lumacaftor, ivacaftor drug combination
(YQCGOSZYHRVOFW-UHFFFAOYSA-N)
Structure
- SMILES
- O=C(C1(CC1)c1ccc2c(c1)OC(O2)(F)F)Nc1ccc(c(n1)c1cccc(c1)C(=O)O)C.O=C(c1c[nH]c2c(c1=O)cccc2)Nc1cc(O)c(cc1C(C)(C)C)C(C)(C)C
- Molecular Formula:
- C48H46F2N4O8
- Molecular Weight:
- 844.898
- Log P:
- 9.9740
- Hydrogen Bond Acceptor:
- 11
- Hydrogen Bond Donor:
- 5
- TPSA:
- 179.94
- CAS Number(s):
- 1815566-23-4
Synonym(s)
1.
lumacaftor, ivacaftor drug combination
2.
Orkambi
3.
ivacaftor - lumacaftor
4.
ivacaftor, lumacaftor drug combination
External Link(s)
| MeSH | C000599212 |
| PubChem Compound | 71494926 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Infective pulmonary exacerbation of cystic fibrosis | FAERS: 364 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 2 | Chest discomfort | FAERS: 201 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 3 | Pulmonary function test decreased | FAERS: 194 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 4 | Malaise | FAERS: 101 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 5 | Infection | FAERS: 92 | US FAERS | |
| 6 | Fatigue | FAERS: 91 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 7 | Cystic Fibrosis | FAERS: 83 | US FAERS | |
| 8 | Nausea | FAERS: 72 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 9 | General physical health deterioration | FAERS: 63 | US FAERS | |
| 10 | Pneumonia | FAERS: 59 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 11 | Cystic fibrosis respiratory infection suppression | FAERS: 56 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Headache | FAERS: 53 | US FAERS | |
| 13 | Drug ineffective | FAERS: 51 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 14 | Weight decreased | FAERS: 49 | US FAERS | |
| 15 | Nasopharyngitis | FAERS: 46 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Chest Pain | FAERS: 44 | US FAERS | |
| 17 | Productive Cough | FAERS: 43 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 18 | Vomiting | FAERS: 41 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 19 | Influenza | FAERS: 39 | US FAERS | |
| 20 | Sinusitis | FAERS: 33 | US FAERS | |
| 21 | Drug dose omission | FAERS: 31 | US FAERS | |
| 22 | Abdominal Pain | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 23 | Anxiety | FAERS: 28 | US FAERS | |
| 24 | Intestinal Obstruction | FAERS: 27 | US FAERS | |
| 25 | Abdominal discomfort | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 26 | Flatulence | FAERS: 22 | US FAERS | |
| 27 | Alopecia | FAERS: 21 | US FAERS | |
| 28 | Bronchospasm | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 29 | Therapy cessation | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 30 | Asthenia | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 31 | Constipation | FAERS: 18 | US FAERS | |
| 32 | Dyspepsia | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 33 | Wheezing | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 34 | Feeling abnormal | FAERS: 16 | US FAERS | |
| 35 | Pain | FAERS: 16 | US FAERS | |
| 36 | Pneumothorax | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 37 | Respiratory Failure | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 38 | Dizziness | FAERS: 15 | US FAERS | |
| 39 | Asthma | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 40 | Increased bronchial secretion | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 41 | Alanine Aminotransferase Increased | FAERS: 13 | US FAERS | |
