rotigotine
(KFQYTPMOWPVWEJ-INIZCTEOSA-N)
Structure
- SMILES
- CCCN([C@H]1CCc2c(C1)cccc2O)CCc1cccs1
- Type(s)
- Approved
- ATC code(s)
- N04BC09
- Molecular Formula:
- C19H25NOS
- Molecular Weight:
- 315.473
- Log P:
- 4.2657
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 1
- TPSA:
- 51.71
- CAS Number(s):
- 99755-59-6
Synonym(s)
1.
rotigotine
2.
(+)-5,6,7,8-tetrahydro-6-(propyl(2-(2-thienyl)ethyl)amino)-1-naphthol
3.
(+--)-5,6,7,8-tetrahydro-6-(propyl(2-(2-thienyl)ethyl)amino)-1-naphthol
4.
1-naphthalenol, 5,6,7,8-tetrahydro-6-(propyl(2-(2-thienyl)ethyl)amino)-
5.
2-(N-n-propyl-N-2-thienylethylamino)-5-hydroxytetralin
6.
N 0437
7.
N 0437, (+-)-isomer
8.
N 0437, (-)-isomer
9.
N 0437, (R)-isomer
10.
N 0437, hydrochloride, (R)-isomer
11.
N 0437, hydrochloride, (S)-isomer
12.
N 0923
13.
N 0924
14.
N-0437
15.
N-0923
16.
N-0924
17.
Neupro
18.
Rotigotine CDS
19.
racemic N-0437
20.
rotigotine (+-)-form
21.
rotigotine, (+)-
22.
rotigotine, (+--)-
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 153 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 2 | Application site erythema | FAERS: 121 | US FAERS | |
| 3 | Application site pruritus | FAERS: 112 | US FAERS | |
| 4 | Product adhesion issue | FAERS: 91 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Application site rash | FAERS: 63 | US FAERS | |
| 6 | Application site reaction | FAERS: 63 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Pharmaceutical product complaint | FAERS: 61 | US FAERS | |
| 8 | Overdose | FAERS: 50 | US FAERS | |
| 9 | Tremor | FAERS: 47 | SIDER US FAERS | |
| 10 | Pneumonia | FAERS: 43 | US FAERS | |
| 11 | Nausea | FAERS: 42 | SIDER US FAERS | |
| 12 | Restless Legs Syndrome | FAERS: 38 | 17563266 18656214 | CTD US FAERS |
| 13 | Dizziness | FAERS: 35 | SIDER US FAERS | |
| 14 | Erythema | FAERS: 31 | SIDER US FAERS | |
| 15 | Application site vesicles | FAERS: 30 | US FAERS | |
| 16 | Pruritus | FAERS: 30 | SIDER US FAERS | |
| 17 | Wrong technique in product usage process | FAERS: 29 | US FAERS | |
| 18 | Fatigue | FAERS: 26 | SIDER US FAERS | |
| 19 | Intentional product misuse | FAERS: 26 | US FAERS | |
| 20 | Application site irritation | FAERS: 25 | US FAERS | |
| 21 | Vomiting | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 22 | Product quality issue | FAERS: 24 | US FAERS | |
| 23 | Somnolence | FAERS: 24 | SIDER US FAERS | |
| 24 | Application site swelling | FAERS: 19 | US FAERS | |
| 25 | Malaise | FAERS: 18 | SIDER US FAERS | |
| 26 | Drug dose omission | FAERS: 17 | US FAERS | |
| 27 | Feeling abnormal | FAERS: 17 | SIDER US FAERS | |
| 28 | Unevaluable event | FAERS: 17 | US FAERS | |
| 29 | Urinary tract infection | FAERS: 17 | US FAERS | |
| 30 | Anxiety | FAERS: 16 | US FAERS | |
| 31 | Application site pain | FAERS: 16 | US FAERS | |
| 32 | Asthenia | FAERS: 16 | SIDER US FAERS | |
| 33 | Pain | FAERS: 16 | SIDER US FAERS | |
| 34 | Skin reaction | FAERS: 15 | US FAERS | |
| 35 | Agitation | FAERS: 12 | SIDER US FAERS | |
| 36 | Cerebrovascular accident | FAERS: 12 | US FAERS | |
| 37 | Hypersensitivity | FAERS: 12 | SIDER US FAERS | |
