Asenapine
(GMDCDXMAFMEDAG-CHHFXETESA-N)
Structure
- SMILES
- Clc1ccc2c(c1)[C@H]1CN(C[C@@H]1c1c(O2)cccc1)C.OC(=O)/C=C\C(=O)O
- Molecular Formula:
- C21H20ClNO5
- Molecular Weight:
- 401.840
- Log P:
- 3.9082
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 2
- TPSA:
- 87.07
- CAS Number(s):
- 85650-56-2
Synonym(s)
1.
Asenapine
2.
5-chloro-2,3,3a,12b-tetrahydro-2-methyl-1H-dibenz(2,3-6,7)oxepino(4,5-c)pyrrole
3.
ORG 5222
4.
ORG-5222
5.
asenapine maleate
6.
saphris
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Dysgeusia | FAERS: 290 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Inappropriate schedule of drug administration | FAERS: 290 | US FAERS | |
| 3 | Somnolence | FAERS: 161 | US FAERS | |
| 4 | Akathisia | FAERS: 152 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Nausea | FAERS: 144 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 6 | Dizziness | FAERS: 138 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Incorrect route of drug administration | FAERS: 132 | US FAERS | |
| 8 | Vomiting | FAERS: 93 | US FAERS | |
| 9 | Agitation | FAERS: 88 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 10 | Anxiety | FAERS: 86 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 11 | Drug ineffective | FAERS: 73 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 12 | Dystonia | FAERS: 73 | US FAERS | |
| 13 | Feeling abnormal | FAERS: 62 | US FAERS | |
| 14 | Headache | FAERS: 61 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 15 | Restless Legs Syndrome | FAERS: 60 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Tremor | FAERS: 60 | US FAERS | |
| 17 | Fatigue | FAERS: 55 | US FAERS | |
| 18 | Hypersensitivity | FAERS: 49 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 19 | Restlessness | FAERS: 48 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 20 | Tardive Dyskinesia | FAERS: 44 | US FAERS | |
| 21 | Dysarthria | FAERS: 37 | US FAERS | |
| 22 | Stomatitis | FAERS: 36 | US FAERS | |
| 23 | Adverse event | FAERS: 34 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 24 | Product taste abnormal | FAERS: 34 | US FAERS | |
| 25 | Blood glucose increased | FAERS: 31 | US FAERS | |
| 26 | Syncope | FAERS: 31 | US FAERS | |
| 27 | Wrong technique in drug usage process | FAERS: 31 | US FAERS | |
| 28 | No adverse event | FAERS: 29 | US FAERS | |
| 29 | Overdose | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 30 | Product quality issue | FAERS: 29 | US FAERS | |
| 31 | Musculoskeletal stiffness | FAERS: 28 | US FAERS | |
| 32 | Tongue blistering | FAERS: 27 | US FAERS | |
| 33 | Angioedema | FAERS: 25 | US FAERS | |
| 34 | Hypotension | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 35 | Drooling | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 36 | Pruritus | FAERS: 22 | US FAERS | |
| 37 | Somnambulism | FAERS: 22 | US FAERS | |
| 38 | Tachycardia | FAERS: 22 | US FAERS | |
| 39 | Arthralgia | FAERS: 21 | US FAERS | |
| 40 | Completed Suicide | FAERS: 21 | US FAERS | |
| 41 | Drug dose omission | FAERS: 21 | US FAERS | |
| 42 | Anger | FAERS: 20 | US FAERS | |
| 43 | Chest Pain | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 44 | Joint swelling | FAERS: 20 | US FAERS | |
