Buprenorphine
(UAIXRPCCYXNJMQ-RZIPZOSSSA-N)
Structure
- SMILES
- CO[C@]12CC[C@]3(C[C@@H]1[C@@](C(C)(C)C)(O)C)[C@@]14[C@H]2Oc2c4c(C[C@H]3N(CC1)CC1CC1)ccc2O.Cl
- Molecular Formula:
- C29H42ClNO4
- Molecular Weight:
- 504.101
- Log P:
- 5.1537
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 3
- TPSA:
- 62.16
- CAS Number(s):
- 52485-79-7; 53152-21-9
Synonym(s)
1.
Buprenorphine
2.
6029-M
3.
Buprenex
4.
Buprenorphine Hydrochloride
5.
Buprex
6.
Prefin
7.
RX-6029-M
8.
Subutex
9.
Temgesic
10.
Temgésic
11.
6029 M
12.
6029M
13.
Hydrochloride, Buprenorphine
14.
RX 6029 M
15.
RX6029M
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 87 Canada Vigilance: 14 | Canada Vigilance US FAERS | |
| 2 | Drug exposure during pregnancy | FAERS: 79 | US FAERS | |
| 3 | Intentional misuse | FAERS: 70 | US FAERS | |
| 4 | Intentional drug misuse | FAERS: 65 | US FAERS | |
| 5 | Nausea | FAERS: 51 | US FAERS | |
| 6 | Product quality issue | FAERS: 50 | US FAERS | |
| 7 | Headache | FAERS: 41 | US FAERS | |
| 8 | Weight decreased | FAERS: 34 | US FAERS | |
| 9 | Vomiting | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 10 | Pain | FAERS: 27 | US FAERS | |
| 11 | Inflammation | FAERS: 26 | US FAERS | |
| 12 | Somnolence | FAERS: 25 | US FAERS | |
| 13 | Drug withdrawal syndrome | FAERS: 23 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 14 | Medication Error | FAERS: 23 | US FAERS | |
| 15 | Endocarditis | FAERS: 19 | US FAERS | |
| 16 | Malaise | FAERS: 19 | US FAERS | |
| 17 | Pregnancy | FAERS: 19 | US FAERS | |
| 18 | Completed Suicide | FAERS: 18 | US FAERS | |
| 19 | Dizziness | FAERS: 18 | US FAERS | |
| 20 | Asthenia | FAERS: 17 | US FAERS | |
| 21 | Overdose | FAERS: 17 | US FAERS | |
| 22 | Product taste abnormal | FAERS: 17 | US FAERS | |
| 23 | Delirium | FAERS: 16 | US FAERS | |
| 24 | Feeling abnormal | FAERS: 16 | US FAERS | |
| 25 | Sepsis | FAERS: 16 | US FAERS | |
| 26 | Wrong technique in product usage process | FAERS: 16 | US FAERS | |
| 27 | Cyanosis | FAERS: 15 | US FAERS | |
| 28 | Endophthalmitis | FAERS: 15 | US FAERS | |
| 29 | Anxiety | FAERS: 14 | US FAERS | |
| 30 | Drug Dependence | FAERS: 14 | US FAERS | |
| 31 | Drug abuser | FAERS: 14 | US FAERS | |
| 32 | Necrosis | FAERS: 14 | US FAERS | |
| 33 | Pneumonia | FAERS: 14 | US FAERS | |
| 34 | Wrong technique in drug usage process | FAERS: 14 | US FAERS | |
| 35 | Drug toxicity | FAERS: 13 | US FAERS | |
| 36 | Pneumothorax | FAERS: 13 | US FAERS | |
| 37 | Abscess | FAERS: 12 | US FAERS | |
| 38 | Lymphadenopathy | FAERS: 12 | US FAERS | |
| 39 | Product adhesion issue | FAERS: 12 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 40 | Pruritus | FAERS: 12 | US FAERS | |
| 41 | Anorexia | FAERS: 11 | US FAERS | |
| 42 | Drug abuse | FAERS: 11 | US FAERS | |
| 43 | Fatigue | FAERS: 11 | US FAERS | |
| 44 | General physical health deterioration | FAERS: 11 | US FAERS | |
| 45 | Incorrect route of drug administration | FAERS: 11 | US FAERS | |
| 46 | Toxicity to various agents | FAERS: 10 | US FAERS | |
| 47 | Accidental overdose | FAERS: 9 | US FAERS | |
| 48 | Candidiasis | FAERS: 9 | US FAERS | |
| 49 | Chest Pain | FAERS: 9 | US FAERS | |
