Prasugrel Hydrochloride
(DTGLZDAWLRGWQN-UHFFFAOYSA-N)
Structure
- SMILES
- CC(=O)Oc1sc2c(c1)CN(CC2)C(c1ccccc1F)C(=O)C1CC1
- Type(s)
- Approved
- ATC code(s)
- B01AC22
- Molecular Formula:
- C20H20FNO3S
- Molecular Weight:
- 373.441
- Log P:
- 3.8289
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 0
- TPSA:
- 74.85
- CAS Number(s):
- 150322-43-3
Synonym(s)
1.
Prasugrel Hydrochloride
2.
CS 747
3.
CS-747
4.
Effient
5.
Efient
6.
LY 640315
7.
LY-640315
8.
LY640315
9.
Prasugrel
10.
Prasugrel HCl
11.
640315, LY
12.
747, CS
13.
CS747
14.
HCl, Prasugrel
15.
Hydrochloride, Prasugrel
External Link(s)
| MeSH | D000068799 |
| PubChem Compound | 6918456 |
| ChEBI | 87723 |
| CHEMBL | CHEMBL1201772 |
| DrugBank | DB06209 |
| DrugCentral | 4113 |
| IUPHAR/BPS Guide to PHARMACOLOGY | 7562 |
| KEGG | dr:D05597 |
| Therapeutic Target Database | D07IRF |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Thrombosis in device | FAERS: 140 | US FAERS | |
| 2 | Myocardial Infarction | FAERS: 93 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Chest Pain | FAERS: 83 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 4 | Cerebrovascular accident | FAERS: 62 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 5 | Drug dose omission | FAERS: 61 | US FAERS | |
| 6 | Acute myocardial infarction | FAERS: 53 | US FAERS | |
| 7 | Epistaxis | FAERS: 51 | SIDER US FAERS | |
| 8 | Fatigue | FAERS: 51 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 9 | Headache | FAERS: 49 | SIDER US FAERS | |
| 10 | Dizziness | FAERS: 45 | SIDER US FAERS | |
| 11 | Asthenia | FAERS: 35 | SIDER US FAERS | |
| 12 | Nausea | FAERS: 35 | SIDER US FAERS | |
| 13 | Device occlusion | FAERS: 31 | US FAERS | |
| 14 | Malaise | FAERS: 30 | US FAERS | |
| 15 | Pruritus | FAERS: 29 | US FAERS | |
| 16 | In-stent coronary artery restenosis | FAERS: 28 | US FAERS | |
| 17 | Angina Pectoris | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 18 | Vomiting | FAERS: 27 | US FAERS | |
| 19 | Urticaria | FAERS: 26 | US FAERS | |
| 20 | Thrombosis | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 21 | Drug ineffective | FAERS: 23 | US FAERS | |
| 22 | Feeling abnormal | FAERS: 23 | US FAERS | |
| 23 | Hypersensitivity | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 24 | Pain | FAERS: 20 | US FAERS | |
| 25 | Abdominal Pain | FAERS: 19 | US FAERS | |
| 26 | Back Pain | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 27 | Vascular stent thrombosis | FAERS: 18 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 28 | Chest discomfort | FAERS: 16 | US FAERS | |
| 29 | Coronary Artery Disease | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 30 | Cardiac Arrest | FAERS: 14 | US FAERS | |
| 31 | Overdose | FAERS: 14 | US FAERS | |
| 32 | Thrombocytopenia | FAERS: 14 | SIDER US FAERS | |
| 33 | Anxiety | FAERS: 13 | US FAERS | |
| 34 | Deep Vein Thrombosis | FAERS: 13 | US FAERS | |
| 35 | Drug dispensing error | FAERS: 13 | US FAERS | |
| 36 | Petechiae | FAERS: 13 | US FAERS | |
| 37 | Abdominal discomfort | FAERS: 12 | US FAERS | |
| 38 | Atrial Fibrillation | FAERS: 12 | SIDER US FAERS | |
| 39 | Visual Impairment | FAERS: 12 | US FAERS | |
| 40 | Arthralgia | FAERS: 11 | US FAERS | |
| 41 | Swelling | FAERS: 11 | US FAERS | |
| 42 | Syncope | FAERS: 11 | US FAERS | |
