Norethindrone acetate and ethinyl estradiol
(GEONECATAKDDLT-JDSZYESASA-N)
Structure
- SMILES
- C#C[C@@]1(CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CCC2=CC(=O)CC[C@H]12)OC(=O)C.C#C[C@]1(O)CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CCc2c1ccc(c2)O
- Molecular Formula:
- C42H52O5
- Molecular Weight:
- 636.859
- Log P:
- 7.6759
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 2
- TPSA:
- 83.83
- CAS Number(s):
- 8015-12-1
Synonym(s)
1.
Norethindrone acetate and ethinyl estradiol
External Link(s)
| PubChem Compound | 63020 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Metrorrhagia | FAERS: 154 | US FAERS | |
| 2 | Drug ineffective | FAERS: 91 | US FAERS | |
| 3 | Product dose omission | FAERS: 80 | US FAERS | |
| 4 | Nausea | FAERS: 71 | US FAERS | |
| 5 | Menorrhagia | FAERS: 70 | US FAERS | |
| 6 | Headache | FAERS: 63 | US FAERS | |
| 7 | Pulmonary Embolism | FAERS: 63 | US FAERS | |
| 8 | Drug dose omission | FAERS: 59 | US FAERS | |
| 9 | Inappropriate schedule of product administration | FAERS: 58 | US FAERS | |
| 10 | Anxiety | FAERS: 51 | US FAERS | |
| 11 | Vomiting | FAERS: 43 | US FAERS | |
| 12 | Pregnancy | FAERS: 39 | US FAERS | |
| 13 | Inappropriate schedule of drug administration | FAERS: 37 | US FAERS | |
| 14 | Alopecia | FAERS: 34 | US FAERS | |
| 15 | Mood swings | FAERS: 34 | US FAERS | |
| 16 | Pregnancy on oral contraceptive | FAERS: 34 | US FAERS | |
| 17 | Product use issue | FAERS: 33 | US FAERS | |
| 18 | Thrombosis | FAERS: 33 | US FAERS | |
| 19 | Dizziness | FAERS: 31 | US FAERS | |
| 20 | Deep Vein Thrombosis | FAERS: 29 | US FAERS | |
| 21 | Recalled product administered | FAERS: 29 | US FAERS | |
| 22 | Abdominal Pain | FAERS: 28 | US FAERS | |
| 23 | Acne | FAERS: 28 | US FAERS | |
| 24 | Fatigue | FAERS: 26 | US FAERS | |
| 25 | Malaise | FAERS: 24 | US FAERS | |
| 26 | Pain | FAERS: 24 | US FAERS | |
| 27 | Urticaria | FAERS: 24 | US FAERS | |
| 28 | Cerebrovascular accident | FAERS: 23 | US FAERS | |
| 29 | Wrong technique in product usage process | FAERS: 22 | US FAERS | |
| 30 | Chest Pain | FAERS: 20 | US FAERS | |
| 31 | Feeling abnormal | FAERS: 18 | US FAERS | |
| 32 | Pruritus | FAERS: 15 | US FAERS | |
| 33 | Crying | FAERS: 14 | US FAERS | |
| 34 | Therapeutic response unexpected | FAERS: 14 | US FAERS | |
| 35 | Breast tenderness | FAERS: 13 | US FAERS | |
| 36 | Maternal exposure timing unspecified | FAERS: 13 | US FAERS | |
| 37 | Palpitations | FAERS: 12 | US FAERS | |
| 38 | Product use in unapproved indication | FAERS: 12 | US FAERS | |
| 39 | Vaginal Discharge | FAERS: 12 | US FAERS | |
| 40 | Abdominal discomfort | FAERS: 11 | US FAERS | |
| 41 | Drug ineffective for unapproved indication | FAERS: 11 | US FAERS | |
| 42 | Incorrect dose administered | FAERS: 11 | US FAERS | |
| 43 | Product substitution issue | FAERS: 11 | US FAERS | |
| 44 | Drug exposure during pregnancy | FAERS: 10 | US FAERS | |
| 45 | No adverse event | FAERS: 10 | US FAERS | |
| 46 | Hypersensitivity | FAERS: 9 | US FAERS | |
| 47 | Intentional product misuse | FAERS: 9 | US FAERS | |
| 48 | Myalgia | FAERS: 9 | US FAERS | |
| 49 | Product quality issue | FAERS: 9 | US FAERS | |
| 50 | Asthenia | FAERS: 8 | US FAERS | |
| 51 | Flatulence | FAERS: 8 | US FAERS | |
| 52 | Weight decreased | FAERS: 8 | US FAERS | |
| 53 | Expired product administered | FAERS: 7 | US FAERS | |
| 54 | Hormone level abnormal | FAERS: 7 | US FAERS | |
| 55 | Anger | FAERS: 6 | US FAERS | |
| 56 | Back Pain | FAERS: 6 | US FAERS | |
| 57 | Cholelithiasis | FAERS: 6 | US FAERS | |
| 58 | Coital bleeding | FAERS: 6 | US FAERS | |
