Tapentadol
(KWTWDQCKEHXFFR-SMDDNHRTSA-N)
Structure
- SMILES
- CC[C@@H](c1cccc(c1)O)[C@H](CN(C)C)C
- Type(s)
- Approved
- ATC code(s)
- N02AX06
- Molecular Formula:
- C14H23NO
- Molecular Weight:
- 221.339
- Log P:
- 3.0835
- Hydrogen Bond Acceptor:
- 2
- Hydrogen Bond Donor:
- 1
- TPSA:
- 23.47
- CAS Number(s):
- 175591-23-8
Synonym(s)
1.
Tapentadol
2.
3-((1R,2R)-3-(dimethylamino)-1-ethyl-2-methylpropyl)phenol
3.
Nucynta
4.
Tapentadol Hydrochloride
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 81 | US FAERS | |
| 2 | Nausea | FAERS: 63 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 3 | Pain | FAERS: 61 | 17656655 28499616 | CTD US FAERS |
| 4 | Dizziness | FAERS: 54 | SIDER US FAERS | |
| 5 | Drug dose omission | FAERS: 53 | US FAERS | |
| 6 | Adverse event | FAERS: 43 | US FAERS | |
| 7 | Feeling abnormal | FAERS: 36 | SIDER US FAERS | |
| 8 | Somnolence | FAERS: 36 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 9 | Headache | FAERS: 34 | SIDER US FAERS | |
| 10 | Vomiting | FAERS: 34 | SIDER US FAERS | |
| 11 | Product use in unapproved indication | FAERS: 31 | US FAERS | |
| 12 | Malaise | FAERS: 28 | US FAERS | |
| 13 | Tremor | FAERS: 27 | SIDER US FAERS | |
| 14 | Palpitations | FAERS: 26 | SIDER US FAERS | |
| 15 | Amnesia | FAERS: 24 | US FAERS | |
| 16 | Pruritus | FAERS: 24 | SIDER US FAERS | |
| 17 | Disorientation | FAERS: 22 | SIDER US FAERS | |
| 18 | Anxiety | FAERS: 21 | SIDER US FAERS | |
| 19 | Serotonin Syndrome | FAERS: 21 | SIDER US FAERS | |
| 20 | Overdose | FAERS: 20 | US FAERS | |
| 21 | Product quality issue | FAERS: 20 | US FAERS | |
| 22 | Drug abuse | FAERS: 16 | SIDER US FAERS | |
| 23 | Product use issue | FAERS: 16 | US FAERS | |
| 24 | Constipation | FAERS: 15 | SIDER US FAERS | |
| 25 | Fatigue | FAERS: 15 | SIDER US FAERS | |
| 26 | Urinary Retention | FAERS: 15 | US FAERS | |
| 27 | Urticaria | FAERS: 15 | SIDER US FAERS | |
| 28 | Agitation | FAERS: 13 | SIDER US FAERS | |
| 29 | Mental status changes | FAERS: 13 | US FAERS | |
| 30 | Tachycardia | FAERS: 13 | SIDER US FAERS | |
| 31 | Chest discomfort | FAERS: 12 | US FAERS | |
| 32 | Delirium | FAERS: 12 | US FAERS | |
| 33 | Drug diversion | FAERS: 12 | US FAERS | |
| 34 | Drug screen positive | FAERS: 12 | US FAERS | |
| 35 | Hypersensitivity | FAERS: 12 | SIDER US FAERS | |
| 36 | Suicide attempt | FAERS: 12 | US FAERS | |
| 37 | Drug withdrawal syndrome | FAERS: 11 | SIDER US FAERS | |
| 38 | Dysarthria | FAERS: 11 | SIDER US FAERS | |
| 39 | Respiratory Depression | FAERS: 11 | SIDER US FAERS | |
| 40 | Toxicity to various agents | FAERS: 11 | US FAERS | |
| 41 | Asthenia | FAERS: 10 | SIDER US FAERS | |
| 42 | Asthma | FAERS: 10 | US FAERS | |
| 43 | Drug prescribing error | FAERS: 10 | US FAERS | |
| 44 | Hypotension | FAERS: 9 | SIDER US FAERS | |
| 45 | Memory impairment | FAERS: 9 | SIDER US FAERS | |
| 46 | Unresponsive to stimuli | FAERS: 9 | US FAERS | |
| 47 | Vertigo | FAERS: 9 | SIDER US FAERS | |