| 38 | No adverse event | FAERS: 12 | US FAERS | |
| 39 | Skin irritation | FAERS: 12 | US FAERS | |
| 40 | Acute myocardial infarction | FAERS: 11 | US FAERS | |
| 41 | Application site hypersensitivity | FAERS: 11 | US FAERS | |
| 42 | Application site urticaria | FAERS: 11 | US FAERS | |
| 43 | Syncope | FAERS: 10 | SIDER US FAERS | |
| 44 | Weight decreased | FAERS: 10 | SIDER US FAERS | |
| 45 | Hypotension | FAERS: 9 | SIDER US FAERS | |
| 46 | Myocardial Infarction | FAERS: 9 | US FAERS | |
| 47 | Vertigo | FAERS: 9 | SIDER US FAERS | |
| 48 | Wrong technique in drug usage process | FAERS: 9 | US FAERS | |
| 49 | Arthralgia | FAERS: 8 | SIDER US FAERS | |
| 50 | Dementia | FAERS: 8 | US FAERS | |
| 51 | Drug Dependence | FAERS: 8 | US FAERS | |
| 52 | Drug effect incomplete | FAERS: 8 | US FAERS | |
| 53 | General physical health deterioration | FAERS: 8 | US FAERS | |
| 54 | Headache | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 55 | Inappropriate schedule of drug administration | FAERS: 8 | US FAERS | |
| 56 | Cardiac Arrest | FAERS: 7 | US FAERS | |
| 57 | Drug administration error | FAERS: 7 | US FAERS | |
| 58 | Neuroleptic Malignant Syndrome | FAERS: 7 | US FAERS | |
| 59 | Obsessive-Compulsive Disorder | FAERS: 7 | SIDER US FAERS | |
| 60 | Palpitations | FAERS: 7 | US FAERS | |
| 61 | Restlessness | FAERS: 7 | US FAERS | |
| 62 | Sepsis | FAERS: 7 | US FAERS | |
| 63 | Suicide attempt | FAERS: 7 | US FAERS | |
| 64 | Back Pain | FAERS: 6 | US FAERS | |
| 65 | Constipation | FAERS: 6 | SIDER US FAERS | |
| 66 | Dehydration | FAERS: 6 | US FAERS | |
| 67 | Incorrect drug administration duration | FAERS: 6 | US FAERS | |
| 68 | Limb discomfort | FAERS: 6 | US FAERS | |
| 69 | Muscle Rigidity | FAERS: 6 | US FAERS | |
| 70 | Musculoskeletal stiffness | FAERS: 6 | US FAERS | |
| 71 | Peripheral swelling | FAERS: 6 | US FAERS | |
| 72 | Urinary Retention | FAERS: 6 | US FAERS | |
| 73 | Abdominal Pain | FAERS: 5 | US FAERS | |
| 74 | Amnesia | FAERS: 5 | US FAERS | |
| 75 | Angioedema | FAERS: 5 | SIDER US FAERS | |
| 76 | Disorientation | FAERS: 5 | SIDER US FAERS | |
| 77 | Infection | FAERS: 5 | SIDER US FAERS | |
| 78 | Medication Error | FAERS: 5 | US FAERS | |
| 79 | Memory impairment | FAERS: 5 | US FAERS | |
| 80 | Nervousness | FAERS: 5 | US FAERS | |
| 81 | Rash erythematous | FAERS: 5 | US FAERS | |
| 82 | Sudden onset of sleep | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 83 | Thrombosis | FAERS: 5 | US FAERS | |
| 84 | Urticaria | FAERS: 5 | SIDER US FAERS | |
| 85 | Abasia | FAERS: 4 | US FAERS | |
| 86 | Accidental overdose | FAERS: 4 | US FAERS | |
| 87 | Application site burn | FAERS: 4 | US FAERS | |
| 88 | Atrial Fibrillation | FAERS: 4 | US FAERS | |
| 89 | Bradycardia | FAERS: 4 | US FAERS | |
| 90 | Chest Pain | FAERS: 4 | US FAERS | |
| 91 | Delirium | FAERS: 4 | US FAERS | |
| 92 | Drug prescribing error | FAERS: 4 | US FAERS | |
| 93 | Glaucoma | FAERS: 4 | US FAERS | |
| 94 | Hypertensive crisis | FAERS: 4 | US FAERS | |
| 95 | Incorrect storage of drug | FAERS: 4 | US FAERS | |
| 96 | Intentional drug misuse | FAERS: 4 | US FAERS | |
