Clofazimine
(WDQPAMHFFCXSNU-UHFFFAOYSA-N)
Structure
- SMILES
- Clc1ccc(cc1)Nc1cc2nc3ccccc3n(c2cc1=NC(C)C)c1ccc(cc1)Cl
- Type(s)
- Approved; Investigational
- ATC code(s)
- J04BA01
- Molecular Formula:
- C27H22Cl2N4
- Molecular Weight:
- 473.396
- Log P:
- 7.6112
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 1
- TPSA:
- 42.21
- CAS Number(s):
- 2030-63-9
Synonym(s)
1.
Clofazimine
2.
B-663
3.
G-30,320
4.
Lamprene
5.
N,5-Bis(4-chlorophenyl)-3,5-dihydro-3-((1-methylethyl)imino)-2-phenazinamine
6.
B 663
7.
B663
8.
G 30,320
9.
G30,320
External Link(s)
| MeSH | D002991 |
| PubChem Compound | 2794 |
| BindingDB | 50378783 50318909 |
| ChEBI | 3749 |
| CHEMBL | CHEMBL1369407 CHEMBL1083384 CHEMBL1292 |
| DrugBank | DB00845 |
| DrugCentral | 692 |
| IUPHAR/BPS Guide to PHARMACOLOGY | 9184 |
| KEGG | cpd:C06915 dr:D00278 |
| Therapeutic Target Database | D0S5UH D07NPR |
| ZINC | 100037101 253916263 17953024 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Abdominal Pain | FAERS: 6 | 16295502 | CTD US FAERS |
| 2 | Weight decreased | FAERS: 5 | SIDER US FAERS | |
| 3 | Fatigue | FAERS: 4 | SIDER US FAERS | |
| 4 | Headache | FAERS: 4 | SIDER US FAERS | |
| 5 | Vomiting | FAERS: 4 | SIDER US FAERS | |
| 6 | Long QT Syndrome | FAERS: 3 | US FAERS | |
| 7 | Product use in unapproved indication | FAERS: 3 | US FAERS | |
| 8 | Alopecia | FAERS: 2 | US FAERS | |
| 9 | Aspartate Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 10 | Asthenia | FAERS: 2 | SIDER US FAERS | |
| 11 | Blood immunoglobulin G decreased | FAERS: 2 | US FAERS | |
| 12 | Bronchiectasis | FAERS: 2 | US FAERS | |
| 13 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 14 | Chest Pain | FAERS: 2 | US FAERS | |
| 15 | Complement factor C3 increased | FAERS: 2 | US FAERS | |
| 16 | Deafness | FAERS: 2 | US FAERS | |
| 17 | Dehydration | FAERS: 2 | US FAERS | |
| 18 | Drug toxicity | FAERS: 2 | US FAERS | |
| 19 | Eosinophil percentage increased | FAERS: 2 | US FAERS | |
| 20 | Epistaxis | FAERS: 2 | US FAERS | |
| 21 | Histiocytosis | FAERS: 2 | US FAERS | |
| 22 | Lip swelling | FAERS: 2 | US FAERS | |
| 23 | Nausea | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 24 | Night sweats | FAERS: 2 | US FAERS | |
| 25 | Oral fungal infection | FAERS: 2 | US FAERS | |
| 26 | Pneumonia | FAERS: 2 | US FAERS | |
| 27 | Productive Cough | FAERS: 2 | US FAERS | |
| 28 | Pulmonary Hypertension | FAERS: 2 | US FAERS | |
| 29 | Respiratory Failure | FAERS: 2 | US FAERS | |
| 30 | Rheumatoid Factor | FAERS: 2 | US FAERS | |
| 31 | Septic Shock | FAERS: 2 | US FAERS | |
| 32 | Synovitis | FAERS: 2 | US FAERS | |
| 33 | Urticaria | FAERS: 2 | US FAERS | |
| 34 | Visual Impairment | FAERS: 2 | SIDER US FAERS | |
| 35 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 36 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 37 | Abscess | FAERS: 1 | US FAERS | |
| 38 | Accidental drug intake by child | FAERS: 1 | US FAERS | |
| 39 | Accidental exposure | FAERS: 1 | US FAERS | |
| 40 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 41 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 42 | Angioedema | FAERS: 1 | US FAERS | |
| 43 | Arthralgia | FAERS: 1 | US FAERS | |
| 44 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 45 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 46 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 47 | Bronchitis | FAERS: 1 | US FAERS | |
| 48 | Cerebral calcification | FAERS: 1 | US FAERS | |
| 49 | Concomitant disease progression | FAERS: 1 | US FAERS | |
| 50 | Critical Illness | FAERS: 1 | US FAERS | |
| 51 | Crystal deposit intestine | FAERS: 1 | US FAERS | |
| 52 | Deposit eye | FAERS: 1 | US FAERS | |
| 53 | Disease recurrence | FAERS: 1 | US FAERS | |
| 54 | Dizziness | FAERS: 1 | SIDER US FAERS | |
| 55 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 56 | Dry skin | FAERS: 1 | US FAERS | |
| 57 | Duodenitis | FAERS: 1 | US FAERS | |
| 58 | Dyspepsia | FAERS: 1 | US FAERS | |
| 59 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 60 | Empyema | FAERS: 1 | US FAERS | |
| 61 | Essential Hypertension | FAERS: 1 | US FAERS | |
| 62 | Facial wasting | FAERS: 1 | US FAERS | |
| 63 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 64 | Gangrene | FAERS: 1 | US FAERS | |