| 59 | Drug prescribing error | FAERS: 6 | US FAERS | |
| 60 | Intentional dose omission | FAERS: 6 | US FAERS | |
| 61 | Lip swelling | FAERS: 6 | US FAERS | |
| 62 | Adverse event | FAERS: 5 | US FAERS | |
| 63 | Blood glucose increased | FAERS: 5 | US FAERS | |
| 64 | Chest discomfort | FAERS: 5 | US FAERS | |
| 65 | Chloasma | FAERS: 5 | US FAERS | |
| 66 | Depressed mood | FAERS: 5 | US FAERS | |
| 67 | Drug administration error | FAERS: 5 | US FAERS | |
| 68 | Emotional disorder | FAERS: 5 | US FAERS | |
| 69 | Lymphadenopathy | FAERS: 5 | US FAERS | |
| 70 | Maternal exposure during breast feeding | FAERS: 5 | US FAERS | |
| 71 | Pulmonary thrombosis | FAERS: 5 | US FAERS | |
| 72 | Urinary tract infection | FAERS: 5 | US FAERS | |
| 73 | Visual Impairment | FAERS: 5 | US FAERS | |
| 74 | jaundice | FAERS: 5 | US FAERS | |
| 75 | Emotional distress | FAERS: 4 | US FAERS | |
| 76 | Flushing | FAERS: 4 | US FAERS | |
| 77 | Joint swelling | FAERS: 4 | US FAERS | |
| 78 | Memory impairment | FAERS: 4 | US FAERS | |
| 79 | Musculoskeletal Pain | FAERS: 4 | US FAERS | |
| 80 | Nervousness | FAERS: 4 | US FAERS | |
| 81 | Paranoia | FAERS: 4 | US FAERS | |
| 82 | Product storage error | FAERS: 4 | US FAERS | |
| 83 | Swelling | FAERS: 4 | US FAERS | |
| 84 | Arthralgia | FAERS: 3 | US FAERS | |
| 85 | Bipolar Disorder | FAERS: 3 | US FAERS | |
| 86 | Cerebral Thrombosis | FAERS: 3 | US FAERS | |
| 87 | Dyspepsia | FAERS: 3 | US FAERS | |
| 88 | Endometriosis | FAERS: 3 | US FAERS | |
| 89 | Erythema | FAERS: 3 | US FAERS | |
| 90 | Impaired work ability | FAERS: 3 | US FAERS | |
| 91 | Intentional product use issue | FAERS: 3 | US FAERS | |
| 92 | Irritable Bowel Syndrome | FAERS: 3 | US FAERS | |
| 93 | Lethargy | FAERS: 3 | US FAERS | |
| 94 | Limb discomfort | FAERS: 3 | US FAERS | |
| 95 | Medication Error | FAERS: 3 | US FAERS | |
| 96 | Mental status changes | FAERS: 3 | US FAERS | |
| 97 | Neck Pain | FAERS: 3 | US FAERS | |
| 98 | Night sweats | FAERS: 3 | US FAERS | |
| 99 | Pallor | FAERS: 3 | US FAERS | |
| 100 | Pelvic Pain | FAERS: 3 | US FAERS | |
| 101 | Pharmaceutical product complaint | FAERS: 3 | US FAERS | |
| 102 | Product administration error | FAERS: 3 | US FAERS | |
| 103 | Product packaging issue | FAERS: 3 | US FAERS | |
| 104 | Rash erythematous | FAERS: 3 | US FAERS | |
| 105 | Suicide attempt | FAERS: 3 | US FAERS | |
| 106 | Vertigo | FAERS: 3 | US FAERS | |
| 107 | Abdominal rigidity | FAERS: 2 | US FAERS | |
| 108 | Abdominal tenderness | FAERS: 2 | US FAERS | |
| 109 | Accidental exposure to product by child | FAERS: 2 | US FAERS | |
| 110 | Androgenetic Alopecia | FAERS: 2 | US FAERS | |
| 111 | Arthroscopy | FAERS: 2 | US FAERS | |
| 112 | Astigmatism | FAERS: 2 | US FAERS | |
| 113 | Bacterial Vaginosis | FAERS: 2 | US FAERS | |
| 114 | Bladder pain | FAERS: 2 | US FAERS | |
| 115 | Blindness | FAERS: 2 | US FAERS | |
| 116 | Blood prolactin increased | FAERS: 2 | US FAERS | |
| 117 | Blood thyroid stimulating hormone increased | FAERS: 2 | US FAERS | |
| 118 | Chills | FAERS: 2 | US FAERS | |
| 119 | Cholestasis | FAERS: 2 | US FAERS | |
| 120 | Chromaturia | FAERS: 2 | US FAERS | |
| 121 | Constipation | FAERS: 2 | US FAERS | |
| 122 | Cyst | FAERS: 2 | US FAERS | |
| 123 | Discomfort | FAERS: 2 | US FAERS | |
| 124 | Dry skin | FAERS: 2 | US FAERS | |
| 125 | Dysarthria | FAERS: 2 | US FAERS | |
| 126 | Eructation | FAERS: 2 | US FAERS | |
| 127 | Extra dose administered | FAERS: 2 | US FAERS | |
| 128 | Eye pain | FAERS: 2 | US FAERS | |
| 129 | Food Allergy | FAERS: 2 | US FAERS | |
