chloroquine diphosphate
(QKICWELGRMTQCR-UHFFFAOYSA-N)
Structure
- SMILES
- OP(=O)(O)O.OP(=O)(O)O.CCN(CCCC(Nc1ccnc2c1ccc(c2)Cl)C)CC
- Molecular Formula:
- C18H32ClN3O8P2
- Molecular Weight:
- 515.863
- Log P:
- 3.0264
- Hydrogen Bond Acceptor:
- 11
- Hydrogen Bond Donor:
- 7
- TPSA:
- 203.3
- CAS Number(s):
- 50-63-5
Synonym(s)
1.
chloroquine diphosphate
2.
Resochin
3.
arechin
4.
chingamin phosphate
5.
chloroquine bis(dihydrogenphosphate) dihydrate
6.
chloroquine diphosphate, (+)-isomer
7.
chloroquine diphosphate, (+-)-isomer
8.
chloroquine diphosphate, (-)-isomer
9.
chloroquine phosphate
10.
delagil
11.
khingamin phosphate
12.
unspecified phosphate of chloroquine diphosphate
External Link(s)
| MeSH | C023676 |
| PubChem Compound | 64927 43833344 |
| CHEMBL | CHEMBL58510 |
| KEGG | dr:D02125 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Toxicity to various agents | FAERS: 29 | US FAERS | |
| 2 | Completed Suicide | FAERS: 13 | US FAERS | |
| 3 | Cardiac Arrest | FAERS: 9 | US FAERS | |
| 4 | Restrictive cardiomyopathy | FAERS: 9 | US FAERS | |
| 5 | Vomiting | FAERS: 9 | US FAERS | |
| 6 | Nausea | FAERS: 7 Canada Vigilance: 1 | 5694600 | CTD Canada Vigilance US FAERS |
| 7 | Overdose | FAERS: 7 | US FAERS | |
| 8 | Abdominal Pain | FAERS: 6 | US FAERS | |
| 9 | Cardiotoxicity | FAERS: 6 | US FAERS | |
| 10 | Headache | FAERS: 5 | 638620 5467364 5694600 | CTD US FAERS |
| 11 | Hypoxia | FAERS: 5 | US FAERS | |
| 12 | Optic Atrophy | FAERS: 5 | US FAERS | |
| 13 | Product use in unapproved indication | FAERS: 5 | US FAERS | |
| 14 | Ventricular hypertrophy | FAERS: 5 | US FAERS | |
| 15 | Alopecia | FAERS: 4 | US FAERS | |
| 16 | Hypotension | FAERS: 4 | 458905 | CTD US FAERS |
| 17 | Suicide attempt | FAERS: 4 | US FAERS | |
| 18 | Ventricular Fibrillation | FAERS: 4 | US FAERS | |
| 19 | Anxiety | FAERS: 3 | US FAERS | |
| 20 | Bradycardia | FAERS: 3 | US FAERS | |
| 21 | Cyanosis | FAERS: 3 | US FAERS | |
| 22 | Dizziness | FAERS: 3 | US FAERS | |
| 23 | Drug ineffective | FAERS: 3 | US FAERS | |
| 24 | Feeling abnormal | FAERS: 3 | US FAERS | |
| 25 | Mental status changes | FAERS: 3 | US FAERS | |
| 26 | Product use issue | FAERS: 3 | US FAERS | |
| 27 | Weight decreased | FAERS: 3 | US FAERS | |
| 28 | Asthenia | FAERS: 2 | US FAERS | |
| 29 | Atrioventricular Block | FAERS: 2 | US FAERS | |
| 30 | Cardiomegaly | FAERS: 2 | 2957973 | CTD US FAERS |
| 31 | Dehydration | FAERS: 2 | US FAERS | |
| 32 | Drug abuse | FAERS: 2 | US FAERS | |
| 33 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 34 | Lethargy | FAERS: 2 | US FAERS | |
| 35 | Malaise | FAERS: 2 | US FAERS | |
| 36 | Metabolic alkalosis | FAERS: 2 | US FAERS | |
| 37 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 38 | PO2 increased | FAERS: 2 | US FAERS | |
| 39 | Paranoia | FAERS: 2 | US FAERS | |
| 40 | Pneumonia | FAERS: 2 | US FAERS | |
| 41 | Pneumonitis | FAERS: 2 | US FAERS | |
| 42 | Retinal Degeneration | FAERS: 2 | US FAERS | |
| 43 | Scotoma | FAERS: 2 | US FAERS | |
| 44 | Syncope | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Tachycardia | FAERS: 2 | US FAERS | |
| 46 | Victim of homicide | FAERS: 2 | US FAERS | |