| 97 | Mood swings | FAERS: 4 | US FAERS | |
| 98 | Neck Pain | FAERS: 4 | US FAERS | |
| 99 | Product administered at inappropriate site | FAERS: 4 | US FAERS | |
| 100 | Product packaging issue | FAERS: 4 | US FAERS | |
| 101 | Tachycardia | FAERS: 4 | US FAERS | |
| 102 | Abdominal discomfort | FAERS: 3 | US FAERS | |
| 103 | Adverse event | FAERS: 3 | US FAERS | |
| 104 | Angina Pectoris | FAERS: 3 | US FAERS | |
| 105 | Anorexia | FAERS: 3 | SIDER US FAERS | |
| 106 | Application site pustules | FAERS: 3 | US FAERS | |
| 107 | Arthritis | FAERS: 3 | US FAERS | |
| 108 | Arthropathy | FAERS: 3 | US FAERS | |
| 109 | Bedridden | FAERS: 3 | US FAERS | |
| 110 | Bronchospasm | FAERS: 3 | US FAERS | |
| 111 | Completed Suicide | FAERS: 3 | US FAERS | |
| 112 | Discomfort | FAERS: 3 | SIDER US FAERS | |
| 113 | Drug ineffective for unapproved indication | FAERS: 3 | US FAERS | |
| 114 | Dyspepsia | FAERS: 3 | SIDER US FAERS | |
| 115 | Euphoric mood | FAERS: 3 | US FAERS | |
| 116 | Eye pain | FAERS: 3 | US FAERS | |
| 117 | Fracture | FAERS: 3 | US FAERS | |
| 118 | Freezing phenomenon | FAERS: 3 | US FAERS | |
| 119 | Gambling | FAERS: 3 | US FAERS | |
| 120 | Immobile | FAERS: 3 | US FAERS | |
| 121 | Influenza | FAERS: 3 | US FAERS | |
| 122 | Intestinal Obstruction | FAERS: 3 | US FAERS | |
| 123 | Joint swelling | FAERS: 3 | US FAERS | |
| 124 | Lethargy | FAERS: 3 | SIDER US FAERS | |
| 125 | Nephrolithiasis | FAERS: 3 | US FAERS | |
| 126 | Pancreatitis | FAERS: 3 | US FAERS | |
| 127 | Poor quality sleep | FAERS: 3 | US FAERS | |
| 128 | Post procedural complication | FAERS: 3 | US FAERS | |
| 129 | Product dose omission | FAERS: 3 | US FAERS | |
| 130 | Sexual abuse | FAERS: 3 | US FAERS | |
| 131 | Therapeutic response unexpected | FAERS: 3 | US FAERS | |
| 132 | Akinesia | FAERS: 2 | US FAERS | |
| 133 | Alopecia | FAERS: 2 | US FAERS | |
| 134 | Aneurysm | FAERS: 2 | US FAERS | |
| 135 | Anger | FAERS: 2 | US FAERS | |
| 136 | Aphasia | FAERS: 2 | US FAERS | |
| 137 | Blindness | FAERS: 2 | US FAERS | |
| 138 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 139 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 140 | Cerebral Infarction | FAERS: 2 | US FAERS | |
| 141 | Choking | FAERS: 2 | US FAERS | |
| 142 | Compulsive shopping | FAERS: 2 | SIDER US FAERS | |
| 143 | Depressed mood | FAERS: 2 | US FAERS | |
| 144 | Diplegia | FAERS: 2 | US FAERS | |
| 145 | Diplopia | FAERS: 2 | US FAERS | |
| 146 | Disability | FAERS: 2 | US FAERS | |
| 147 | Disease complication | FAERS: 2 | US FAERS | |
| 148 | Drug administered at inappropriate site | FAERS: 2 | US FAERS | |
| 149 | Drug delivery system malfunction | FAERS: 2 | US FAERS | |
| 150 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 151 | Drug withdrawal syndrome | FAERS: 2 | US FAERS | |
| 152 | Dry skin | FAERS: 2 | US FAERS | |
| 153 | Dysphonia | FAERS: 2 | US FAERS | |
| 154 | Dystonia | FAERS: 2 | US FAERS | |
| 155 | Eczema | FAERS: 2 | SIDER US FAERS | |
| 156 | Emotional disorder | FAERS: 2 | US FAERS | |
| 157 | Excoriation | FAERS: 2 | US FAERS | |
| 158 | Expired drug administered | FAERS: 2 | US FAERS | |
