ivacaftor
(PURKAOJPTOLRMP-UHFFFAOYSA-N)
Structure
- SMILES
- O=C(c1c[nH]c2c(c1=O)cccc2)Nc1cc(O)c(cc1C(C)(C)C)C(C)(C)C
- Type(s)
- Approved
- ATC code(s)
- R07AX02; R07AX30; R07AX31
- Molecular Formula:
- C24H28N2O3
- Molecular Weight:
- 392.491
- Log P:
- 5.1540
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 3
- TPSA:
- 82.19
- CAS Number(s):
- 873054-44-5
Synonym(s)
1.
ivacaftor
2.
3-quinolinecarboxamide, N-(2,4-bis(1,1-dimethylethyl)-5-hydroxyphenyl)-1,4-dihydro-4-oxo-
3.
Kalydeco
4.
N-(2,4-bis(1,1-dimethylethyl)-5-hydroxyphenyl)-4-oxo-1,4-dihydroquinoline-3-carboxamide
5.
N-(2,4-di-tert-butyl-5-hydroxyphenyl)-4-oxo-1,4-dihydroquinoline-3-carboxamide
6.
VX-770
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Infective pulmonary exacerbation of cystic fibrosis | FAERS: 151 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 2 | Nasopharyngitis | FAERS: 105 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 3 | Headache | FAERS: 95 | SIDER US FAERS | |
| 4 | Malaise | FAERS: 91 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 5 | Drug dose omission | FAERS: 84 | US FAERS | |
| 6 | Pneumonia | FAERS: 69 | US FAERS | |
| 7 | Pulmonary function test decreased | FAERS: 63 | US FAERS | |
| 8 | Influenza | FAERS: 60 | US FAERS | |
| 9 | Sinusitis | FAERS: 58 | US FAERS | |
| 10 | Drug ineffective | FAERS: 44 | US FAERS | |
| 11 | Infection | FAERS: 44 | SIDER US FAERS | |
| 12 | Dizziness | FAERS: 40 | SIDER US FAERS | |
| 13 | Vomiting | FAERS: 35 | US FAERS | |
| 14 | Nausea | FAERS: 33 | SIDER US FAERS | |
| 15 | Fatigue | FAERS: 31 | US FAERS | |
| 16 | Constipation | FAERS: 30 | US FAERS | |
| 17 | Weight decreased | FAERS: 30 | US FAERS | |
| 18 | Abdominal Pain | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 19 | Oropharyngeal pain | FAERS: 27 | SIDER US FAERS | |
| 20 | Abdominal discomfort | FAERS: 26 | US FAERS | |
| 21 | Cystic fibrosis respiratory infection suppression | FAERS: 25 | US FAERS | |
| 22 | Chest Pain | FAERS: 23 | US FAERS | |
| 23 | Productive Cough | FAERS: 23 | US FAERS | |
| 24 | Arthralgia | FAERS: 21 | SIDER US FAERS | |
| 25 | Pancreatitis | FAERS: 21 | US FAERS | |
| 26 | Cystic Fibrosis | FAERS: 20 | CTD US FAERS | |
| 27 | Feeling abnormal | FAERS: 16 | US FAERS | |
| 28 | Lower respiratory tract infection | FAERS: 14 | US FAERS | |
| 29 | Chest discomfort | FAERS: 13 | US FAERS | |
| 30 | Dehydration | FAERS: 13 | US FAERS | |
| 31 | Asthma | FAERS: 12 | US FAERS | |
| 32 | Visual Impairment | FAERS: 12 | US FAERS | |
| 33 | Asthenia | FAERS: 11 | US FAERS | |
| 34 | Bronchitis | FAERS: 11 | US FAERS | |
| 35 | General physical health deterioration | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 36 | Pain | FAERS: 11 | US FAERS | |
| 37 | Product dose omission | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 38 | Wheezing | FAERS: 11 | SIDER US FAERS | |
| 39 | Pneumothorax | FAERS: 10 | US FAERS | |
| 40 | Sinus operation | FAERS: 10 | US FAERS | |
| 41 | Acne | FAERS: 9 | US FAERS | |
| 42 | Antibiotic Prophylaxis | FAERS: 9 | US FAERS | |
| 43 | Myalgia | FAERS: 9 | SIDER US FAERS | |
| 44 | Nephrolithiasis | FAERS: 9 | US FAERS | |
| 45 | Urticaria | FAERS: 9 | US FAERS | |
| 46 | Anxiety | FAERS: 8 | US FAERS | |
| 47 | Arthritis | FAERS: 8 | US FAERS | |
| 48 | Epistaxis | FAERS: 8 | US FAERS | |
| 49 | Hypersensitivity | FAERS: 8 | US FAERS | |
| 50 | Pseudomonas test positive | FAERS: 8 | US FAERS | |