| 48 | Alopecia | FAERS: 8 | US FAERS | |
| 49 | Crying | FAERS: 8 | US FAERS | |
| 50 | Drug Dependence | FAERS: 8 | US FAERS | |
| 51 | Medication Error | FAERS: 8 | US FAERS | |
| 52 | Nervousness | FAERS: 8 | SIDER US FAERS | |
| 53 | Visual Impairment | FAERS: 8 | SIDER US FAERS | |
| 54 | Wrong technique in product usage process | FAERS: 8 | US FAERS | |
| 55 | Chest Pain | FAERS: 7 | US FAERS | |
| 56 | Drug dose titration not performed | FAERS: 7 | US FAERS | |
| 57 | Incorrect route of drug administration | FAERS: 7 | US FAERS | |
| 58 | Intentional drug misuse | FAERS: 7 | US FAERS | |
| 59 | Product distribution issue | FAERS: 7 | US FAERS | |
| 60 | Akathisia | FAERS: 6 | US FAERS | |
| 61 | Cerebrovascular accident | FAERS: 6 | US FAERS | |
| 62 | Chills | FAERS: 6 | SIDER US FAERS | |
| 63 | Depressed Level of Consciousness | FAERS: 6 | SIDER US FAERS | |
| 64 | Depressed mood | FAERS: 6 | US FAERS | |
| 65 | Euphoric mood | FAERS: 6 | SIDER US FAERS | |
| 66 | Impaired driving ability | FAERS: 6 | US FAERS | |
| 67 | Lethargy | FAERS: 6 | SIDER US FAERS | |
| 68 | Mental impairment | FAERS: 6 | US FAERS | |
| 69 | Pancreatitis | FAERS: 6 | US FAERS | |
| 70 | Pneumonia | FAERS: 6 | US FAERS | |
| 71 | Presyncope | FAERS: 6 | SIDER US FAERS | |
| 72 | Unevaluable event | FAERS: 6 | US FAERS | |
| 73 | Wrong drug administered | FAERS: 6 | US FAERS | |
| 74 | Abasia | FAERS: 5 | US FAERS | |
| 75 | Activities of daily living impaired | FAERS: 5 | US FAERS | |
| 76 | Aphasia | FAERS: 5 | US FAERS | |
| 77 | Back Pain | FAERS: 5 | US FAERS | |
| 78 | Drug ineffective for unapproved indication | FAERS: 5 | US FAERS | |
| 79 | Drug screen negative | FAERS: 5 | US FAERS | |
| 80 | Dysphonia | FAERS: 5 | US FAERS | |
| 81 | Erythema | FAERS: 5 | US FAERS | |
| 82 | Fibromyalgia | FAERS: 5 | US FAERS | |
| 83 | Inappropriate schedule of drug administration | FAERS: 5 | US FAERS | |
| 84 | Intentional product misuse | FAERS: 5 | US FAERS | |
| 85 | Myocardial Infarction | FAERS: 5 | US FAERS | |
| 86 | Nasopharyngitis | FAERS: 5 | SIDER US FAERS | |
| 87 | Weight decreased | FAERS: 5 | SIDER US FAERS | |
| 88 | Wrong technique in drug usage process | FAERS: 5 | US FAERS | |
| 89 | Abdominal Pain | FAERS: 4 | US FAERS | |
| 90 | Abdominal discomfort | FAERS: 4 | SIDER US FAERS | |
| 91 | Cardiac Arrest | FAERS: 4 | US FAERS | |
| 92 | Completed Suicide | FAERS: 4 | US FAERS | |
| 93 | Dehydration | FAERS: 4 | US FAERS | |
| 94 | Drug dispensing error | FAERS: 4 | US FAERS | |
| 95 | Dysuria | FAERS: 4 | US FAERS | |
| 96 | Flushing | FAERS: 4 | US FAERS | |
| 97 | Impaired work ability | FAERS: 4 | US FAERS | |
| 98 | Incorrect dose administered | FAERS: 4 | US FAERS | |
| 99 | Lymphadenopathy | FAERS: 4 | US FAERS | |
| 100 | Myalgia | FAERS: 4 | US FAERS | |
| 101 | Paranoia | FAERS: 4 | US FAERS | |
| 102 | Renal pain | FAERS: 4 | US FAERS | |
| 103 | Screaming | FAERS: 4 | US FAERS | |