| 45 | Malaise | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 46 | Urticaria | FAERS: 20 | US FAERS | |
| 47 | Oral pain | FAERS: 19 | US FAERS | |
| 48 | Swelling | FAERS: 19 | US FAERS | |
| 49 | Ageusia | FAERS: 18 | US FAERS | |
| 50 | Memory impairment | FAERS: 18 | US FAERS | |
| 51 | Drug administered to patient of inappropriate age | FAERS: 17 | US FAERS | |
| 52 | Enuresis | FAERS: 17 | US FAERS | |
| 53 | Myalgia | FAERS: 17 | US FAERS | |
| 54 | Pain | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 55 | Weight decreased | FAERS: 17 | US FAERS | |
| 56 | Asthenia | FAERS: 16 | US FAERS | |
| 57 | Myocardial Infarction | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 58 | Oropharyngeal blistering | FAERS: 16 | US FAERS | |
| 59 | Palpitations | FAERS: 16 | US FAERS | |
| 60 | Alopecia | FAERS: 15 | US FAERS | |
| 61 | Constipation | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 62 | Hypersomnia | FAERS: 15 | US FAERS | |
| 63 | Disorientation | FAERS: 14 | US FAERS | |
| 64 | Suicide attempt | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 65 | Abdominal discomfort | FAERS: 13 | US FAERS | |
| 66 | Intentional product misuse | FAERS: 13 | US FAERS | |
| 67 | Muscle tightness | FAERS: 13 | US FAERS | |
| 68 | Schizophrenia | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 69 | Unevaluable event | FAERS: 13 | US FAERS | |
| 70 | Blood prolactin increased | FAERS: 12 | US FAERS | |
| 71 | Cerebrovascular accident | FAERS: 12 | US FAERS | |
| 72 | Erythema | FAERS: 12 | US FAERS | |
| 73 | Lip swelling | FAERS: 12 | US FAERS | |
| 74 | Nervousness | FAERS: 12 | US FAERS | |
| 75 | Therapeutic product ineffective | FAERS: 12 | US FAERS | |
| 76 | Amnesia | FAERS: 11 | US FAERS | |
| 77 | Neuroleptic Malignant Syndrome | FAERS: 11 | US FAERS | |
| 78 | Paranoia | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 79 | Abasia | FAERS: 10 | US FAERS | |
| 80 | Abdominal Pain | FAERS: 10 | US FAERS | |
| 81 | Acne | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 82 | Chest discomfort | FAERS: 10 | US FAERS | |
| 83 | Crying | FAERS: 10 | US FAERS | |
| 84 | Laceration | FAERS: 10 | US FAERS | |
| 85 | Dental caries | FAERS: 9 | US FAERS | |
| 86 | Drug prescribing error | FAERS: 9 | US FAERS | |
| 87 | Dysphemia | FAERS: 9 | US FAERS | |
| 88 | Emotional disorder | FAERS: 9 | US FAERS | |
| 89 | Feeling Cold | FAERS: 9 | US FAERS | |
| 90 | Feeling jittery | FAERS: 9 | US FAERS | |
| 91 | Glossitis | FAERS: 9 | US FAERS | |
| 92 | Hunger | FAERS: 9 | US FAERS | |
| 93 | Incorrect dose administered | FAERS: 9 | US FAERS | |
| 94 | Lethargy | FAERS: 9 | US FAERS | |
| 95 | Retching | FAERS: 9 | US FAERS | |
| 96 | Thirst | FAERS: 9 | US FAERS | |
| 97 | Throat irritation | FAERS: 9 | US FAERS | |
| 98 | Unresponsive to stimuli | FAERS: 9 | US FAERS | |
| 99 | White blood cell count decreased | FAERS: 9 | US FAERS | |
| 100 | Anaphylactic shock | FAERS: 8 | US FAERS | |
| 101 | Aphthous Stomatitis | FAERS: 8 | US FAERS | |
| 102 | Application site reaction | FAERS: 8 | US FAERS | |
| 103 | Bradyphrenia | FAERS: 8 | US FAERS | |
| 104 | Drug Dependence | FAERS: 8 | US FAERS | |
| 105 | nervous system disorder | FAERS: 8 | US FAERS | |
| 106 | Back Pain | FAERS: 7 | US FAERS | |
| 107 | Hypomania | FAERS: 7 | US FAERS | |