| 43 | Dyspepsia | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 44 | Intentional product misuse | FAERS: 10 | US FAERS | |
| 45 | Medication Error | FAERS: 10 | US FAERS | |
| 46 | Palpitations | FAERS: 10 | US FAERS | |
| 47 | Peripheral swelling | FAERS: 10 | US FAERS | |
| 48 | Platelet function test abnormal | FAERS: 10 | US FAERS | |
| 49 | Acute Coronary Syndrome | FAERS: 9 | US FAERS | |
| 50 | Angioedema | FAERS: 9 | SIDER US FAERS | |
| 51 | Blood urine present | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 52 | Constipation | FAERS: 9 | US FAERS | |
| 53 | Dysgeusia | FAERS: 9 | US FAERS | |
| 54 | Hypotension | FAERS: 9 | SIDER US FAERS | |
| 55 | Incorrect product storage | FAERS: 9 | US FAERS | |
| 56 | Myalgia | FAERS: 9 | US FAERS | |
| 57 | No adverse event | FAERS: 9 | US FAERS | |
| 58 | Pneumonia | FAERS: 9 | US FAERS | |
| 59 | Sepsis | FAERS: 9 | US FAERS | |
| 60 | Erythema | FAERS: 8 | US FAERS | |
| 61 | Gastric ulcer | FAERS: 8 | US FAERS | |
| 62 | Non-cardiac chest pain | FAERS: 8 | SIDER US FAERS | |
| 63 | Pericardial effusion | FAERS: 8 | SIDER US FAERS | |
| 64 | Vascular occlusion | FAERS: 8 | US FAERS | |
| 65 | Weight decreased | FAERS: 8 | US FAERS | |
| 66 | Wrong technique in product usage process | FAERS: 8 | US FAERS | |
| 67 | Accidental overdose | FAERS: 7 | US FAERS | |
| 68 | Alanine Aminotransferase Increased | FAERS: 7 | US FAERS | |
| 69 | Arterial restenosis | FAERS: 7 | US FAERS | |
| 70 | Tinnitus | FAERS: 7 | US FAERS | |
| 71 | Adverse event | FAERS: 6 | US FAERS | |
| 72 | Amnesia | FAERS: 6 | US FAERS | |
| 73 | Dehydration | FAERS: 6 | US FAERS | |
| 74 | Diabetes Mellitus | FAERS: 6 | US FAERS | |
| 75 | Diverticulitis | FAERS: 6 | US FAERS | |
| 76 | Flushing | FAERS: 6 | US FAERS | |
| 77 | Gamma-Glutamyltransferase Increased | FAERS: 6 | US FAERS | |
| 78 | In-stent arterial restenosis | FAERS: 6 | US FAERS | |
| 79 | Joint swelling | FAERS: 6 | US FAERS | |
| 80 | Prescribed overdose | FAERS: 6 | US FAERS | |
| 81 | Product counterfeit | FAERS: 6 | US FAERS | |
| 82 | Troponin increased | FAERS: 6 | US FAERS | |
| 83 | Activities of daily living impaired | FAERS: 5 | US FAERS | |
| 84 | Alopecia | FAERS: 5 | US FAERS | |
| 85 | Appendicitis | FAERS: 5 | US FAERS | |
| 86 | Arteriosclerosis | FAERS: 5 | US FAERS | |
| 87 | Arthritis | FAERS: 5 | US FAERS | |
| 88 | Cardiac Tamponade | FAERS: 5 | US FAERS | |
| 89 | Chromaturia | FAERS: 5 | US FAERS | |
| 90 | Hernia | FAERS: 5 | US FAERS | |
| 91 | Intracranial Aneurysm | FAERS: 5 | US FAERS | |
| 92 | Menorrhagia | FAERS: 5 | US FAERS | |
| 93 | Neck Pain | FAERS: 5 | US FAERS | |
| 94 | Product storage error | FAERS: 5 | US FAERS | |
| 95 | Abasia | FAERS: 4 | US FAERS | |
| 96 | Arterial thrombosis | FAERS: 4 | US FAERS | |
| 97 | Arteriovenous fistula | FAERS: 4 | US FAERS | |
| 98 | Aspartate Aminotransferase Increased | FAERS: 4 | US FAERS | |
| 99 | Bradycardia | FAERS: 4 | SIDER US FAERS | |
| 100 | Cerebellar infarction | FAERS: 4 | US FAERS | |
| 101 | Discomfort | FAERS: 4 | US FAERS | |
| 102 | Disorientation | FAERS: 4 | US FAERS | |
| 103 | Ecchymosis | FAERS: 4 | SIDER US FAERS | |
| 104 | Flatulence | FAERS: 4 | US FAERS | |
| 105 | Gastritis | FAERS: 4 | US FAERS | |
| 106 | Gastroenteritis | FAERS: 4 | US FAERS | |
| 107 | Hepatitis | FAERS: 4 | US FAERS | |