| 159 | Expired product administered | FAERS: 2 | US FAERS | |
| 160 | Hypervigilance | FAERS: 2 | US FAERS | |
| 161 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 162 | Incorrect product storage | FAERS: 2 | US FAERS | |
| 163 | Infarction | FAERS: 2 | US FAERS | |
| 164 | Inflammation | FAERS: 2 | SIDER US FAERS | |
| 165 | Initial insomnia | FAERS: 2 | US FAERS | |
| 166 | Lip swelling | FAERS: 2 | US FAERS | |
| 167 | Lower respiratory tract infection | FAERS: 2 | US FAERS | |
| 168 | Macular degeneration | FAERS: 2 | US FAERS | |
| 169 | Maternal exposure before pregnancy | FAERS: 2 | US FAERS | |
| 170 | Maternal exposure during pregnancy | FAERS: 2 | US FAERS | |
| 171 | Miscarriage of partner | FAERS: 2 | US FAERS | |
| 172 | Myalgia | FAERS: 2 | US FAERS | |
| 173 | Narcolepsy | FAERS: 2 | US FAERS | |
| 174 | Nasopharyngitis | FAERS: 2 | SIDER US FAERS | |
| 175 | Nonspecific reaction | FAERS: 2 | US FAERS | |
| 176 | Osteoporosis | FAERS: 2 | US FAERS | |
| 177 | Pancytopenia | FAERS: 2 | US FAERS | |
| 178 | Paranoia | FAERS: 2 | US FAERS | |
| 179 | Personality Change | FAERS: 2 | US FAERS | |
| 180 | Pregnancy of partner | FAERS: 2 | US FAERS | |
| 181 | Prescribed overdose | FAERS: 2 | US FAERS | |
| 182 | Product physical issue | FAERS: 2 | US FAERS | |
| 183 | Rehabilitation therapy | FAERS: 2 | US FAERS | |
| 184 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 185 | Retinal telangiectasia | FAERS: 2 | US FAERS | |
| 186 | Sciatica | FAERS: 2 | US FAERS | |
| 187 | Seizure like phenomena | FAERS: 2 | US FAERS | |
| 188 | Skin lesion | FAERS: 2 | US FAERS | |
| 189 | Sleep Talking | FAERS: 2 | US FAERS | |
| 190 | Spinal column stenosis | FAERS: 2 | US FAERS | |
| 191 | Spinal fusion surgery | FAERS: 2 | US FAERS | |
| 192 | Sputum retention | FAERS: 2 | US FAERS | |
| 193 | Sudden death | FAERS: 2 | US FAERS | |
| 194 | Thermal burn | FAERS: 2 | US FAERS | |
| 195 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 196 | Accidental exposure | FAERS: 1 | US FAERS | |
| 197 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 198 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 199 | Agnosia | FAERS: 1 | US FAERS | |
| 200 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 201 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 202 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 203 | Application site acne | FAERS: 1 | US FAERS | |
| 204 | Application site discharge | FAERS: 1 | US FAERS | |
| 205 | Application site dryness | FAERS: 1 | US FAERS | |
| 206 | Application site exfoliation | FAERS: 1 | US FAERS | |
| 207 | Application site papules | FAERS: 1 | US FAERS | |
| 208 | Application site scab | FAERS: 1 | US FAERS | |
| 209 | Application site scar | FAERS: 1 | US FAERS | |
| 210 | Application site warmth | FAERS: 1 | US FAERS | |
| 211 | Asphyxia | FAERS: 1 | US FAERS | |
| 212 | Asthma | FAERS: 1 | US FAERS | |
| 213 | Ataxia | FAERS: 1 | US FAERS | |
| 214 | Atelectasis | FAERS: 1 | US FAERS | |
| 215 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 216 | Avulsion fracture | FAERS: 1 | US FAERS | |