| 108 | Joint stiffness | FAERS: 7 | US FAERS | |
| 109 | Medication Error | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 110 | Muscle Rigidity | FAERS: 7 | US FAERS | |
| 111 | Poor quality sleep | FAERS: 7 | US FAERS | |
| 112 | Therapeutic response unexpected | FAERS: 7 | US FAERS | |
| 113 | Toothache | FAERS: 7 | US FAERS | |
| 114 | Urinary Retention | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 115 | Bruxism | FAERS: 6 | US FAERS | |
| 116 | Chills | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 117 | Discomfort | FAERS: 6 | US FAERS | |
| 118 | Drug screen positive | FAERS: 6 | US FAERS | |
| 119 | Embolic stroke | FAERS: 6 | US FAERS | |
| 120 | Formication | FAERS: 6 | US FAERS | |
| 121 | Mood swings | FAERS: 6 | US FAERS | |
| 122 | Oropharyngeal pain | FAERS: 6 | US FAERS | |
| 123 | Torticollis | FAERS: 6 | US FAERS | |
| 124 | Wheezing | FAERS: 6 | US FAERS | |
| 125 | Acute myocardial infarction | FAERS: 5 | US FAERS | |
| 126 | Asphyxia | FAERS: 5 | US FAERS | |
| 127 | Bradycardia | FAERS: 5 | US FAERS | |
| 128 | Choking | FAERS: 5 | US FAERS | |
| 129 | Drug administration error | FAERS: 5 | US FAERS | |
| 130 | Dyspepsia | FAERS: 5 | US FAERS | |
| 131 | Epistaxis | FAERS: 5 | US FAERS | |
| 132 | Euphoric mood | FAERS: 5 | US FAERS | |
| 133 | Feeling of body temperature change | FAERS: 5 | US FAERS | |
| 134 | Intentional self-injury | FAERS: 5 | US FAERS | |
| 135 | Mucosal excoriation | FAERS: 5 | US FAERS | |
| 136 | Musculoskeletal Pain | FAERS: 5 | US FAERS | |
| 137 | Obsessive-Compulsive Disorder | FAERS: 5 | US FAERS | |
| 138 | Oral mucosal exfoliation | FAERS: 5 | US FAERS | |
| 139 | Oromandibular dystonia | FAERS: 5 | US FAERS | |
| 140 | Product blister packaging issue | FAERS: 5 | US FAERS | |
| 141 | Product packaging issue | FAERS: 5 | US FAERS | |
| 142 | Rash erythematous | FAERS: 5 | US FAERS | |
| 143 | Stress | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 144 | Tongue exfoliation | FAERS: 5 | US FAERS | |
| 145 | Trismus | FAERS: 5 | US FAERS | |
| 146 | Aphasia | FAERS: 4 | US FAERS | |
| 147 | Blood potassium decreased | FAERS: 4 | US FAERS | |
| 148 | Cardiac Arrest | FAERS: 4 | US FAERS | |
| 149 | Dehydration | FAERS: 4 | US FAERS | |
| 150 | Depressed mood | FAERS: 4 | US FAERS | |
| 151 | Disease recurrence | FAERS: 4 | US FAERS | |
| 152 | Drug ineffective for unapproved indication | FAERS: 4 | US FAERS | |
| 153 | Food craving | FAERS: 4 | US FAERS | |
| 154 | Impaired work ability | FAERS: 4 | US FAERS | |
| 155 | Laryngospasm | FAERS: 4 | US FAERS | |
| 156 | Mydriasis | FAERS: 4 | US FAERS | |
| 157 | Oral candidiasis | FAERS: 4 | US FAERS | |
| 158 | Peripheral swelling | FAERS: 4 | US FAERS | |
| 159 | Personality Change | FAERS: 4 | US FAERS | |
| 160 | Physical assault | FAERS: 4 | US FAERS | |
| 161 | Pneumonia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 162 | Pulmonary Embolism | FAERS: 4 | US FAERS | |
| 163 | Sexual Dysfunction | FAERS: 4 | US FAERS | |
| 164 | Sudden onset of sleep | FAERS: 4 | US FAERS | |
| 165 | Temperature intolerance | FAERS: 4 | US FAERS | |
| 166 | Urinary Incontinence | FAERS: 4 | US FAERS | |
| 167 | VIIth nerve paralysis | FAERS: 4 | US FAERS | |