| 104 | Syncope | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 105 | Therapeutic response unexpected | FAERS: 4 | US FAERS | |
| 106 | Accidental exposure to product | FAERS: 3 | US FAERS | |
| 107 | Accidental exposure to product by child | FAERS: 3 | US FAERS | |
| 108 | Accidental overdose | FAERS: 3 | US FAERS | |
| 109 | Ageusia | FAERS: 3 | US FAERS | |
| 110 | Angioedema | FAERS: 3 | SIDER US FAERS | |
| 111 | Arthralgia | FAERS: 3 | SIDER US FAERS | |
| 112 | Back disorder | FAERS: 3 | US FAERS | |
| 113 | Blindness | FAERS: 3 | US FAERS | |
| 114 | Blood glucose increased | FAERS: 3 | US FAERS | |
| 115 | Bradycardia | FAERS: 3 | SIDER US FAERS | |
| 116 | Chromaturia | FAERS: 3 | US FAERS | |
| 117 | Cold sweat | FAERS: 3 | US FAERS | |
| 118 | Drug Tolerance | FAERS: 3 | US FAERS | |
| 119 | Dystonia | FAERS: 3 | US FAERS | |
| 120 | Electrocardiogram change | FAERS: 3 | US FAERS | |
| 121 | Feeling jittery | FAERS: 3 | US FAERS | |
| 122 | Intestinal Obstruction | FAERS: 3 | US FAERS | |
| 123 | Joint injury | FAERS: 3 | US FAERS | |
| 124 | Limb injury | FAERS: 3 | US FAERS | |
| 125 | No adverse event | FAERS: 3 | US FAERS | |
| 126 | Opiates negative | FAERS: 3 | US FAERS | |
| 127 | Panic Disorder | FAERS: 3 | US FAERS | |
| 128 | Product dose omission | FAERS: 3 | US FAERS | |
| 129 | Restlessness | FAERS: 3 | US FAERS | |
| 130 | Sinus Tachycardia | FAERS: 3 | US FAERS | |
| 131 | Swelling | FAERS: 3 | US FAERS | |
| 132 | Urinary tract infection | FAERS: 3 | SIDER US FAERS | |
| 133 | Wheezing | FAERS: 3 | US FAERS | |
| 134 | Ataxia | FAERS: 2 | SIDER US FAERS | |
| 135 | Bipolar Disorder | FAERS: 2 | US FAERS | |
| 136 | Bladder pain | FAERS: 2 | US FAERS | |
| 137 | Blepharospasm | FAERS: 2 | US FAERS | |
| 138 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 139 | Bradyphrenia | FAERS: 2 | US FAERS | |
| 140 | Burning sensation | FAERS: 2 | US FAERS | |
| 141 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 142 | Cyst | FAERS: 2 | US FAERS | |
| 143 | Dental caries | FAERS: 2 | US FAERS | |
| 144 | Dependence | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 145 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 146 | Disability | FAERS: 2 | US FAERS | |
| 147 | Discomfort | FAERS: 2 | US FAERS | |
| 148 | Dissociation | FAERS: 2 | US FAERS | |
| 149 | Drug screen false positive | FAERS: 2 | US FAERS | |
| 150 | Dysgeusia | FAERS: 2 | US FAERS | |
| 151 | Electrocardiogram abnormal | FAERS: 2 | US FAERS | |
| 152 | Expired product administered | FAERS: 2 | US FAERS | |
| 153 | Gait inability | FAERS: 2 | US FAERS | |
| 154 | Gambling | FAERS: 2 | US FAERS | |
| 155 | Gamma-Glutamyltransferase Increased | FAERS: 2 | SIDER US FAERS | |
| 156 | Gout | FAERS: 2 | US FAERS | |
| 157 | Hemiplegia | FAERS: 2 | US FAERS | |
| 158 | Hysterectomy | FAERS: 2 | US FAERS | |
| 159 | Ileus | FAERS: 2 | US FAERS | |
| 160 | Laceration | FAERS: 2 | US FAERS | |
| 161 | Laryngitis | FAERS: 2 | US FAERS | |
| 162 | Neck Pain | FAERS: 2 | US FAERS | |
