Valganciclovir
(ZORWARFPXPVJLW-MTFPJWTKSA-N)
Structure
- SMILES
- OCC(OCn1cnc2c1nc(N)[nH]c2=O)COC(=O)[C@H](C(C)C)N.Cl
- Molecular Formula:
- C14H23ClN6O5
- Molecular Weight:
- 390.823
- Log P:
- 0.6468
- Hydrogen Bond Acceptor:
- 10
- Hydrogen Bond Donor:
- 5
- TPSA:
- 171.37
- CAS Number(s):
- 175865-59-5
Synonym(s)
1.
Valganciclovir
2.
Ganciclovir L-valyl Ester
3.
Valcyt
4.
Valcyte
5.
Valganciclovir Hydrochloride
6.
Ganciclovir L valyl Ester
External Link(s)
| MeSH | D000077562 |
| PubChem Compound | 135876141 135413534 |
| CHEMBL | CHEMBL1200454 |
| KEGG | dr:D03256 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | No adverse event | FAERS: 130 | US FAERS | |
| 2 | Intentional product use issue | FAERS: 60 | US FAERS | |
| 3 | Intercepted medication error | FAERS: 52 | US FAERS | |
| 4 | Incorrect product storage | FAERS: 41 | US FAERS | |
| 5 | Malaise | FAERS: 30 | US FAERS | |
| 6 | Intercepted product storage error | FAERS: 26 | US FAERS | |
| 7 | Product storage error | FAERS: 22 | US FAERS | |
| 8 | Pneumonia | FAERS: 21 | US FAERS | |
| 9 | Drug ineffective | FAERS: 16 | US FAERS | |
| 10 | Nausea | FAERS: 15 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 11 | Leukopenia | FAERS: 14 | US FAERS | |
| 12 | Neutropenia | FAERS: 14 | US FAERS | |
| 13 | White blood cell count decreased | FAERS: 13 | US FAERS | |
| 14 | Fatigue | FAERS: 11 | US FAERS | |
| 15 | Cytomegalovirus test positive | FAERS: 10 | US FAERS | |
| 16 | Drug dose omission | FAERS: 10 | US FAERS | |
| 17 | Vomiting | FAERS: 10 | US FAERS | |
| 18 | Circumstance or information capable of leading to medication error | FAERS: 9 | US FAERS | |
| 19 | Infection | FAERS: 9 | US FAERS | |
| 20 | Blindness | FAERS: 8 | US FAERS | |
| 21 | Cerebrovascular accident | FAERS: 8 | US FAERS | |
| 22 | Alopecia | FAERS: 7 | US FAERS | |
| 23 | Drug resistance | FAERS: 7 | US FAERS | |
| 24 | Lung transplant rejection | FAERS: 7 | US FAERS | |
| 25 | Pain | FAERS: 7 | US FAERS | |
| 26 | Respiratory Failure | FAERS: 7 | US FAERS | |
| 27 | Sepsis | FAERS: 7 | US FAERS | |
| 28 | Asthenia | FAERS: 6 | US FAERS | |
| 29 | Headache | FAERS: 6 | US FAERS | |
| 30 | Medication Error | FAERS: 6 | US FAERS | |
| 31 | Thrombocytopenia | FAERS: 6 | US FAERS | |
| 32 | Product quality issue | FAERS: 5 | US FAERS | |
| 33 | Tremor | FAERS: 5 | US FAERS | |
| 34 | treatment failure | FAERS: 5 | US FAERS | |
| 35 | Accidental exposure to product | FAERS: 4 | US FAERS | |
| 36 | Arthralgia | FAERS: 4 | US FAERS | |
| 37 | Cardiac Arrest | FAERS: 4 | US FAERS | |
| 38 | Dizziness | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 39 | Drug administration error | FAERS: 4 | US FAERS | |
| 40 | Feeling abnormal | FAERS: 4 | US FAERS | |
| 41 | Immunosuppression | FAERS: 4 | US FAERS | |
| 42 | Neutrophil count decreased | FAERS: 4 | US FAERS | |
| 43 | Pneumonitis | FAERS: 4 | US FAERS | |
| 44 | Viral load increased | FAERS: 4 | US FAERS | |
| 45 | Weight decreased | FAERS: 4 | US FAERS | |
| 46 | Abdominal Pain | FAERS: 3 | US FAERS | |
| 47 | Cholestasis | FAERS: 3 | US FAERS | |
| 48 | Dehydration | FAERS: 3 | US FAERS | |
| 49 | Exposure via inhalation | FAERS: 3 | US FAERS | |
| 50 | General physical health deterioration | FAERS: 3 | US FAERS | |
| 51 | Myocardial Infarction | FAERS: 3 | US FAERS | |
| 52 | Overdose | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 53 | Pancytopenia | FAERS: 3 | US FAERS | |
| 54 | Pneumocystis jiroveci pneumonia | FAERS: 3 | US FAERS | |