| 42 | Aspartate Aminotransferase Increased | FAERS: 13 | US FAERS | |
| 43 | Urticaria | FAERS: 13 | US FAERS | |
| 44 | Blood creatine phosphokinase increased | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Visual Impairment | FAERS: 12 | US FAERS | |
| 46 | Depressed mood | FAERS: 11 | US FAERS | |
| 47 | Oropharyngeal pain | FAERS: 11 | US FAERS | |
| 48 | Blood glucose increased | FAERS: 10 | US FAERS | |
| 49 | Hypersensitivity | FAERS: 10 | US FAERS | |
| 50 | Blood glucose decreased | FAERS: 9 | US FAERS | |
| 51 | Bronchial secretion retention | FAERS: 9 | US FAERS | |
| 52 | Menorrhagia | FAERS: 9 | US FAERS | |
| 53 | Dehydration | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 54 | Distal intestinal obstruction syndrome | FAERS: 8 | US FAERS | |
| 55 | Nephrolithiasis | FAERS: 8 | US FAERS | |
| 56 | Pericarditis | FAERS: 8 | US FAERS | |
| 57 | Rhabdomyolysis | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 58 | Chills | FAERS: 7 | US FAERS | |
| 59 | Extra dose administered | FAERS: 7 | US FAERS | |
| 60 | Lethargy | FAERS: 7 | US FAERS | |
| 61 | Pulmonary congestion | FAERS: 7 | US FAERS | |
| 62 | Anger | FAERS: 6 | US FAERS | |
| 63 | Insurance issue | FAERS: 6 | US FAERS | |
| 64 | Lower respiratory tract infection | FAERS: 6 | US FAERS | |
| 65 | Mood swings | FAERS: 6 | US FAERS | |
| 66 | Myalgia | FAERS: 6 | US FAERS | |
| 67 | Night sweats | FAERS: 6 | US FAERS | |
| 68 | Product dose omission | FAERS: 6 | US FAERS | |
| 69 | Pulmonary pain | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 70 | Sinus operation | FAERS: 6 | US FAERS | |
| 71 | Suicide attempt | FAERS: 6 | US FAERS | |
| 72 | Transplant | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 73 | Arthralgia | FAERS: 5 | US FAERS | |
| 74 | Back Pain | FAERS: 5 | US FAERS | |
| 75 | Cataract | FAERS: 5 | US FAERS | |
| 76 | Epistaxis | FAERS: 5 | US FAERS | |
| 77 | Hypoxia | FAERS: 5 | US FAERS | |
| 78 | Intercepted drug dispensing error | FAERS: 5 | US FAERS | |
| 79 | Memory impairment | FAERS: 5 | US FAERS | |
| 80 | Metrorrhagia | FAERS: 5 | US FAERS | |
| 81 | No adverse event | FAERS: 5 | US FAERS | |
| 82 | Product dispensing error | FAERS: 5 | US FAERS | |
| 83 | Pruritus | FAERS: 5 | US FAERS | |
| 84 | Respiratory distress | FAERS: 5 | US FAERS | |
| 85 | Somnolence | FAERS: 5 | US FAERS | |
| 86 | Thrombosis | FAERS: 5 | US FAERS | |
| 87 | Viral upper respiratory tract infection | FAERS: 5 | US FAERS | |
| 88 | Acute respiratory failure | FAERS: 4 | US FAERS | |
| 89 | Bradycardia | FAERS: 4 | US FAERS | |
| 90 | Drug dispensing error | FAERS: 4 | US FAERS | |
| 91 | Drug screen false positive | FAERS: 4 | US FAERS | |
| 92 | Dysgeusia | FAERS: 4 | US FAERS | |
| 93 | Incorrect dose administered | FAERS: 4 | US FAERS | |
| 94 | Lung Abscess | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 95 | Musculoskeletal chest pain | FAERS: 4 | US FAERS | |
| 96 | Respiratory tract infection viral | FAERS: 4 | US FAERS | |
| 97 | Retinal Detachment | FAERS: 4 | US FAERS | |
| 98 | Therapy non-responder | FAERS: 4 | US FAERS | |
| 99 | Acne | FAERS: 3 | US FAERS | |
| 100 | Bronchitis | FAERS: 3 | US FAERS | |
| 101 | Bronchopulmonary Aspergillosis | FAERS: 3 | US FAERS | |
| 102 | Chromaturia | FAERS: 3 | US FAERS | |
| 103 | Crying | FAERS: 3 | US FAERS | |
| 104 | Gastritis | FAERS: 3 | US FAERS | |
| 105 | Gastrointestinal infection | FAERS: 3 | US FAERS | |