| 51 | Blood glucose increased | FAERS: 7 | SIDER US FAERS | |
| 52 | Incorrect dose administered | FAERS: 7 | US FAERS | |
| 53 | Infectious Mononucleosis | FAERS: 7 | US FAERS | |
| 54 | Insurance issue | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 55 | Alopecia | FAERS: 6 | US FAERS | |
| 56 | Inappropriate schedule of drug administration | FAERS: 6 | US FAERS | |
| 57 | Intestinal Obstruction | FAERS: 6 | US FAERS | |
| 58 | Sweat test abnormal | FAERS: 6 | US FAERS | |
| 59 | Thrombosis | FAERS: 6 | US FAERS | |
| 60 | Tinnitus | FAERS: 6 | SIDER US FAERS | |
| 61 | Antibiotic therapy | FAERS: 5 | US FAERS | |
| 62 | Back Pain | FAERS: 5 | US FAERS | |
| 63 | Cystic fibrosis related diabetes | FAERS: 5 | US FAERS | |
| 64 | Increased bronchial secretion | FAERS: 5 | US FAERS | |
| 65 | Medication Error | FAERS: 5 | US FAERS | |
| 66 | Memory impairment | FAERS: 5 | US FAERS | |
| 67 | Nasal Polyps | FAERS: 5 | US FAERS | |
| 68 | Pulmonary congestion | FAERS: 5 | US FAERS | |
| 69 | Respiratory Failure | FAERS: 5 | US FAERS | |
| 70 | Secretion discharge | FAERS: 5 | US FAERS | |
| 71 | Sinus headache | FAERS: 5 | SIDER US FAERS | |
| 72 | Somnolence | FAERS: 5 | US FAERS | |
| 73 | Ulcer | FAERS: 5 | US FAERS | |
| 74 | Urinary tract infection | FAERS: 5 | US FAERS | |
| 75 | Alanine Aminotransferase Increased | FAERS: 4 | US FAERS | |
| 76 | Aspartate Aminotransferase Increased | FAERS: 4 | SIDER US FAERS | |
| 77 | Blood alkaline phosphatase increased | FAERS: 4 | US FAERS | |
| 78 | Bronchial secretion retention | FAERS: 4 | US FAERS | |
| 79 | Bronchospasm | FAERS: 4 | US FAERS | |
| 80 | Chromaturia | FAERS: 4 | US FAERS | |
| 81 | Depressed mood | FAERS: 4 | US FAERS | |
| 82 | Diabetes Mellitus | FAERS: 4 | US FAERS | |
| 83 | Distal intestinal obstruction syndrome | FAERS: 4 | US FAERS | |
| 84 | Dyspepsia | FAERS: 4 | US FAERS | |
| 85 | Eczema | FAERS: 4 | US FAERS | |
| 86 | Flushing | FAERS: 4 | US FAERS | |
| 87 | Pharyngitis | FAERS: 4 | US FAERS | |
| 88 | Pruritus | FAERS: 4 | US FAERS | |
| 89 | Staphylococcus test positive | FAERS: 4 | US FAERS | |
| 90 | Throat irritation | FAERS: 4 | US FAERS | |
| 91 | Upper-airway cough syndrome | FAERS: 4 | US FAERS | |
| 92 | Abscess | FAERS: 3 | US FAERS | |
| 93 | Acute kidney injury | FAERS: 3 | US FAERS | |
| 94 | Ankle Fracture | FAERS: 3 | US FAERS | |
| 95 | Atelectasis | FAERS: 3 | US FAERS | |
| 96 | Atrial Fibrillation | FAERS: 3 | US FAERS | |
| 97 | Bacterial test positive | FAERS: 3 | US FAERS | |
| 98 | Blood glucose decreased | FAERS: 3 | US FAERS | |
| 99 | Bronchopneumonia | FAERS: 3 | US FAERS | |
| 100 | Cataract | FAERS: 3 | US FAERS | |
| 101 | Chills | FAERS: 3 | US FAERS | |
| 102 | Dysphonia | FAERS: 3 | US FAERS | |
| 103 | Emotional disorder | FAERS: 3 | US FAERS | |
| 104 | Feeling Cold | FAERS: 3 | US FAERS | |
| 105 | Hepatitis | FAERS: 3 | US FAERS | |
| 106 | Hypersomnia | FAERS: 3 | US FAERS | |
| 107 | Hypothyroidism | FAERS: 3 | US FAERS | |
| 108 | Impaired gastric emptying | FAERS: 3 | US FAERS | |
| 109 | Increased upper airway secretion | FAERS: 3 | US FAERS | |
| 110 | Inflammation | FAERS: 3 | US FAERS | |
| 111 | Laryngitis | FAERS: 3 | US FAERS | |
| 112 | No adverse event | FAERS: 3 | US FAERS | |
| 113 | Pulmonary Embolism | FAERS: 3 | US FAERS | |
| 114 | Skin Papilloma | FAERS: 3 | US FAERS | |
