ziprasidone
(NZDBKBRIBJLNNT-UHFFFAOYSA-N)
Structure
- SMILES
- O=C1Nc2c(C1)cc(c(c2)Cl)CCN1CCN(CC1)c1nsc2c1cccc2.Cl
- Molecular Formula:
- C21H22Cl2N4OS
- Molecular Weight:
- 449.397
- Log P:
- 4.7519
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 2
- TPSA:
- 76.71
- CAS Number(s):
- 122883-93-6
Synonym(s)
1.
ziprasidone
2.
5-(2-(4-(3-benzisothiazolyl)piperazinyl)ethyl)-6-chloro-1,3-dihydro-2H-indol-2-one
3.
CP 88059
4.
CP 88059-01
5.
CP-88,059
6.
CP-88,059-01
7.
CP-88,059-1
8.
Geodon
9.
ziprasidone hydrochloride
10.
ziprasidone hydrochloride, monohydrate
11.
ziprazidone
External Link(s)
| MeSH | C092292 |
| PubChem Compound | 219099 67108352 |
| BindingDB | 50366825 |
| CHEMBL | CHEMBL1712 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 53 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Anxiety | FAERS: 16 | US FAERS | |
| 3 | Agitation | FAERS: 12 | US FAERS | |
| 4 | Product substitution issue | FAERS: 12 | US FAERS | |
| 5 | Feeling abnormal | FAERS: 9 | US FAERS | |
| 6 | Headache | FAERS: 8 | US FAERS | |
| 7 | Tremor | FAERS: 8 | US FAERS | |
| 8 | Dizziness | FAERS: 7 | US FAERS | |
| 9 | Malaise | FAERS: 7 | US FAERS | |
| 10 | Somnolence | FAERS: 7 | US FAERS | |
| 11 | Tachycardia | FAERS: 7 | US FAERS | |
| 12 | Vomiting | FAERS: 7 | US FAERS | |
| 13 | Blood creatine phosphokinase increased | FAERS: 6 | US FAERS | |
| 14 | Dystonia | FAERS: 6 | US FAERS | |
| 15 | Pain | FAERS: 6 | US FAERS | |
| 16 | Completed Suicide | FAERS: 5 | US FAERS | |
| 17 | Fatigue | FAERS: 5 | US FAERS | |
| 18 | Mental status changes | FAERS: 5 | US FAERS | |
| 19 | Neuroleptic Malignant Syndrome | FAERS: 5 | US FAERS | |
| 20 | Paranoia | FAERS: 5 | US FAERS | |
| 21 | Asthenia | FAERS: 4 | US FAERS | |
| 22 | Hypersensitivity | FAERS: 4 | US FAERS | |
| 23 | Mood swings | FAERS: 4 | US FAERS | |
| 24 | Nausea | FAERS: 4 | US FAERS | |
| 25 | No adverse event | FAERS: 4 | US FAERS | |
| 26 | Priapism | FAERS: 4 | US FAERS | |
| 27 | Product use in unapproved indication | FAERS: 4 | US FAERS | |
| 28 | Syncope | FAERS: 4 | US FAERS | |
| 29 | Accidental exposure | FAERS: 3 | US FAERS | |
| 30 | Activation syndrome | FAERS: 3 | US FAERS | |
| 31 | Akathisia | FAERS: 3 | US FAERS | |
| 32 | Anger | FAERS: 3 | US FAERS | |
| 33 | Atrioventricular Block | FAERS: 3 | US FAERS | |
| 34 | Bulimia Nervosa | FAERS: 3 | US FAERS | |
| 35 | Cardiac Arrest | FAERS: 3 | US FAERS | |
| 36 | Chest Pain | FAERS: 3 | US FAERS | |
| 37 | Crying | FAERS: 3 | US FAERS | |
| 38 | Dehydration | FAERS: 3 | US FAERS | |
| 39 | Delirium | FAERS: 3 | US FAERS | |
| 40 | Disease recurrence | FAERS: 3 | US FAERS | |
| 41 | Drooling | FAERS: 3 | US FAERS | |
| 42 | Obsessive-Compulsive Disorder | FAERS: 3 | US FAERS | |
| 43 | Pleurothotonus | FAERS: 3 | US FAERS | |
| 44 | Respiratory Failure | FAERS: 3 | US FAERS | |
| 45 | Respiratory muscle weakness | FAERS: 3 | US FAERS | |
| 46 | Restlessness | FAERS: 3 | US FAERS | |
| 47 | Stress | FAERS: 3 | US FAERS | |
| 48 | Suicide attempt | FAERS: 3 | US FAERS | |
| 49 | Tardive Dyskinesia | FAERS: 3 | US FAERS | |
| 50 | Urinary Incontinence | FAERS: 3 | US FAERS | |
| 51 | Visual Impairment | FAERS: 3 | US FAERS | |
| 52 | Accidental overdose | FAERS: 2 | US FAERS | |
| 53 | Adverse event | FAERS: 2 | US FAERS | |