| 130 | Gastrointestinal Pain | FAERS: 2 | US FAERS | |
| 131 | General physical condition abnormal | FAERS: 2 | US FAERS | |
| 132 | Head discomfort | FAERS: 2 | US FAERS | |
| 133 | Hepatotoxicity | FAERS: 2 | US FAERS | |
| 134 | Hypophagia | FAERS: 2 | US FAERS | |
| 135 | Inappropriate affect | FAERS: 2 | US FAERS | |
| 136 | Incorrect product dosage form administered | FAERS: 2 | US FAERS | |
| 137 | Influenza | FAERS: 2 | US FAERS | |
| 138 | Keratomileusis | FAERS: 2 | US FAERS | |
| 139 | Malnutrition | FAERS: 2 | US FAERS | |
| 140 | Maternal exposure during pregnancy | FAERS: 2 | US FAERS | |
| 141 | Mental impairment | FAERS: 2 | US FAERS | |
| 142 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 143 | Pancreatitis | FAERS: 2 | US FAERS | |
| 144 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 145 | Pneumonia | FAERS: 2 | US FAERS | |
| 146 | Poor quality sleep | FAERS: 2 | US FAERS | |
| 147 | Pregnancy on contraceptive | FAERS: 2 | US FAERS | |
| 148 | Presyncope | FAERS: 2 | US FAERS | |
| 149 | Product appearance confusion | FAERS: 2 | US FAERS | |
| 150 | Product prescribing issue | FAERS: 2 | US FAERS | |
| 151 | Product solubility abnormal | FAERS: 2 | US FAERS | |
| 152 | Product taste abnormal | FAERS: 2 | US FAERS | |
| 153 | Pulmonary Infarction | FAERS: 2 | US FAERS | |
| 154 | Quality of life decreased | FAERS: 2 | US FAERS | |
| 155 | Skin irritation | FAERS: 2 | US FAERS | |
| 156 | Tachycardia | FAERS: 2 | US FAERS | |
| 157 | Thirst | FAERS: 2 | US FAERS | |
| 158 | Toxicity to various agents | FAERS: 2 | US FAERS | |
| 159 | Tremor | FAERS: 2 | US FAERS | |
| 160 | Unevaluable event | FAERS: 2 | US FAERS | |
| 161 | Urinary Incontinence | FAERS: 2 | US FAERS | |
| 162 | Uterine spasm | FAERS: 2 | US FAERS | |
| 163 | Vascular occlusion | FAERS: 2 | US FAERS | |
| 164 | Venous Insufficiency | FAERS: 2 | US FAERS | |
| 165 | Venous stenosis | FAERS: 2 | US FAERS | |
| 166 | Visual disturbance | FAERS: 2 | US FAERS | |
| 167 | Abasia | FAERS: 1 | US FAERS | |
| 168 | Abnormal weight gain | FAERS: 1 | US FAERS | |
| 169 | Abnormal withdrawal bleeding | FAERS: 1 | US FAERS | |
| 170 | Accidental overdose | FAERS: 1 | US FAERS | |
| 171 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 172 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 173 | Adnexa uteri pain | FAERS: 1 | US FAERS | |
| 174 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 175 | Aneurysm | FAERS: 1 | US FAERS | |
| 176 | Angioedema | FAERS: 1 | US FAERS | |
| 177 | Anorexia | FAERS: 1 | US FAERS | |
| 178 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 179 | Aversion | FAERS: 1 | US FAERS | |
| 180 | Axillary vein thrombosis | FAERS: 1 | US FAERS | |
| 181 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 182 | Blood homocysteine increased | FAERS: 1 | US FAERS | |
| 183 | Blood iron increased | FAERS: 1 | US FAERS | |
| 184 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 185 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 186 | Blue Toe Syndrome | FAERS: 1 | US FAERS | |
| 187 | Body temperature fluctuation | FAERS: 1 | US FAERS | |
| 188 | Bone pain | FAERS: 1 | US FAERS | |
| 189 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 190 | Brain Death | FAERS: 1 | US FAERS | |
| 191 | Catheter related complication | FAERS: 1 | US FAERS | |
| 192 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 193 | Cholecystitis | FAERS: 1 | US FAERS | |
| 194 | Cholelithotomy | FAERS: 1 | US FAERS | |
| 195 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 196 | Clumsiness | FAERS: 1 | US FAERS | |
| 197 | Cluster Headache | FAERS: 1 | US FAERS | |