| 50 | Drug screen positive | FAERS: 9 | US FAERS | |
| 51 | Hepatitis C | FAERS: 9 | US FAERS | |
| 52 | Product solubility abnormal | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 53 | Product substitution issue | FAERS: 9 | US FAERS | |
| 54 | Restlessness | FAERS: 9 | US FAERS | |
| 55 | Abdominal Pain | FAERS: 8 | US FAERS | |
| 56 | Granulocytosis | FAERS: 8 | US FAERS | |
| 57 | Rhabdomyolysis | FAERS: 8 | US FAERS | |
| 58 | Stomatitis | FAERS: 8 | US FAERS | |
| 59 | Ascites | FAERS: 7 | US FAERS | |
| 60 | Cytolytic hepatitis | FAERS: 7 | US FAERS | |
| 61 | Gangrene | FAERS: 7 | US FAERS | |
| 62 | Respiratory Depression | FAERS: 7 | US FAERS | |
| 63 | Swelling | FAERS: 7 | US FAERS | |
| 64 | Injection site pain | FAERS: 6 | US FAERS | |
| 65 | Intentional product misuse | FAERS: 6 | US FAERS | |
| 66 | Intentional product use issue | FAERS: 6 | US FAERS | |
| 67 | Leukocytosis | FAERS: 6 | US FAERS | |
| 68 | Maternal exposure during pregnancy | FAERS: 6 | US FAERS | |
| 69 | Palpitations | FAERS: 6 | US FAERS | |
| 70 | Pulmonary Embolism | FAERS: 6 | US FAERS | |
| 71 | Subcutaneous Abscess | FAERS: 6 | US FAERS | |
| 72 | Suicide attempt | FAERS: 6 | US FAERS | |
| 73 | Tremor | FAERS: 6 | US FAERS | |
| 74 | Alopecia | FAERS: 5 | US FAERS | |
| 75 | Arthritis | FAERS: 5 | US FAERS | |
| 76 | Back Pain | FAERS: 5 | US FAERS | |
| 77 | Cardiac Arrest | FAERS: 5 | US FAERS | |
| 78 | Chest discomfort | FAERS: 5 | US FAERS | |
| 79 | Deep Vein Thrombosis | FAERS: 5 | US FAERS | |
| 80 | Depressed mood | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 81 | Drug screen negative | FAERS: 5 | US FAERS | |
| 82 | Epidermal necrosis | FAERS: 5 | US FAERS | |
| 83 | Epilepsy | FAERS: 5 | US FAERS | |
| 84 | Inappropriate schedule of drug administration | FAERS: 5 | US FAERS | |
| 85 | Lymphopenia | FAERS: 5 | US FAERS | |
| 86 | Oral candidiasis | FAERS: 5 | US FAERS | |
| 87 | Pancreatitis | FAERS: 5 | US FAERS | |
| 88 | Pulmonary sepsis | FAERS: 5 | US FAERS | |
| 89 | Purpura | FAERS: 5 | US FAERS | |
| 90 | Septic Shock | FAERS: 5 | US FAERS | |
| 91 | Skin necrosis | FAERS: 5 | US FAERS | |
| 92 | Stillbirth | FAERS: 5 | US FAERS | |
| 93 | Abnormal palmar/plantar creases | FAERS: 4 | US FAERS | |
| 94 | Activities of daily living impaired | FAERS: 4 | US FAERS | |
| 95 | Agitation | FAERS: 4 | US FAERS | |
| 96 | Alanine Aminotransferase Increased | FAERS: 4 | US FAERS | |
| 97 | Application site erythema | FAERS: 4 | US FAERS | |
| 98 | Aspartate Aminotransferase Increased | FAERS: 4 | US FAERS | |
| 99 | Cerebrovascular accident | FAERS: 4 | US FAERS | |
| 100 | Chills | FAERS: 4 | US FAERS | |
| 101 | Constipation | FAERS: 4 | US FAERS | |
| 102 | Drug dispensing error | FAERS: 4 | US FAERS | |
| 103 | Eclampsia | FAERS: 4 | US FAERS | |
| 104 | Erysipelas | FAERS: 4 | US FAERS | |
| 105 | Fracture | FAERS: 4 | US FAERS | |
| 106 | Hepatitis C positive | FAERS: 4 | US FAERS | |
| 107 | Inadequate analgesia | FAERS: 4 | US FAERS | |
| 108 | Incorrect dose administered | FAERS: 4 | US FAERS | |
| 109 | Intentional self-injury | FAERS: 4 | US FAERS | |
| 110 | Lividity | FAERS: 4 | US FAERS | |
| 111 | Metabolic acidosis | FAERS: 4 | US FAERS | |