| 108 | Infarction | FAERS: 4 | US FAERS | |
| 109 | Influenza | FAERS: 4 | US FAERS | |
| 110 | Lip swelling | FAERS: 4 | US FAERS | |
| 111 | Musculoskeletal Pain | FAERS: 4 | US FAERS | |
| 112 | Musculoskeletal stiffness | FAERS: 4 | US FAERS | |
| 113 | Oropharyngeal pain | FAERS: 4 | US FAERS | |
| 114 | Pallor | FAERS: 4 | US FAERS | |
| 115 | Pancreatitis | FAERS: 4 | US FAERS | |
| 116 | Percutaneous Coronary Intervention | FAERS: 4 | US FAERS | |
| 117 | Platelet aggregation abnormal | FAERS: 4 | US FAERS | |
| 118 | Post procedural complication | FAERS: 4 | US FAERS | |
| 119 | Purpura | FAERS: 4 | US FAERS | |
| 120 | Respiratory distress | FAERS: 4 | US FAERS | |
| 121 | Shock | FAERS: 4 | US FAERS | |
| 122 | Stent embolisation | FAERS: 4 | US FAERS | |
| 123 | Sudden death | FAERS: 4 | US FAERS | |
| 124 | treatment failure | FAERS: 4 | US FAERS | |
| 125 | Agitation | FAERS: 3 | US FAERS | |
| 126 | Aphasia | FAERS: 3 | US FAERS | |
| 127 | Blood count abnormal | FAERS: 3 | US FAERS | |
| 128 | Blood glucose increased | FAERS: 3 | US FAERS | |
| 129 | Carotid artery occlusion | FAERS: 3 | US FAERS | |
| 130 | Chills | FAERS: 3 | US FAERS | |
| 131 | Cholelithiasis | FAERS: 3 | US FAERS | |
| 132 | Drug resistance | FAERS: 3 | US FAERS | |
| 133 | Dysarthria | FAERS: 3 | US FAERS | |
| 134 | Gastrointestinal Pain | FAERS: 3 | US FAERS | |
| 135 | Gout | FAERS: 3 | US FAERS | |
| 136 | Hemiplegia | FAERS: 3 | US FAERS | |
| 137 | Incorrect dose administered | FAERS: 3 | US FAERS | |
| 138 | Increased tendency to bruise | FAERS: 3 | US FAERS | |
| 139 | Laceration | FAERS: 3 | US FAERS | |
| 140 | Nasopharyngitis | FAERS: 3 | US FAERS | |
| 141 | Pancytopenia | FAERS: 3 | US FAERS | |
| 142 | Photophobia | FAERS: 3 | US FAERS | |
| 143 | Presyncope | FAERS: 3 | US FAERS | |
| 144 | Product substitution issue | FAERS: 3 | US FAERS | |
| 145 | Respiratory Failure | FAERS: 3 | US FAERS | |
| 146 | Sudden Cardiac Death | FAERS: 3 | US FAERS | |
| 147 | Thermal burn | FAERS: 3 | US FAERS | |
| 148 | Thrombocytosis | FAERS: 3 | US FAERS | |
| 149 | Tremor | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 150 | Ulcer | FAERS: 3 | US FAERS | |
| 151 | nervous system disorder | FAERS: 3 | US FAERS | |
| 152 | Aortic Aneurysm | FAERS: 2 | US FAERS | |
| 153 | Arthropathy | FAERS: 2 | US FAERS | |
| 154 | Atrial thrombosis | FAERS: 2 | US FAERS | |
| 155 | Atrioventricular Block | FAERS: 2 | US FAERS | |
| 156 | Blindness | FAERS: 2 | US FAERS | |
| 157 | Cataract | FAERS: 2 | US FAERS | |
| 158 | Cerebral Infarction | FAERS: 2 | US FAERS | |
| 159 | Colectomy | FAERS: 2 | US FAERS | |
| 160 | Deafness | FAERS: 2 | US FAERS | |
| 161 | Depressed mood | FAERS: 2 | US FAERS | |
| 162 | Diplopia | FAERS: 2 | US FAERS | |
| 163 | Disease Progression | FAERS: 2 | US FAERS | |
| 164 | Drug administration error | FAERS: 2 | US FAERS | |
| 165 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 166 | Dry skin | FAERS: 2 | US FAERS | |
| 167 | Ejection Fraction Decreased | FAERS: 2 | US FAERS | |
| 168 | Embolic stroke | FAERS: 2 | US FAERS | |
| 169 | Erectile dysfunction | FAERS: 2 | US FAERS | |
| 170 | General physical health deterioration | FAERS: 2 | US FAERS | |
| 171 | Guillain-Barre Syndrome | FAERS: 2 | US FAERS | |
| 172 | Implantable defibrillator insertion | FAERS: 2 | US FAERS | |
