darifenacin
(HXGBXQDTNZMWGS-RUZDIDTESA-N)
Structure
- SMILES
- NC(=O)C(c1ccccc1)(c1ccccc1)[C@@H]1CCN(C1)CCc1ccc2c(c1)CCO2
- Type(s)
- Approved; Investigational
- ATC code(s)
- G04BD10
- Molecular Formula:
- C28H30N2O2
- Molecular Weight:
- 426.550
- Log P:
- 4.5957
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 1
- TPSA:
- 55.56
- CAS Number(s):
- 133099-04-4
Synonym(s)
1.
darifenacin
2.
(S)-1-(2-(2,3-dihydro-5-benzofuranyl)ethyl)-alpha,alpha-diphenyl-3-pyrrolidineacetamide
3.
Emselex
4.
Enablex
5.
UK-88525
6.
darifenacin hydrobromide
7.
darifenacin hydrochloride
8.
darifenacine
9.
darifenicin
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 465 Canada Vigilance: 8 | Canada Vigilance OFFSIDES US FAERS | |
| 2 | Constipation | FAERS: 244 Canada Vigilance: 1 | 18811599 | CTD SIDER Canada Vigilance US FAERS |
| 3 | Dizziness | FAERS: 63 | SIDER US FAERS | |
| 4 | Dyspepsia | FAERS: 46 | OFFSIDES SIDER US FAERS | |
| 5 | Headache | FAERS: 43 | SIDER US FAERS | |
| 6 | Urinary Retention | FAERS: 41 | SIDER US FAERS | |
| 7 | Urinary Incontinence | FAERS: 39 Canada Vigilance: 2 | 15977961 | CTD Canada Vigilance US FAERS |
| 8 | Abdominal Pain | FAERS: 33 | SIDER US FAERS | |
| 9 | Pruritus | FAERS: 33 | SIDER US FAERS | |
| 10 | Somnolence | FAERS: 31 | SIDER US FAERS | |
| 11 | Nausea | FAERS: 27 | SIDER US FAERS | |
| 12 | Fatigue | FAERS: 24 | OFFSIDES US FAERS | |
| 13 | Dysuria | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 14 | Back Pain | FAERS: 17 | SIDER US FAERS | |
| 15 | Pain | FAERS: 17 | OFFSIDES SIDER US FAERS | |
| 16 | Arthralgia | FAERS: 15 | SIDER US FAERS | |
| 17 | Flatulence | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 18 | Nocturia | FAERS: 15 | US FAERS | |
| 19 | Asthenia | FAERS: 14 | SIDER US FAERS | |
| 20 | Feeling abnormal | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 21 | Malaise | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 22 | Blood glucose increased | FAERS: 12 | US FAERS | |
| 23 | Chest Pain | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 24 | Blood urine present | FAERS: 11 | OFFSIDES US FAERS | |
| 25 | Vomiting | FAERS: 11 | SIDER US FAERS | |
| 26 | Joint swelling | FAERS: 10 | US FAERS | |
| 27 | Myalgia | FAERS: 10 | US FAERS | |
| 28 | Urinary tract infection | FAERS: 10 | SIDER US FAERS | |
| 29 | Tremor | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 30 | Dry skin | FAERS: 8 | SIDER US FAERS | |
| 31 | Bladder spasm | FAERS: 7 | US FAERS | |
| 32 | Epistaxis | FAERS: 7 | US FAERS | |
| 33 | Glaucoma | FAERS: 7 | US FAERS | |
| 34 | Pharyngolaryngeal Pain | FAERS: 7 | OFFSIDES US FAERS | |
| 35 | Abdominal discomfort | FAERS: 6 | US FAERS | |
| 36 | Cerebrovascular accident | FAERS: 6 | SIDER US FAERS | |
| 37 | Chest discomfort | FAERS: 6 | US FAERS | |
| 38 | Dysgeusia | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 39 | Intestinal Obstruction | FAERS: 6 | US FAERS | |
| 40 | Palpitations | FAERS: 6 | SIDER US FAERS | |
| 41 | Thirst | FAERS: 6 | US FAERS | |
| 42 | Blindness | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 43 | Erythema | FAERS: 5 | US FAERS | |
| 44 | Flushing | FAERS: 5 | US FAERS | |
| 45 | Hypersensitivity | FAERS: 5 | SIDER US FAERS | |
| 46 | Hypotension | FAERS: 5 | US FAERS | |
| 47 | Therapeutic response unexpected | FAERS: 5 | OFFSIDES US FAERS | |
| 48 | Visual disturbance | FAERS: 5 | SIDER US FAERS | |
| 49 | Weight decreased | FAERS: 5 | US FAERS | |