| 168 | Vertigo | FAERS: 4 | US FAERS | |
| 169 | Accidental exposure | FAERS: 3 | US FAERS | |
| 170 | Activation syndrome | FAERS: 3 | US FAERS | |
| 171 | Activities of daily living impaired | FAERS: 3 | US FAERS | |
| 172 | Acute psychosis | FAERS: 3 | US FAERS | |
| 173 | Angina Pectoris | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 174 | Application site vesicles | FAERS: 3 | US FAERS | |
| 175 | Asthma | FAERS: 3 | US FAERS | |
| 176 | Ataxia | FAERS: 3 | US FAERS | |
| 177 | Bipolar I disorder | FAERS: 3 | US FAERS | |
| 178 | Blood cholesterol increased | FAERS: 3 | US FAERS | |
| 179 | Blood creatine phosphokinase increased | FAERS: 3 | US FAERS | |
| 180 | Blood sodium decreased | FAERS: 3 | US FAERS | |
| 181 | Blood triglycerides increased | FAERS: 3 | US FAERS | |
| 182 | Burning sensation | FAERS: 3 | US FAERS | |
| 183 | Conjunctivitis | FAERS: 3 | US FAERS | |
| 184 | Deep Vein Thrombosis | FAERS: 3 | US FAERS | |
| 185 | Delirium | FAERS: 3 | US FAERS | |
| 186 | Depressed Level of Consciousness | FAERS: 3 | US FAERS | |
| 187 | Diabetic Ketoacidosis | FAERS: 3 | US FAERS | |
| 188 | Diplopia | FAERS: 3 | US FAERS | |
| 189 | Dissociation | FAERS: 3 | US FAERS | |
| 190 | Erectile dysfunction | FAERS: 3 | US FAERS | |
| 191 | Expired drug administered | FAERS: 3 | US FAERS | |
| 192 | Flushing | FAERS: 3 | US FAERS | |
| 193 | Head discomfort | FAERS: 3 | US FAERS | |
| 194 | Hyperphagia | FAERS: 3 | US FAERS | |
| 195 | Hypoaesthesia facial | FAERS: 3 | US FAERS | |
| 196 | Hypoventilation | FAERS: 3 | US FAERS | |
| 197 | Immobile | FAERS: 3 | US FAERS | |
| 198 | Inappropriate schedule of product administration | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 199 | Incoherent | FAERS: 3 | US FAERS | |
| 200 | Influenza | FAERS: 3 | US FAERS | |
| 201 | Lobar Pneumonia | FAERS: 3 | US FAERS | |
| 202 | Nasopharyngitis | FAERS: 3 | US FAERS | |
| 203 | Nephrolithiasis | FAERS: 3 | US FAERS | |
| 204 | Neutropenia | FAERS: 3 | US FAERS | |
| 205 | Neutrophil count decreased | FAERS: 3 | US FAERS | |
| 206 | Nonspecific reaction | FAERS: 3 | US FAERS | |
| 207 | Oculogyric crisis | FAERS: 3 | US FAERS | |
| 208 | Orthostatic hypertension | FAERS: 3 | US FAERS | |
| 209 | Panic Disorder | FAERS: 3 | US FAERS | |
| 210 | Prescribed underdose | FAERS: 3 | US FAERS | |
| 211 | Presyncope | FAERS: 3 | US FAERS | |
| 212 | Product barcode issue | FAERS: 3 | US FAERS | |
| 213 | Product solubility abnormal | FAERS: 3 | US FAERS | |
| 214 | Product storage error | FAERS: 3 | US FAERS | |
| 215 | Product use issue | FAERS: 3 | US FAERS | |
| 216 | Respiratory arrest | FAERS: 3 | US FAERS | |
| 217 | Rhabdomyolysis | FAERS: 3 | US FAERS | |
| 218 | Scab | FAERS: 3 | US FAERS | |
| 219 | Screaming | FAERS: 3 | US FAERS | |
| 220 | Serotonin Syndrome | FAERS: 3 | US FAERS | |
| 221 | Sneezing | FAERS: 3 | US FAERS | |
| 222 | Stupor | FAERS: 3 | US FAERS | |
| 223 | Tinnitus | FAERS: 3 | US FAERS | |
| 224 | Tongue discomfort | FAERS: 3 | US FAERS | |
| 225 | Tongue eruption | FAERS: 3 | US FAERS | |
| 226 | Visual Impairment | FAERS: 3 | US FAERS | |
| 227 | Wrong technique in product usage process | FAERS: 3 | US FAERS | |
| 228 | Abdominal adhesions | FAERS: 2 | US FAERS | |
