Methylergonovine
(UNBRKDKAWYKMIV-QWQRMKEZSA-N)
Structure
- SMILES
- CC[C@H](NC(=O)[C@H]1CN(C)[C@H]2C(=C1)c1cccc3c1c(C2)c[nH]3)CO
- Type(s)
- Approved
- ATC code(s)
- G02AB01; G02AC01
- Molecular Formula:
- C20H25N3O2
- Molecular Weight:
- 339.431
- Log P:
- 2.2535
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 3
- TPSA:
- 68.36
- CAS Number(s):
- 113-42-8
Synonym(s)
1.
Methylergonovine
2.
Methylergobasin
3.
Methylergometrin
4.
Methergin
5.
Methergine
6.
Methylergometrine
7.
Methylergometrine Maleate
8.
Methylergonovine Maleate
9.
Méthergin
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Wrong drug administered | FAERS: 64 | OFFSIDES US FAERS | |
| 2 | Drug exposure during pregnancy | FAERS: 49 | OFFSIDES US FAERS | |
| 3 | Vomiting | FAERS: 45 | SIDER US FAERS | |
| 4 | Abdominal Pain | FAERS: 31 | 8376101 | CTD OFFSIDES SIDER US FAERS |
| 5 | Accidental exposure | FAERS: 25 | OFFSIDES US FAERS | |
| 6 | Cyanosis | FAERS: 24 | OFFSIDES US FAERS | |
| 7 | Headache | FAERS: 21 | 8376101 | CTD SIDER US FAERS |
| 8 | Dizziness | FAERS: 19 | OFFSIDES SIDER US FAERS | |
| 9 | Maternal exposure during pregnancy | FAERS: 16 | US FAERS | |
| 10 | Drug exposure via breast milk | FAERS: 15 | OFFSIDES US FAERS | |
| 11 | Accidental drug intake by child | FAERS: 13 | US FAERS | |
| 12 | Agitation | FAERS: 13 | US FAERS | |
| 13 | Nausea | FAERS: 13 | SIDER US FAERS | |
| 14 | Hypotension | FAERS: 12 | SIDER US FAERS | |
| 15 | Medication Error | FAERS: 12 | US FAERS | |
| 16 | Tachycardia | FAERS: 12 | SIDER US FAERS | |
| 17 | Malaise | FAERS: 11 | US FAERS | |
| 18 | Somnolence | FAERS: 11 | US FAERS | |
| 19 | No adverse event | FAERS: 10 | US FAERS | |
| 20 | Mydriasis | FAERS: 9 | US FAERS | |
| 21 | Respiratory Depression | FAERS: 9 | US FAERS | |
| 22 | Sepsis | FAERS: 9 | US FAERS | |
| 23 | Bradycardia | FAERS: 8 | 18831911 | CTD OFFSIDES SIDER US FAERS |
| 24 | Tremor | FAERS: 8 | US FAERS | |
| 25 | Crying | FAERS: 7 | US FAERS | |
| 26 | Feeling abnormal | FAERS: 7 | OFFSIDES US FAERS | |
| 27 | Hypoxia | FAERS: 7 | OFFSIDES US FAERS | |
| 28 | Intentional drug misuse | FAERS: 7 | OFFSIDES US FAERS | |
| 29 | Oliguria | FAERS: 7 | OFFSIDES US FAERS | |
| 30 | Restlessness | FAERS: 7 | US FAERS | |
| 31 | Vaginal Discharge | FAERS: 7 | US FAERS | |
| 32 | Back Pain | FAERS: 6 | US FAERS | |
| 33 | Bronchospasm | FAERS: 6 | US FAERS | |
| 34 | Complication of delivery | FAERS: 6 | OFFSIDES US FAERS | |
| 35 | Gastrointestinal hypermotility | FAERS: 6 | US FAERS | |
| 36 | Hypertensive Encephalopathy | FAERS: 6 | US FAERS | |
| 37 | Venous Insufficiency | FAERS: 6 | US FAERS | |
| 38 | Accidental exposure to product | FAERS: 5 | US FAERS | |
| 39 | Anxiety | FAERS: 5 | US FAERS | |
| 40 | Hypercapnia | FAERS: 5 | US FAERS | |
| 41 | Lethargy | FAERS: 5 | US FAERS | |
| 42 | Nervousness | FAERS: 5 | US FAERS | |
| 43 | Product quality issue | FAERS: 5 | US FAERS | |