| 217 | Back disorder | FAERS: 1 | US FAERS | |
| 218 | Benign Prostatic Hyperplasia | FAERS: 1 | US FAERS | |
| 219 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 220 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 221 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 222 | Blood thyroid stimulating hormone increased | FAERS: 1 | US FAERS | |
| 223 | Blood urea abnormal | FAERS: 1 | US FAERS | |
| 224 | Blood urea increased | FAERS: 1 | US FAERS | |
| 225 | Blood urine present | FAERS: 1 | US FAERS | |
| 226 | Bradykinesia | FAERS: 1 | US FAERS | |
| 227 | Breech Presentation | FAERS: 1 | US FAERS | |
| 228 | Bronchitis | FAERS: 1 | US FAERS | |
| 229 | Burning sensation | FAERS: 1 | US FAERS | |
| 230 | Cachexia | FAERS: 1 | US FAERS | |
| 231 | Camptocormia | FAERS: 1 | US FAERS | |
| 232 | Cardiovascular insufficiency | FAERS: 1 | US FAERS | |
| 233 | Cartilage injury | FAERS: 1 | US FAERS | |
| 234 | Catheter sepsis | FAERS: 1 | US FAERS | |
| 235 | Cellulitis | FAERS: 1 | US FAERS | |
| 236 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 237 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 238 | Chemical injury | FAERS: 1 | US FAERS | |
| 239 | Choreoathetosis | FAERS: 1 | US FAERS | |
| 240 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 241 | Crying | FAERS: 1 | US FAERS | |
| 242 | Cystitis | FAERS: 1 | US FAERS | |
| 243 | Cystocele | FAERS: 1 | US FAERS | |
| 244 | Deep Brain Stimulation | FAERS: 1 | US FAERS | |
| 245 | Dependence | FAERS: 1 | US FAERS | |
| 246 | Dermatitis | FAERS: 1 | SIDER US FAERS | |
| 247 | Device Failure | FAERS: 1 | US FAERS | |
| 248 | Device adhesion issue | FAERS: 1 | US FAERS | |
| 249 | Device malfunction | FAERS: 1 | US FAERS | |
| 250 | Device related infection | FAERS: 1 | US FAERS | |
| 251 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 252 | Diathermy | FAERS: 1 | US FAERS | |
| 253 | Disease Progression | FAERS: 1 | US FAERS | |
| 254 | Disease recurrence | FAERS: 1 | US FAERS | |
| 255 | Drug delivery device implantation | FAERS: 1 | US FAERS | |
| 256 | Drug dose titration not performed | FAERS: 1 | US FAERS | |
| 257 | Drug effect variable | FAERS: 1 | US FAERS | |
| 258 | Drug therapy enhancement | FAERS: 1 | US FAERS | |
| 259 | Drug titration error | FAERS: 1 | US FAERS | |
| 260 | Dysgeusia | FAERS: 1 | US FAERS | |
| 261 | Dysuria | FAERS: 1 | US FAERS | |
| 262 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 263 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 264 | Emergency Care | FAERS: 1 | US FAERS | |
| 265 | Emotional distress | FAERS: 1 | US FAERS | |
| 266 | Epilepsy | FAERS: 1 | US FAERS | |
| 267 | Erysipelas | FAERS: 1 | US FAERS | |
| 268 | Erythema Nodosum | FAERS: 1 | US FAERS | |
| 269 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 270 | Exposure via body fluid | FAERS: 1 | US FAERS | |
| 271 | Extra dose administered | FAERS: 1 | US FAERS | |
| 272 | Eye irritation | FAERS: 1 | US FAERS | |
| 273 | Facial Paresis | FAERS: 1 | US FAERS | |
| 274 | Feeling Cold | FAERS: 1 | US FAERS | |
| 275 | Fibrin increased | FAERS: 1 | US FAERS | |