| 106 | Gastrointestinal obstruction | FAERS: 3 | US FAERS | |
| 107 | Gastrostomy | FAERS: 3 | US FAERS | |
| 108 | Hepatitis | FAERS: 3 | US FAERS | |
| 109 | Inappropriate affect | FAERS: 3 | US FAERS | |
| 110 | Intentional product use issue | FAERS: 3 | US FAERS | |
| 111 | Lower respiratory tract infection bacterial | FAERS: 3 | US FAERS | |
| 112 | Muscle tightness | FAERS: 3 | US FAERS | |
| 113 | Palpitations | FAERS: 3 | US FAERS | |
| 114 | Portal Hypertension | FAERS: 3 | US FAERS | |
| 115 | Post procedural complication | FAERS: 3 | US FAERS | |
| 116 | Product use issue | FAERS: 3 | US FAERS | |
| 117 | Pulmonary Embolism | FAERS: 3 | US FAERS | |
| 118 | Respiratory tract congestion | FAERS: 3 | US FAERS | |
| 119 | Retching | FAERS: 3 | US FAERS | |
| 120 | Sepsis | FAERS: 3 | US FAERS | |
| 121 | Stevens-Johnson Syndrome | FAERS: 3 | US FAERS | |
| 122 | Therapy change | FAERS: 3 | US FAERS | |
| 123 | Tinnitus | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 124 | Tonsillectomy | FAERS: 3 | US FAERS | |
| 125 | Unevaluable event | FAERS: 3 | US FAERS | |
| 126 | Acute kidney injury | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 127 | Amnesia | FAERS: 2 | US FAERS | |
| 128 | Apathy | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 129 | Ascites | FAERS: 2 | US FAERS | |
| 130 | Bacterial disease carrier | FAERS: 2 | US FAERS | |
| 131 | Blood creatinine increased | FAERS: 2 | US FAERS | |
| 132 | Bowel movement irregularity | FAERS: 2 | US FAERS | |
| 133 | Bronchial Obstruction | FAERS: 2 | US FAERS | |
| 134 | Bruxism | FAERS: 2 | US FAERS | |
| 135 | Burkholderia cepacia complex infection | FAERS: 2 | US FAERS | |
| 136 | Chemical burn of gastrointestinal tract | FAERS: 2 | US FAERS | |
| 137 | Cholecystitis | FAERS: 2 | US FAERS | |
| 138 | Chronic respiratory failure | FAERS: 2 | US FAERS | |
| 139 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 140 | Clostridium difficile infection | FAERS: 2 | US FAERS | |
| 141 | Clostridium test positive | FAERS: 2 | US FAERS | |
| 142 | Colitis | FAERS: 2 | US FAERS | |
| 143 | Complication associated with device | FAERS: 2 | US FAERS | |
| 144 | Cystic fibrosis related diabetes | FAERS: 2 | US FAERS | |
| 145 | Cyst | FAERS: 2 | US FAERS | |
| 146 | Deep Vein Thrombosis | FAERS: 2 | US FAERS | |
| 147 | Dermatitis acneiform | FAERS: 2 | US FAERS | |
| 148 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 149 | Disease complication | FAERS: 2 | US FAERS | |
| 150 | Dysphonia | FAERS: 2 | US FAERS | |
| 151 | Economic problem | FAERS: 2 | US FAERS | |
| 152 | Emergency Care | FAERS: 2 | US FAERS | |
| 153 | Eosinophilia | FAERS: 2 | US FAERS | |
| 154 | Epilepsy | FAERS: 2 | US FAERS | |
| 155 | Eructation | FAERS: 2 | US FAERS | |
| 156 | Excessive eye blinking | FAERS: 2 | US FAERS | |
| 157 | Flushing | FAERS: 2 | US FAERS | |
| 158 | Hypertensive crisis | FAERS: 2 | US FAERS | |
| 159 | Hypotension | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 160 | Idiosyncratic drug reaction | FAERS: 2 | US FAERS | |
| 161 | Increased viscosity of bronchial secretion | FAERS: 2 | US FAERS | |
| 162 | Inflammation | FAERS: 2 | US FAERS | |
| 163 | Intentional dose omission | FAERS: 2 | US FAERS | |
| 164 | Laryngitis | FAERS: 2 | US FAERS | |
| 165 | Lower respiratory tract infection viral | FAERS: 2 | US FAERS | |
| 166 | Lyme Disease | FAERS: 2 | US FAERS | |