| 44 | Respiratory distress | FAERS: 5 | US FAERS | |
| 45 | Shock | FAERS: 5 | US FAERS | |
| 46 | Acidosis | FAERS: 4 | US FAERS | |
| 47 | Altered state of consciousness | FAERS: 4 | OFFSIDES US FAERS | |
| 48 | Aphasia | FAERS: 4 | US FAERS | |
| 49 | Cerebral Infarction | FAERS: 4 | US FAERS | |
| 50 | Chest Pain | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 51 | Depressed Level of Consciousness | FAERS: 4 | US FAERS | |
| 52 | Drug toxicity | FAERS: 4 | US FAERS | |
| 53 | General physical condition abnormal | FAERS: 4 | US FAERS | |
| 54 | General physical health deterioration | FAERS: 4 | US FAERS | |
| 55 | Menorrhagia | FAERS: 4 | US FAERS | |
| 56 | Opisthotonus | FAERS: 4 | US FAERS | |
| 57 | Pain | FAERS: 4 | US FAERS | |
| 58 | Pallor | FAERS: 4 | US FAERS | |
| 59 | Palpitations | FAERS: 4 | SIDER US FAERS | |
| 60 | Product use in unapproved indication | FAERS: 4 | US FAERS | |
| 61 | Abdominal discomfort | FAERS: 3 | US FAERS | |
| 62 | Accidental overdose | FAERS: 3 | OFFSIDES US FAERS | |
| 63 | Alanine Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 64 | Anorexia | FAERS: 3 | US FAERS | |
| 65 | Aspartate Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 66 | Bone pain | FAERS: 3 | OFFSIDES US FAERS | |
| 67 | Cardiac Arrest | FAERS: 3 | US FAERS | |
| 68 | Chest discomfort | FAERS: 3 | US FAERS | |
| 69 | Complications of maternal exposure to therapeutic drugs | FAERS: 3 | OFFSIDES US FAERS | |
| 70 | Diplopia | FAERS: 3 | OFFSIDES US FAERS | |
| 71 | Drug administration error | FAERS: 3 | OFFSIDES US FAERS | |
| 72 | Dysarthria | FAERS: 3 | US FAERS | |
| 73 | Fatigue | FAERS: 3 | US FAERS | |
| 74 | Feeling Cold | FAERS: 3 | US FAERS | |
| 75 | Myalgia | FAERS: 3 | US FAERS | |
| 76 | Myocardial Infarction | FAERS: 3 | CTD US FAERS | |
| 77 | Presyncope | FAERS: 3 | US FAERS | |
| 78 | Rhinitis | FAERS: 3 | US FAERS | |
| 79 | Thirst | FAERS: 3 | US FAERS | |
| 80 | Toxicity to various agents | FAERS: 3 | US FAERS | |
| 81 | Ventricular hypokinesia | FAERS: 3 | OFFSIDES US FAERS | |
| 82 | Angiogram abnormal | FAERS: 2 | OFFSIDES US FAERS | |
| 83 | Asthenia | FAERS: 2 | OFFSIDES US FAERS | |
| 84 | Asthma | FAERS: 2 | OFFSIDES US FAERS | |
| 85 | Base excess decreased | FAERS: 2 | US FAERS | |
| 86 | Cerebellar Ataxia | FAERS: 2 | OFFSIDES US FAERS | |
| 87 | Cerebellar infarction | FAERS: 2 | OFFSIDES US FAERS | |
| 88 | Cold sweat | FAERS: 2 | US FAERS | |
| 89 | Deep Vein Thrombosis | FAERS: 2 | US FAERS | |
| 90 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 91 | Drug ineffective | FAERS: 2 | US FAERS | |
| 92 | Epilepsy | FAERS: 2 | US FAERS | |
| 93 | Erythema | FAERS: 2 | US FAERS | |
| 94 | Hemiparesis | FAERS: 2 | US FAERS | |
| 95 | Hemiplegia | FAERS: 2 | US FAERS | |
| 96 | Hepatic congestion | FAERS: 2 | US FAERS | |
| 97 | Hyperreflexia | FAERS: 2 | US FAERS | |
| 98 | Hysterectomy | FAERS: 2 | OFFSIDES US FAERS | |
