c2c1c(C)c(=O)n(c2Nc1ccc(cc1F)I)C
- Type(s)
- Approved
- ATC code(s)
- L01XE25
- Molecular Formula:
- C26H23FIN5O4
- Molecular Weight:
- 615.395
- Log P:
- 4.0861
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 2
- TPSA:
- 107.13
- CAS Number(s):
- 871700-17-3
Synonym(s)
1.
trametinib
2.
GSK 1120212
3.
GSK-1120212
4.
GSK1120212
5.
JTP 74057
6.
JTP-74057
7.
JTP74057
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Product use in unapproved indication | FAERS: 76 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 2 | Nausea | FAERS: 48 Canada Vigilance: 1 | 25417902 | CTD SIDER Canada Vigilance US FAERS |
| 3 | Disease Progression | FAERS: 41 | SIDER US FAERS | |
| 4 | Malaise | FAERS: 40 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Malignant neoplasm progression | FAERS: 39 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 6 | Acne | FAERS: 38 | US FAERS | |
| 7 | Product use issue | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Vomiting | FAERS: 36 Canada Vigilance: 1 | 25417902 | CTD SIDER Canada Vigilance US FAERS |
| 9 | Drug ineffective | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 10 | Fatigue | FAERS: 32 Canada Vigilance: 1 | 25417902 | CTD SIDER Canada Vigilance US FAERS |
| 11 | Chills | FAERS: 25 | SIDER US FAERS | |
| 12 | Dermatitis acneiform | FAERS: 24 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 13 | Visual Impairment | FAERS: 23 | US FAERS | |
| 14 | Peripheral swelling | FAERS: 18 | US FAERS | |
| 15 | Pneumonia | FAERS: 18 | US FAERS | |
| 16 | Stomatitis | FAERS: 17 | SIDER US FAERS | |
| 17 | Incorrect dose administered | FAERS: 16 | US FAERS | |
| 18 | Erythema | FAERS: 15 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 19 | Pruritus | FAERS: 14 | SIDER US FAERS | |
| 20 | Alopecia | FAERS: 13 | US FAERS | |
| 21 | Arthralgia | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 22 | Dehydration | FAERS: 13 | SIDER US FAERS | |
| 23 | Dry skin | FAERS: 13 | SIDER US FAERS | |
| 24 | Headache | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 25 | Incorrect product storage | FAERS: 12 | US FAERS | |
| 26 | Epistaxis | FAERS: 11 | SIDER US FAERS | |
| 27 | Urinary tract infection | FAERS: 11 | SIDER US FAERS | |
| 28 | Abdominal Pain | FAERS: 10 | SIDER US FAERS | |
| 29 | Drug dose omission | FAERS: 10 | US FAERS | |
| 30 | Hypersensitivity | FAERS: 10 | US FAERS | |
| 31 | Pain | FAERS: 10 | US FAERS | |
| 32 | Skin lesion | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 33 | Ejection Fraction Decreased | FAERS: 8 | SIDER US FAERS | |
| 34 | Abdominal discomfort | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 35 | Myalgia | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 36 | Osteomyelitis | FAERS: 7 | US FAERS | |
| 37 | Therapy cessation | FAERS: 7 | US FAERS | |
| 38 | Thrombocytopenia | FAERS: 7 | SIDER US FAERS | |
| 39 | Tremor | FAERS: 7 | US FAERS | |
| 40 | Constipation | FAERS: 6 | SIDER US FAERS | |
| 41 | Folliculitis | FAERS: 6 | SIDER US FAERS | |
| 42 | Memory impairment | FAERS: 6 | US FAERS | |
| 43 | Pneumonitis | FAERS: 6 | US FAERS | |
| 44 | Skin Ulcer | FAERS: 6 | US FAERS | |
| 45 | Therapy change | FAERS: 6 | US FAERS | |
| 46 | Toxicity to various agents | FAERS: 6 | US FAERS | |
| 47 | Alanine Aminotransferase Increased | FAERS: 5 | SIDER US FAERS | |
| 48 | Asthenia | FAERS: 5 | SIDER US FAERS | |
| 49 | Blood creatine phosphokinase increased | FAERS: 5 | US FAERS | |
| 50 | Dermatitis | FAERS: 5 | SIDER US FAERS | |
| 51 | Diplopia | FAERS: 5 | US FAERS | |
| 52 | Dysgeusia | FAERS: 5 | SIDER US FAERS | |
| 53 | Hydrocephalus | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 54 | Hypotension | FAERS: 5 | US FAERS | |