| 167 | Mental impairment | FAERS: 2 | US FAERS | |
| 168 | Mental status changes | FAERS: 2 | US FAERS | |
| 169 | Musculoskeletal discomfort | FAERS: 2 | US FAERS | |
| 170 | Mycobacterium test positive | FAERS: 2 | US FAERS | |
| 171 | Myopia | FAERS: 2 | US FAERS | |
| 172 | Pancreatitis | FAERS: 2 | US FAERS | |
| 173 | Paranasal sinus hypersecretion | FAERS: 2 | US FAERS | |
| 174 | Product supply issue | FAERS: 2 | US FAERS | |
| 175 | Product taste abnormal | FAERS: 2 | US FAERS | |
| 176 | Rash erythematous | FAERS: 2 | US FAERS | |
| 177 | Respiratory tract infection bacterial | FAERS: 2 | US FAERS | |
| 178 | Respiratory tract irritation | FAERS: 2 | US FAERS | |
| 179 | Ruptured cerebral aneurysm | FAERS: 2 | US FAERS | |
| 180 | Sinus headache | FAERS: 2 | US FAERS | |
| 181 | Thirst | FAERS: 2 | US FAERS | |
| 182 | Upper-airway cough syndrome | FAERS: 2 | US FAERS | |
| 183 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 184 | intensive care | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 185 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 186 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 187 | Acute psychosis | FAERS: 1 | US FAERS | |
| 188 | Adverse event | FAERS: 1 | US FAERS | |
| 189 | Agitation | FAERS: 1 | US FAERS | |
| 190 | Angioplasty | FAERS: 1 | US FAERS | |
| 191 | Aphonia | FAERS: 1 | US FAERS | |
| 192 | Aspergilloma | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 193 | Astigmatism | FAERS: 1 | US FAERS | |
| 194 | Atrial Fibrillation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 195 | Bedridden | FAERS: 1 | US FAERS | |
| 196 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 197 | Bladder dysfunction | FAERS: 1 | US FAERS | |
| 198 | Blood creatine phosphokinase BB increased | FAERS: 1 | US FAERS | |
| 199 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 200 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 201 | Blood testosterone increased | FAERS: 1 | US FAERS | |
| 202 | Blood thyroid stimulating hormone increased | FAERS: 1 | US FAERS | |
| 203 | Blood urine present | FAERS: 1 | US FAERS | |
| 204 | Bone pain | FAERS: 1 | US FAERS | |
| 205 | Brain Abscess | FAERS: 1 | US FAERS | |
| 206 | Breast tenderness | FAERS: 1 | US FAERS | |
| 207 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 208 | Bronchoscopy | FAERS: 1 | US FAERS | |
| 209 | Cardiac asthma | FAERS: 1 | US FAERS | |
| 210 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 211 | Child-Pugh-Turcotte score increased | FAERS: 1 | US FAERS | |
| 212 | Choking | FAERS: 1 | US FAERS | |
| 213 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 214 | Cholestasis | FAERS: 1 | US FAERS | |
| 215 | Compression fracture | FAERS: 1 | US FAERS | |
| 216 | Congenital kyphoscoliosis | FAERS: 1 | US FAERS | |
| 217 | Cyanosis | FAERS: 1 | US FAERS | |
| 218 | Cystic fibrosis hepatic disease | FAERS: 1 | US FAERS | |
| 219 | Dacryostenosis acquired | FAERS: 1 | US FAERS | |
| 220 | Dark circles under eyes | FAERS: 1 | US FAERS | |
| 221 | Device related thrombosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 222 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 223 | Diffuse panbronchiolitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 224 | Diplopia | FAERS: 1 | US FAERS | |
| 225 | Disorientation | FAERS: 1 | US FAERS | |
| 226 | Drug administration error | FAERS: 1 | US FAERS | |