| 99 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 100 | Maternal exposure before pregnancy | FAERS: 2 | US FAERS | |
| 101 | Neonatal disorder | FAERS: 2 | US FAERS | |
| 102 | Overdose | FAERS: 2 | US FAERS | |
| 103 | Posturing | FAERS: 2 | US FAERS | |
| 104 | Pregnancy | FAERS: 2 | US FAERS | |
| 105 | Pulmonary arterial hypertension | FAERS: 2 | US FAERS | |
| 106 | Rales | FAERS: 2 | OFFSIDES US FAERS | |
| 107 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 108 | Scleroderma | FAERS: 2 | US FAERS | |
| 109 | Uterine spasm | FAERS: 2 | OFFSIDES US FAERS | |
| 110 | Vasculitis | FAERS: 2 | US FAERS | |
| 111 | Vertigo | FAERS: 2 | US FAERS | |
| 112 | Visual disturbance | FAERS: 2 | OFFSIDES US FAERS | |
| 113 | jaundice | FAERS: 2 | US FAERS | |
| 114 | Abasia | FAERS: 1 | US FAERS | |
| 115 | Acute myocardial infarction | FAERS: 1 | SIDER US FAERS | |
| 116 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 117 | Afterbirth pain | FAERS: 1 | US FAERS | |
| 118 | Amnesia | FAERS: 1 | US FAERS | |
| 119 | Angina Pectoris | FAERS: 1 | SIDER US FAERS | |
| 120 | Angioedema | FAERS: 1 | US FAERS | |
| 121 | Anticoagulation drug level below therapeutic | FAERS: 1 | US FAERS | |
| 122 | Apathy | FAERS: 1 | OFFSIDES US FAERS | |
| 123 | Apparent death | FAERS: 1 | US FAERS | |
| 124 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 125 | Arthritis | FAERS: 1 | US FAERS | |
| 126 | Atrioventricular Block | FAERS: 1 | 12706285 | CTD OFFSIDES SIDER US FAERS |
| 127 | Biopsy | FAERS: 1 | US FAERS | |
| 128 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 129 | Blood lactate dehydrogenase abnormal | FAERS: 1 | US FAERS | |
| 130 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 131 | Blood urine present | FAERS: 1 | OFFSIDES US FAERS | |
| 132 | Burning sensation | FAERS: 1 | US FAERS | |
| 133 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 134 | Cerebral artery stenosis | FAERS: 1 | US FAERS | |
| 135 | Cerebral vasoconstriction | FAERS: 1 | US FAERS | |
| 136 | Cerebrovascular stenosis | FAERS: 1 | US FAERS | |
| 137 | Cholelithotomy | FAERS: 1 | US FAERS | |
| 138 | Congenital diaphragmatic hernia | FAERS: 1 | US FAERS | |
| 139 | Depressed mood | FAERS: 1 | US FAERS | |
| 140 | Discomfort | FAERS: 1 | US FAERS | |
| 141 | Disease recurrence | FAERS: 1 | US FAERS | |
| 142 | Disorientation | FAERS: 1 | US FAERS | |
| 143 | Drug dose omission | FAERS: 1 | US FAERS | |
| 144 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 145 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 146 | Drug resistance | FAERS: 1 | US FAERS | |
| 147 | Drug withdrawal maintenance therapy | FAERS: 1 | US FAERS | |
| 148 | Dystonia | FAERS: 1 | US FAERS | |
| 149 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 150 | Encephalitis | FAERS: 1 | US FAERS | |
| 151 | Endometriosis | FAERS: 1 | US FAERS | |