| 229 | Akinesia | FAERS: 2 | US FAERS | |
| 230 | Alcohol abuse | FAERS: 2 | US FAERS | |
| 231 | Ammonia increased | FAERS: 2 | US FAERS | |
| 232 | Application site ulcer | FAERS: 2 | US FAERS | |
| 233 | Arthritis | FAERS: 2 | US FAERS | |
| 234 | Bifascicular block | FAERS: 2 | US FAERS | |
| 235 | Bipolar Disorder | FAERS: 2 | US FAERS | |
| 236 | Blood glucose abnormal | FAERS: 2 | US FAERS | |
| 237 | Blood testosterone decreased | FAERS: 2 | US FAERS | |
| 238 | Breast tenderness | FAERS: 2 | US FAERS | |
| 239 | Catatonia | FAERS: 2 | US FAERS | |
| 240 | Choking sensation | FAERS: 2 | US FAERS | |
| 241 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 242 | Compulsive shopping | FAERS: 2 | US FAERS | |
| 243 | Deafness | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 244 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 245 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 246 | Drug screen false positive | FAERS: 2 | US FAERS | |
| 247 | Drug screen negative | FAERS: 2 | US FAERS | |
| 248 | Drug withdrawal syndrome | FAERS: 2 | US FAERS | |
| 249 | Dysuria | FAERS: 2 | US FAERS | |
| 250 | Flat affect | FAERS: 2 | US FAERS | |
| 251 | Flatulence | FAERS: 2 | US FAERS | |
| 252 | Foaming at mouth | FAERS: 2 | US FAERS | |
| 253 | Hallucinations, mixed | FAERS: 2 | US FAERS | |
| 254 | Head titubation | FAERS: 2 | US FAERS | |
| 255 | Homicide | FAERS: 2 | US FAERS | |
| 256 | Hyporesponsive to stimuli | FAERS: 2 | US FAERS | |
| 257 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 258 | Incorrect route of product administration | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 259 | Increased tendency to bruise | FAERS: 2 | US FAERS | |
| 260 | Infectious Mononucleosis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 261 | Inflammation | FAERS: 2 | US FAERS | |
| 262 | Initial insomnia | FAERS: 2 | US FAERS | |
| 263 | Left Ventricular Hypertrophy | FAERS: 2 | US FAERS | |
| 264 | Limb discomfort | FAERS: 2 | US FAERS | |
| 265 | Lymphadenopathy | FAERS: 2 | US FAERS | |
| 266 | Mental impairment | FAERS: 2 | US FAERS | |
| 267 | Middle insomnia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 268 | Migraine with Aura | FAERS: 2 | US FAERS | |
| 269 | Muscle Fatigue | FAERS: 2 | US FAERS | |
| 270 | Ocular discomfort | FAERS: 2 | US FAERS | |
| 271 | Oral administration complication | FAERS: 2 | US FAERS | |
| 272 | Oral mucosal eruption | FAERS: 2 | US FAERS | |
| 273 | Oral mucosal erythema | FAERS: 2 | US FAERS | |
| 274 | Pancytopenia | FAERS: 2 | US FAERS | |
| 275 | Poisoning | FAERS: 2 | US FAERS | |
| 276 | Polyuria | FAERS: 2 | US FAERS | |
| 277 | Prescribed overdose | FAERS: 2 | US FAERS | |
| 278 | Psychiatric decompensation | FAERS: 2 | US FAERS | |
| 279 | Shoplifting | FAERS: 2 | US FAERS | |
| 280 | Skin lesion | FAERS: 2 | US FAERS | |
| 281 | Staring | FAERS: 2 | US FAERS | |
| 282 | Stevens-Johnson Syndrome | FAERS: 2 | US FAERS | |
| 283 | Tachyphrenia | FAERS: 2 | US FAERS | |
| 284 | Transcription medication error | FAERS: 2 | US FAERS | |
| 285 | Ulcer | FAERS: 2 | US FAERS | |
| 286 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 287 | Acarodermatitis | FAERS: 1 | US FAERS | |