| 227 | Drug level decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 228 | Dry skin | FAERS: 1 | US FAERS | |
| 229 | Ear discomfort | FAERS: 1 | US FAERS | |
| 230 | Educational problem | FAERS: 1 | US FAERS | |
| 231 | Emotional disorder | FAERS: 1 | US FAERS | |
| 232 | Enuresis | FAERS: 1 | US FAERS | |
| 233 | Environmental Exposure | FAERS: 1 | US FAERS | |
| 234 | Enzyme level abnormal | FAERS: 1 | US FAERS | |
| 235 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 236 | Erythema | FAERS: 1 | US FAERS | |
| 237 | Expired product administered | FAERS: 1 | US FAERS | |
| 238 | Exposure to toxic agent | FAERS: 1 | US FAERS | |
| 239 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 240 | Forced expiratory volume abnormal | FAERS: 1 | US FAERS | |
| 241 | Frustration tolerance decreased | FAERS: 1 | US FAERS | |
| 242 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 243 | Genital pain | FAERS: 1 | US FAERS | |
| 244 | Gingivitis | FAERS: 1 | US FAERS | |
| 245 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 246 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 247 | Hormone level abnormal | FAERS: 1 | US FAERS | |
| 248 | Hunger | FAERS: 1 | US FAERS | |
| 249 | Hypercapnia | FAERS: 1 | US FAERS | |
| 250 | Hypertensive emergency | FAERS: 1 | US FAERS | |
| 251 | Hyperventilation | FAERS: 1 | US FAERS | |
| 252 | Hypohidrosis | FAERS: 1 | US FAERS | |
| 253 | Immune tolerance induction | FAERS: 1 | US FAERS | |
| 254 | Impaired work ability | FAERS: 1 | US FAERS | |
| 255 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 256 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 257 | Infectious colitis | FAERS: 1 | US FAERS | |
| 258 | Influenza B virus test positive | FAERS: 1 | US FAERS | |
| 259 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 260 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 261 | Intercepted drug prescribing error | FAERS: 1 | US FAERS | |
| 262 | Joint swelling | FAERS: 1 | US FAERS | |
| 263 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 264 | Leukopenia | FAERS: 1 | US FAERS | |
| 265 | Liver function test decreased | FAERS: 1 | US FAERS | |
| 266 | Liver transplant rejection | FAERS: 1 | US FAERS | |
| 267 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 268 | Lower respiratory tract infection fungal | FAERS: 1 | US FAERS | |
| 269 | Lung infection pseudomonal | FAERS: 1 | US FAERS | |
| 270 | Malabsorption | FAERS: 1 | US FAERS | |
| 271 | Malnutrition | FAERS: 1 | US FAERS | |
| 272 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 273 | Medication Error | FAERS: 1 | US FAERS | |
| 274 | Menopause | FAERS: 1 | US FAERS | |
| 275 | Multiple allergies | FAERS: 1 | US FAERS | |
| 276 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 277 | Muscle strain | FAERS: 1 | US FAERS | |
| 278 | Mycobacterium abscessus Infection | FAERS: 1 | US FAERS | |
| 279 | Myositis | FAERS: 1 | US FAERS | |
| 280 | Nasal Polyps | FAERS: 1 | US FAERS | |
| 281 | Nasopharyngeal surgery | FAERS: 1 | US FAERS | |
| 282 | Negativism | FAERS: 1 | US FAERS | |
| 283 | Obesity | FAERS: 1 | US FAERS | |
| 284 | Optic Neuritis | FAERS: 1 | US FAERS | |
| 285 | Oral pain | FAERS: 1 | US FAERS | |
| 286 | Osteopenia | FAERS: 1 | US FAERS | |
| 287 | Osteoporosis | FAERS: 1 | US FAERS | |
| 288 | Overdose | FAERS: 1 | US FAERS | |
| 289 | Oxygen consumption increased | FAERS: 1 | US FAERS | |
| 290 | PCO2 increased | FAERS: 1 | US FAERS | |