| 50 | Amnesia | FAERS: 4 | US FAERS | |
| 51 | Anxiety | FAERS: 4 | US FAERS | |
| 52 | Burning sensation | FAERS: 4 | US FAERS | |
| 53 | Enuresis | FAERS: 4 | OFFSIDES US FAERS | |
| 54 | Eye pain | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 55 | Incontinence | FAERS: 4 | US FAERS | |
| 56 | Medication Error | FAERS: 4 | US FAERS | |
| 57 | Musculoskeletal Pain | FAERS: 4 | OFFSIDES US FAERS | |
| 58 | Neck Pain | FAERS: 4 | US FAERS | |
| 59 | Pulmonary Embolism | FAERS: 4 | US FAERS | |
| 60 | Therapy responder | FAERS: 4 | OFFSIDES US FAERS | |
| 61 | Urine flow decreased | FAERS: 4 | US FAERS | |
| 62 | Urticaria | FAERS: 4 | US FAERS | |
| 63 | Vertigo | FAERS: 4 | US FAERS | |
| 64 | Anorgasmia | FAERS: 3 | OFFSIDES US FAERS | |
| 65 | Aphasia | FAERS: 3 | US FAERS | |
| 66 | Bone pain | FAERS: 3 | US FAERS | |
| 67 | Cataract | FAERS: 3 | US FAERS | |
| 68 | Concomitant disease aggravated | FAERS: 3 | OFFSIDES US FAERS | |
| 69 | Cystitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 70 | Dementia | FAERS: 3 | US FAERS | |
| 71 | Discomfort | FAERS: 3 | US FAERS | |
| 72 | Disorientation | FAERS: 3 | US FAERS | |
| 73 | Erectile dysfunction | FAERS: 3 | SIDER US FAERS | |
| 74 | Hypertensive crisis | FAERS: 3 | US FAERS | |
| 75 | Incorrect dose administered | FAERS: 3 | US FAERS | |
| 76 | Lip exfoliation | FAERS: 3 | OFFSIDES US FAERS | |
| 77 | Lip swelling | FAERS: 3 | US FAERS | |
| 78 | Nervousness | FAERS: 3 | US FAERS | |
| 79 | Tinnitus | FAERS: 3 | US FAERS | |
| 80 | Troponin increased | FAERS: 3 | OFFSIDES US FAERS | |
| 81 | Urinary tract obstruction | FAERS: 3 | US FAERS | |
| 82 | Visual Impairment | FAERS: 3 | SIDER US FAERS | |
| 83 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 84 | Ageusia | FAERS: 2 | OFFSIDES US FAERS | |
| 85 | Alopecia | FAERS: 2 | US FAERS | |
| 86 | Anorexia | FAERS: 2 | US FAERS | |
| 87 | Anuria | FAERS: 2 | US FAERS | |
| 88 | Asthma | FAERS: 2 | US FAERS | |
| 89 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 90 | Chills | FAERS: 2 | US FAERS | |
| 91 | Choking | FAERS: 2 | US FAERS | |
| 92 | Cholecystitis | FAERS: 2 | US FAERS | |
| 93 | Chromaturia | FAERS: 2 | US FAERS | |
| 94 | Cystoscopy | FAERS: 2 | US FAERS | |
| 95 | Dental caries | FAERS: 2 | US FAERS | |
| 96 | Depressed mood | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 97 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 98 | Diabetes mellitus inadequate control | FAERS: 2 | OFFSIDES US FAERS | |
| 99 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 100 | Emotional disorder | FAERS: 2 | OFFSIDES US FAERS | |
| 101 | Eructation | FAERS: 2 | US FAERS | |
| 102 | Eye irritation | FAERS: 2 | US FAERS | |
| 103 | Feeling Cold | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 104 | Gamma-Glutamyltransferase Increased | FAERS: 2 | US FAERS | |
| 105 | Hyperchlorhydria | FAERS: 2 | US FAERS | |
| 106 | Hypersomnia | FAERS: 2 | US FAERS | |
| 107 | Initial insomnia | FAERS: 2 | US FAERS | |
| 108 | Lethargy | FAERS: 2 | US FAERS | |
| 109 | Memory impairment | FAERS: 2 | US FAERS | |
| 110 | Meniscus operation | FAERS: 2 | US FAERS | |
| 111 | Mental impairment | FAERS: 2 | US FAERS | |
| 112 | Metrorrhagia | FAERS: 2 | US FAERS | |
| 113 | Middle insomnia | FAERS: 2 | US FAERS | |
| 114 | Multiple Sclerosis | FAERS: 2 | OFFSIDES US FAERS | |