| 54 | Angioedema | FAERS: 2 | US FAERS | |
| 55 | Astigmatism | FAERS: 2 | US FAERS | |
| 56 | Blood creatinine decreased | FAERS: 2 | US FAERS | |
| 57 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 58 | Bradycardia | FAERS: 2 | US FAERS | |
| 59 | Cataract | FAERS: 2 | US FAERS | |
| 60 | Cogwheel Rigidity | FAERS: 2 | US FAERS | |
| 61 | Colectomy | FAERS: 2 | US FAERS | |
| 62 | Discomfort | FAERS: 2 | US FAERS | |
| 63 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 64 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 65 | Drug exposure during pregnancy | FAERS: 2 | US FAERS | |
| 66 | Drug withdrawal syndrome | FAERS: 2 | US FAERS | |
| 67 | Dysgeusia | FAERS: 2 | US FAERS | |
| 68 | Female Orgasmic Disorder | FAERS: 2 | US FAERS | |
| 69 | Female sexual arousal disorder | FAERS: 2 | US FAERS | |
| 70 | Hypomania | FAERS: 2 | US FAERS | |
| 71 | Hyporeflexia | FAERS: 2 | US FAERS | |
| 72 | Hypotension | FAERS: 2 | US FAERS | |
| 73 | Middle insomnia | FAERS: 2 | US FAERS | |
| 74 | Muscle Rigidity | FAERS: 2 | US FAERS | |
| 75 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 76 | Myopia | FAERS: 2 | US FAERS | |
| 77 | Palpitations | FAERS: 2 | US FAERS | |
| 78 | Pancreatitis | FAERS: 2 | US FAERS | |
| 79 | Polydipsia | FAERS: 2 | US FAERS | |
| 80 | Product use issue | FAERS: 2 | US FAERS | |
| 81 | Pseudoexfoliation of lens capsule | FAERS: 2 | US FAERS | |
| 82 | Psychiatric decompensation | FAERS: 2 | US FAERS | |
| 83 | Pulmonary congestion | FAERS: 2 | US FAERS | |
| 84 | Sinus bradycardia | FAERS: 2 | US FAERS | |
| 85 | Theft | FAERS: 2 | US FAERS | |
| 86 | Torticollis | FAERS: 2 | US FAERS | |
| 87 | Urticaria | FAERS: 2 | US FAERS | |
| 88 | Ventricular Fibrillation | FAERS: 2 | US FAERS | |
| 89 | Weight decreased | FAERS: 2 | US FAERS | |
| 90 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 91 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 92 | Acne | FAERS: 1 | US FAERS | |
| 93 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 94 | Alcohol abuse | FAERS: 1 | US FAERS | |
| 95 | Alopecia | FAERS: 1 | US FAERS | |
| 96 | Altered visual depth perception | FAERS: 1 | US FAERS | |
| 97 | Amnesia | FAERS: 1 | US FAERS | |
| 98 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 99 | Anoxic Encephalopathy | FAERS: 1 | US FAERS | |
| 100 | Arthralgia | FAERS: 1 | US FAERS | |
| 101 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 102 | Autoimmune thyroiditis | FAERS: 1 | US FAERS | |
| 103 | Autonomic nervous system imbalance | FAERS: 1 | US FAERS | |
| 104 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 105 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 106 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 107 | Blood immunoglobulin E increased | FAERS: 1 | US FAERS | |
| 108 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 109 | Blood pH decreased | FAERS: 1 | US FAERS | |
| 110 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 111 | Blood urea increased | FAERS: 1 | US FAERS | |
| 112 | Breast Cyst | FAERS: 1 | US FAERS | |
| 113 | Burning sensation | FAERS: 1 | US FAERS | |
| 114 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 115 | Cardiovascular insufficiency | FAERS: 1 | US FAERS | |
| 116 | Cellulitis | FAERS: 1 | US FAERS | |