| 288 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 289 | Agranulocytosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 290 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 291 | Amphetamines positive | FAERS: 1 | US FAERS | |
| 292 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 293 | Aneurysm | FAERS: 1 | US FAERS | |
| 294 | Anosmia | FAERS: 1 | US FAERS | |
| 295 | Aphagia | FAERS: 1 | US FAERS | |
| 296 | Aphonia | FAERS: 1 | US FAERS | |
| 297 | Apparent death | FAERS: 1 | US FAERS | |
| 298 | Apparent life threatening event | FAERS: 1 | US FAERS | |
| 299 | Application site inflammation | FAERS: 1 | US FAERS | |
| 300 | Application site irritation | FAERS: 1 | US FAERS | |
| 301 | Application site laceration | FAERS: 1 | US FAERS | |
| 302 | Application site pain | FAERS: 1 | US FAERS | |
| 303 | Arthropathy | FAERS: 1 | US FAERS | |
| 304 | Aversion | FAERS: 1 | US FAERS | |
| 305 | Bedridden | FAERS: 1 | US FAERS | |
| 306 | Benzodiazepine drug level | FAERS: 1 | US FAERS | |
| 307 | Bladder pain | FAERS: 1 | US FAERS | |
| 308 | Blindness | FAERS: 1 | US FAERS | |
| 309 | Blood amylase increased | FAERS: 1 | US FAERS | |
| 310 | Blood blister | FAERS: 1 | US FAERS | |
| 311 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 312 | Blood electrolytes abnormal | FAERS: 1 | US FAERS | |
| 313 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 314 | Bone density decreased | FAERS: 1 | US FAERS | |
| 315 | Breath alcohol test positive | FAERS: 1 | US FAERS | |
| 316 | Bronchitis | FAERS: 1 | US FAERS | |
| 317 | Bronchospasm | FAERS: 1 | US FAERS | |
| 318 | Burning Mouth Syndrome | FAERS: 1 | US FAERS | |
| 319 | Candidiasis | FAERS: 1 | US FAERS | |
| 320 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 321 | Carotid artery occlusion | FAERS: 1 | US FAERS | |
| 322 | Cheilitis | FAERS: 1 | US FAERS | |
| 323 | Chemical burn of gastrointestinal tract | FAERS: 1 | US FAERS | |
| 324 | Chemical injury | FAERS: 1 | US FAERS | |
| 325 | Chorea | FAERS: 1 | US FAERS | |
| 326 | Chromaturia | FAERS: 1 | US FAERS | |
| 327 | Clumsiness | FAERS: 1 | US FAERS | |
| 328 | Cold sweat | FAERS: 1 | US FAERS | |
| 329 | Coma scale abnormal | FAERS: 1 | US FAERS | |
| 330 | Complex partial seizures | FAERS: 1 | US FAERS | |
| 331 | Conversion disorder | FAERS: 1 | US FAERS | |
| 332 | Cyanosis | FAERS: 1 | US FAERS | |
| 333 | Device breakage | FAERS: 1 | US FAERS | |
| 334 | Disseminated Intravascular Coagulation | FAERS: 1 | US FAERS | |
| 335 | Dissociative disorder | FAERS: 1 | US FAERS | |
| 336 | Disturbance in sexual arousal | FAERS: 1 | US FAERS | |
| 337 | Dreamy state | FAERS: 1 | US FAERS | |
| 338 | Drug administered at inappropriate site | FAERS: 1 | US FAERS | |
| 339 | Drug diversion | FAERS: 1 | US FAERS | |
| 340 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 341 | Drug withdrawal headache | FAERS: 1 | US FAERS | |
| 342 | Dysgraphia | FAERS: 1 | US FAERS | |
| 343 | Dysphonia | FAERS: 1 | US FAERS | |
| 344 | Early satiety | FAERS: 1 | US FAERS | |
| 345 | Ecchymosis | FAERS: 1 | US FAERS | |
| 346 | Eczema | FAERS: 1 | US FAERS | |
| 347 | Electrocardiogram QT interval abnormal | FAERS: 1 | US FAERS | |
| 348 | Electrocardiogram repolarisation abnormality | FAERS: 1 | US FAERS | |