| 198 | Coagulation factor VIII level increased | FAERS: 1 | US FAERS | |
| 199 | Colitis | FAERS: 1 | US FAERS | |
| 200 | Contact lens complication | FAERS: 1 | US FAERS | |
| 201 | Contact lens intolerance | FAERS: 1 | US FAERS | |
| 202 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 203 | Conversion disorder | FAERS: 1 | US FAERS | |
| 204 | Cystitis | FAERS: 1 | US FAERS | |
| 205 | Dehydration | FAERS: 1 | US FAERS | |
| 206 | Disease recurrence | FAERS: 1 | US FAERS | |
| 207 | Dissociation | FAERS: 1 | US FAERS | |
| 208 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 209 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 210 | Drug effective for unapproved indication | FAERS: 1 | US FAERS | |
| 211 | Duodenogastric Reflux | FAERS: 1 | US FAERS | |
| 212 | Dyspareunia | FAERS: 1 | US FAERS | |
| 213 | Ecchymosis | FAERS: 1 | US FAERS | |
| 214 | Economic problem | FAERS: 1 | US FAERS | |
| 215 | Epilepsy | FAERS: 1 | US FAERS | |
| 216 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 217 | Erythema Nodosum | FAERS: 1 | US FAERS | |
| 218 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 219 | Eye irritation | FAERS: 1 | US FAERS | |
| 220 | Facial Pain | FAERS: 1 | US FAERS | |
| 221 | Feeling Cold | FAERS: 1 | US FAERS | |
| 222 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 223 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 224 | Flank Pain | FAERS: 1 | US FAERS | |
| 225 | Food aversion | FAERS: 1 | US FAERS | |
| 226 | Food craving | FAERS: 1 | US FAERS | |
| 227 | Gait inability | FAERS: 1 | US FAERS | |
| 228 | Gastritis | FAERS: 1 | US FAERS | |
| 229 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 230 | Gastrointestinal bacterial overgrowth | FAERS: 1 | US FAERS | |
| 231 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 232 | Hemiparesis | FAERS: 1 | US FAERS | |
| 233 | Hemiplegia | FAERS: 1 | US FAERS | |
| 234 | Hepatitis | FAERS: 1 | US FAERS | |
| 235 | Hernia | FAERS: 1 | US FAERS | |
| 236 | Hostility | FAERS: 1 | US FAERS | |
| 237 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 238 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 239 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 240 | Hysterectomy | FAERS: 1 | US FAERS | |
| 241 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 242 | In-stent arterial restenosis | FAERS: 1 | US FAERS | |
| 243 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 244 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 245 | Induration | FAERS: 1 | US FAERS | |
| 246 | Inflammation | FAERS: 1 | US FAERS | |
| 247 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 248 | Intervertebral disc injury | FAERS: 1 | US FAERS | |
| 249 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 250 | Joint injury | FAERS: 1 | US FAERS | |
| 251 | Joint sprain | FAERS: 1 | US FAERS | |
| 252 | Joint stiffness | FAERS: 1 | US FAERS | |
| 253 | Joint warmth | FAERS: 1 | US FAERS | |
| 254 | Ketoacidosis | FAERS: 1 | US FAERS | |
| 255 | Limb injury | FAERS: 1 | US FAERS | |
| 256 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 257 | Lobar Pneumonia | FAERS: 1 | US FAERS | |
| 258 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 259 | Lupus-like syndrome | FAERS: 1 | US FAERS | |
| 260 | Medication residue present | FAERS: 1 | US FAERS | |
| 261 | Meningitis | FAERS: 1 | US FAERS | |
| 262 | Middle insomnia | FAERS: 1 | US FAERS | |
| 263 | Mouth swelling | FAERS: 1 | US FAERS | |
| 264 | Moyamoya Disease | FAERS: 1 | US FAERS | |
| 265 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 266 | Muscle tightness | FAERS: 1 | US FAERS | |