| 55 | Pneumothorax | FAERS: 3 | US FAERS | |
| 56 | Poor quality drug administered | FAERS: 3 | US FAERS | |
| 57 | Pulmonary Embolism | FAERS: 3 | US FAERS | |
| 58 | Sinusitis | FAERS: 3 | US FAERS | |
| 59 | Therapy cessation | FAERS: 3 | US FAERS | |
| 60 | Thrombosis | FAERS: 3 | US FAERS | |
| 61 | Wrong technique in product usage process | FAERS: 3 | US FAERS | |
| 62 | nervous system disorder | FAERS: 3 | US FAERS | |
| 63 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 64 | Acquired Immunodeficiency Syndrome | FAERS: 2 | US FAERS | |
| 65 | Acute respiratory failure | FAERS: 2 | US FAERS | |
| 66 | Agranulocytosis | FAERS: 2 | US FAERS | |
| 67 | Alanine Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 68 | Blood alkaline phosphatase increased | FAERS: 2 | US FAERS | |
| 69 | Blood creatinine increased | FAERS: 2 | US FAERS | |
| 70 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 71 | Cellulitis | FAERS: 2 | US FAERS | |
| 72 | Chest Pain | FAERS: 2 | US FAERS | |
| 73 | Cholecystitis | FAERS: 2 | US FAERS | |
| 74 | Clostridium difficile colitis | FAERS: 2 | US FAERS | |
| 75 | Clostridium difficile sepsis | FAERS: 2 | US FAERS | |
| 76 | Colitis | FAERS: 2 | US FAERS | |
| 77 | Constipation | FAERS: 2 | US FAERS | |
| 78 | Coronary Artery Disease | FAERS: 2 | US FAERS | |
| 79 | Deafness | FAERS: 2 | US FAERS | |
| 80 | Diverticulitis | FAERS: 2 | US FAERS | |
| 81 | Dysphonia | FAERS: 2 | US FAERS | |
| 82 | Febrile Neutropenia | FAERS: 2 | US FAERS | |
| 83 | Glioblastoma Multiforme | FAERS: 2 | US FAERS | |
| 84 | Haematotoxicity | FAERS: 2 | US FAERS | |
| 85 | Hepatic infection fungal | FAERS: 2 | US FAERS | |
| 86 | Infectious peritonitis | FAERS: 2 | US FAERS | |
| 87 | Intentional product misuse | FAERS: 2 | US FAERS | |
| 88 | Laceration | FAERS: 2 | US FAERS | |
| 89 | Malignant neoplasm progression | FAERS: 2 | US FAERS | |
| 90 | Mechanical ventilation | FAERS: 2 | US FAERS | |
| 91 | Memory impairment | FAERS: 2 | US FAERS | |
| 92 | Myalgia | FAERS: 2 | US FAERS | |
| 93 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 94 | Nephrectomy | FAERS: 2 | US FAERS | |
| 95 | Occupational exposure to product | FAERS: 2 | US FAERS | |
| 96 | Petechiae | FAERS: 2 | US FAERS | |
| 97 | Post procedural complication | FAERS: 2 | US FAERS | |
| 98 | Pregnancy | FAERS: 2 | US FAERS | |
| 99 | Product container issue | FAERS: 2 | US FAERS | |
| 100 | Product preparation error | FAERS: 2 | US FAERS | |
| 101 | Pseudomonal sepsis | FAERS: 2 | US FAERS | |
| 102 | Rehabilitation therapy | FAERS: 2 | US FAERS | |
| 103 | Renal tubular disorder | FAERS: 2 | US FAERS | |
| 104 | Retching | FAERS: 2 | US FAERS | |
| 105 | Septic Shock | FAERS: 2 | US FAERS | |
| 106 | Squamous cell carcinoma | FAERS: 2 | US FAERS | |
| 107 | Stomatitis | FAERS: 2 | US FAERS | |
| 108 | Swelling | FAERS: 2 | US FAERS | |
| 109 | Unevaluable event | FAERS: 2 | US FAERS | |
| 110 | Urticaria | FAERS: 2 | US FAERS | |
| 111 | Visual Impairment | FAERS: 2 | US FAERS | |
| 112 | Accidental exposure | FAERS: 1 | US FAERS | |
| 113 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 114 | Adenoviral hepatitis | FAERS: 1 | US FAERS | |
| 115 | Adverse event | FAERS: 1 | US FAERS | |
| 116 | Agitation | FAERS: 1 | US FAERS | |
| 117 | Amnesia | FAERS: 1 | US FAERS | |
| 118 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 119 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 120 | Angioedema | FAERS: 1 | US FAERS | |