| 349 | Elevated mood | FAERS: 1 | US FAERS | |
| 350 | Epilepsy | FAERS: 1 | US FAERS | |
| 351 | Eructation | FAERS: 1 | US FAERS | |
| 352 | Essential Tremor | FAERS: 1 | US FAERS | |
| 353 | Ex-tobacco user | FAERS: 1 | US FAERS | |
| 354 | Excessive masturbation | FAERS: 1 | US FAERS | |
| 355 | Expired product administered | FAERS: 1 | US FAERS | |
| 356 | Eye pain | FAERS: 1 | US FAERS | |
| 357 | Feelings of worthlessness | FAERS: 1 | US FAERS | |
| 358 | Food Allergy | FAERS: 1 | US FAERS | |
| 359 | Galactostasis | FAERS: 1 | US FAERS | |
| 360 | Gambling | FAERS: 1 | US FAERS | |
| 361 | Gastritis | FAERS: 1 | US FAERS | |
| 362 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 363 | Gingivitis | FAERS: 1 | US FAERS | |
| 364 | Hemiparesis | FAERS: 1 | US FAERS | |
| 365 | Hemiplegia | FAERS: 1 | US FAERS | |
| 366 | Hepatitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 367 | Heteronymous diplopia | FAERS: 1 | US FAERS | |
| 368 | Hip surgery | FAERS: 1 | US FAERS | |
| 369 | Hostility | FAERS: 1 | US FAERS | |
| 370 | Hypohidrosis | FAERS: 1 | US FAERS | |
| 371 | Hypokinesia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 372 | Hypoxia | FAERS: 1 | US FAERS | |
| 373 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 374 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 375 | Incontinence | FAERS: 1 | US FAERS | |
| 376 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 377 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 378 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 379 | Intercepted drug prescribing error | FAERS: 1 | US FAERS | |
| 380 | Intestinal gangrene | FAERS: 1 | US FAERS | |
| 381 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 382 | Leukopenia | FAERS: 1 | US FAERS | |
| 383 | Lipase increased | FAERS: 1 | US FAERS | |
| 384 | Lipoma of breast | FAERS: 1 | US FAERS | |
| 385 | Loss of dreaming | FAERS: 1 | US FAERS | |
| 386 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 387 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 388 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 389 | Menorrhagia | FAERS: 1 | US FAERS | |
| 390 | Mental status changes | FAERS: 1 | US FAERS | |
| 391 | Monocyte count increased | FAERS: 1 | US FAERS | |
| 392 | Mononucleosis syndrome | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 393 | Motion Sickness | FAERS: 1 | US FAERS | |
| 394 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 395 | Myoclonus | FAERS: 1 | US FAERS | |
| 396 | Neck Pain | FAERS: 1 | US FAERS | |
| 397 | Nephrogenic Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 398 | Nerve injury | FAERS: 1 | US FAERS | |
| 399 | Neuralgia | FAERS: 1 | US FAERS | |
| 400 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 401 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 402 | Nuchal Rigidity | FAERS: 1 | US FAERS | |
| 403 | Nystagmus | FAERS: 1 | US FAERS | |
| 404 | Obesity | FAERS: 1 | US FAERS | |
| 405 | Obsessive thoughts | FAERS: 1 | US FAERS | |
| 406 | Oligodipsia | FAERS: 1 | US FAERS | |
| 407 | Oral pruritus | FAERS: 1 | US FAERS | |
| 408 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 409 | Osteopenia | FAERS: 1 | US FAERS | |
| 410 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 411 | Petechiae | FAERS: 1 | US FAERS | |