| 276 | Fibrosis | FAERS: 1 | US FAERS | |
| 277 | Flushing | FAERS: 1 | US FAERS | |
| 278 | Focal Nodular Hyperplasia | FAERS: 1 | US FAERS | |
| 279 | Food craving | FAERS: 1 | US FAERS | |
| 280 | Foreign travel | FAERS: 1 | US FAERS | |
| 281 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 282 | Gastroenteritis norovirus | FAERS: 1 | US FAERS | |
| 283 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 284 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 285 | Granuloma | FAERS: 1 | US FAERS | |
| 286 | Growth retardation | FAERS: 1 | US FAERS | |
| 287 | Hemiparesis | FAERS: 1 | US FAERS | |
| 288 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 289 | Hip surgery | FAERS: 1 | US FAERS | |
| 290 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 291 | Hyperventilation | FAERS: 1 | US FAERS | |
| 292 | Hypokinesia | FAERS: 1 | US FAERS | |
| 293 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 294 | Incisional hernia | FAERS: 1 | US FAERS | |
| 295 | Incontinence | FAERS: 1 | US FAERS | |
| 296 | Incorrect dose administered by device | FAERS: 1 | US FAERS | |
| 297 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 298 | Injection site bruising | FAERS: 1 | US FAERS | |
| 299 | Injection site pain | FAERS: 1 | US FAERS | |
| 300 | Intestinal resection | FAERS: 1 | US FAERS | |
| 301 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 302 | Kleptomania | FAERS: 1 | US FAERS | |
| 303 | Laceration | FAERS: 1 | US FAERS | |
| 304 | Leukoderma | FAERS: 1 | US FAERS | |
| 305 | Leukopenia | FAERS: 1 | US FAERS | |
| 306 | Living in residential institution | FAERS: 1 | US FAERS | |
| 307 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 308 | Lymphoma | FAERS: 1 | US FAERS | |
| 309 | Malabsorption | FAERS: 1 | US FAERS | |
| 310 | Malnutrition | FAERS: 1 | SIDER US FAERS | |
| 311 | Medical device battery replacement | FAERS: 1 | US FAERS | |
| 312 | Meningioma | FAERS: 1 | US FAERS | |
| 313 | Metastasis | FAERS: 1 | US FAERS | |
| 314 | Middle insomnia | FAERS: 1 | US FAERS | |
| 315 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 316 | Multiple allergies | FAERS: 1 | US FAERS | |
| 317 | Muscle strain | FAERS: 1 | US FAERS | |
| 318 | Muscle tightness | FAERS: 1 | US FAERS | |
| 319 | Musculoskeletal Pain | FAERS: 1 | SIDER US FAERS | |
| 320 | Myoglobin blood increased | FAERS: 1 | US FAERS | |
| 321 | Nail bed disorder | FAERS: 1 | US FAERS | |
| 322 | Night sweats | FAERS: 1 | US FAERS | |
| 323 | Obsessive thoughts | FAERS: 1 | US FAERS | |
| 324 | Open wound | FAERS: 1 | US FAERS | |
| 325 | Pallor | FAERS: 1 | US FAERS | |
| 326 | Parkinsonian rest tremor | FAERS: 1 | US FAERS | |
| 327 | Pharyngitis | FAERS: 1 | US FAERS | |
| 328 | Pneumothorax | FAERS: 1 | US FAERS | |
| 329 | Poisoning | FAERS: 1 | US FAERS | |
| 330 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 331 | Presyncope | FAERS: 1 | US FAERS | |
| 332 | Procedural complication | FAERS: 1 | US FAERS | |
| 333 | Product deposit | FAERS: 1 | US FAERS | |
| 334 | Product label issue | FAERS: 1 | US FAERS | |