| 112 | Myositis | FAERS: 4 | US FAERS | |
| 113 | Nephrotic Syndrome | FAERS: 4 | US FAERS | |
| 114 | Product use issue | FAERS: 4 | US FAERS | |
| 115 | Shock | FAERS: 4 | US FAERS | |
| 116 | Skin nodule | FAERS: 4 | US FAERS | |
| 117 | Unevaluable event | FAERS: 4 | US FAERS | |
| 118 | Urinary Retention | FAERS: 4 | US FAERS | |
| 119 | Abdominal discomfort | FAERS: 3 | US FAERS | |
| 120 | Accidental drug intake by child | FAERS: 3 | US FAERS | |
| 121 | Accidental exposure to product | FAERS: 3 | US FAERS | |
| 122 | Acute myocardial infarction | FAERS: 3 | US FAERS | |
| 123 | Aortic Aneurysm | FAERS: 3 | US FAERS | |
| 124 | Application site pruritus | FAERS: 3 | US FAERS | |
| 125 | Application site swelling | FAERS: 3 | US FAERS | |
| 126 | Asphyxia | FAERS: 3 | US FAERS | |
| 127 | Atrial Fibrillation | FAERS: 3 | US FAERS | |
| 128 | Blood amylase increased | FAERS: 3 | US FAERS | |
| 129 | Bone infarction | FAERS: 3 | US FAERS | |
| 130 | Breakthrough Pain | FAERS: 3 | US FAERS | |
| 131 | Cholestasis of pregnancy | FAERS: 3 | US FAERS | |
| 132 | Cholestasis | FAERS: 3 | US FAERS | |
| 133 | Dementia | FAERS: 3 | US FAERS | |
| 134 | Depressed Level of Consciousness | FAERS: 3 | US FAERS | |
| 135 | Disorientation | FAERS: 3 | US FAERS | |
| 136 | Drug ineffective for unapproved indication | FAERS: 3 | US FAERS | |
| 137 | Dysarthria | FAERS: 3 | US FAERS | |
| 138 | Dysgeusia | FAERS: 3 | US FAERS | |
| 139 | Dyspepsia | FAERS: 3 | US FAERS | |
| 140 | Euphoric mood | FAERS: 3 | US FAERS | |
| 141 | Gastroschisis | FAERS: 3 | US FAERS | |
| 142 | Hallucinations, mixed | FAERS: 3 | US FAERS | |
| 143 | Hepatomegaly | FAERS: 3 | US FAERS | |
| 144 | Hypersensitivity | FAERS: 3 | US FAERS | |
| 145 | Impaired gastric emptying | FAERS: 3 | US FAERS | |
| 146 | Inappropriate schedule of product administration | FAERS: 3 | US FAERS | |
| 147 | Injection Site Reaction | FAERS: 3 | US FAERS | |
| 148 | Injection site abscess | FAERS: 3 | US FAERS | |
| 149 | Lethargy | FAERS: 3 | US FAERS | |
| 150 | Leukoencephalopathy | FAERS: 3 | US FAERS | |
| 151 | Lipase increased | FAERS: 3 | US FAERS | |
| 152 | Lymphadenitis | FAERS: 3 | US FAERS | |
| 153 | Microcephaly | FAERS: 3 | US FAERS | |
| 154 | Myalgia | FAERS: 3 | US FAERS | |
| 155 | Nervousness | FAERS: 3 | US FAERS | |
| 156 | Oliguria | FAERS: 3 | US FAERS | |
| 157 | Pre-Eclampsia | FAERS: 3 | US FAERS | |
| 158 | Product formulation issue | FAERS: 3 | US FAERS | |
| 159 | Pyopneumothorax | FAERS: 3 | US FAERS | |
| 160 | Rash erythematous | FAERS: 3 | US FAERS | |
| 161 | Respiratory distress | FAERS: 3 | US FAERS | |
| 162 | Septic embolus | FAERS: 3 | US FAERS | |
| 163 | Squamous cell carcinoma | FAERS: 3 | US FAERS | |
| 164 | Toxicologic test abnormal | FAERS: 3 | US FAERS | |
| 165 | Urticaria | FAERS: 3 | US FAERS | |
| 166 | Amnesia | FAERS: 2 | US FAERS | |
| 167 | Aneurysm | FAERS: 2 | US FAERS | |
| 168 | Anger | FAERS: 2 | US FAERS | |
| 169 | Application site irritation | FAERS: 2 | US FAERS | |
| 170 | Arthropathy | FAERS: 2 | US FAERS | |
| 171 | Burning sensation | FAERS: 2 | US FAERS | |
| 172 | Cachexia | FAERS: 2 | US FAERS | |