| 267 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 268 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 269 | Myopia | FAERS: 1 | US FAERS | |
| 270 | Negative thoughts | FAERS: 1 | US FAERS | |
| 271 | Nocturia | FAERS: 1 | US FAERS | |
| 272 | Nodule | FAERS: 1 | US FAERS | |
| 273 | Obsessive thoughts | FAERS: 1 | US FAERS | |
| 274 | Obstruction | FAERS: 1 | US FAERS | |
| 275 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 276 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 277 | Otosclerosis | FAERS: 1 | US FAERS | |
| 278 | Pancytopenia | FAERS: 1 | US FAERS | |
| 279 | Paresis | FAERS: 1 | US FAERS | |
| 280 | Patient dissatisfaction with treatment | FAERS: 1 | US FAERS | |
| 281 | Pelvic fluid collection | FAERS: 1 | US FAERS | |
| 282 | Peripheral embolism | FAERS: 1 | US FAERS | |
| 283 | Photophobia | FAERS: 1 | US FAERS | |
| 284 | Platelet count abnormal | FAERS: 1 | US FAERS | |
| 285 | Pneumothorax | FAERS: 1 | US FAERS | |
| 286 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 287 | Poor quality product administered | FAERS: 1 | US FAERS | |
| 288 | Portal vein stenosis | FAERS: 1 | US FAERS | |
| 289 | Pregnancy test false positive | FAERS: 1 | US FAERS | |
| 290 | Premenstrual syndrome | FAERS: 1 | US FAERS | |
| 291 | Product blister packaging issue | FAERS: 1 | US FAERS | |
| 292 | Product expiration date issue | FAERS: 1 | US FAERS | |
| 293 | Product formulation issue | FAERS: 1 | US FAERS | |
| 294 | Product label issue | FAERS: 1 | US FAERS | |
| 295 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 296 | Product physical issue | FAERS: 1 | US FAERS | |
| 297 | Product prescribing error | FAERS: 1 | US FAERS | |
| 298 | Product use complaint | FAERS: 1 | US FAERS | |
| 299 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 300 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 301 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 302 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 303 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 304 | Ruptured ectopic pregnancy | FAERS: 1 | US FAERS | |
| 305 | Scab | FAERS: 1 | US FAERS | |
| 306 | Screaming | FAERS: 1 | US FAERS | |
| 307 | Secretion discharge | FAERS: 1 | US FAERS | |
| 308 | Seroma | FAERS: 1 | US FAERS | |
| 309 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 310 | Skin laceration | FAERS: 1 | US FAERS | |
| 311 | Skin texture abnormal | FAERS: 1 | US FAERS | |
| 312 | Sneezing | FAERS: 1 | US FAERS | |
| 313 | Somnolence | FAERS: 1 | US FAERS | |
| 314 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 315 | Stomatitis | FAERS: 1 | US FAERS | |
| 316 | Sunburn | FAERS: 1 | US FAERS | |
| 317 | Suppressed lactation | FAERS: 1 | US FAERS | |
| 318 | Syncope | FAERS: 1 | US FAERS | |
| 319 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 320 | Thrombophlebitis | FAERS: 1 | US FAERS | |
| 321 | Tonsillitis | FAERS: 1 | US FAERS | |
| 322 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 323 | Trisomy 21 | FAERS: 1 | US FAERS | |
| 324 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 325 | Unwanted pregnancy | FAERS: 1 | US FAERS | |
| 326 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 327 | Vulvovaginal discomfort | FAERS: 1 | US FAERS | |
| 328 | Vulvovaginal dryness | FAERS: 1 | US FAERS | |
| 329 | Vulvovaginal mycotic infection | FAERS: 1 | US FAERS | |
| 330 | Vulvovaginal pain | FAERS: 1 | US FAERS | |
| 331 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 332 | nervous system disorder | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.