| 152 | Erysipelas | FAERS: 1 | US FAERS | |
| 153 | Exaggerated startle response | FAERS: 1 | US FAERS | |
| 154 | Feeding disorder neonatal | FAERS: 1 | OFFSIDES US FAERS | |
| 155 | Formication | FAERS: 1 | OFFSIDES US FAERS | |
| 156 | Gastroenteritis | FAERS: 1 | OFFSIDES US FAERS | |
| 157 | Gaze palsy | FAERS: 1 | OFFSIDES US FAERS | |
| 158 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 159 | Hypokinesia | FAERS: 1 | US FAERS | |
| 160 | Hypoventilation | FAERS: 1 | US FAERS | |
| 161 | Influenza | FAERS: 1 | US FAERS | |
| 162 | Intrauterine infection | FAERS: 1 | US FAERS | |
| 163 | Intubation | FAERS: 1 | OFFSIDES US FAERS | |
| 164 | Mental status changes | FAERS: 1 | OFFSIDES US FAERS | |
| 165 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 166 | Myoclonus | FAERS: 1 | US FAERS | |
| 167 | Nail bed tenderness | FAERS: 1 | US FAERS | |
| 168 | Nodule on extremity | FAERS: 1 | US FAERS | |
| 169 | Open wound | FAERS: 1 | US FAERS | |
| 170 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 171 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 172 | Placenta Accreta | FAERS: 1 | US FAERS | |
| 173 | Pneumothorax | FAERS: 1 | US FAERS | |
| 174 | Polyuria | FAERS: 1 | US FAERS | |
| 175 | Post procedural complication | FAERS: 1 | US FAERS | |
| 176 | Postoperative wound complication | FAERS: 1 | US FAERS | |
| 177 | Product label confusion | FAERS: 1 | US FAERS | |
| 178 | Pruritus | FAERS: 1 | US FAERS | |
| 179 | Pulmonary Valve Stenosis | FAERS: 1 | US FAERS | |
| 180 | Pulmonary arterial pressure increased | FAERS: 1 | US FAERS | |
| 181 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 182 | Quadriparesis | FAERS: 1 | US FAERS | |
| 183 | Retching | FAERS: 1 | US FAERS | |
| 184 | Reversible cerebral vasoconstriction syndrome | FAERS: 1 | US FAERS | |
| 185 | Sluggishness | FAERS: 1 | US FAERS | |
| 186 | Suppressed lactation | FAERS: 1 | OFFSIDES US FAERS | |
| 187 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 188 | Syncope | FAERS: 1 | US FAERS | |
| 189 | Therapy change | FAERS: 1 | US FAERS | |
| 190 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 191 | Thrombosis | FAERS: 1 | US FAERS | |
| 192 | Tonic clonic movements | FAERS: 1 | OFFSIDES US FAERS | |
| 193 | Traumatic Brain Injury | FAERS: 1 | US FAERS | |
| 194 | Trismus | FAERS: 1 | US FAERS | |
| 195 | Troponin I increased | FAERS: 1 | US FAERS | |
| 196 | Urinary Retention | FAERS: 1 | US FAERS | |
| 197 | Uterine Rupture | FAERS: 1 | US FAERS | |
| 198 | Uterine contractions during pregnancy | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 199 | Vasospasm | FAERS: 1 | SIDER US FAERS | |
| 200 | Ventricular hypoplasia | FAERS: 1 | US FAERS | |
| 201 | Vertebrobasilar Insufficiency | FAERS: 1 | US FAERS | |
| 202 | White matter lesion | FAERS: 1 | US FAERS | |
| 203 | Wound Complication | FAERS: 1 | US FAERS | |
| 204 | Yawning | FAERS: 1 | OFFSIDES US FAERS | |