| 55 | Hypoxia | FAERS: 5 | US FAERS | |
| 56 | Overdose | FAERS: 5 | US FAERS | |
| 57 | Rhabdomyolysis | FAERS: 5 | SIDER US FAERS | |
| 58 | Sepsis | FAERS: 5 | US FAERS | |
| 59 | Somnolence | FAERS: 5 | US FAERS | |
| 60 | Swelling | FAERS: 5 | US FAERS | |
| 61 | Urticaria | FAERS: 5 | US FAERS | |
| 62 | Wrong technique in product usage process | FAERS: 5 | US FAERS | |
| 63 | Accidental overdose | FAERS: 4 | US FAERS | |
| 64 | Amnesia | FAERS: 4 | US FAERS | |
| 65 | Chest Pain | FAERS: 4 | US FAERS | |
| 66 | Dizziness | FAERS: 4 | SIDER US FAERS | |
| 67 | Drug dispensing error | FAERS: 4 | US FAERS | |
| 68 | Eczema | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 69 | Febrile Neutropenia | FAERS: 4 | US FAERS | |
| 70 | Feeling abnormal | FAERS: 4 | US FAERS | |
| 71 | General physical health deterioration | FAERS: 4 | US FAERS | |
| 72 | Joint swelling | FAERS: 4 | US FAERS | |
| 73 | Musculoskeletal stiffness | FAERS: 4 | US FAERS | |
| 74 | Nail Infection | FAERS: 4 | US FAERS | |
| 75 | Nasopharyngitis | FAERS: 4 | US FAERS | |
| 76 | Nephrolithiasis | FAERS: 4 | US FAERS | |
| 77 | No adverse event | FAERS: 4 | US FAERS | |
| 78 | Pancreatic carcinoma | FAERS: 4 | US FAERS | |
| 79 | Product storage error | FAERS: 4 | US FAERS | |
| 80 | Thrombosis | FAERS: 4 | US FAERS | |
| 81 | Weight decreased | FAERS: 4 | US FAERS | |
| 82 | Acute kidney injury | FAERS: 3 | US FAERS | |
| 83 | Adverse event | FAERS: 3 | US FAERS | |
| 84 | Angular cheilitis | FAERS: 3 | US FAERS | |
| 85 | Anxiety | FAERS: 3 | US FAERS | |
| 86 | Aphasia | FAERS: 3 | US FAERS | |
| 87 | Aspartate Aminotransferase Increased | FAERS: 3 | SIDER US FAERS | |
| 88 | Back Pain | FAERS: 3 | SIDER US FAERS | |
| 89 | Blood creatinine increased | FAERS: 3 | SIDER US FAERS | |
| 90 | Chest discomfort | FAERS: 3 | US FAERS | |
| 91 | Disease complication | FAERS: 3 | US FAERS | |
| 92 | Dysphonia | FAERS: 3 | US FAERS | |
| 93 | Infection | FAERS: 3 | SIDER US FAERS | |
| 94 | Influenza | FAERS: 3 | US FAERS | |
| 95 | Intestinal Obstruction | FAERS: 3 | US FAERS | |
| 96 | Lower respiratory tract infection | FAERS: 3 | US FAERS | |
| 97 | Myocardial Infarction | FAERS: 3 | US FAERS | |
| 98 | Neck Pain | FAERS: 3 | US FAERS | |
| 99 | Nephrotic Syndrome | FAERS: 3 | US FAERS | |
| 100 | Pancreatitis | FAERS: 3 | SIDER US FAERS | |
| 101 | Pancytopenia | FAERS: 3 | US FAERS | |
| 102 | Pulmonary thrombosis | FAERS: 3 | US FAERS | |
| 103 | Rash erythematous | FAERS: 3 | SIDER US FAERS | |
| 104 | Skin irritation | FAERS: 3 | US FAERS | |
| 105 | Tooth Infection | FAERS: 3 | US FAERS | |
| 106 | Uveitis | FAERS: 3 | US FAERS | |
| 107 | Ventricular hypokinesia | FAERS: 3 | US FAERS | |
| 108 | nervous system disorder | FAERS: 3 | SIDER US FAERS | |
| 109 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 110 | Ammonia abnormal | FAERS: 2 | US FAERS | |
| 111 | Astrocytoma, low grade | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 112 | Blindness | FAERS: 2 | US FAERS | |
| 113 | Blood alkaline phosphatase increased | FAERS: 2 | SIDER US FAERS | |
| 114 | Blood glucose decreased | FAERS: 2 | US FAERS | |
| 115 | Blood lactate dehydrogenase increased | FAERS: 2 | US FAERS | |
| 116 | Blood urine present | FAERS: 2 | US FAERS | |
| 117 | Bradycardia | FAERS: 2 | SIDER US FAERS | |
| 118 | Bronchitis | FAERS: 2 | US FAERS | |
| 119 | Burning sensation | FAERS: 2 | US FAERS | |
| 120 | Cachexia | FAERS: 2 | US FAERS | |
| 121 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 122 | Cardiotoxicity | FAERS: 2 | US FAERS | |
| 123 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 124 | Cheilitis | FAERS: 2 | US FAERS | |