| 121 | Anxiety | FAERS: 1 | US FAERS | |
| 122 | Arthropod bite | FAERS: 1 | US FAERS | |
| 123 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 124 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 125 | Basal cell carcinoma | FAERS: 1 | US FAERS | |
| 126 | Biliary anastomosis complication | FAERS: 1 | US FAERS | |
| 127 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 128 | Blood ketone body increased | FAERS: 1 | US FAERS | |
| 129 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 130 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 131 | CD4 Lymphocytes Decreased | FAERS: 1 | US FAERS | |
| 132 | Calciphylaxis | FAERS: 1 | US FAERS | |
| 133 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 134 | Cataract | FAERS: 1 | US FAERS | |
| 135 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 136 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 137 | Cholangitis | FAERS: 1 | US FAERS | |
| 138 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 139 | Colectomy | FAERS: 1 | US FAERS | |
| 140 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 141 | Cystitis | FAERS: 1 | US FAERS | |
| 142 | Cytomegalovirus chorioretinitis | FAERS: 1 | US FAERS | |
| 143 | Cytomegalovirus hepatitis | FAERS: 1 | US FAERS | |
| 144 | Cytomegalovirus test negative | FAERS: 1 | US FAERS | |
| 145 | Cytomegalovirus test | FAERS: 1 | US FAERS | |
| 146 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 147 | Delirium | FAERS: 1 | US FAERS | |
| 148 | Diffuse Large B-Cell Lymphoma | FAERS: 1 | US FAERS | |
| 149 | Disability | FAERS: 1 | US FAERS | |
| 150 | Disease Progression | FAERS: 1 | US FAERS | |
| 151 | Disorientation | FAERS: 1 | US FAERS | |
| 152 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 153 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 154 | Dysgeusia | FAERS: 1 | US FAERS | |
| 155 | Dysuria | FAERS: 1 | US FAERS | |
| 156 | Encephalitis | FAERS: 1 | US FAERS | |
| 157 | End stage AIDS | FAERS: 1 | US FAERS | |
| 158 | Endocarditis | FAERS: 1 | US FAERS | |
| 159 | Enzyme level abnormal | FAERS: 1 | US FAERS | |
| 160 | Epistaxis | FAERS: 1 | US FAERS | |
| 161 | Epstein-Barr virus test positive | FAERS: 1 | US FAERS | |
| 162 | Erythema | FAERS: 1 | US FAERS | |
| 163 | Expired product administered | FAERS: 1 | US FAERS | |
| 164 | Exposure via skin contact | FAERS: 1 | US FAERS | |
| 165 | Exsanguination | FAERS: 1 | US FAERS | |
| 166 | Extra dose administered | FAERS: 1 | US FAERS | |
| 167 | Eye pain | FAERS: 1 | US FAERS | |
| 168 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 169 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 170 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 171 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 172 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 173 | Granulomatous liver disease | FAERS: 1 | US FAERS | |
| 174 | Hemiplegia | FAERS: 1 | US FAERS | |
| 175 | Hepatitis | FAERS: 1 | US FAERS | |
| 176 | Histoplasmosis | FAERS: 1 | US FAERS | |
| 177 | Hospice Care | FAERS: 1 | US FAERS | |
| 178 | Hydropneumothorax | FAERS: 1 | US FAERS | |
| 179 | Hypercreatinaemia | FAERS: 1 | US FAERS | |
| 180 | Hypercreatininaemia | FAERS: 1 | US FAERS | |
| 181 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 182 | Hypotension | FAERS: 1 | US FAERS | |
| 183 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 184 | Hypoxia | FAERS: 1 | US FAERS | |
| 185 | Illness anxiety disorder | FAERS: 1 | US FAERS | |