| 163 | Nerve injury | FAERS: 2 | US FAERS | |
| 164 | Neuralgia | FAERS: 2 | US FAERS | |
| 165 | Nystagmus | FAERS: 2 | US FAERS | |
| 166 | Obsessive-Compulsive Disorder | FAERS: 2 | US FAERS | |
| 167 | Opiates positive | FAERS: 2 | US FAERS | |
| 168 | Personality Change | FAERS: 2 | US FAERS | |
| 169 | Petechiae | FAERS: 2 | US FAERS | |
| 170 | Product taste abnormal | FAERS: 2 | US FAERS | |
| 171 | Restless Legs Syndrome | FAERS: 2 | US FAERS | |
| 172 | Rhabdomyolysis | FAERS: 2 | US FAERS | |
| 173 | Rotator cuff syndrome | FAERS: 2 | US FAERS | |
| 174 | Sinus bradycardia | FAERS: 2 | US FAERS | |
| 175 | Stupor | FAERS: 2 | US FAERS | |
| 176 | Sudden death | FAERS: 2 | US FAERS | |
| 177 | Tachyphrenia | FAERS: 2 | US FAERS | |
| 178 | Therapeutic response delayed | FAERS: 2 | US FAERS | |
| 179 | Therapy cessation | FAERS: 2 | US FAERS | |
| 180 | Tooth Loss | FAERS: 2 | US FAERS | |
| 181 | Transaminases increased | FAERS: 2 | US FAERS | |
| 182 | Violence-related symptom | FAERS: 2 | US FAERS | |
| 183 | Vitreous Detachment | FAERS: 2 | US FAERS | |
| 184 | nervous system disorder | FAERS: 2 | SIDER US FAERS | |
| 185 | Acute Lung Injury | FAERS: 1 | US FAERS | |
| 186 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 187 | Acute psychosis | FAERS: 1 | US FAERS | |
| 188 | Anaphylactic shock | FAERS: 1 | SIDER US FAERS | |
| 189 | Androgenetic Alopecia | FAERS: 1 | US FAERS | |
| 190 | Anger | FAERS: 1 | US FAERS | |
| 191 | Anhedonia | FAERS: 1 | US FAERS | |
| 192 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 193 | Anosmia | FAERS: 1 | US FAERS | |
| 194 | Anuria | FAERS: 1 | US FAERS | |
| 195 | Arachnoiditis | FAERS: 1 | US FAERS | |
| 196 | Ascites | FAERS: 1 | US FAERS | |
| 197 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 198 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 199 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 200 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 201 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 202 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 203 | Bone pain | FAERS: 1 | US FAERS | |
| 204 | Breakthrough Pain | FAERS: 1 | US FAERS | |
| 205 | Bronchitis | FAERS: 1 | US FAERS | |
| 206 | Bronchospasm | FAERS: 1 | US FAERS | |
| 207 | Bruxism | FAERS: 1 | US FAERS | |
| 208 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 209 | Cystitis | FAERS: 1 | US FAERS | |
| 210 | Deafness | FAERS: 1 | US FAERS | |
| 211 | Dementia | FAERS: 1 | US FAERS | |
| 212 | Diplopia | FAERS: 1 | US FAERS | |
| 213 | Dreamy state | FAERS: 1 | US FAERS | |
| 214 | Drooling | FAERS: 1 | US FAERS | |
| 215 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 216 | Drug effect variable | FAERS: 1 | US FAERS | |
| 217 | Dysgraphia | FAERS: 1 | US FAERS | |
| 218 | Dyspepsia | FAERS: 1 | SIDER US FAERS | |
| 219 | Dysphemia | FAERS: 1 | US FAERS | |
| 220 | Economic problem | FAERS: 1 | US FAERS | |
| 221 | Emotional disorder | FAERS: 1 | US FAERS | |