| 125 | Dropped head syndrome | FAERS: 2 | US FAERS | |
| 126 | Erysipelas | FAERS: 2 | US FAERS | |
| 127 | Extra dose administered | FAERS: 2 | US FAERS | |
| 128 | Feeling Cold | FAERS: 2 | US FAERS | |
| 129 | Histiocytic sarcoma | FAERS: 2 | US FAERS | |
| 130 | Hypersomnia | FAERS: 2 | US FAERS | |
| 131 | Ileus | FAERS: 2 | US FAERS | |
| 132 | Inappropriate schedule of product administration | FAERS: 2 | US FAERS | |
| 133 | Intestinal Perforation | FAERS: 2 | US FAERS | |
| 134 | Myositis | FAERS: 2 | US FAERS | |
| 135 | Nasal discomfort | FAERS: 2 | US FAERS | |
| 136 | Neutropenia | FAERS: 2 | SIDER US FAERS | |
| 137 | Non-cardiac chest pain | FAERS: 2 | US FAERS | |
| 138 | Oropharyngeal pain | FAERS: 2 | SIDER US FAERS | |
| 139 | Panniculitis | FAERS: 2 | US FAERS | |
| 140 | Product dose omission | FAERS: 2 | US FAERS | |
| 141 | Product quality issue | FAERS: 2 | US FAERS | |
| 142 | Pulmonary congestion | FAERS: 2 | US FAERS | |
| 143 | Purpura | FAERS: 2 | US FAERS | |
| 144 | Pyelonephritis | FAERS: 2 | US FAERS | |
| 145 | Quadriparesis | FAERS: 2 | US FAERS | |
| 146 | Renal pain | FAERS: 2 | US FAERS | |
| 147 | Respiratory Failure | FAERS: 2 | US FAERS | |
| 148 | Sciatica | FAERS: 2 | US FAERS | |
| 149 | Sinus Tachycardia | FAERS: 2 | US FAERS | |
| 150 | Skin toxicity | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 151 | Supraventricular tachycardia | FAERS: 2 | US FAERS | |
| 152 | Syncope | FAERS: 2 | US FAERS | |
| 153 | Tachycardia | FAERS: 2 | US FAERS | |
| 154 | Therapy non-responder | FAERS: 2 | US FAERS | |
| 155 | Troponin T increased | FAERS: 2 | US FAERS | |
| 156 | Unevaluable event | FAERS: 2 | US FAERS | |
| 157 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 158 | Xerosis | FAERS: 2 | US FAERS | |
| 159 | Abasia | FAERS: 1 | US FAERS | |
| 160 | Abdominal adhesions | FAERS: 1 | US FAERS | |
| 161 | Abscess | FAERS: 1 | US FAERS | |
| 162 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 163 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 164 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 165 | Adenocarcinoma | FAERS: 1 | US FAERS | |
| 166 | Aeromonas infection | FAERS: 1 | US FAERS | |
| 167 | Agitation | FAERS: 1 | US FAERS | |
| 168 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 169 | Anger | FAERS: 1 | US FAERS | |
| 170 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 171 | Ascites | FAERS: 1 | US FAERS | |
| 172 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 173 | Bile Duct Stenosis | FAERS: 1 | US FAERS | |
| 174 | Blood creatine phosphokinase abnormal | FAERS: 1 | US FAERS | |
| 175 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 176 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 177 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 178 | Blood uric acid decreased | FAERS: 1 | US FAERS | |
| 179 | Carbon dioxide increased | FAERS: 1 | US FAERS | |
| 180 | Cataract | FAERS: 1 | US FAERS | |
| 181 | Cellulitis | FAERS: 1 | SIDER US FAERS | |
| 182 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 183 | Cholangitis | FAERS: 1 | US FAERS | |
| 184 | Chromaturia | FAERS: 1 | US FAERS | |
| 185 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 186 | Concomitant disease progression | FAERS: 1 | US FAERS | |
| 187 | Contrast media allergy | FAERS: 1 | US FAERS | |
| 188 | Dementia | FAERS: 1 | US FAERS | |
| 189 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 190 | Device related infection | FAERS: 1 | US FAERS | |
| 191 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 192 | Discomfort | FAERS: 1 | US FAERS | |
| 193 | Disorientation | FAERS: 1 | US FAERS | |
| 194 | Drug abuse | FAERS: 1 | US FAERS | |