| 412 | Physical abuse | FAERS: 1 | US FAERS | |
| 413 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 414 | Precancerous cells present | FAERS: 1 | US FAERS | |
| 415 | Pregnancy | FAERS: 1 | US FAERS | |
| 416 | Product outer packaging issue | FAERS: 1 | US FAERS | |
| 417 | Product package associated injury | FAERS: 1 | US FAERS | |
| 418 | Product packaging confusion | FAERS: 1 | US FAERS | |
| 419 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 420 | Product physical issue | FAERS: 1 | US FAERS | |
| 421 | Product use complaint | FAERS: 1 | US FAERS | |
| 422 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 423 | Psychomotor skills impaired | FAERS: 1 | US FAERS | |
| 424 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 425 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 426 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 427 | Respiratory distress | FAERS: 1 | US FAERS | |
| 428 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 429 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 430 | Salivary gland pain | FAERS: 1 | US FAERS | |
| 431 | Sclerosing encapsulating peritonitis | FAERS: 1 | US FAERS | |
| 432 | Sensory level | FAERS: 1 | US FAERS | |
| 433 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 434 | Skin laceration | FAERS: 1 | US FAERS | |
| 435 | Skin reaction | FAERS: 1 | US FAERS | |
| 436 | Sleep Paralysis | FAERS: 1 | US FAERS | |
| 437 | Sleep-related eating disorder | FAERS: 1 | US FAERS | |
| 438 | Sluggishness | FAERS: 1 | US FAERS | |
| 439 | Soliloquy | FAERS: 1 | US FAERS | |
| 440 | Strabismus | FAERS: 1 | US FAERS | |
| 441 | Sudden death | FAERS: 1 | US FAERS | |
| 442 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 443 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 444 | Tablet physical issue | FAERS: 1 | US FAERS | |
| 445 | Tension | FAERS: 1 | US FAERS | |
| 446 | Therapeutic product ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 447 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 448 | Thrombosis | FAERS: 1 | US FAERS | |
| 449 | Tongue biting | FAERS: 1 | US FAERS | |
| 450 | Tongue dysplasia | FAERS: 1 | US FAERS | |
| 451 | Tongue movement disturbance | FAERS: 1 | US FAERS | |
| 452 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 453 | Tuberculosis | FAERS: 1 | US FAERS | |
| 454 | Urinary hesitation | FAERS: 1 | US FAERS | |
| 455 | Urinary tract infection | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 456 | Urine output increased | FAERS: 1 | US FAERS | |
| 457 | Vaginal Discharge | FAERS: 1 | US FAERS | |
| 458 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 459 | Victim of homicide | FAERS: 1 | US FAERS | |
| 460 | Vulvitis | FAERS: 1 | US FAERS | |
| 461 | Waist circumference increased | FAERS: 1 | US FAERS | |
| 462 | furuncle | FAERS: 1 | US FAERS | |
| 463 | muscle injury | FAERS: 1 | US FAERS | |
| 464 | Blunted affect | Canada Vigilance: 1 | Canada Vigilance | |
| 465 | Emotional poverty | Canada Vigilance: 1 | Canada Vigilance | |
| 466 | Obsessive-compulsive symptom | Canada Vigilance: 1 | Canada Vigilance | |
| 467 | Therapeutic product effect incomplete | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.