| 222 | Epistaxis | FAERS: 1 | US FAERS | |
| 223 | Erectile dysfunction | FAERS: 1 | SIDER US FAERS | |
| 224 | Escherichia test positive | FAERS: 1 | US FAERS | |
| 225 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 226 | Eye irritation | FAERS: 1 | US FAERS | |
| 227 | Eye pain | FAERS: 1 | US FAERS | |
| 228 | Feeling Cold | FAERS: 1 | US FAERS | |
| 229 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 230 | Flat affect | FAERS: 1 | US FAERS | |
| 231 | Formication | FAERS: 1 | US FAERS | |
| 232 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 233 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 234 | Glossitis | FAERS: 1 | US FAERS | |
| 235 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 236 | Hallucinations, mixed | FAERS: 1 | US FAERS | |
| 237 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 238 | Histamine abnormal | FAERS: 1 | US FAERS | |
| 239 | Hypercreatininaemia | FAERS: 1 | US FAERS | |
| 240 | Hypersomnia | FAERS: 1 | US FAERS | |
| 241 | Hyperventilation | FAERS: 1 | US FAERS | |
| 242 | Hypoxia | FAERS: 1 | US FAERS | |
| 243 | Immobile | FAERS: 1 | US FAERS | |
| 244 | Impaired gastric emptying | FAERS: 1 | SIDER US FAERS | |
| 245 | Inadequate analgesia | FAERS: 1 | US FAERS | |
| 246 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 247 | Incoherent | FAERS: 1 | US FAERS | |
| 248 | Incontinence | FAERS: 1 | US FAERS | |
| 249 | Influenza | FAERS: 1 | US FAERS | |
| 250 | Infrequent bowel movements | FAERS: 1 | US FAERS | |
| 251 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 252 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 253 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 254 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 255 | Intervertebral disc injury | FAERS: 1 | US FAERS | |
| 256 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 257 | Leukocytosis | FAERS: 1 | US FAERS | |
| 258 | Lip swelling | FAERS: 1 | US FAERS | |
| 259 | Loose tooth | FAERS: 1 | US FAERS | |
| 260 | Lyme Disease | FAERS: 1 | US FAERS | |
| 261 | Mechanical urticaria | FAERS: 1 | US FAERS | |
| 262 | Menorrhagia | FAERS: 1 | US FAERS | |
| 263 | Middle insomnia | FAERS: 1 | US FAERS | |
| 264 | Monoplegia | FAERS: 1 | US FAERS | |
| 265 | Mood swings | FAERS: 1 | US FAERS | |
| 266 | Mouth swelling | FAERS: 1 | US FAERS | |
| 267 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 268 | Mydriasis | FAERS: 1 | US FAERS | |
| 269 | Myoclonic Epilepsy | FAERS: 1 | US FAERS | |
| 270 | Myoclonus | FAERS: 1 | US FAERS | |
| 271 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 272 | Neutropenia | FAERS: 1 | US FAERS | |
| 273 | Obesity | FAERS: 1 | US FAERS | |
| 274 | Obsessive thoughts | FAERS: 1 | US FAERS | |
| 275 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 276 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 277 | Pallor | FAERS: 1 | US FAERS | |
| 278 | Performance status decreased | FAERS: 1 | US FAERS | |