| 115 | Syncope | FAERS: 3 | US FAERS | |
| 116 | Therapy cessation | FAERS: 3 | US FAERS | |
| 117 | Tonsillitis | FAERS: 3 | US FAERS | |
| 118 | Transaminases increased | FAERS: 3 | SIDER US FAERS | |
| 119 | Tremor | FAERS: 3 | US FAERS | |
| 120 | Accidental exposure to product by child | FAERS: 2 | US FAERS | |
| 121 | Accidental overdose | FAERS: 2 | US FAERS | |
| 122 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 123 | Acute respiratory failure | FAERS: 2 | US FAERS | |
| 124 | Agitation | FAERS: 2 | US FAERS | |
| 125 | Allergic sinusitis | FAERS: 2 | US FAERS | |
| 126 | Anger | FAERS: 2 | US FAERS | |
| 127 | Aphagia | FAERS: 2 | US FAERS | |
| 128 | Aphonia | FAERS: 2 | US FAERS | |
| 129 | Arthropathy | FAERS: 2 | US FAERS | |
| 130 | Bacterial disease carrier | FAERS: 2 | US FAERS | |
| 131 | Conjunctivitis | FAERS: 2 | US FAERS | |
| 132 | Croup infectious | FAERS: 2 | US FAERS | |
| 133 | Deafness | FAERS: 2 | US FAERS | |
| 134 | Diabetes mellitus inadequate control | FAERS: 2 | US FAERS | |
| 135 | Discomfort | FAERS: 2 | US FAERS | |
| 136 | Disease Progression | FAERS: 2 | US FAERS | |
| 137 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 138 | Erythema | FAERS: 2 | US FAERS | |
| 139 | Extra dose administered | FAERS: 2 | US FAERS | |
| 140 | Eye Infection | FAERS: 2 | US FAERS | |
| 141 | Eye irritation | FAERS: 2 | US FAERS | |
| 142 | Eye pain | FAERS: 2 | US FAERS | |
| 143 | Feeling jittery | FAERS: 2 | US FAERS | |
| 144 | Food Poisoning | FAERS: 2 | US FAERS | |
| 145 | Gamma-Glutamyltransferase Increased | FAERS: 2 | US FAERS | |
| 146 | Gastroenteritis | FAERS: 2 | US FAERS | |
| 147 | Gestational Diabetes | FAERS: 2 | US FAERS | |
| 148 | Hernia | FAERS: 2 | US FAERS | |
| 149 | Hospice Care | FAERS: 2 | US FAERS | |
| 150 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 151 | Inability to afford medication | FAERS: 2 | US FAERS | |
| 152 | Irritable Bowel Syndrome | FAERS: 2 | US FAERS | |
| 153 | Joint injury | FAERS: 2 | US FAERS | |
| 154 | Joint swelling | FAERS: 2 | US FAERS | |
| 155 | Lethargy | FAERS: 2 | US FAERS | |
| 156 | Limb operation | FAERS: 2 | US FAERS | |
| 157 | Mechanical urticaria | FAERS: 2 | US FAERS | |
| 158 | Mood swings | FAERS: 2 | US FAERS | |
| 159 | Musculoskeletal chest pain | FAERS: 2 | SIDER US FAERS | |
| 160 | Neuralgia | FAERS: 2 | US FAERS | |
| 161 | Night sweats | FAERS: 2 | US FAERS | |
| 162 | Oral candidiasis | FAERS: 2 | US FAERS | |
| 163 | Personality Change | FAERS: 2 | US FAERS | |
| 164 | Pleurisy | FAERS: 2 | US FAERS | |
| 165 | Product distribution issue | FAERS: 2 | US FAERS | |
| 166 | Product prescribing error | FAERS: 2 | US FAERS | |
| 167 | Rales | FAERS: 2 | US FAERS | |
| 168 | Respiratory Therapy | FAERS: 2 | US FAERS | |
| 169 | Respiratory tract irritation | FAERS: 2 | US FAERS | |
| 170 | Sluggishness | FAERS: 2 | US FAERS | |
| 171 | Sneezing | FAERS: 2 | US FAERS | |
| 172 | Stress | FAERS: 2 | US FAERS | |
| 173 | Suicide attempt | FAERS: 2 | US FAERS | |
| 174 | Therapy change | FAERS: 2 | US FAERS | |
| 175 | Tooth Infection | FAERS: 2 | US FAERS | |
| 176 | Unevaluable event | FAERS: 2 | US FAERS | |
| 177 | Viral sinusitis | FAERS: 2 | US FAERS | |
| 178 | Abasia | FAERS: 1 | US FAERS | |
| 179 | Accidental death | FAERS: 1 | US FAERS | |
| 180 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 181 | Adenoidal disorder | FAERS: 1 | US FAERS | |