| 65 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 66 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 67 | Hemiplegia | FAERS: 1 | US FAERS | |
| 68 | Hypotension | FAERS: 1 | US FAERS | |
| 69 | Ileus | FAERS: 1 | US FAERS | |
| 70 | Implantable defibrillator insertion | FAERS: 1 | US FAERS | |
| 71 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 72 | Infection | FAERS: 1 | US FAERS | |
| 73 | Intestinal Obstruction | FAERS: 1 | SIDER US FAERS | |
| 74 | Intubation | FAERS: 1 | US FAERS | |
| 75 | Joint swelling | FAERS: 1 | US FAERS | |
| 76 | Lethargy | FAERS: 1 | US FAERS | |
| 77 | Leukocytosis | FAERS: 1 | US FAERS | |
| 78 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 79 | Malabsorption | FAERS: 1 | US FAERS | |
| 80 | Malnutrition | FAERS: 1 | US FAERS | |
| 81 | Medication Error | FAERS: 1 | US FAERS | |
| 82 | Melkersson-Rosenthal Syndrome | FAERS: 1 | US FAERS | |
| 83 | Meningitis | FAERS: 1 | US FAERS | |
| 84 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 85 | Myocardial fibrosis | FAERS: 1 | US FAERS | |
| 86 | Neck Pain | FAERS: 1 | US FAERS | |
| 87 | Neuritis | FAERS: 1 | US FAERS | |
| 88 | Optic Neuropathy | FAERS: 1 | US FAERS | |
| 89 | Overdose | FAERS: 1 | US FAERS | |
| 90 | Pain | FAERS: 1 | US FAERS | |
| 91 | Pallor | FAERS: 1 | US FAERS | |
| 92 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 93 | Peritonitis | FAERS: 1 | US FAERS | |
| 94 | Product deposit | FAERS: 1 | US FAERS | |
| 95 | Product use issue | FAERS: 1 | US FAERS | |
| 96 | Pruritus | FAERS: 1 | SIDER US FAERS | |
| 97 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 98 | Pyoderma Gangrenosum | FAERS: 1 | 7387877 | CTD US FAERS |
| 99 | Retching | FAERS: 1 | US FAERS | |
| 100 | Reticulocytosis | FAERS: 1 | US FAERS | |
| 101 | Sciatica | FAERS: 1 | US FAERS | |
| 102 | Scleral pigmentation | FAERS: 1 | US FAERS | |
| 103 | Sepsis | FAERS: 1 | US FAERS | |
| 104 | Shock | FAERS: 1 | US FAERS | |
| 105 | Sinusitis | FAERS: 1 | US FAERS | |
| 106 | Suicide attempt | FAERS: 1 | US FAERS | |
| 107 | Therapy change | FAERS: 1 | US FAERS | |
| 108 | Tremor | FAERS: 1 | US FAERS | |
| 109 | Troponin increased | FAERS: 1 | US FAERS | |
| 110 | Type 2 lepra reaction | FAERS: 1 | US FAERS | |
| 111 | Vascular encephalopathy | FAERS: 1 | US FAERS | |
| 112 | Venous Insufficiency | FAERS: 1 | US FAERS | |
| 113 | Wheezing | FAERS: 1 | US FAERS | |
| 114 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 115 | jaundice | FAERS: 1 | SIDER US FAERS | |
| 116 | Agranulocytosis | 19274991 20140364 | CTD | |
| 117 | Anemia, Hemolytic | 19274991 20140364 | CTD | |
| 118 | Anorexia | SIDER | ||
| 119 | Bladder pain | SIDER | ||
| 120 | Bone pain | SIDER | ||
| 121 | Cardiomyopathies | 29258954 | CTD | |
| 122 | Cheilosis | SIDER | ||
| 123 | Completed Suicide | SIDER | ||
| 124 | Constipation | SIDER | ||
| 125 | Corneal pigmentation | SIDER | ||
| 126 | Cystitis | SIDER | ||
| 127 | Dermatitis acneiform | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 128 | Dermatitis | SIDER | ||
| 129 | Diarrhea | 16295502 | CTD | |
| 130 | Drowsiness | SIDER | ||
| 131 | Embolism | SIDER | ||
| 132 | Enteritis | SIDER | ||
| 133 | Eosinophilia | SIDER | ||
| 134 | Epigastric pain | SIDER | ||
| 135 | Hepatitis | SIDER | ||
| 136 | Hepatomegaly | SIDER | ||
| 137 | Hyperkinesia | Canada Vigilance: 1 | Canada Vigilance | |
| 138 | Hypokalemia | 16295502 | CTD | |
| 139 | Leprosy, Lepromatous | 16038251 16638414 | CTD | |
| 140 | Leprosy, Multibacillary | 20140364 | CTD | |
| 141 | Leprosy | 6260900 16015260 | CTD | |
| 142 | Lymphadenopathy | SIDER | ||
| 143 | Myalgia | Canada Vigilance: 2 | Canada Vigilance | |
| 144 | Neuralgia | SIDER | ||
| 145 | Phototoxicity | SIDER | ||
| 146 | Restless Legs Syndrome | Canada Vigilance: 1 | Canada Vigilance | |
| 147 | Retinal pigmentation | Canada Vigilance: 1 | Canada Vigilance | |
| 148 | Somnolence | SIDER | ||
| 149 | Splenic Infarction | 7387877 | CTD SIDER | |
| 150 | Suicide | SIDER | ||
| 151 | Taste Disorders | SIDER | ||
| 152 | Thromboembolism | SIDER | ||
| 153 | Vascular pain | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.