| 173 | Cardiac valve vegetation | FAERS: 2 | US FAERS | |
| 174 | Cellulitis | FAERS: 2 | US FAERS | |
| 175 | Cerebral Infarction | FAERS: 2 | US FAERS | |
| 176 | Chorioamnionitis | FAERS: 2 | US FAERS | |
| 177 | Cold sweat | FAERS: 2 | US FAERS | |
| 178 | Complications of maternal exposure to therapeutic drugs | FAERS: 2 | US FAERS | |
| 179 | Congenital intestinal malformation | FAERS: 2 | US FAERS | |
| 180 | Denervation atrophy | FAERS: 2 | US FAERS | |
| 181 | Dental caries | FAERS: 2 | US FAERS | |
| 182 | Dependence | FAERS: 2 | US FAERS | |
| 183 | Dermatitis | FAERS: 2 | US FAERS | |
| 184 | Discomfort | FAERS: 2 | US FAERS | |
| 185 | Drug administered at inappropriate site | FAERS: 2 | US FAERS | |
| 186 | Drug administered to patient of inappropriate age | FAERS: 2 | US FAERS | |
| 187 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 188 | Drug level increased | FAERS: 2 | US FAERS | |
| 189 | Drug resistance | FAERS: 2 | US FAERS | |
| 190 | Dry gangrene | FAERS: 2 | US FAERS | |
| 191 | Dysmorphism | FAERS: 2 | US FAERS | |
| 192 | Dysphonia | FAERS: 2 | US FAERS | |
| 193 | Dysuria | FAERS: 2 | US FAERS | |
| 194 | Embolic stroke | FAERS: 2 | US FAERS | |
| 195 | Embolism | FAERS: 2 | US FAERS | |
| 196 | Enamel anomaly | FAERS: 2 | US FAERS | |
| 197 | Erythrocyanosis | FAERS: 2 | US FAERS | |
| 198 | Escherichia urinary tract infection | FAERS: 2 | US FAERS | |
| 199 | Feeling Cold | FAERS: 2 | US FAERS | |
| 200 | Gastrointestinal candidiasis | FAERS: 2 | US FAERS | |
| 201 | Hepatitis | FAERS: 2 | US FAERS | |
| 202 | Hepatotoxicity | FAERS: 2 | US FAERS | |
| 203 | Hyperreflexia | FAERS: 2 | US FAERS | |
| 204 | Incorrect drug administration duration | FAERS: 2 | US FAERS | |
| 205 | Injection site necrosis | FAERS: 2 | US FAERS | |
| 206 | Intercepted drug dispensing error | FAERS: 2 | US FAERS | |
| 207 | Lymphoma | FAERS: 2 | US FAERS | |
| 208 | Memory impairment | FAERS: 2 | US FAERS | |
| 209 | Mood swings | FAERS: 2 | US FAERS | |
| 210 | Muscle tightness | FAERS: 2 | US FAERS | |
| 211 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 212 | Myoclonus | FAERS: 2 | US FAERS | |
| 213 | Neonatal aspiration | FAERS: 2 | US FAERS | |
| 214 | Neuralgia | FAERS: 2 | US FAERS | |
| 215 | Opiates positive | FAERS: 2 | US FAERS | |
| 216 | Oral pruritus | FAERS: 2 | US FAERS | |
| 217 | Oropharyngeal blistering | FAERS: 2 | US FAERS | |
| 218 | Oropharyngeal pain | FAERS: 2 | US FAERS | |
| 219 | Pancreatic carcinoma | FAERS: 2 | US FAERS | |
| 220 | Panniculitis | FAERS: 2 | US FAERS | |
| 221 | Pneumoperitoneum | FAERS: 2 | US FAERS | |
| 222 | Poisoning | FAERS: 2 | US FAERS | |
| 223 | Poor sucking reflex | FAERS: 2 | US FAERS | |
| 224 | Product dispensing error | FAERS: 2 | US FAERS | |
| 225 | Product use in unapproved indication | FAERS: 2 | US FAERS | |
| 226 | Pulmonary congestion | FAERS: 2 | US FAERS | |
| 227 | Respiratory Failure | FAERS: 2 | US FAERS | |
| 228 | Retinal Detachment | FAERS: 2 | US FAERS | |
| 229 | Sacroiliitis | FAERS: 2 | US FAERS | |
| 230 | Skin Ulcer | FAERS: 2 | US FAERS | |
| 231 | Therapeutic response unexpected | FAERS: 2 | US FAERS | |
| 232 | Thrombophlebitis | FAERS: 2 | US FAERS | |