| 182 | Adenoidectomy | FAERS: 1 | US FAERS | |
| 183 | Adverse event | FAERS: 1 | US FAERS | |
| 184 | Amnesia | FAERS: 1 | US FAERS | |
| 185 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 186 | Antinuclear antibody increased | FAERS: 1 | US FAERS | |
| 187 | Arrhythmogenic Right Ventricular Dysplasia | FAERS: 1 | US FAERS | |
| 188 | Arthropod sting | FAERS: 1 | US FAERS | |
| 189 | Asphyxia | FAERS: 1 | US FAERS | |
| 190 | Astigmatism | FAERS: 1 | US FAERS | |
| 191 | Atypical mycobacterial lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 192 | Atypical pneumonia | FAERS: 1 | US FAERS | |
| 193 | Back disorder | FAERS: 1 | US FAERS | |
| 194 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 195 | Blepharospasm | FAERS: 1 | US FAERS | |
| 196 | Blood chloride decreased | FAERS: 1 | US FAERS | |
| 197 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 198 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 199 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 200 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 201 | Blood immunoglobulin M increased | FAERS: 1 | US FAERS | |
| 202 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 203 | Blood prolactin increased | FAERS: 1 | US FAERS | |
| 204 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 205 | Blood urea increased | FAERS: 1 | US FAERS | |
| 206 | Blood uric acid abnormal | FAERS: 1 | US FAERS | |
| 207 | Body height below normal | FAERS: 1 | US FAERS | |
| 208 | Bone density decreased | FAERS: 1 | US FAERS | |
| 209 | Bone pain | FAERS: 1 | US FAERS | |
| 210 | Brain Abscess | FAERS: 1 | US FAERS | |
| 211 | Bronchopulmonary Aspergillosis | FAERS: 1 | US FAERS | |
| 212 | Bronchoscopy | FAERS: 1 | US FAERS | |
| 213 | Carbon dioxide increased | FAERS: 1 | US FAERS | |
| 214 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 215 | Cardiac monitoring | FAERS: 1 | US FAERS | |
| 216 | Cerebral cyst | FAERS: 1 | US FAERS | |
| 217 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 218 | Cheilitis | FAERS: 1 | US FAERS | |
| 219 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 220 | Chronic sinusitis | FAERS: 1 | US FAERS | |
| 221 | Clumsiness | FAERS: 1 | US FAERS | |
| 222 | Crying | FAERS: 1 | US FAERS | |
| 223 | Cyanosis | FAERS: 1 | US FAERS | |
| 224 | Cystic fibrosis hepatic disease | FAERS: 1 | US FAERS | |
| 225 | Delirium | FAERS: 1 | US FAERS | |
| 226 | Device related infection | FAERS: 1 | US FAERS | |
| 227 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 228 | Dialysis related complication | FAERS: 1 | US FAERS | |
| 229 | Disability | FAERS: 1 | US FAERS | |
| 230 | Disease complication | FAERS: 1 | US FAERS | |
| 231 | Disorientation | FAERS: 1 | US FAERS | |
| 232 | Diverticulitis | FAERS: 1 | US FAERS | |
| 233 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 234 | Dysgeusia | FAERS: 1 | US FAERS | |
| 235 | Empyema | FAERS: 1 | US FAERS | |
| 236 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 237 | Epilepsy | FAERS: 1 | US FAERS | |
| 238 | Eructation | FAERS: 1 | US FAERS | |
| 239 | Eustachian tube disorder | FAERS: 1 | US FAERS | |
| 240 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 241 | False negative investigation result | FAERS: 1 | US FAERS | |
| 242 | Flatulence | FAERS: 1 | US FAERS | |
| 243 | Food craving | FAERS: 1 | US FAERS | |
| 244 | Forced expiratory volume abnormal | FAERS: 1 | US FAERS | |