| 173 | Incorrect storage of drug | FAERS: 2 | US FAERS | |
| 174 | Infection | FAERS: 2 | US FAERS | |
| 175 | Inflammation | FAERS: 2 | US FAERS | |
| 176 | Intentional drug misuse | FAERS: 2 | US FAERS | |
| 177 | Intercepted drug dispensing error | FAERS: 2 | US FAERS | |
| 178 | Joint injury | FAERS: 2 | US FAERS | |
| 179 | Lethargy | FAERS: 2 | US FAERS | |
| 180 | Limb injury | FAERS: 2 | US FAERS | |
| 181 | Livedo Reticularis | FAERS: 2 | US FAERS | |
| 182 | Maternal exposure during pregnancy | FAERS: 2 | US FAERS | |
| 183 | Memory impairment | FAERS: 2 | US FAERS | |
| 184 | Metastatic Neoplasm | FAERS: 2 | US FAERS | |
| 185 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 186 | Peptic Ulcer | FAERS: 2 | US FAERS | |
| 187 | Pericarditis | FAERS: 2 | US FAERS | |
| 188 | Peripheral arterial occlusive disease | FAERS: 2 | US FAERS | |
| 189 | Platelet aggregation decreased | FAERS: 2 | US FAERS | |
| 190 | Platelet count abnormal | FAERS: 2 | US FAERS | |
| 191 | Post procedural infection | FAERS: 2 | US FAERS | |
| 192 | Procedural complication | FAERS: 2 | US FAERS | |
| 193 | Product dispensing error | FAERS: 2 | US FAERS | |
| 194 | Product quality issue | FAERS: 2 | US FAERS | |
| 195 | Sneezing | FAERS: 2 | US FAERS | |
| 196 | Somnolence | FAERS: 2 | US FAERS | |
| 197 | Stent malfunction | FAERS: 2 | US FAERS | |
| 198 | Stress | FAERS: 2 | US FAERS | |
| 199 | Thrombophlebitis | FAERS: 2 | US FAERS | |
| 200 | Tooth Extraction | FAERS: 2 | US FAERS | |
| 201 | Toothache | FAERS: 2 | US FAERS | |
| 202 | Troponin T increased | FAERS: 2 | US FAERS | |
| 203 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 204 | Venous occlusion | FAERS: 2 | US FAERS | |
| 205 | Ventricle rupture | FAERS: 2 | US FAERS | |
| 206 | Ventricular Fibrillation | FAERS: 2 | US FAERS | |
| 207 | Vertigo | FAERS: 2 | US FAERS | |
| 208 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 209 | jaundice | FAERS: 2 | US FAERS | |
| 210 | Abdominal Infection | FAERS: 1 | US FAERS | |
| 211 | Abscess | FAERS: 1 | US FAERS | |
| 212 | Acne | FAERS: 1 | US FAERS | |
| 213 | Activated partial thromboplastin time abnormal | FAERS: 1 | US FAERS | |
| 214 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 215 | Acute right ventricular failure | FAERS: 1 | US FAERS | |
| 216 | Adenocarcinoma | FAERS: 1 | US FAERS | |
| 217 | Adrenal mass | FAERS: 1 | US FAERS | |
| 218 | Ageusia | FAERS: 1 | US FAERS | |
| 219 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 220 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 221 | Angioplasty | FAERS: 1 | US FAERS | |
| 222 | Anorectal discomfort | FAERS: 1 | US FAERS | |
| 223 | Anti-platelet antibody negative | FAERS: 1 | US FAERS | |
| 224 | Aortic occlusion | FAERS: 1 | US FAERS | |
| 225 | Apallic syndrome | FAERS: 1 | US FAERS | |
| 226 | Aphonia | FAERS: 1 | US FAERS | |
| 227 | Arterial Injury | FAERS: 1 | US FAERS | |
| 228 | Arterial therapeutic procedure | FAERS: 1 | US FAERS | |
| 229 | Asphyxia | FAERS: 1 | US FAERS | |
| 230 | Asthma | FAERS: 1 | US FAERS | |
| 231 | Atherosclerotic plaque rupture | FAERS: 1 | US FAERS | |
| 232 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 233 | Autoimmune neutropenia | FAERS: 1 | US FAERS | |
| 234 | Autonomic nervous system imbalance | FAERS: 1 | US FAERS | |