| 233 | Thrombosis | FAERS: 2 | US FAERS | |
| 234 | Thyroid Neoplasm | FAERS: 2 | US FAERS | |
| 235 | Tooth Loss | FAERS: 2 | US FAERS | |
| 236 | Toothache | FAERS: 2 | US FAERS | |
| 237 | Transcription medication error | FAERS: 2 | US FAERS | |
| 238 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 239 | Unwanted pregnancy | FAERS: 2 | US FAERS | |
| 240 | Vascular stenosis | FAERS: 2 | US FAERS | |
| 241 | Vitritis | FAERS: 2 | US FAERS | |
| 242 | Accidental exposure | FAERS: 1 | US FAERS | |
| 243 | Acute psychosis | FAERS: 1 | US FAERS | |
| 244 | Administration site irritation | FAERS: 1 | US FAERS | |
| 245 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 246 | Amino acid level increased | FAERS: 1 | US FAERS | |
| 247 | Anuria | FAERS: 1 | US FAERS | |
| 248 | Apathy | FAERS: 1 | US FAERS | |
| 249 | Application site discharge | FAERS: 1 | US FAERS | |
| 250 | Application site erosion | FAERS: 1 | US FAERS | |
| 251 | Application site hypersensitivity | FAERS: 1 | US FAERS | |
| 252 | Application site pain | FAERS: 1 | US FAERS | |
| 253 | Application site rash | FAERS: 1 | US FAERS | |
| 254 | Application site reaction | FAERS: 1 | US FAERS | |
| 255 | Application site scar | FAERS: 1 | US FAERS | |
| 256 | Application site wound | FAERS: 1 | US FAERS | |
| 257 | Arthralgia | FAERS: 1 | US FAERS | |
| 258 | Asthma | FAERS: 1 | US FAERS | |
| 259 | Ataxia | FAERS: 1 | US FAERS | |
| 260 | Aura | FAERS: 1 | US FAERS | |
| 261 | Bacillus infection | FAERS: 1 | US FAERS | |
| 262 | Bedridden | FAERS: 1 | US FAERS | |
| 263 | Bladder pain | FAERS: 1 | US FAERS | |
| 264 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 265 | Blood culture negative | FAERS: 1 | US FAERS | |
| 266 | Blood folate decreased | FAERS: 1 | US FAERS | |
| 267 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 268 | Bradycardia | FAERS: 1 | US FAERS | |
| 269 | Brain Contusion | FAERS: 1 | US FAERS | |
| 270 | Breast Feeding | FAERS: 1 | US FAERS | |
| 271 | Bronchiolitis | FAERS: 1 | US FAERS | |
| 272 | Bruxism | FAERS: 1 | US FAERS | |
| 273 | Cardiac Tamponade | FAERS: 1 | US FAERS | |
| 274 | Cardiac ablation | FAERS: 1 | US FAERS | |
| 275 | Carotid artery occlusion | FAERS: 1 | US FAERS | |
| 276 | Choking sensation | FAERS: 1 | US FAERS | |
| 277 | Cholecystitis | FAERS: 1 | US FAERS | |
| 278 | Congenital cystic kidney disease | FAERS: 1 | US FAERS | |
| 279 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 280 | Culture positive | FAERS: 1 | US FAERS | |
| 281 | Cyst | FAERS: 1 | US FAERS | |
| 282 | Deafness | FAERS: 1 | US FAERS | |
| 283 | Dehydration | FAERS: 1 | US FAERS | |
| 284 | Delusional disorder, persecutory type | FAERS: 1 | US FAERS | |
| 285 | Disease recurrence | FAERS: 1 | US FAERS | |
| 286 | Drowning | FAERS: 1 | US FAERS | |
| 287 | Drug dose omission | FAERS: 1 | US FAERS | |
| 288 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 289 | Drug effect variable | FAERS: 1 | US FAERS | |
| 290 | Drug level above therapeutic | FAERS: 1 | US FAERS | |
| 291 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 292 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 293 | Dyschezia | FAERS: 1 | US FAERS | |