| 245 | Forced expiratory volume increased | FAERS: 1 | US FAERS | |
| 246 | Foreign body in respiratory tract | FAERS: 1 | US FAERS | |
| 247 | Gastric Bypass | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 248 | Gastric infection | FAERS: 1 | US FAERS | |
| 249 | Gastritis | FAERS: 1 | US FAERS | |
| 250 | Gastroenteritis pseudomonas | FAERS: 1 | US FAERS | |
| 251 | Gastrointestinal Pain | FAERS: 1 | SIDER US FAERS | |
| 252 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 253 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 254 | Gastrointestinal obstruction | FAERS: 1 | US FAERS | |
| 255 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 256 | Growing pains | FAERS: 1 | US FAERS | |
| 257 | Head discomfort | FAERS: 1 | US FAERS | |
| 258 | Head titubation | FAERS: 1 | US FAERS | |
| 259 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 260 | Hunger | FAERS: 1 | US FAERS | |
| 261 | Hyperandrogenism | FAERS: 1 | US FAERS | |
| 262 | Hypoxia | FAERS: 1 | US FAERS | |
| 263 | Impaired work ability | FAERS: 1 | US FAERS | |
| 264 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 265 | Incision site infection | FAERS: 1 | US FAERS | |
| 266 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 267 | Incorrect product formulation administered | FAERS: 1 | US FAERS | |
| 268 | Increased viscosity of bronchial secretion | FAERS: 1 | US FAERS | |
| 269 | Increased viscosity of upper respiratory secretion | FAERS: 1 | US FAERS | |
| 270 | Infective exacerbation of bronchiectasis | FAERS: 1 | US FAERS | |
| 271 | Infrequent bowel movements | FAERS: 1 | US FAERS | |
| 272 | Injection Site Reaction | FAERS: 1 | US FAERS | |
| 273 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 274 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 275 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 276 | Joint Instability | FAERS: 1 | US FAERS | |
| 277 | Joint stiffness | FAERS: 1 | US FAERS | |
| 278 | Latent Tuberculosis | FAERS: 1 | US FAERS | |
| 279 | Ligament injury | FAERS: 1 | US FAERS | |
| 280 | Ligament rupture | FAERS: 1 | US FAERS | |
| 281 | Limb injury | FAERS: 1 | US FAERS | |
| 282 | Lip swelling | FAERS: 1 | US FAERS | |
| 283 | Lower respiratory tract infection bacterial | FAERS: 1 | US FAERS | |
| 284 | Lower respiratory tract infection fungal | FAERS: 1 | US FAERS | |
| 285 | Lung Abscess | FAERS: 1 | US FAERS | |
| 286 | Lung infection pseudomonal | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 287 | Lung transplant rejection | FAERS: 1 | US FAERS | |
| 288 | Lyme Disease | FAERS: 1 | US FAERS | |
| 289 | Macular fibrosis | FAERS: 1 | US FAERS | |
| 290 | Malabsorption | FAERS: 1 | US FAERS | |
| 291 | Malnutrition | FAERS: 1 | US FAERS | |
| 292 | Mucosal Infection | FAERS: 1 | US FAERS | |
| 293 | Multiple allergies | FAERS: 1 | US FAERS | |
| 294 | Muscle strain | FAERS: 1 | US FAERS | |
| 295 | Musculoskeletal discomfort | FAERS: 1 | SIDER US FAERS | |
| 296 | Mycobacterium test positive | FAERS: 1 | US FAERS | |
| 297 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 298 | Nerve injury | FAERS: 1 | US FAERS | |
| 299 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 300 | Oral pustule | FAERS: 1 | US FAERS | |
| 301 | Orchitis | FAERS: 1 | US FAERS | |
| 302 | Orthostatic hypertension | FAERS: 1 | US FAERS | |
| 303 | Otitis Media | FAERS: 1 | US FAERS | |
| 304 | PCO2 increased | FAERS: 1 | US FAERS | |