| 235 | Babesiosis | FAERS: 1 | US FAERS | |
| 236 | Bacterial disease carrier | FAERS: 1 | US FAERS | |
| 237 | Basal cell carcinoma | FAERS: 1 | US FAERS | |
| 238 | Blood blister | FAERS: 1 | US FAERS | |
| 239 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 240 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 241 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 242 | Blood pressure immeasurable | FAERS: 1 | US FAERS | |
| 243 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 244 | Blue Toe Syndrome | FAERS: 1 | US FAERS | |
| 245 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 246 | Brain Death | FAERS: 1 | US FAERS | |
| 247 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 248 | Bronchitis | FAERS: 1 | US FAERS | |
| 249 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 250 | Burning sensation | FAERS: 1 | US FAERS | |
| 251 | Bursitis | FAERS: 1 | US FAERS | |
| 252 | Cardiac perforation | FAERS: 1 | US FAERS | |
| 253 | Cardiac pseudoaneurysm | FAERS: 1 | US FAERS | |
| 254 | Cardiac stress test abnormal | FAERS: 1 | US FAERS | |
| 255 | Cellulitis | FAERS: 1 | US FAERS | |
| 256 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 257 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 258 | Choking | FAERS: 1 | US FAERS | |
| 259 | Coagulation time shortened | FAERS: 1 | US FAERS | |
| 260 | Cold sweat | FAERS: 1 | US FAERS | |
| 261 | Completed Suicide | FAERS: 1 | US FAERS | |
| 262 | Complication associated with device | FAERS: 1 | US FAERS | |
| 263 | Coronary artery reocclusion | FAERS: 1 | US FAERS | |
| 264 | Crying | FAERS: 1 | US FAERS | |
| 265 | Cystitis | FAERS: 1 | US FAERS | |
| 266 | Dark circles under eyes | FAERS: 1 | US FAERS | |
| 267 | Dementia | FAERS: 1 | US FAERS | |
| 268 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 269 | Device Failure | FAERS: 1 | US FAERS | |
| 270 | Device connection issue | FAERS: 1 | US FAERS | |
| 271 | Diaphragmatic spasm | FAERS: 1 | US FAERS | |
| 272 | Diverticular perforation | FAERS: 1 | US FAERS | |
| 273 | Diverticulum | FAERS: 1 | US FAERS | |
| 274 | Drug level below therapeutic | FAERS: 1 | US FAERS | |
| 275 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 276 | Dysphonia | FAERS: 1 | US FAERS | |
| 277 | Dysuria | FAERS: 1 | US FAERS | |
| 278 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 279 | Embolic cerebral infarction | FAERS: 1 | US FAERS | |
| 280 | Embolism | FAERS: 1 | US FAERS | |
| 281 | Emotional distress | FAERS: 1 | US FAERS | |
| 282 | Endotracheal intubation complication | FAERS: 1 | US FAERS | |
| 283 | Enzyme abnormality | FAERS: 1 | US FAERS | |
| 284 | Eosinophilia | FAERS: 1 | US FAERS | |
| 285 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 286 | Erysipelas | FAERS: 1 | US FAERS | |
| 287 | Erythema Nodosum | FAERS: 1 | US FAERS | |
| 288 | Excoriation | FAERS: 1 | US FAERS | |
| 289 | Expired product administered | FAERS: 1 | US FAERS | |
| 290 | Extra dose administered | FAERS: 1 | US FAERS | |
| 291 | Eye pain | FAERS: 1 | US FAERS | |
| 292 | Femoral artery occlusion | FAERS: 1 | US FAERS | |
| 293 | Flank Pain | FAERS: 1 | US FAERS | |
| 294 | Food aversion | FAERS: 1 | US FAERS | |
| 295 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 296 | Gastrointestinal angiodysplasia haemorrhagic | FAERS: 1 | US FAERS | |