| 291 | Pallor | FAERS: 1 | US FAERS | |
| 292 | Pancreatic Cyst | FAERS: 1 | US FAERS | |
| 293 | Pancreatic carcinoma | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 294 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 295 | Personality Change | FAERS: 1 | US FAERS | |
| 296 | Petechiae | FAERS: 1 | US FAERS | |
| 297 | Pleurisy | FAERS: 1 | US FAERS | |
| 298 | Polymenorrhagia | FAERS: 1 | US FAERS | |
| 299 | Poor personal hygiene | FAERS: 1 | US FAERS | |
| 300 | Post-tussive vomiting | FAERS: 1 | US FAERS | |
| 301 | Posterior reversible encephalopathy syndrome | FAERS: 1 | US FAERS | |
| 302 | Pre-Eclampsia | FAERS: 1 | US FAERS | |
| 303 | Prescribed underdose | FAERS: 1 | US FAERS | |
| 304 | Product communication issue | FAERS: 1 | US FAERS | |
| 305 | Product formulation issue | FAERS: 1 | US FAERS | |
| 306 | Product label confusion | FAERS: 1 | US FAERS | |
| 307 | Product preparation error | FAERS: 1 | US FAERS | |
| 308 | Product storage error | FAERS: 1 | US FAERS | |
| 309 | Product substitution issue | FAERS: 1 | US FAERS | |
| 310 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 311 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 312 | Pulmonary function test increased | FAERS: 1 | US FAERS | |
| 313 | Pulmonary necrosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 314 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 315 | Renal pain | FAERS: 1 | US FAERS | |
| 316 | Renal tubular injury | FAERS: 1 | US FAERS | |
| 317 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 318 | Respiratory tract infection fungal | FAERS: 1 | US FAERS | |
| 319 | Retinal pigmentation | FAERS: 1 | US FAERS | |
| 320 | Retro-orbital neoplasm | FAERS: 1 | US FAERS | |
| 321 | Rhinitis | FAERS: 1 | US FAERS | |
| 322 | Rhinovirus infection | FAERS: 1 | US FAERS | |
| 323 | Secretion discharge | FAERS: 1 | US FAERS | |
| 324 | Self-induced vomiting | FAERS: 1 | US FAERS | |
| 325 | Septic Shock | FAERS: 1 | US FAERS | |
| 326 | Sinus polyp | FAERS: 1 | US FAERS | |
| 327 | Skin lesion | FAERS: 1 | US FAERS | |
| 328 | Sperm concentration decreased | FAERS: 1 | US FAERS | |
| 329 | Splenomegaly | FAERS: 1 | US FAERS | |
| 330 | Staphylococcal pharyngitis | FAERS: 1 | US FAERS | |
| 331 | Staphylococcus test positive | FAERS: 1 | US FAERS | |
| 332 | Stress at work | FAERS: 1 | US FAERS | |
| 333 | Stress | FAERS: 1 | US FAERS | |
| 334 | Subileus | FAERS: 1 | US FAERS | |
| 335 | Sunburn | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 336 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 337 | Syncope | FAERS: 1 | US FAERS | |
| 338 | Tachycardia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 339 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 340 | Terminal state | FAERS: 1 | US FAERS | |
| 341 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 342 | Tooth Extraction | FAERS: 1 | US FAERS | |
| 343 | Transaminases increased | FAERS: 1 | US FAERS | |
| 344 | Transcription medication error | FAERS: 1 | US FAERS | |
| 345 | Tremor | FAERS: 1 | US FAERS | |
| 346 | Tuberculosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 347 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 348 | White blood cell count decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 349 | jaundice | FAERS: 1 | US FAERS | |
| 350 | Product administration error | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.