| 115 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 116 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 117 | Nasopharyngitis | FAERS: 2 | OFFSIDES US FAERS | |
| 118 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 119 | Oral pain | FAERS: 2 | US FAERS | |
| 120 | Overdose | FAERS: 2 | US FAERS | |
| 121 | Polyuria | FAERS: 2 | US FAERS | |
| 122 | Restlessness | FAERS: 2 | US FAERS | |
| 123 | Retinal Vascular Disorder | FAERS: 2 | US FAERS | |
| 124 | Sneezing | FAERS: 2 | US FAERS | |
| 125 | Stool analysis abnormal | FAERS: 2 | OFFSIDES US FAERS | |
| 126 | Stress | FAERS: 2 | OFFSIDES US FAERS | |
| 127 | Throat irritation | FAERS: 2 | US FAERS | |
| 128 | Thrombosis | FAERS: 2 | US FAERS | |
| 129 | Unevaluable event | FAERS: 2 | US FAERS | |
| 130 | Urge Incontinence | FAERS: 2 | OFFSIDES US FAERS | |
| 131 | Vaginal burning sensation | FAERS: 2 | OFFSIDES US FAERS | |
| 132 | Accidental overdose | FAERS: 1 | OFFSIDES US FAERS | |
| 133 | Agitation | FAERS: 1 | US FAERS | |
| 134 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 135 | Angle Closure Glaucoma | FAERS: 1 | US FAERS | |
| 136 | Appendicitis | FAERS: 1 | US FAERS | |
| 137 | Arthropathy | FAERS: 1 | US FAERS | |
| 138 | Bedridden | FAERS: 1 | US FAERS | |
| 139 | Bladder catheter temporary | FAERS: 1 | OFFSIDES US FAERS | |
| 140 | Bladder stenosis | FAERS: 1 | US FAERS | |
| 141 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 142 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 143 | Blood thyroid stimulating hormone decreased | FAERS: 1 | US FAERS | |
| 144 | Bradycardia | FAERS: 1 | US FAERS | |
| 145 | Breast tenderness | FAERS: 1 | OFFSIDES US FAERS | |
| 146 | Cataract operation | FAERS: 1 | US FAERS | |
| 147 | Catheter placement | FAERS: 1 | US FAERS | |
| 148 | Catheter site pain | FAERS: 1 | US FAERS | |
| 149 | Catheter site related reaction | FAERS: 1 | US FAERS | |
| 150 | Choking sensation | FAERS: 1 | US FAERS | |
| 151 | Colectomy | FAERS: 1 | US FAERS | |
| 152 | Colitis | FAERS: 1 | US FAERS | |
| 153 | Corneal Infection | FAERS: 1 | US FAERS | |
| 154 | Dehydration | FAERS: 1 | US FAERS | |
| 155 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 156 | Disease Progression | FAERS: 1 | US FAERS | |
| 157 | Dissociation | FAERS: 1 | US FAERS | |
| 158 | Disturbance in sexual arousal | FAERS: 1 | US FAERS | |
| 159 | Drug administration error | FAERS: 1 | OFFSIDES US FAERS | |
| 160 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 161 | Drug exposure via breast milk | FAERS: 1 | US FAERS | |
| 162 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 163 | Drug resistance | FAERS: 1 | US FAERS | |
| 164 | Dysarthria | FAERS: 1 | US FAERS | |
| 165 | Dysphonia | FAERS: 1 | US FAERS | |
| 166 | Electrocardiogram ST-T change | FAERS: 1 | US FAERS | |
| 167 | Emotional distress | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 168 | Erythema Multiforme | FAERS: 1 | SIDER US FAERS | |
| 169 | Excoriation | FAERS: 1 | US FAERS | |
| 170 | Expired drug administered | FAERS: 1 | US FAERS | |
| 171 | Eyelid margin crusting | FAERS: 1 | US FAERS | |
| 172 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 173 | Flank Pain | FAERS: 1 | US FAERS | |
| 174 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 175 | Gastrointestinal Pain | FAERS: 1 | SIDER US FAERS | |
| 176 | Gastrointestinal hypomotility | FAERS: 1 | US FAERS | |
| 177 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 178 | Genital rash | FAERS: 1 | US FAERS | |