| 117 | Cerebral atrophy | FAERS: 1 | US FAERS | |
| 118 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 119 | Chest discomfort | FAERS: 1 | US FAERS | |
| 120 | Chills | FAERS: 1 | US FAERS | |
| 121 | Complement factor C3 increased | FAERS: 1 | US FAERS | |
| 122 | Complement factor C4 increased | FAERS: 1 | US FAERS | |
| 123 | Cyst | FAERS: 1 | US FAERS | |
| 124 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 125 | Depressed mood | FAERS: 1 | US FAERS | |
| 126 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 127 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 128 | Diplegia | FAERS: 1 | US FAERS | |
| 129 | Disorientation | FAERS: 1 | US FAERS | |
| 130 | Drug Dependence | FAERS: 1 | US FAERS | |
| 131 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 132 | Drug administration error | FAERS: 1 | US FAERS | |
| 133 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 134 | Drug toxicity | FAERS: 1 | US FAERS | |
| 135 | Dysarthria | FAERS: 1 | US FAERS | |
| 136 | Dysplasia | FAERS: 1 | US FAERS | |
| 137 | Ear discomfort | FAERS: 1 | US FAERS | |
| 138 | Electrocardiogram ST segment abnormal | FAERS: 1 | US FAERS | |
| 139 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 140 | Emotional disorder | FAERS: 1 | US FAERS | |
| 141 | Emotional distress | FAERS: 1 | US FAERS | |
| 142 | Erection increased | FAERS: 1 | US FAERS | |
| 143 | Erythema | FAERS: 1 | US FAERS | |
| 144 | Euphoric mood | FAERS: 1 | US FAERS | |
| 145 | Feeling jittery | FAERS: 1 | US FAERS | |
| 146 | Flat affect | FAERS: 1 | US FAERS | |
| 147 | Flight of ideas | FAERS: 1 | US FAERS | |
| 148 | Folliculitis | FAERS: 1 | US FAERS | |
| 149 | Gastritis | FAERS: 1 | US FAERS | |
| 150 | Gaze palsy | FAERS: 1 | US FAERS | |
| 151 | Hallucinations, mixed | FAERS: 1 | US FAERS | |
| 152 | Hepatitis A antibody positive | FAERS: 1 | US FAERS | |
| 153 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 154 | Hypervigilance | FAERS: 1 | US FAERS | |
| 155 | Impaired work ability | FAERS: 1 | US FAERS | |
| 156 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 157 | Incoherent | FAERS: 1 | US FAERS | |
| 158 | Infantile back arching | FAERS: 1 | US FAERS | |
| 159 | Initial insomnia | FAERS: 1 | US FAERS | |
| 160 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 161 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 162 | Irregular sleep phase | FAERS: 1 | US FAERS | |
| 163 | Joint injury | FAERS: 1 | US FAERS | |
| 164 | Joint stiffness | FAERS: 1 | US FAERS | |
| 165 | Kounis Syndrome | FAERS: 1 | US FAERS | |
| 166 | Laceration | FAERS: 1 | US FAERS | |
| 167 | Lethargy | FAERS: 1 | US FAERS | |
| 168 | Leukopenia | FAERS: 1 | US FAERS | |
| 169 | Limb discomfort | FAERS: 1 | US FAERS | |
| 170 | Lower respiratory tract inflammation | FAERS: 1 | US FAERS | |
| 171 | Macular degeneration | FAERS: 1 | US FAERS | |
| 172 | Medication Error | FAERS: 1 | US FAERS | |
| 173 | Memory impairment | FAERS: 1 | US FAERS | |
| 174 | Mental impairment | FAERS: 1 | US FAERS | |
| 175 | Muscle Spasticity | FAERS: 1 | US FAERS | |
| 176 | Muscle tightness | FAERS: 1 | US FAERS | |
| 177 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 178 | Neck Pain | FAERS: 1 | US FAERS | |
| 179 | Negativism | FAERS: 1 | US FAERS | |