| 47 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 48 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 49 | Accidental overdose | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 50 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 51 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 52 | Acute psychosis | FAERS: 1 | US FAERS | |
| 53 | Alcohol interaction | FAERS: 1 | US FAERS | |
| 54 | Anorexia | FAERS: 1 | US FAERS | |
| 55 | Arthralgia | FAERS: 1 | US FAERS | |
| 56 | Ascites | FAERS: 1 | US FAERS | |
| 57 | Asphyxia | FAERS: 1 | US FAERS | |
| 58 | Back Pain | FAERS: 1 | US FAERS | |
| 59 | Bifascicular block | FAERS: 1 | US FAERS | |
| 60 | Bipolar I disorder | FAERS: 1 | US FAERS | |
| 61 | Blindness | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 62 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 63 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 64 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 65 | Brain Death | FAERS: 1 | US FAERS | |
| 66 | Brain Hypoxia | FAERS: 1 | US FAERS | |
| 67 | Carotid Artery Thrombosis | FAERS: 1 | US FAERS | |
| 68 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 69 | Chills | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 70 | Chorioretinal atrophy | FAERS: 1 | US FAERS | |
| 71 | Coma scale abnormal | FAERS: 1 | US FAERS | |
| 72 | Crying | FAERS: 1 | US FAERS | |
| 73 | Depressed mood | FAERS: 1 | US FAERS | |
| 74 | Depression suicidal | FAERS: 1 | US FAERS | |
| 75 | Drug toxicity | FAERS: 1 | US FAERS | |
| 76 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 77 | Electrocardiogram U-wave abnormality | FAERS: 1 | US FAERS | |
| 78 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 79 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 80 | Exposure via ingestion | FAERS: 1 | US FAERS | |
| 81 | Eye pain | FAERS: 1 | US FAERS | |
| 82 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 83 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 84 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 85 | Hepatic necrosis | FAERS: 1 | US FAERS | |
| 86 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 87 | Hypercapnia | FAERS: 1 | US FAERS | |
| 88 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 89 | Keratopathy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 90 | Kidney congestion | FAERS: 1 | US FAERS | |
| 91 | Latex allergy | FAERS: 1 | US FAERS | |
| 92 | Left atrial dilatation | FAERS: 1 | US FAERS | |
| 93 | Lip swelling | FAERS: 1 | US FAERS | |
| 94 | Lymphocytic infiltration | FAERS: 1 | US FAERS | |
| 95 | Macular pigmentation | FAERS: 1 | US FAERS | |
| 96 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 97 | Memory impairment | FAERS: 1 | US FAERS | |
| 98 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 99 | Myalgia | FAERS: 1 | US FAERS | |
| 100 | Myasthenic Syndrome | FAERS: 1 | US FAERS | |
| 101 | Myoclonus | FAERS: 1 | US FAERS | |
| 102 | N-terminal prohormone brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 103 | Nervousness | FAERS: 1 | US FAERS | |
| 104 | Obsessive-Compulsive Disorder | FAERS: 1 | US FAERS | |
| 105 | Ophthalmological examination abnormal | FAERS: 1 | US FAERS | |
| 106 | Ototoxicity | FAERS: 1 | US FAERS | |
| 107 | Panic Disorder | FAERS: 1 | US FAERS | |