| 186 | Immobile | FAERS: 1 | US FAERS | |
| 187 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 188 | Impaired work ability | FAERS: 1 | US FAERS | |
| 189 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 190 | Incisional hernia | FAERS: 1 | US FAERS | |
| 191 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 192 | Infantile spitting up | FAERS: 1 | US FAERS | |
| 193 | Infectious Mononucleosis | FAERS: 1 | US FAERS | |
| 194 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 195 | Lethargy | FAERS: 1 | US FAERS | |
| 196 | Limb injury | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 197 | Lip and/or oral cavity cancer | FAERS: 1 | US FAERS | |
| 198 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 199 | Lymphoma | FAERS: 1 | US FAERS | |
| 200 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 201 | Macrocytosis | FAERS: 1 | US FAERS | |
| 202 | Macule | FAERS: 1 | US FAERS | |
| 203 | Malnutrition | FAERS: 1 | US FAERS | |
| 204 | Meningitis | FAERS: 1 | US FAERS | |
| 205 | Mental impairment | FAERS: 1 | US FAERS | |
| 206 | Multi-organ disorder | FAERS: 1 | US FAERS | |
| 207 | Multiple Myeloma | FAERS: 1 | US FAERS | |
| 208 | Muscle hernia | FAERS: 1 | US FAERS | |
| 209 | Mycosis Fungoides | FAERS: 1 | US FAERS | |
| 210 | Myopathy | FAERS: 1 | US FAERS | |
| 211 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 212 | No adverse effect | FAERS: 1 | US FAERS | |
| 213 | Obesity | FAERS: 1 | US FAERS | |
| 214 | Oncologic complication | FAERS: 1 | US FAERS | |
| 215 | Palpitations | FAERS: 1 | US FAERS | |
| 216 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 217 | Portal Hypertension | FAERS: 1 | US FAERS | |
| 218 | Posterior reversible encephalopathy syndrome | FAERS: 1 | US FAERS | |
| 219 | Pregnancy of partner | FAERS: 1 | US FAERS | |
| 220 | Product dose omission | FAERS: 1 | US FAERS | |
| 221 | Product tampering | FAERS: 1 | US FAERS | |
| 222 | Productive Cough | FAERS: 1 | US FAERS | |
| 223 | Pruritus | FAERS: 1 | US FAERS | |
| 224 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 225 | Pulmonary function test decreased | FAERS: 1 | US FAERS | |
| 226 | Pulmonary pain | FAERS: 1 | US FAERS | |
| 227 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 228 | Respiratory distress | FAERS: 1 | US FAERS | |
| 229 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 230 | Shock | FAERS: 1 | US FAERS | |
| 231 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 232 | Skin hypertrophy | FAERS: 1 | US FAERS | |
| 233 | Somnolence | FAERS: 1 | US FAERS | |
| 234 | Stress | FAERS: 1 | US FAERS | |
| 235 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 236 | Swallow study abnormal | FAERS: 1 | US FAERS | |
| 237 | T-Cell Lymphoma | FAERS: 1 | US FAERS | |
| 238 | Terminal state | FAERS: 1 | US FAERS | |
| 239 | Therapy change | FAERS: 1 | US FAERS | |
| 240 | Throat cancer | FAERS: 1 | US FAERS | |
| 241 | Transaminases increased | FAERS: 1 | US FAERS | |
| 242 | Tuberculosis | FAERS: 1 | US FAERS | |
| 243 | Ulcer | FAERS: 1 | US FAERS | |
| 244 | Ureteropyelostomy | FAERS: 1 | US FAERS | |
| 245 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 246 | Venous thrombosis limb | FAERS: 1 | US FAERS | |
| 247 | Vertigo | FAERS: 1 | US FAERS | |
| 248 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 249 | White blood cell count abnormal | FAERS: 1 | US FAERS | |
| 250 | Product administration error | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.