| 180 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 181 | Nervousness | FAERS: 1 | US FAERS | |
| 182 | Neuralgia | FAERS: 1 | US FAERS | |
| 183 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 184 | Nodule | FAERS: 1 | US FAERS | |
| 185 | Oculogyric crisis | FAERS: 1 | US FAERS | |
| 186 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 187 | Overdose | FAERS: 1 | US FAERS | |
| 188 | PCO2 increased | FAERS: 1 | US FAERS | |
| 189 | Pacemaker generated rhythm | FAERS: 1 | US FAERS | |
| 190 | Pancreatectomy | FAERS: 1 | US FAERS | |
| 191 | Parkinsonian rest tremor | FAERS: 1 | US FAERS | |
| 192 | Pathological fracture | FAERS: 1 | US FAERS | |
| 193 | Personality Change | FAERS: 1 | US FAERS | |
| 194 | Poisoning | FAERS: 1 | US FAERS | |
| 195 | Pregnancy | FAERS: 1 | US FAERS | |
| 196 | Presyncope | FAERS: 1 | US FAERS | |
| 197 | Product packaging issue | FAERS: 1 | US FAERS | |
| 198 | Product physical issue | FAERS: 1 | US FAERS | |
| 199 | Product size issue | FAERS: 1 | US FAERS | |
| 200 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 201 | Pruritus | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 202 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 203 | Purpura | FAERS: 1 | US FAERS | |
| 204 | Rash erythematous | FAERS: 1 | US FAERS | |
| 205 | Rebound effect | FAERS: 1 | US FAERS | |
| 206 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 207 | Retained products of conception | FAERS: 1 | US FAERS | |
| 208 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 209 | Rhinitis | FAERS: 1 | US FAERS | |
| 210 | Schizophrenia | FAERS: 1 | US FAERS | |
| 211 | Serotonin Syndrome | FAERS: 1 | US FAERS | |
| 212 | Shock | FAERS: 1 | US FAERS | |
| 213 | Sleep Paralysis | FAERS: 1 | US FAERS | |
| 214 | Sleep-related eating disorder | FAERS: 1 | US FAERS | |
| 215 | Slow response to stimuli | FAERS: 1 | US FAERS | |
| 216 | Sluggishness | FAERS: 1 | US FAERS | |
| 217 | Snoring | FAERS: 1 | US FAERS | |
| 218 | Somnambulism | FAERS: 1 | US FAERS | |
| 219 | Strabismus | FAERS: 1 | US FAERS | |
| 220 | Suspected product quality issue | FAERS: 1 | US FAERS | |
| 221 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 222 | Throat irritation | FAERS: 1 | US FAERS | |
| 223 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 224 | Tinnitus | FAERS: 1 | US FAERS | |
| 225 | Toothache | FAERS: 1 | US FAERS | |
| 226 | Type III immune complex mediated reaction | FAERS: 1 | US FAERS | |
| 227 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 228 | Urine output increased | FAERS: 1 | US FAERS | |
| 229 | Wheezing | FAERS: 1 | US FAERS | |
| 230 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 231 | Yawning | FAERS: 1 | US FAERS | |
| 232 | furuncle | FAERS: 1 | US FAERS | |
| 233 | nervous system disorder | FAERS: 1 | US FAERS | |
| 234 | Anorgasmia | Canada Vigilance: 1 | Canada Vigilance | |
| 235 | Disturbance in sexual arousal | Canada Vigilance: 1 | Canada Vigilance | |
| 236 | Lichen Planus | Canada Vigilance: 1 | Canada Vigilance | |
| 237 | Myocardial Infarction | Canada Vigilance: 1 | Canada Vigilance | |
| 238 | Sexual Dysfunction | Canada Vigilance: 1 | Canada Vigilance | |
| 239 | Skin lesion | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.