| 179 | Head discomfort | FAERS: 1 | US FAERS | |
| 180 | Heat Exhaustion | FAERS: 1 | US FAERS | |
| 181 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 182 | Hypophagia | FAERS: 1 | US FAERS | |
| 183 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 184 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 185 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 186 | Infarction | FAERS: 1 | US FAERS | |
| 187 | Infection | FAERS: 1 | SIDER US FAERS | |
| 188 | Infertility | FAERS: 1 | US FAERS | |
| 189 | Interstitial granulomatous dermatitis | FAERS: 1 | US FAERS | |
| 190 | Lacrimation decreased | FAERS: 1 | US FAERS | |
| 191 | Lactose Intolerance | FAERS: 1 | US FAERS | |
| 192 | Limb discomfort | FAERS: 1 | US FAERS | |
| 193 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 194 | Lymphoma | FAERS: 1 | US FAERS | |
| 195 | Medication residue | FAERS: 1 | US FAERS | |
| 196 | Mood swings | FAERS: 1 | US FAERS | |
| 197 | Muscle tightness | FAERS: 1 | US FAERS | |
| 198 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 199 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 200 | No adverse event | FAERS: 1 | US FAERS | |
| 201 | Obstruction | FAERS: 1 | US FAERS | |
| 202 | Optic Neuritis | FAERS: 1 | US FAERS | |
| 203 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 204 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 205 | Polydipsia | FAERS: 1 | US FAERS | |
| 206 | Presyncope | FAERS: 1 | US FAERS | |
| 207 | Product quality issue | FAERS: 1 | US FAERS | |
| 208 | Rectal tenesmus | FAERS: 1 | US FAERS | |
| 209 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 210 | Shoulder Pain | FAERS: 1 | US FAERS | |
| 211 | Sinusitis | FAERS: 1 | SIDER US FAERS | |
| 212 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 213 | Sluggishness | FAERS: 1 | US FAERS | |
| 214 | Spinal column injury | FAERS: 1 | US FAERS | |
| 215 | Stomatitis | FAERS: 1 | SIDER US FAERS | |
| 216 | Sunburn | FAERS: 1 | US FAERS | |
| 217 | Therapy regimen changed | FAERS: 1 | US FAERS | |
| 218 | Trichorrhexis | FAERS: 1 | OFFSIDES US FAERS | |
| 219 | Ulcer | FAERS: 1 | US FAERS | |
| 220 | Unresponsive to stimuli | FAERS: 1 | OFFSIDES US FAERS | |
| 221 | Urinary Tract Pain | FAERS: 1 | US FAERS | |
| 222 | Urinary hesitation | FAERS: 1 | US FAERS | |
| 223 | Vaginal pain | FAERS: 1 | US FAERS | |
| 224 | Vein pain | FAERS: 1 | US FAERS | |
| 225 | Vessel puncture site reaction | FAERS: 1 | US FAERS | |
| 226 | Vessel puncture site swelling | FAERS: 1 | US FAERS | |
| 227 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 228 | Vulvovaginal discomfort | FAERS: 1 | US FAERS | |
| 229 | Vulvovaginal dryness | FAERS: 1 | US FAERS | |
| 230 | Abnormal vision | OFFSIDES SIDER | ||
| 231 | Abuse | OFFSIDES | ||
| 232 | Acute myocardial infarction | OFFSIDES | ||
| 233 | Acute retention of urine | SIDER | ||
| 234 | Alanine Aminotransferase Increased | SIDER | ||
| 235 | Anaphylactic shock | SIDER | ||
| 236 | Angioedema | OFFSIDES SIDER | ||
| 237 | Anhedonia | OFFSIDES | ||
| 238 | Aspartate Aminotransferase Increased | SIDER | ||
| 239 | Autoimmune hepatitis | OFFSIDES | ||
| 240 | Avascular necrosis | OFFSIDES | ||
| 241 | Bacterial test positive | OFFSIDES | ||
| 242 | Basophil percentage increased | OFFSIDES | ||
| 243 | Bladder pain | SIDER | ||
| 244 | Blood alkaline phosphatase | OFFSIDES | ||
| 245 | Blurred vision | OFFSIDES | ||