| 335 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 336 | Psychomotor skills impaired | FAERS: 1 | US FAERS | |
| 337 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 338 | Pulmonary Nocardiosis | FAERS: 1 | US FAERS | |
| 339 | Rebound effect | FAERS: 1 | US FAERS | |
| 340 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 341 | Respiratory distress | FAERS: 1 | US FAERS | |
| 342 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 343 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 344 | Rhinitis | FAERS: 1 | US FAERS | |
| 345 | Sexual activity increased | FAERS: 1 | US FAERS | |
| 346 | Silicosis | FAERS: 1 | US FAERS | |
| 347 | Sinus operation | FAERS: 1 | US FAERS | |
| 348 | Skin Erosion | FAERS: 1 | US FAERS | |
| 349 | Skin Induration | FAERS: 1 | US FAERS | |
| 350 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 351 | Skin necrosis | FAERS: 1 | US FAERS | |
| 352 | Sluggishness | FAERS: 1 | US FAERS | |
| 353 | Somnambulism | FAERS: 1 | US FAERS | |
| 354 | Starvation | FAERS: 1 | US FAERS | |
| 355 | Strabismus | FAERS: 1 | US FAERS | |
| 356 | Stress | FAERS: 1 | US FAERS | |
| 357 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 358 | Swelling | FAERS: 1 | SIDER US FAERS | |
| 359 | Temporal Arteritis | FAERS: 1 | US FAERS | |
| 360 | Terminal state | FAERS: 1 | US FAERS | |
| 361 | Throat irritation | FAERS: 1 | US FAERS | |
| 362 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 363 | Tobacco user | FAERS: 1 | US FAERS | |
| 364 | Trismus | FAERS: 1 | US FAERS | |
| 365 | Ulcer | FAERS: 1 | US FAERS | |
| 366 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 367 | Upper respiratory tract inflammation | FAERS: 1 | US FAERS | |
| 368 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 369 | Vascular rupture | FAERS: 1 | US FAERS | |
| 370 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 371 | Visual Impairment | FAERS: 1 | SIDER US FAERS | |
| 372 | Visual disturbance | FAERS: 1 | US FAERS | |
| 373 | Vitiligo | FAERS: 1 | US FAERS | |
| 374 | Vulvovaginal pain | FAERS: 1 | US FAERS | |
| 375 | Wheelchair user | FAERS: 1 | US FAERS | |
| 376 | Wheezing | FAERS: 1 | US FAERS | |
| 377 | Wound infection bacterial | FAERS: 1 | US FAERS | |
| 378 | Wrong patient received medication | FAERS: 1 | US FAERS | |
| 379 | skin abrasion | FAERS: 1 | US FAERS | |
| 380 | Abnormal vision | SIDER | ||
| 381 | Application and instillation site reactions | SIDER | ||
| 382 | Asthenic conditions | SIDER | ||
| 383 | Disturbance in sexual arousal | SIDER | ||
| 384 | Ear and labyrinth disorders | SIDER | ||
| 385 | Erectile dysfunction | SIDER | ||
| 386 | Excessive daytime sleepiness | SIDER | ||
| 387 | Hyperpyrexia | SIDER | ||
| 388 | Hypotension symptomatic | SIDER | ||
| 389 | Infestation | SIDER | ||
| 390 | Musculoskeletal discomfort | SIDER | ||
| 391 | Papule | SIDER | ||
| 392 | Parkinson Disease | 17563266 23165154 | CTD | |
| 393 | Pharyngolaryngeal Pain | SIDER | ||
| 394 | Prurigo | SIDER | ||
| 395 | Punding | SIDER | ||
| 396 | Shock | SIDER | ||
| 397 | Sinusitis | SIDER | ||
| 398 | Tinnitus | SIDER | ||
| 399 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.