| 195 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 196 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 197 | Drug resistance | FAERS: 1 | US FAERS | |
| 198 | Duodenal perforation | FAERS: 1 | US FAERS | |
| 199 | Dysarthria | FAERS: 1 | US FAERS | |
| 200 | Dysentery | FAERS: 1 | US FAERS | |
| 201 | Dyspepsia | FAERS: 1 | US FAERS | |
| 202 | Dysuria | FAERS: 1 | US FAERS | |
| 203 | Ejection fraction abnormal | FAERS: 1 | US FAERS | |
| 204 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 205 | Emotional disorder | FAERS: 1 | US FAERS | |
| 206 | Endocarditis | FAERS: 1 | US FAERS | |
| 207 | Enterocolitis | FAERS: 1 | US FAERS | |
| 208 | Escherichia infection | FAERS: 1 | US FAERS | |
| 209 | Exfoliative rash | FAERS: 1 | US FAERS | |
| 210 | Eye irritation | FAERS: 1 | US FAERS | |
| 211 | Flushing | FAERS: 1 | US FAERS | |
| 212 | Food Allergy | FAERS: 1 | US FAERS | |
| 213 | Fracture | FAERS: 1 | US FAERS | |
| 214 | Frustration tolerance decreased | FAERS: 1 | US FAERS | |
| 215 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 216 | Gait inability | FAERS: 1 | US FAERS | |
| 217 | Gamma radiation therapy to brain | FAERS: 1 | US FAERS | |
| 218 | Ganglioglioma | FAERS: 1 | US FAERS | |
| 219 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 220 | Germ Cell Cancer | FAERS: 1 | US FAERS | |
| 221 | Gingival Hypertrophy | FAERS: 1 | US FAERS | |
| 222 | Glioma | FAERS: 1 | US FAERS | |
| 223 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 224 | Hypophagia | FAERS: 1 | US FAERS | |
| 225 | Immobile | FAERS: 1 | US FAERS | |
| 226 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 227 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 228 | Incontinence | FAERS: 1 | US FAERS | |
| 229 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 230 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 231 | Infected cyst | FAERS: 1 | US FAERS | |
| 232 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 233 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 234 | Intracranial meningioma malignant | FAERS: 1 | US FAERS | |
| 235 | Lethargy | FAERS: 1 | US FAERS | |
| 236 | Leukopenia | FAERS: 1 | SIDER US FAERS | |
| 237 | Lip swelling | FAERS: 1 | US FAERS | |
| 238 | Lymphangitis | FAERS: 1 | US FAERS | |
| 239 | Lymphocyte count decreased | FAERS: 1 | US FAERS | |
| 240 | Lymphocyte count increased | FAERS: 1 | US FAERS | |
| 241 | Malignant melanoma stage IV | FAERS: 1 | US FAERS | |
| 242 | Manufacturing product shipping issue | FAERS: 1 | US FAERS | |
| 243 | Medication Error | FAERS: 1 | US FAERS | |
| 244 | Mental status changes | FAERS: 1 | US FAERS | |
| 245 | Metamorphopsia | FAERS: 1 | US FAERS | |
| 246 | Metastatic ocular melanoma | FAERS: 1 | US FAERS | |
| 247 | Monocyte count decreased | FAERS: 1 | US FAERS | |
| 248 | Mood swings | FAERS: 1 | US FAERS | |
| 249 | Mouth swelling | FAERS: 1 | US FAERS | |
| 250 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 251 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 252 | Myocarditis | FAERS: 1 | US FAERS | |
| 253 | Neutrophilic dermatosis | FAERS: 1 | US FAERS | |
| 254 | Night sweats | FAERS: 1 | SIDER US FAERS | |
| 255 | Nodule | FAERS: 1 | US FAERS | |
| 256 | Noninfective gingivitis | FAERS: 1 | US FAERS | |
| 257 | Ocular Toxicity | FAERS: 1 | SIDER US FAERS | |
| 258 | Onychoclasis | FAERS: 1 | US FAERS | |
| 259 | Oral pain | FAERS: 1 | US FAERS | |
| 260 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 261 | Pain of skin | FAERS: 1 | US FAERS | |
| 262 | Pancreatic enzymes increased | FAERS: 1 | US FAERS | |
| 263 | Pancreatic toxicity | FAERS: 1 | US FAERS | |
| 264 | Papule | FAERS: 1 | US FAERS | |