| 246 | Brain Hypoxia | OFFSIDES | ||
| 247 | Bronchitis | SIDER | ||
| 248 | Bursitis | OFFSIDES | ||
| 249 | Cervical myelopathy | OFFSIDES | ||
| 250 | Cholecystitis infective | OFFSIDES | ||
| 251 | Cholesterol granuloma | OFFSIDES | ||
| 252 | Coagulation test abnormal | OFFSIDES | ||
| 253 | Completed Suicide | OFFSIDES | ||
| 254 | Complex partial seizures | OFFSIDES | ||
| 255 | Conjunctival deposit | OFFSIDES | ||
| 256 | Corneal Ulcer | OFFSIDES | ||
| 257 | Cystocele | OFFSIDES | ||
| 258 | Dependence | OFFSIDES | ||
| 259 | Dermatitis | SIDER | ||
| 260 | Device malfunction | Canada Vigilance: 1 | Canada Vigilance | |
| 261 | Difficult to wean from ventilator | OFFSIDES | ||
| 262 | Disease complication | OFFSIDES | ||
| 263 | Drowsiness | OFFSIDES | ||
| 264 | Drug administered at inappropriate site | OFFSIDES | ||
| 265 | Drug withdrawal headache | OFFSIDES | ||
| 266 | Economic problem | OFFSIDES | ||
| 267 | Encephalitis | OFFSIDES | ||
| 268 | Endotracheal intubation complication | OFFSIDES | ||
| 269 | Enterococcal sepsis | OFFSIDES | ||
| 270 | Flu symptoms | SIDER | ||
| 271 | Fracture treatment | OFFSIDES | ||
| 272 | Frustration | OFFSIDES | ||
| 273 | Granuloma Annulare | SIDER | ||
| 274 | Hepatic congestion | OFFSIDES | ||
| 275 | Hyperkeratosis | OFFSIDES | ||
| 276 | Immune reconstitution syndrome | OFFSIDES | ||
| 277 | Impaired driving ability | OFFSIDES | ||
| 278 | Impaired gastric emptying | OFFSIDES | ||
| 279 | Infestation | SIDER | ||
| 280 | Influenza | SIDER | ||
| 281 | Injection site dermatitis | OFFSIDES | ||
| 282 | Intubation | OFFSIDES | ||
| 283 | Left atrial dilatation | OFFSIDES | ||
| 284 | Lysosomal Storage Diseases | 28551711 | CTD | |
| 285 | Malignant Hypertension | OFFSIDES | ||
| 286 | Mass excision | OFFSIDES | ||
| 287 | Mental status changes | OFFSIDES | ||
| 288 | Migraine with Aura | OFFSIDES | ||
| 289 | Multiple sclerosis relapse | OFFSIDES | ||
| 290 | Musculoskeletal discomfort | SIDER | ||
| 291 | Mutism | OFFSIDES | ||
| 292 | Mycosis Fungoides | OFFSIDES | ||
| 293 | Negative thoughts | OFFSIDES | ||
| 294 | Neuralgia | OFFSIDES | ||
| 295 | Oncologic complication | OFFSIDES | ||
| 296 | Peripheral swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 297 | Pharyngitis | SIDER | ||
| 298 | Platelet aggregation | OFFSIDES | ||
| 299 | Productive Cough | OFFSIDES | ||
| 300 | Pulmonary Hypertension | OFFSIDES | ||
| 301 | Pulmonary Infarction | OFFSIDES | ||
| 302 | Quadriparesis | OFFSIDES | ||
| 303 | Rhinitis | SIDER | ||
| 304 | Secretion discharge | OFFSIDES | ||
| 305 | Shock | SIDER | ||
| 306 | Skeletal injury | OFFSIDES | ||
| 307 | Skin lesion | OFFSIDES | ||
| 308 | Sleep Talking | OFFSIDES | ||
| 309 | Sudden onset of sleep | OFFSIDES | ||
| 310 | Sweating | SIDER | ||
| 311 | Syncope | SIDER | ||
| 312 | Tachycardia | SIDER | ||
| 313 | Tardive Dyskinesia | OFFSIDES | ||
| 314 | Tendinitis | OFFSIDES | ||
| 315 | Terminal state | OFFSIDES | ||
| 316 | Tobacco user | OFFSIDES | ||
| 317 | Ulcerative stomatitis | SIDER | ||
| 318 | Urinary tract infection enterococcal | OFFSIDES | ||
| 319 | Vascular resistance systemic increased | OFFSIDES | ||
| 320 | Viral upper respiratory tract infection | OFFSIDES | ||
| 321 | Vitamin B 12 Deficiency | OFFSIDES | ||
| 322 | Xerostomia | 18811599 | CTD | |
| 323 | effusion | OFFSIDES | ||
| 324 | muscle injury | OFFSIDES | ||
| 325 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.