| 297 | Gastrointestinal angiodysplasia | FAERS: 1 | US FAERS | |
| 298 | Gastrointestinal ulcer | FAERS: 1 | US FAERS | |
| 299 | General symptom | FAERS: 1 | US FAERS | |
| 300 | Head discomfort | FAERS: 1 | US FAERS | |
| 301 | Helicobacter test positive | FAERS: 1 | US FAERS | |
| 302 | Hemiparesis | FAERS: 1 | US FAERS | |
| 303 | Hepatitis C | FAERS: 1 | US FAERS | |
| 304 | Hepatobiliary scan abnormal | FAERS: 1 | US FAERS | |
| 305 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 306 | Hypertransaminasaemia | FAERS: 1 | US FAERS | |
| 307 | Iliac artery stenosis | FAERS: 1 | US FAERS | |
| 308 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 309 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 310 | Incarcerated hernia | FAERS: 1 | US FAERS | |
| 311 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 312 | Infusion site infection | FAERS: 1 | US FAERS | |
| 313 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 314 | Joint stiffness | FAERS: 1 | US FAERS | |
| 315 | Labile blood pressure | FAERS: 1 | US FAERS | |
| 316 | Laryngitis | FAERS: 1 | US FAERS | |
| 317 | Leukopenia | FAERS: 1 | SIDER US FAERS | |
| 318 | Limb discomfort | FAERS: 1 | US FAERS | |
| 319 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 320 | Lymphangitis | FAERS: 1 | US FAERS | |
| 321 | Lymphocytic infiltration | FAERS: 1 | US FAERS | |
| 322 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 323 | Malignant Hypertension | FAERS: 1 | US FAERS | |
| 324 | Mallory-Weiss Syndrome | FAERS: 1 | US FAERS | |
| 325 | Malnutrition | FAERS: 1 | US FAERS | |
| 326 | Mechanical ventilation | FAERS: 1 | US FAERS | |
| 327 | Mediastinal mass | FAERS: 1 | US FAERS | |
| 328 | Medical device implantation | FAERS: 1 | US FAERS | |
| 329 | Medication residue present | FAERS: 1 | US FAERS | |
| 330 | Mental status changes | FAERS: 1 | US FAERS | |
| 331 | Miliaria | FAERS: 1 | US FAERS | |
| 332 | Monoplegia | FAERS: 1 | US FAERS | |
| 333 | Mouth swelling | FAERS: 1 | US FAERS | |
| 334 | Multimorbidity | FAERS: 1 | US FAERS | |
| 335 | Muscle strain | FAERS: 1 | US FAERS | |
| 336 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 337 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 338 | Myopathy | FAERS: 1 | US FAERS | |
| 339 | Nasal Polyps | FAERS: 1 | US FAERS | |
| 340 | Neurogenic Bowel | FAERS: 1 | US FAERS | |
| 341 | Night sweats | FAERS: 1 | US FAERS | |
| 342 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 343 | Ocular icterus | FAERS: 1 | US FAERS | |
| 344 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 345 | Oral infection | FAERS: 1 | US FAERS | |
| 346 | Oral mucosal erythema | FAERS: 1 | US FAERS | |
| 347 | Oral pain | FAERS: 1 | US FAERS | |
| 348 | Pain of skin | FAERS: 1 | US FAERS | |
| 349 | Pathogen resistance | FAERS: 1 | US FAERS | |
| 350 | Peripheral artery thrombosis | FAERS: 1 | US FAERS | |
| 351 | Platelet function test normal | FAERS: 1 | US FAERS | |
| 352 | Pneumobilia | FAERS: 1 | US FAERS | |
| 353 | Polyuria | FAERS: 1 | US FAERS | |
| 354 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 355 | Postinfarction angina | FAERS: 1 | US FAERS | |
| 356 | Product dose omission | FAERS: 1 | US FAERS | |
| 357 | Product physical issue | FAERS: 1 | US FAERS | |