| 294 | Enterobacter test positive | FAERS: 1 | US FAERS | |
| 295 | Enterococcal sepsis | FAERS: 1 | US FAERS | |
| 296 | Enzyme level increased | FAERS: 1 | US FAERS | |
| 297 | Epistaxis | FAERS: 1 | US FAERS | |
| 298 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 299 | Erythema | FAERS: 1 | US FAERS | |
| 300 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 301 | Extremity necrosis | FAERS: 1 | US FAERS | |
| 302 | Eye irritation | FAERS: 1 | US FAERS | |
| 303 | Flushing | FAERS: 1 | US FAERS | |
| 304 | Folliculitis | FAERS: 1 | US FAERS | |
| 305 | Fundoscopy abnormal | FAERS: 1 | US FAERS | |
| 306 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 307 | Glaucoma | FAERS: 1 | US FAERS | |
| 308 | Graft infection | FAERS: 1 | US FAERS | |
| 309 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 310 | Hepatic necrosis | FAERS: 1 | US FAERS | |
| 311 | Hepatitis C antibody positive | FAERS: 1 | US FAERS | |
| 312 | Hoarseness | FAERS: 1 | US FAERS | |
| 313 | Hypervigilance | FAERS: 1 | US FAERS | |
| 314 | Hypotension | FAERS: 1 | US FAERS | |
| 315 | Hypoxia | FAERS: 1 | US FAERS | |
| 316 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 317 | Impaired work ability | FAERS: 1 | US FAERS | |
| 318 | Incoherent | FAERS: 1 | US FAERS | |
| 319 | Infection | FAERS: 1 | US FAERS | |
| 320 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 321 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 322 | Intercepted product dispensing error | FAERS: 1 | US FAERS | |
| 323 | Joint swelling | FAERS: 1 | US FAERS | |
| 324 | Laceration | FAERS: 1 | US FAERS | |
| 325 | Laryngitis | FAERS: 1 | US FAERS | |
| 326 | Livedo Reticularis | FAERS: 1 | US FAERS | |
| 327 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 328 | Lung adenocarcinoma recurrent | FAERS: 1 | US FAERS | |
| 329 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 330 | Marasmus | FAERS: 1 | US FAERS | |
| 331 | Medication residue | FAERS: 1 | US FAERS | |
| 332 | Medication residue present | FAERS: 1 | US FAERS | |
| 333 | Mental status changes | FAERS: 1 | US FAERS | |
| 334 | Micropenis | FAERS: 1 | US FAERS | |
| 335 | Migration of implanted drug | FAERS: 1 | US FAERS | |
| 336 | Miscarriage of partner | FAERS: 1 | US FAERS | |
| 337 | Monoplegia | FAERS: 1 | US FAERS | |
| 338 | Motion Sickness | FAERS: 1 | US FAERS | |
| 339 | Mouth swelling | FAERS: 1 | US FAERS | |
| 340 | Multi-organ disorder | FAERS: 1 | US FAERS | |
| 341 | Myocarditis | FAERS: 1 | US FAERS | |
| 342 | Nasal mucosal disorder | FAERS: 1 | US FAERS | |
| 343 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 344 | Neonatal disorder | FAERS: 1 | US FAERS | |
| 345 | Neuropsychiatric syndrome | FAERS: 1 | US FAERS | |
| 346 | No adverse effect | FAERS: 1 | US FAERS | |
| 347 | No adverse event | FAERS: 1 | US FAERS | |
| 348 | Nystagmus | FAERS: 1 | US FAERS | |
| 349 | Obsessive thoughts | FAERS: 1 | US FAERS | |
| 350 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 351 | Osteitis | FAERS: 1 | US FAERS | |
| 352 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 353 | PO2 decreased | FAERS: 1 | US FAERS | |
| 354 | Pancreas lipomatosis | FAERS: 1 | US FAERS | |