| 108 | Peripheral arterial occlusive disease | FAERS: 1 | US FAERS | |
| 109 | Photophobia | FAERS: 1 | US FAERS | |
| 110 | Plasmodium falciparum infection | FAERS: 1 | US FAERS | |
| 111 | Poisoning | FAERS: 1 | US FAERS | |
| 112 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 113 | Pressure of speech | FAERS: 1 | US FAERS | |
| 114 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 115 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 116 | Pulmonary arterial pressure increased | FAERS: 1 | US FAERS | |
| 117 | Quadriplegia | FAERS: 1 | US FAERS | |
| 118 | Rales | FAERS: 1 | US FAERS | |
| 119 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 120 | Restlessness | FAERS: 1 | US FAERS | |
| 121 | Retinal pigment epitheliopathy | FAERS: 1 | US FAERS | |
| 122 | Retinal toxicity | FAERS: 1 | US FAERS | |
| 123 | Right atrial dilatation | FAERS: 1 | US FAERS | |
| 124 | Right ventricular failure | FAERS: 1 | US FAERS | |
| 125 | Sepsis | FAERS: 1 | US FAERS | |
| 126 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 127 | Strabismus | FAERS: 1 | US FAERS | |
| 128 | Systolic dysfunction | FAERS: 1 | US FAERS | |
| 129 | Thrombotic stroke | FAERS: 1 | US FAERS | |
| 130 | Thymus enlargement | FAERS: 1 | US FAERS | |
| 131 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 132 | Transaminases increased | FAERS: 1 | US FAERS | |
| 133 | Troponin I increased | FAERS: 1 | US FAERS | |
| 134 | Urticaria | FAERS: 1 | US FAERS | |
| 135 | Visual Impairment | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 136 | Adams-Stokes Syndrome | 638620 | CTD | |
| 137 | Angioedema | Canada Vigilance: 1 | 5467364 | CTD Canada Vigilance |
| 138 | Chemical and Drug Induced Liver Injury | 22166485 | CTD | |
| 139 | Cleft Palate | Canada Vigilance: 1 | Canada Vigilance | |
| 140 | Corneal Diseases | 638620 | CTD | |
| 141 | Corneal Opacity | Canada Vigilance: 1 | Canada Vigilance | |
| 142 | Dermatitis | Canada Vigilance: 1 | Canada Vigilance | |
| 143 | Drug Eruptions | 5467364 | CTD | |
| 144 | Hearing Loss | 4013729 | CTD | |
| 145 | Heart Block | 638620 | CTD | |
| 146 | Heart Diseases | 22166485 | CTD | |
| 147 | Heart failure | 2957973 | CTD | |
| 148 | Keratitis | Canada Vigilance: 1 | Canada Vigilance | |
| 149 | Liver Cirrhosis | 29133031 | CTD | |
| 150 | Lupus Erythematosus, Systemic | 638620 2957973 | CTD | |
| 151 | Macular degeneration | 638620 4875645 | CTD | |
| 152 | Malaria, Falciparum | 4922770 | CTD | |
| 153 | Malaria | 458905 638620 1232932 | CTD | |
| 154 | Medication Error | Canada Vigilance: 1 | Canada Vigilance | |
| 155 | Mental disorders | 638620 | CTD | |
| 156 | Movement Disorders | 851793 | CTD | |
| 157 | Muscle Weakness | 15909088 | CTD | |
| 158 | Neurologic Manifestations | 638620 | CTD | |
| 159 | Neuromuscular Diseases | 8879864 | CTD | |
| 160 | Papilledema | 1232932 | CTD | |
| 161 | Peripheral Nervous System Diseases | 514939 | CTD | |
| 162 | Pruritus | 5467364 | CTD | |
| 163 | Renal Insufficiency | 22166485 | CTD | |
| 164 | Seizures | 5694600 | CTD | |
| 165 | Vision Disorders | 5694600 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120141
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.