| 205 | Acne | OFFSIDES | ||
| 206 | Allergy test positive | OFFSIDES | ||
| 207 | Anaphylactic shock | SIDER | ||
| 208 | Anaphylactoid syndrome of pregnancy | OFFSIDES | ||
| 209 | Angina Pectoris, Variant | 1677137 | CTD | |
| 210 | Anticholinergic Syndrome | OFFSIDES | ||
| 211 | Aphagia | OFFSIDES | ||
| 212 | Apnea | OFFSIDES | ||
| 213 | Application site pain | OFFSIDES | ||
| 214 | Arterial Occlusive Diseases | 2228677 | CTD | |
| 215 | Atrial tachycardia | OFFSIDES | ||
| 216 | Aura | OFFSIDES | ||
| 217 | Automatism | OFFSIDES | ||
| 218 | Blood creatine phosphokinase increased | OFFSIDES | ||
| 219 | Blood immunoglobulin E | OFFSIDES | ||
| 220 | Blurred vision | OFFSIDES | ||
| 221 | Brain Edema | 1033698 | CTD | |
| 222 | Brain natriuretic peptide increased | OFFSIDES | ||
| 223 | Bronchoalveolar Lavage | OFFSIDES | ||
| 224 | Cardiovascular insufficiency | OFFSIDES | ||
| 225 | Cerebrovascular Disorders | 15199757 | CTD | |
| 226 | Cerebrovascular accident | SIDER | ||
| 227 | Choking sensation | OFFSIDES | ||
| 228 | Circumstance or information capable of leading to medication error | OFFSIDES | ||
| 229 | Congenital heart disease | OFFSIDES | ||
| 230 | Coronary Artery Disease | 1677137 | CTD | |
| 231 | Cramps of lower extremities | SIDER | ||
| 232 | Dermatitis | SIDER | ||
| 233 | Disseminated Intravascular Coagulation | OFFSIDES | ||
| 234 | Drowsiness | OFFSIDES | ||
| 235 | Drug withdrawal headache | OFFSIDES | ||
| 236 | Dysphonia | OFFSIDES | ||
| 237 | Dysthymic Disorder | OFFSIDES | ||
| 238 | Eclampsia | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 239 | Ejection fraction abnormal | OFFSIDES | ||
| 240 | Electromechanical dissociation | OFFSIDES | ||
| 241 | End-tidal CO2 decreased | OFFSIDES | ||
| 242 | Enterocolitis | OFFSIDES | ||
| 243 | Fetal Distress | 3172085 | CTD | |
| 244 | Foaming at mouth | OFFSIDES | ||
| 245 | Gastrointestinal Pain | SIDER | ||
| 246 | Influenza serology positive | OFFSIDES | ||
| 247 | Intention tremor | OFFSIDES | ||
| 248 | Low Cardiac Output Syndrome | OFFSIDES | ||
| 249 | Megakaryocytes increased | OFFSIDES | ||
| 250 | Muscle Hypertonia | 3172085 | CTD | |
| 251 | Myocardial Ischemia | 8547214 15087660 | CTD | |
| 252 | Nervous tension | OFFSIDES | ||
| 253 | Oculomucocutaneous syndrome | OFFSIDES | ||
| 254 | Oxygen supplementation | OFFSIDES | ||
| 255 | Peripartum cardiomyopathy | OFFSIDES | ||
| 256 | Poisoning | 9499292 | CTD | |
| 257 | Postpartum Hemorrhage | 11765484 | CTD | |
| 258 | Pulmonary Edema | 2051564 | CTD | |
| 259 | Risus sardonicus | OFFSIDES | ||
| 260 | Tension Headache | OFFSIDES | ||
| 261 | Tetany | 3172085 | CTD | |
| 262 | Thrombophlebitis | SIDER | ||
| 263 | Tinnitus | SIDER | ||
| 264 | Uterine hemorrhage | 12706285 | CTD | |
| 265 | Ventricular Fibrillation | SIDER | ||
| 266 | Water Intoxication | SIDER | ||
| 267 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.