| 279 | Periodontitis | FAERS: 1 | US FAERS | |
| 280 | Peritonitis | FAERS: 1 | US FAERS | |
| 281 | Peritonsillar Abscess | FAERS: 1 | US FAERS | |
| 282 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 283 | Post procedural sepsis | FAERS: 1 | US FAERS | |
| 284 | Product administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 285 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 286 | Product physical issue | FAERS: 1 | US FAERS | |
| 287 | Product prescribing error | FAERS: 1 | US FAERS | |
| 288 | Product selection error | FAERS: 1 | US FAERS | |
| 289 | Product used for unknown indication | FAERS: 1 | US FAERS | |
| 290 | Psoriasis | FAERS: 1 | US FAERS | |
| 291 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 292 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 293 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 294 | Scab | FAERS: 1 | US FAERS | |
| 295 | Schizophrenia | FAERS: 1 | US FAERS | |
| 296 | Sepsis | FAERS: 1 | US FAERS | |
| 297 | Shock | FAERS: 1 | SIDER US FAERS | |
| 298 | Sick Sinus Syndrome | FAERS: 1 | US FAERS | |
| 299 | Sinus headache | FAERS: 1 | US FAERS | |
| 300 | Skin laceration | FAERS: 1 | US FAERS | |
| 301 | Sleep disorder due to general medical condition, insomnia type | FAERS: 1 | US FAERS | |
| 302 | Sopor | FAERS: 1 | US FAERS | |
| 303 | Splenic Infarction | FAERS: 1 | US FAERS | |
| 304 | Staring | FAERS: 1 | US FAERS | |
| 305 | Stress | FAERS: 1 | US FAERS | |
| 306 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 307 | Tardive Dyskinesia | FAERS: 1 | US FAERS | |
| 308 | Temperature regulation disorder | FAERS: 1 | US FAERS | |
| 309 | Thrombosis | FAERS: 1 | US FAERS | |
| 310 | Tonsillitis | FAERS: 1 | US FAERS | |
| 311 | Upper airway obstruction | FAERS: 1 | US FAERS | |
| 312 | Urinary hesitation | FAERS: 1 | SIDER US FAERS | |
| 313 | Vein pain | FAERS: 1 | US FAERS | |
| 314 | jaundice | FAERS: 1 | US FAERS | |
| 315 | Alanine Aminotransferase Increased | SIDER | ||
| 316 | Altered state of consciousness | SIDER | ||
| 317 | Aspartate Aminotransferase Increased | SIDER | ||
| 318 | Brain Injuries | 28499616 | CTD | |
| 319 | Chemical and Drug Induced Liver Injury | 28689766 | CTD | |
| 320 | Dermatitis | SIDER | ||
| 321 | Fatty Liver | 28689766 | CTD | |
| 322 | Heart Diseases | 28499616 | CTD | |
| 323 | Hemorrhage | 28499616 | CTD | |
| 324 | Hypotensive | SIDER | ||
| 325 | Infection | SIDER | ||
| 326 | Infestation | SIDER | ||
| 327 | Lung Injury | 28499616 | CTD | |
| 328 | Malnutrition | SIDER | ||
| 329 | Mental Retardation | SIDER | ||
| 330 | Musculoskeletal discomfort | SIDER | ||
| 331 | Necrosis | 27317026 | CTD | |
| 332 | Nerve Degeneration | 28499616 | CTD | |
| 333 | Perceptual disturbance | SIDER | ||
| 334 | Proteinuria | 28689766 | CTD | |
| 335 | Pulmonary function test decreased | SIDER | ||
| 336 | Sexual Dysfunction | SIDER | ||
| 337 | Tension | SIDER | ||
| 338 | Visual disturbance | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.