| 265 | Photophobia | FAERS: 1 | US FAERS | |
| 266 | Piloerection | FAERS: 1 | US FAERS | |
| 267 | Platelet count abnormal | FAERS: 1 | US FAERS | |
| 268 | Polymerase chain reaction positive | FAERS: 1 | US FAERS | |
| 269 | Post procedural complication | FAERS: 1 | US FAERS | |
| 270 | Presyncope | FAERS: 1 | US FAERS | |
| 271 | Product size issue | FAERS: 1 | US FAERS | |
| 272 | Product use complaint | FAERS: 1 | US FAERS | |
| 273 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 274 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 275 | Pyogenic granuloma | FAERS: 1 | US FAERS | |
| 276 | Rales | FAERS: 1 | US FAERS | |
| 277 | Rash follicular | FAERS: 1 | US FAERS | |
| 278 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 279 | Retinal Vascular Disorder | FAERS: 1 | US FAERS | |
| 280 | Retinal Vein Occlusion | FAERS: 1 | US FAERS | |
| 281 | Retinal vascular thrombosis | FAERS: 1 | US FAERS | |
| 282 | Retinoschisis | FAERS: 1 | US FAERS | |
| 283 | Septic Shock | FAERS: 1 | US FAERS | |
| 284 | Serous cystadenocarcinoma ovary | FAERS: 1 | US FAERS | |
| 285 | Shunt infection | FAERS: 1 | US FAERS | |
| 286 | Shunt occlusion | FAERS: 1 | US FAERS | |
| 287 | Skin Papilloma | FAERS: 1 | SIDER US FAERS | |
| 288 | Squamous cell carcinoma of skin | FAERS: 1 | US FAERS | |
| 289 | Staphylococcus test positive | FAERS: 1 | US FAERS | |
| 290 | Stem cell transplant | FAERS: 1 | US FAERS | |
| 291 | Stress | FAERS: 1 | US FAERS | |
| 292 | Swelling of eyelid | FAERS: 1 | US FAERS | |
| 293 | Syringomyelia | FAERS: 1 | US FAERS | |
| 294 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 295 | Terminal state | FAERS: 1 | US FAERS | |
| 296 | Therapeutic procedure | FAERS: 1 | US FAERS | |
| 297 | Throat cancer | FAERS: 1 | US FAERS | |
| 298 | Trichomegaly | FAERS: 1 | US FAERS | |
| 299 | Troponin I increased | FAERS: 1 | US FAERS | |
| 300 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 301 | Varicella Zoster Virus Infection | FAERS: 1 | US FAERS | |
| 302 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 303 | Vertigo | FAERS: 1 | US FAERS | |
| 304 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 305 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 306 | Wheezing | FAERS: 1 | US FAERS | |
| 307 | White matter lesion | FAERS: 1 | US FAERS | |
| 308 | Wrong patient received product | FAERS: 1 | US FAERS | |
| 309 | Wrong product stored | FAERS: 1 | US FAERS | |
| 310 | Wrong technique in device usage process | FAERS: 1 | US FAERS | |
| 311 | Yawning | FAERS: 1 | US FAERS | |
| 312 | jaundice | FAERS: 1 | US FAERS | |
| 313 | treatment failure | FAERS: 1 | US FAERS | |
| 314 | Abdominal tenderness | SIDER | ||
| 315 | Acneiform Eruptions | 25417902 | CTD | |
| 316 | Actinic keratosis | SIDER | ||
| 317 | Aphthous Stomatitis | SIDER | ||
| 318 | Creatinine increased | SIDER | ||
| 319 | Cyst | SIDER | ||
| 320 | Diarrhea | 25417902 | CTD | |
| 321 | Dyspnea | 25417902 | CTD | |
| 322 | Exanthema | 25417902 | CTD | |
| 323 | Gamma-Glutamyltransferase Increased | SIDER | ||
| 324 | Gastrointestinal Pain | SIDER | ||
| 325 | Hyperkeratosis | SIDER | ||
| 326 | Infestation | SIDER | ||
| 327 | Left ventricular ejection fraction decreased | SIDER | ||
| 328 | Lymphopenia | SIDER | ||
| 329 | Malnutrition | SIDER | ||
| 330 | Musculoskeletal discomfort | SIDER | ||
| 331 | Prurigo | SIDER | ||
| 332 | Reaction febrile | SIDER | ||
| 333 | Refractory hypertension | SIDER | ||
| 334 | Therapeutic product effect incomplete | Canada Vigilance: 1 | Canada Vigilance | |
| 335 | Venous Thromboembolism | SIDER | ||
| 336 | melanoma | 23432625 23587417 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.