| 305 | Pallor | FAERS: 1 | US FAERS | |
| 306 | Pancreatic Cyst | FAERS: 1 | US FAERS | |
| 307 | Pancreatic Insufficiency | FAERS: 1 | US FAERS | |
| 308 | Pancreatic Neoplasm | FAERS: 1 | US FAERS | |
| 309 | Pancytopenia | FAERS: 1 | US FAERS | |
| 310 | Papule | FAERS: 1 | US FAERS | |
| 311 | Paranasal cyst | FAERS: 1 | US FAERS | |
| 312 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 313 | Paranasal sinus hypersecretion | FAERS: 1 | US FAERS | |
| 314 | Paranoia | FAERS: 1 | US FAERS | |
| 315 | Pericarditis | FAERS: 1 | US FAERS | |
| 316 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 317 | Pertussis | FAERS: 1 | US FAERS | |
| 318 | Photophobia | FAERS: 1 | US FAERS | |
| 319 | Pleuritic pain | FAERS: 1 | SIDER US FAERS | |
| 320 | Pneumonitis | FAERS: 1 | US FAERS | |
| 321 | Polyarthritis | FAERS: 1 | US FAERS | |
| 322 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 323 | Product size issue | FAERS: 1 | US FAERS | |
| 324 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 325 | Pulmonary function test increased | FAERS: 1 | US FAERS | |
| 326 | Pulmonary pain | FAERS: 1 | US FAERS | |
| 327 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 328 | Renal pain | FAERS: 1 | US FAERS | |
| 329 | Respiratory distress | FAERS: 1 | US FAERS | |
| 330 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 331 | Respiratory tract infection viral | FAERS: 1 | US FAERS | |
| 332 | Retching | FAERS: 1 | US FAERS | |
| 333 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 334 | Rhinovirus infection | FAERS: 1 | US FAERS | |
| 335 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 336 | School refusal | FAERS: 1 | US FAERS | |
| 337 | Screaming | FAERS: 1 | US FAERS | |
| 338 | Self-induced vomiting | FAERS: 1 | US FAERS | |
| 339 | Sepsis | FAERS: 1 | US FAERS | |
| 340 | Shunt malfunction | FAERS: 1 | US FAERS | |
| 341 | Skin irritation | FAERS: 1 | US FAERS | |
| 342 | Somnambulism | FAERS: 1 | US FAERS | |
| 343 | Splenomegaly | FAERS: 1 | US FAERS | |
| 344 | Steroid therapy | FAERS: 1 | US FAERS | |
| 345 | Tachyarrhythmia | FAERS: 1 | US FAERS | |
| 346 | Tachycardia | FAERS: 1 | US FAERS | |
| 347 | Tension Headache | FAERS: 1 | US FAERS | |
| 348 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 349 | Thirst | FAERS: 1 | US FAERS | |
| 350 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 351 | Tonsillectomy | FAERS: 1 | US FAERS | |
| 352 | Tooth Extraction | FAERS: 1 | US FAERS | |
| 353 | Toothache | FAERS: 1 | US FAERS | |
| 354 | Torticollis | FAERS: 1 | US FAERS | |
| 355 | Tuberculosis | FAERS: 1 | US FAERS | |
| 356 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 357 | Urine oxalate increased | FAERS: 1 | US FAERS | |
| 358 | Vascular calcification | FAERS: 1 | US FAERS | |
| 359 | Vena cava injury | FAERS: 1 | US FAERS | |
| 360 | Viral pharyngitis | FAERS: 1 | US FAERS | |
| 361 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 362 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 363 | Wound Infection | FAERS: 1 | US FAERS | |
| 364 | Dermatitis | SIDER | ||
| 365 | Ear and labyrinth disorders | SIDER | ||
| 366 | Ear congestion | SIDER | ||
| 367 | Ear discomfort | SIDER | ||
| 368 | Infestation | SIDER | ||
| 369 | Mastitis | SIDER | ||
| 370 | Nipple pain | SIDER | ||
| 371 | Rhinitis | SIDER | ||
| 372 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.