| 358 | Prothrombin time abnormal | FAERS: 1 | US FAERS | |
| 359 | Psoriasis | FAERS: 1 | US FAERS | |
| 360 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 361 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 362 | Pulmonary sepsis | FAERS: 1 | US FAERS | |
| 363 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 364 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 365 | Radiation proctitis | FAERS: 1 | US FAERS | |
| 366 | Rash erythematous | FAERS: 1 | US FAERS | |
| 367 | Renal cyst | FAERS: 1 | US FAERS | |
| 368 | Renal pain | FAERS: 1 | US FAERS | |
| 369 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 370 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 371 | Retrograde p-waves | FAERS: 1 | US FAERS | |
| 372 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 373 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 374 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 375 | Ruptured cerebral aneurysm | FAERS: 1 | US FAERS | |
| 376 | Sarcoidosis | FAERS: 1 | US FAERS | |
| 377 | Scab | FAERS: 1 | US FAERS | |
| 378 | Sinus polyp | FAERS: 1 | US FAERS | |
| 379 | Skin irritation | FAERS: 1 | US FAERS | |
| 380 | Skin necrosis | FAERS: 1 | US FAERS | |
| 381 | Skin reaction | FAERS: 1 | US FAERS | |
| 382 | Sleep disorder due to general medical condition, insomnia type | FAERS: 1 | US FAERS | |
| 383 | Sluggishness | FAERS: 1 | US FAERS | |
| 384 | Soft tissue mass | FAERS: 1 | US FAERS | |
| 385 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 386 | Stomatitis | FAERS: 1 | US FAERS | |
| 387 | Stress ulcer | FAERS: 1 | US FAERS | |
| 388 | Stroke in evolution | FAERS: 1 | US FAERS | |
| 389 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 390 | Surgical failure | FAERS: 1 | US FAERS | |
| 391 | Tachycardia | FAERS: 1 | US FAERS | |
| 392 | Tension | FAERS: 1 | US FAERS | |
| 393 | Therapeutic procedure | FAERS: 1 | US FAERS | |
| 394 | Throat cancer | FAERS: 1 | US FAERS | |
| 395 | Tongue blistering | FAERS: 1 | US FAERS | |
| 396 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 397 | Tongue exfoliation | FAERS: 1 | US FAERS | |
| 398 | Tooth Infection | FAERS: 1 | US FAERS | |
| 399 | Tumour haemorrhage | FAERS: 1 | US FAERS | |
| 400 | Unevaluable event | FAERS: 1 | US FAERS | |
| 401 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 402 | Urethral Obstruction | FAERS: 1 | US FAERS | |
| 403 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 404 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 405 | Uterine Polyp | FAERS: 1 | US FAERS | |
| 406 | Vaginal Discharge | FAERS: 1 | US FAERS | |
| 407 | Vascular bypass dysfunction | FAERS: 1 | US FAERS | |
| 408 | Vascular stenosis | FAERS: 1 | US FAERS | |
| 409 | Vascular stent occlusion | FAERS: 1 | US FAERS | |
| 410 | Vascular stent restenosis | FAERS: 1 | US FAERS | |
| 411 | Vasculitis | FAERS: 1 | US FAERS | |
| 412 | Wheezing | FAERS: 1 | US FAERS | |
| 413 | White blood cell count abnormal | FAERS: 1 | US FAERS | |
| 414 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 415 | Yawning | FAERS: 1 | US FAERS | |
| 416 | effusion | FAERS: 1 | US FAERS | |
| 417 | Anaphylactic shock | SIDER | ||
| 418 | Blood and lymphatic system disorders | SIDER | ||
| 419 | Dermatitis | SIDER | ||
| 420 | Thrombocytopenic purpura | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.