| 355 | Paranoia | FAERS: 1 | US FAERS | |
| 356 | Pelvic abscess | FAERS: 1 | US FAERS | |
| 357 | Penile necrosis | FAERS: 1 | US FAERS | |
| 358 | Pericarditis | FAERS: 1 | US FAERS | |
| 359 | Petechiae | FAERS: 1 | US FAERS | |
| 360 | Pharyngitis | FAERS: 1 | US FAERS | |
| 361 | Piloerection | FAERS: 1 | US FAERS | |
| 362 | Plagiocephaly | FAERS: 1 | US FAERS | |
| 363 | Pneumoconiosis | FAERS: 1 | US FAERS | |
| 364 | Pneumonitis | FAERS: 1 | US FAERS | |
| 365 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 366 | Priapism | FAERS: 1 | US FAERS | |
| 367 | Product administered at inappropriate site | FAERS: 1 | US FAERS | |
| 368 | Product dosage form issue | FAERS: 1 | US FAERS | |
| 369 | Product friable | FAERS: 1 | US FAERS | |
| 370 | Product label confusion | FAERS: 1 | US FAERS | |
| 371 | Product physical issue | FAERS: 1 | US FAERS | |
| 372 | Product size issue | FAERS: 1 | US FAERS | |
| 373 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 374 | Pulmonary vascular disorder | FAERS: 1 | US FAERS | |
| 375 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 376 | Quadriplegia | FAERS: 1 | US FAERS | |
| 377 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 378 | Radiation injury | FAERS: 1 | US FAERS | |
| 379 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 380 | Scotoma | FAERS: 1 | US FAERS | |
| 381 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 382 | Skin lesion | FAERS: 1 | US FAERS | |
| 383 | Sluggishness | FAERS: 1 | US FAERS | |
| 384 | Sneezing | FAERS: 1 | US FAERS | |
| 385 | Spondylitis | FAERS: 1 | US FAERS | |
| 386 | Staphylococcal abscess | FAERS: 1 | US FAERS | |
| 387 | Staring | FAERS: 1 | US FAERS | |
| 388 | Stasis dermatitis | FAERS: 1 | US FAERS | |
| 389 | Strabismus | FAERS: 1 | US FAERS | |
| 390 | Streptococcal abscess | FAERS: 1 | US FAERS | |
| 391 | Sudden death | FAERS: 1 | US FAERS | |
| 392 | Superinfection | FAERS: 1 | US FAERS | |
| 393 | Syncope | FAERS: 1 | US FAERS | |
| 394 | Syndactyly | FAERS: 1 | US FAERS | |
| 395 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 396 | Tablet physical issue | FAERS: 1 | US FAERS | |
| 397 | Tension | FAERS: 1 | US FAERS | |
| 398 | Theft | FAERS: 1 | US FAERS | |
| 399 | Therapeutic product effect incomplete | FAERS: 1 | US FAERS | |
| 400 | Therapeutic product ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 401 | Therapy cessation | FAERS: 1 | US FAERS | |
| 402 | Therapy naive | FAERS: 1 | US FAERS | |
| 403 | Thirst | FAERS: 1 | US FAERS | |
| 404 | Transaminases increased | FAERS: 1 | US FAERS | |
| 405 | Transmission of drug via semen | FAERS: 1 | US FAERS | |
| 406 | Tuberculosis | FAERS: 1 | US FAERS | |
| 407 | Ulcer | FAERS: 1 | US FAERS | |
| 408 | Urethritis | FAERS: 1 | US FAERS | |
| 409 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 410 | Vasculitis | FAERS: 1 | US FAERS | |
| 411 | Venous thrombosis limb | FAERS: 1 | US FAERS | |
| 412 | Visceral congestion | FAERS: 1 | US FAERS | |
| 413 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 414 | furuncle | FAERS: 1 | US FAERS | |
| 415 | Oral administration complication | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.